| Quote ID | Nick | Quote |
| 4039 |
ADINSX |
<ADINSX> someone should put a counter on the knock up notchin so we know what notch we're currently knocked up to |
| 1313 |
AI_coder |
<AI_coder> It's an unsized integer? |
| 6712 |
AL3X^^ |
<AL3X^^> segfault ? hmm, I dont know it eighter :S |
| 3935 |
AMX |
<AMX> opcom, isn't it "str" for string variable? |
| 5302 |
AMcBain |
<AMcBain> It's a templated class! There is no way to strip it down and give you a test caseQ! |
| 6918 |
AP_ |
<AP_> You are right "nolyc" |
| 1715 |
Aardwolf |
<Aardwolf> Runescape > WoW |
| 1874 |
Aardwolf |
<Aardwolf> java is like C++ on coffee |
| 2374 |
Aardwolf |
<Aardwolf> My C++ book is from 1990!! |
| 2440 |
Aardwolf |
<Aardwolf> people might think horsecock is C++ terminology |
| 2445 |
Aardwolf |
<Aardwolf> I want to make the best MMORPG ever where you can do anything and it'll have better graphics than WoW. But where can I download a program to make a MMORPG? |
| 2514 |
Aardwolf |
<Aardwolf> planeshift, I logged in to that game once when the first beta was released, you could only walk around back then and do nothing else |
| 2729 |
Aardwolf |
<Aardwolf> if the cost of hamster food will be less than that of electricity :) |
| 2847 |
Aardwolf |
<Aardwolf> If compilers had feelings, they certainly wouldn't compile your code |
| 2851 |
Aardwolf |
<Aardwolf> invisible C++ > visual C++ |
| 5004 |
Aardwolf |
<Aardwolf> emilk, int O_o, o_o, O_O, *_O; (*_O) = (O_o) <(o_o)> (O_O); |
| 2142 |
Ace |
<Ace> talking to you is futile |
| 136 |
AcidReign |
<AcidReign> in soviet russa, machine operates you |
| 2827 |
Ademan |
<Ademan> my girlfriend thinks computers are black magic |
| 2396 |
AdolfH |
<AdolfH> and my name is after Hitler, im a fan of him |
| 3 |
Adrinael |
<Adrinael> Emacs is kinda like sendmail. Both are good but neither has a good editor or MTA. |
| 5 |
Adrinael |
<Adrinael> Once I dreamt that I coded in lisp, and whenever I finished a function, it went playing Quake 3. And I got furious, since you cannot get any code done when your functions just shoot each other. |
| 7 |
Adrinael |
<Adrinael> What makes women ultracute is... when they borrow your t-shirt and it's way too big for them |
| 32 |
Adrinael |
<Adrinael> Nobody expects camel humpers |
| 46 |
Adrinael |
<Adrinael> Wait. That doesn't make sense. |
| 66 |
Adrinael |
<Adrinael> I Am Something Unpossimateable. |
| 103 |
Adrinael |
<Adrinael> rj1, your compiler is older than the new pope |
| 151 |
Adrinael |
<Adrinael> That's ok, we love nonsense |
| 152 |
Adrinael |
<Adrinael> You could die on your deathbed |
| 174 |
Adrinael |
<Adrinael> HansZ, I don't want to offend you, but you are really dense, slow, thick-headed and passive. |
| 184 |
Adrinael |
* Adrinael makes a test case! |
| 194 |
Adrinael |
<Adrinael> blank is my favorite woman |
| 238 |
Adrinael |
<Adrinael> Feto, some people believe underwear is the minimum for this channel |
| 240 |
Adrinael |
<Adrinael> Now that's naughty. |
| 247 |
Adrinael |
* Adrinael fondles Fetrovsky's privates |
| 254 |
Adrinael |
<Adrinael> Now even nostalgia isn't what it used to be. |
| 271 |
Adrinael |
<Adrinael> Arrays give me shivers |
| 352 |
Adrinael |
<Adrinael> Lipsicution is the method of larting the users of inferior programming languages. |
| 365 |
Adrinael |
<Adrinael> shared_ptr, no, lisp is readable |
| 395 |
Adrinael |
<Adrinael> I need if its last name is Itate. |
| 413 |
Adrinael |
<Adrinael> I see lisp! I see lisp! |
| 427 |
Adrinael |
<Adrinael> Tell them they couldn't grab orbitz's ass even if someone was grabbing his ass and they were doing it |
| 467 |
Adrinael |
<Adrinael> Yellow just squeezes hard, grabs the bum and +q's |
| 489 |
Adrinael |
<Adrinael> boost::please can help |
| 498 |
Adrinael |
<Adrinael> So many priceless lines, so few opportunities to grab. |
| 502 |
Adrinael |
<Adrinael> boost doesn't have issues. It has episodes. |
| 503 |
Adrinael |
<Adrinael> I'm silent for an hour and people get worried. |
| 505 |
Adrinael |
* Adrinael kicks mauke for not being here |
| 528 |
Adrinael |
<Adrinael> C++ is stupid |
| 579 |
Adrinael |
<Adrinael> Well, those chars typed there are WTF-8 |
| 620 |
Adrinael |
<Adrinael> I have mindreading +2 |
| 629 |
Adrinael |
* Adrinael says this line just to keep up with stats. |
| 691 |
Adrinael |
<Adrinael> uman, the difference is that Klingons don't have parameters. They have arguments. AND THEY ALWAYS WIN THEM! |
| 722 |
Adrinael |
* Adrinael rides rubicant |
| 745 |
Adrinael |
<Adrinael> It's a tarpenter! |
| 747 |
Adrinael |
* Adrinael begins to write "spend 10 minutes in 10 minutes" |
| 792 |
Adrinael |
<Adrinael> And this flu is killing my ability to play nethack |
| 801 |
Adrinael |
<Adrinael> I vote for the removal of that factoid on the grounds that it contains too much opinion |
| 827 |
Adrinael |
<Adrinael> Kevin Sorbo is the most man of them all! |
| 830 |
Adrinael |
<Adrinael> Without the exclamation mark, that's just me shouting at you |
| 862 |
Adrinael |
<Adrinael> Meanwhile, a large dog is kicking my ass |
| 912 |
Adrinael |
<Adrinael> Erlang must be named like this: "What would you name this lang?" "Er.... Lang?" |
| 916 |
Adrinael |
<Adrinael> Yeah, our school is superior as we have structs |
| 951 |
Adrinael |
<Adrinael> What was said earlier is so true. [floyd] is occasionally right but you still want to hit him in the face. |
| 972 |
Adrinael |
<Adrinael> It was quite scary walking around my school today. There was a sign saying "NONLINEAR PARABOLIC PROBLEMS ===>" and I was wondering whether it was telling of electric maintenance or sudden existence failures around the elevator. |
| 985 |
Adrinael |
<Adrinael> Let's see, how many problems we can solve today with an underwear analogy |
| 987 |
Adrinael |
<Adrinael> That's what they always say. "I thought !google wouldn't do nothing", "I thought it wouldn't kill cylon", "I thought she was 18" |
| 999 |
Adrinael |
<Adrinael> Come on, baby, lick my list. |
| 1010 |
Adrinael |
<Adrinael> Use factoids! We have them so we don't have to answer! |
| 1037 |
Adrinael |
<Adrinael> These windows seem to be wanting to get on my lap at times |
| 1038 |
Adrinael |
<Adrinael> I've never seen a horsecock standing so erect before, this is awesome. http://adrinael.net/horsecock.jpg |
| 1049 |
Adrinael |
<Adrinael> A bad analogy is like a leaky screwdriver. |
| 1055 |
Adrinael |
<Adrinael> Of all inferior languages, C++ is the only one I tolerate |
| 1056 |
Adrinael |
<Adrinael> Common Lisp roks and Iron Chef woks. |
| 1067 |
Adrinael |
<Adrinael> While at it, also complain to the telnet author about the message "cannot connect to remote host" when connecting to localhost. |
| 1087 |
Adrinael |
* Adrinael happily punches phrakture in the face. |
| 1092 |
Adrinael |
<Adrinael> Another good way is to send NICK TRK\r\nJOIN ##C++\r\nPRIVMSG ##C++ :Hi guys, how are you on this timeline?\r\n |
| 1095 |
Adrinael |
<Adrinael> Girls really love guys who know C++. Can't beat the resizing vectors. |
| 1118 |
Adrinael |
<Adrinael> "I tried to buy a Volvo in a Volvo shop but there were no salesmen available, so I came here into this Ford shop. Why won't you sell me Volvos?!?!?!?!" |
| 1137 |
Adrinael |
<Adrinael> I only type int main() and Emacs auto-completes my full project code into it by intuition. |
| 1152 |
Adrinael |
<Adrinael> Accelerated C++ teaches you to code C++ using C++. Other beginner's books teach you to code C using C++. |
| 1153 |
Adrinael |
<Adrinael> It's useful to code without ;, automatic error checking. |
| 1175 |
Adrinael |
<Adrinael> 1) get money 2) order online 3) ???? 4) PROFIT! |
| 1177 |
Adrinael |
<Adrinael> It's like going to the prison naked. You feel like a cool dude, but it's fatal for your ass. |
| 1179 |
Adrinael |
<Adrinael> In math, 1/0 starts nethack. |
| 1182 |
Adrinael |
<Adrinael> "I threw a rat in a cardboard box and installed NetBSD on it" |
| 1245 |
Adrinael |
<Adrinael> Type slower, I cannot read it when you type that fast! |
| 1281 |
Adrinael |
<Adrinael> It turns out this channel never fails to feed Captain Obvious |
| 1294 |
Adrinael |
<Adrinael> floats only have std::numeric_limits<float>::digits digits of precision |
| 1306 |
Adrinael |
<Adrinael> Why is everyone harassing orbitz and why is orbitz responding to it? |
| 1327 |
Adrinael |
<Adrinael> I intentionally left blank in the gun chamber. |
| 1423 |
Adrinael |
<Adrinael> Psychoanalysis?? I thought this was a nude rap session!!! |
| 1469 |
Adrinael |
<Adrinael> Grabbing should be harder, not easier |
| 1502 |
Adrinael |
<Adrinael> I have a picture of everything. |
| 1573 |
Adrinael |
<Adrinael> It's possible to pee against the wind |
| 1574 |
Adrinael |
<Adrinael> It's possible to pee in your morning cereals |
| 1611 |
Adrinael |
<Adrinael> Wow, Penguin___ is flooding my privates. |
| 1612 |
Adrinael |
<Adrinael> Interestingly (:[]) looks like Homer. |
| 1622 |
Adrinael |
<Adrinael> But prolog is cheating |
| 1723 |
Adrinael |
<Adrinael> orbitz, can you be a bit friendlier, it's your feminine and touchy side which I fell in love with |
| 1745 |
Adrinael |
<Adrinael> I had that a few years ago, and it was fascinating the first five minutes. |
| 1746 |
Adrinael |
<Adrinael> PlasmaHH, now look what you have done! This channel is overly wild and social and talkative. There's no going back to the times when everyone just sulked in their own corners and snapped at anyone careless enough to ask orbitz for help. |
| 1814 |
Adrinael |
<Adrinael> -O2 -O2 looks like a gentooism |
| 1866 |
Adrinael |
<Adrinael> God said: "Let there be light". Chuck Norris said: "Aaaaaagh! A talking god!" |
| 1929 |
Adrinael |
* Adrinael kicks but the goalie EWOULDBLOCK |
| 1973 |
Adrinael |
<Adrinael> My firefox shoots about:blanks. |
| 1986 |
Adrinael |
<Adrinael> Gnus don't kill people. |
| 2107 |
Adrinael |
<Adrinael> Think in Common Lisp all the time. Then you only need to remember how to do the easy things in a hard language the hard way. |
| 2128 |
Adrinael |
<Adrinael> Help people and you shall receive. |
| 2130 |
Adrinael |
<Adrinael> caddy, no time! I'm using my X-RAY VISION to obtain a rare glimpse of the INNER WORKINGS of this POTATO! |
| 2145 |
Adrinael |
<Adrinael> Two muffins went to a bar. One said: "Shall we get a pint?" The other replied: "Dude, this talking joke is getting old." |
| 2164 |
Adrinael |
<Adrinael> Do you know why the people of the stone age didn't just phone us and ask for directions to MacDonalds? |
| 2196 |
Adrinael |
<Adrinael> Imagine a large hammer and some helpless poultry. |
| 2209 |
Adrinael |
<Adrinael> pwned, no botsex allowed on about channels |
| 2217 |
Adrinael |
<Adrinael> It's not gay if balls are not touching. |
| 2310 |
Adrinael |
* Adrinael milks raf256 |
| 2315 |
Adrinael |
<Adrinael> Wow, nih::string |
| 2328 |
Adrinael |
<Adrinael> Bus error means you're walking. |
| 2332 |
Adrinael |
<Adrinael> Ohnoes! The goalie returns -1 and EWOULDBLOCK! |
| 2360 |
Adrinael |
<Adrinael> Error: Only one $* allowed |
| 2364 |
Adrinael |
<Adrinael> I only realised I was disconnected when dolphin hadn't trolled about boost for a while. |
| 2366 |
Adrinael |
<Adrinael> qalam, I made a pong with visual basic. It has a radio button as the ball and two push buttons as the paddles. |
| 2369 |
Adrinael |
<Adrinael> Is that Shii's song or Longcat's song? |
| 2379 |
Adrinael |
<Adrinael> Is the string you have really a Seibold::SString and not Sausages_from_last_night::SString? |
| 2397 |
Adrinael |
<Adrinael> It has all sorts of silly stuff, I just want jumping. |
| 2406 |
Adrinael |
<Adrinael> C++ sucks. |
| 2423 |
Adrinael |
<Adrinael> Is the pay good? Can you IRC while working? |
| 2470 |
Adrinael |
<Adrinael> If * and -> go fighting in swatninja style, -> wins. |
| 2493 |
Adrinael |
<Adrinael> All my base are belong to you |
| 2524 |
Adrinael |
<Adrinael> Having listened to Slay Radio for a few weeks at work I start to wonder... Where do the sounds come from, there are no speakers here? |
| 2528 |
Adrinael |
<Adrinael> O(RLY) |
| 2532 |
Adrinael |
<Adrinael> It's even graphical if you use a terminal emulator in X. |
| 2535 |
Adrinael |
* Adrinael goes back to nethack |
| 2546 |
Adrinael |
<Adrinael> u r right! i has a shuvel! |
| 2553 |
Adrinael |
<Adrinael> Sorry, C++ doesn't work like that unless you are Captain Picard. Then you could just say std::make_it_so(); |
| 2569 |
Adrinael |
<Adrinael> homerman_, try googling for the strip man page |
| 2590 |
Adrinael |
<Adrinael> Why are kid meals not made of babies? |
| 2610 |
Adrinael |
<Adrinael> Hey, it's not gay if balls are not touching. |
| 2633 |
Adrinael |
<Adrinael> Slay just told me I'm listening to the best radio station ever. |
| 2639 |
Adrinael |
<Adrinael> All your code are belong to /usr |
| 2648 |
Adrinael |
<Adrinael> Finnih thoundth lithpy |
| 2659 |
Adrinael |
<Adrinael> "But I'm using Microsoft C++! Are you using some C++ stolen from Microsoft? You evil open source hackers." |
| 2712 |
Adrinael |
<Adrinael> I called you a moron, asshole. |
| 2766 |
Adrinael |
<Adrinael> !fs un |
| 2768 |
Adrinael |
<Adrinael> It's not gay if balls don't touch |
| 2803 |
Adrinael |
<Adrinael> plank, your p is upside down |
| 2808 |
Adrinael |
<Adrinael> My vector accelerates to hundred km/h in 8 seconds |
| 2818 |
Adrinael |
<Adrinael> Humour tends to lead to fun, which is not allowed here. |
| 2903 |
Adrinael |
<Adrinael> I've never before seen bad hearing happen on IRC |
| 2996 |
Adrinael |
<Adrinael> I would need to check docs, and I'm lazy |
| 3111 |
Adrinael |
<Adrinael> 1) identify the problem 2) think real hard 3) write down the solution |
| 3143 |
Adrinael |
<Adrinael> Listen to me! I'm an idiot too! |
| 3165 |
Adrinael |
<Adrinael> Everything is syntactic sugar for not using Common Lisp |
| 3201 |
Adrinael |
<Adrinael> If no one ever runs this code, is it buggy? |
| 3221 |
Adrinael |
<Adrinael> Who would have thought implementing the standard library is actually hard |
| 3460 |
Adrinael |
<Adrinael> My cup is a pointer to my tea, which I am now dereferencing. |
| 3476 |
Adrinael |
<Adrinael> How is vector inherently slow? Maybe some operations might be slow, but what operations? Or does it just mean that if you put a vector into a pocketpc, you can't drive a car that contains it over 60km/h |
| 3505 |
Adrinael |
<Adrinael> Stop dying, it's bad for your health. |
| 3568 |
Adrinael |
<Adrinael> Let's all just dance |
| 3607 |
Adrinael |
<Adrinael> What's the difference between "I helped my uncle Jack off a horse" and "I helped my uncle jack off a horse"? |
| 3661 |
Adrinael |
<Adrinael> Where's pacman, I need him, my dots are all over the place. |
| 3757 |
Adrinael |
<Adrinael> Sexual harassment - pandaaaa |
| 3767 |
Adrinael |
<Adrinael> It would appear, good sir, that all of your military establishments are now within my possession. |
| 3783 |
Adrinael |
<Adrinael> Why do you grab bash.org quotes? |
| 3791 |
Adrinael |
<Adrinael> #define desu ; |
| 3818 |
Adrinael |
<Adrinael> Programming is 60% algorithms and 90% tea. |
| 3863 |
Adrinael |
* Adrinael adds [heyI'mOnIRC] to his nick |
| 3869 |
Adrinael |
<Adrinael> My toaster has automatic garbage collection, but only for the crumbs. |
| 4096 |
Adrinael |
<Adrinael> Disregard that, I suck cocks |
| 4113 |
Adrinael |
<Adrinael> Scratch your itch. That's what open source dudes do anyway. |
| 4147 |
Adrinael |
* Adrinael is an epix mount |
| 4165 |
Adrinael |
<Adrinael> Now what does cygwin mingw32 mean? Is that like Sony's Nintendo Wii? |
| 4211 |
Adrinael |
<Adrinael> Tits and nipples, and also horsecocks. Just think of the silly stuff you can hear about on this channel. |
| 4258 |
Adrinael |
<Adrinael> The grab database is already filled with bovine excrement. |
| 4359 |
Adrinael |
<Adrinael> Your rights of nitpicking are hereby revoked. Please hand over your tea cup for my perusal. |
| 4433 |
Adrinael |
<Adrinael> This reminds me, identifying users via ip addresses is not going to work for everything. A host might have more than one user, even at the same time. It should be mandatory to submit some valid identification, recent picture and possible tea making equipment over the inter nets when using it. |
| 4496 |
Adrinael |
<Adrinael> I'm the one who put "sexy" in "dyslexic"! |
| 4506 |
Adrinael |
<Adrinael> struct { I tarzan; U jane; } |
| 4540 |
Adrinael |
<Adrinael> pwned, the line "can you write C++ with C syntax" |
| 4615 |
Adrinael |
<Adrinael> Weak typing is when you leave half the characters off when writing to IRC. |
| 4759 |
Adrinael |
<Adrinael> My nipples explode with delight |
| 4773 |
Adrinael |
<Adrinael> Grabbing has a purpose anyway. And it's not filling the db with meaningless cruft |
| 4986 |
Adrinael |
* Adrinael wields the +2 Holy Swift Boosted Parenhammer of w00tness |
| 5027 |
Adrinael |
<Adrinael> Vi has two modes, in one it beeps and in one it doesn't. And its commands are smileys because it's made by teenagers. |
| 5074 |
Adrinael |
<Adrinael> Grab Shield of w00tness! |
| 5086 |
Adrinael |
<Adrinael> Meronik, actually it is. Recent Intel processors have detector chips that see if the code is compiled from lisp, and then run it 10 times as slow |
| 5089 |
Adrinael |
<Adrinael> Grab shield btw |
| 5164 |
Adrinael |
<Adrinael> Do not use underscores in factoid names and please use <reply> unless the word is fits nicely in a sentence |
| 5192 |
Adrinael |
<Adrinael> "My car doesn't start. Here's another car that looks just like it, it starts though. But can you help?" |
| 5216 |
Adrinael |
<Adrinael> This, children, is why you don't use C when coding C++ |
| 5222 |
Adrinael |
<Adrinael> Lede, stop filling me with honey on my birthday =( |
| 5266 |
Adrinael |
<Adrinael> Very funny, Scotty. Now beam down my clothes too. |
| 5812 |
Adrinael |
<Adrinael> A good heuristic for A* search: int g(node) { return 0; } |
| 5813 |
Adrinael |
<Adrinael> Is heuristic coding style the one where you write "roughly correct" code, and then debug? |
| 5867 |
Adrinael |
<Adrinael> I'm so weak for those |
| 6107 |
Adrinael |
<Adrinael> level1_, here's a personal insult for you! Yo momma is so fat she exceeds std::vector<int>::max_size()! |
| 6262 |
Adrinael |
<Adrinael> kcbanner, so you want something to be different for each TU, and be the same for each TU? |
| 6572 |
Adrinael |
<Adrinael> You have way too optimistic view of the distribution of wits |
| 6837 |
Adrinael |
<Adrinael> I hate you blank! |
| 6903 |
Adrinael |
<Adrinael> Is a carry-adder a snake that transports stuff? |
| 7639 |
Adrinael |
<Adrinael> Eelis's Law of Software Evolution: Whenever you blink, geordi gains a feature. |
| 7669 |
Adrinael |
<Adrinael> But making errors is so 90s |
| 7886 |
Adrinael |
<Adrinael> pragma_, now why would you do that to your workstation... |
| 7889 |
Adrinael |
<Adrinael> Take that, you damn! |
| 7921 |
Adrinael |
<Adrinael> Grab shield of quickness |
| 7974 |
Adrinael |
<Adrinael> I'm too lazy to care |
| 7978 |
Adrinael |
<Adrinael> G-G-G-G-G-GRAB SHIELD |
| 8105 |
Adrinael |
<Adrinael> Everyone knows math is no problem for email because all emails are written using Micro soft Word. Stop trolling. |
| 8358 |
Adrinael |
<Adrinael> But I am unique!!! Just like everyone else! |
| 4730 |
AerialX |
<AerialX> lol |
| 6159 |
Afmlasdfkos |
<Afmlasdfkos> Why bother with C++, and C++ books, just buy 2 gb of ram for 40$ and learn Java from web |
| 300 |
Aggrav8d |
<Aggrav8d> just airdrop 50k tons of ramen noodle |
| 302 |
Aggrav8d |
<Aggrav8d> yo momma so big and so nasty it takes me two trains and a bus to get to her good side |
| 3559 |
Agiofws |
<Agiofws> Adrinael, the goal is to make a clock in c++ |
| 3560 |
Agiofws |
<Agiofws> hey is c++ written in c++ |
| 3561 |
Agiofws |
<Agiofws> i mean when they discovered C hwta language di they code it in ? |
| 5105 |
Agiofws |
<Agiofws> hello can you get 2 functions in C executed in parallel and not one after the other or in c++ even better ? |
| 5107 |
Agiofws |
<Agiofws> why do windows users ask me when i show them my app ; ahh and what program did you use to code it ? ....... whats that got to do with coding ? |
| 7207 |
Agu10 |
<Agu10> i get this error: [Linker error] underlined reference to 'GetPixel@12' |
| 2720 |
Ahmadi |
<Ahmadi> i have not a good english for this reason i use a jpeg and some shapes |
| 6258 |
Aikar |
<Aikar> static void* pAutoTransThis = (void*)(*(int*)(((**(int**)((BYTE*)(SigScan("@@8bfd83c9ff33c06a00f2aef7d1496a01518b0d")) + 19)) + 0x7e30) + 60)); |
| 3850 |
Aimson |
<Aimson> Can you write a 3D MMORPG game in C++? |
| 3107 |
AjS15822 |
<AjS15822> I've never given a second thought as to why I really have this nickname-- it just 'fits'. Maybe the allure lies in its ambiguous nature... |
| 7955 |
Akkernight |
<Akkernight> where does it get the jokes from ? |
| 8211 |
Akkernight |
<Akkernight> cud som1 do my homework plz? |
| 7947 |
Akkernight1 |
<Akkernight1> ok, just an offtopic, why do you call me Akkernight1 o.O? |
| 4068 |
Alanius |
<Alanius> hash sounds cool |
| 2814 |
Alconquian |
<Alconquian> I am a professional ActiveX programmer |
| 7865 |
Aldaron |
<Aldaron> Gargantua: I like "C++: The Complete Reference" by H. Schildt. It's handy for solving specific problems, but it's also a good read and provides just the right amount of information for someone who already knows C |
| 7866 |
Aldaron |
<Aldaron> ville: huh?! |
| 1156 |
Alderin |
<Alderin> ever accidently type #ifdef WIN#@ ... and feel it was quie appropriate? |
| 7614 |
AlexElliott |
<AlexElliott> pedants* |
| 1189 |
Algorithms |
* Algorithms are fun. |
| 3870 |
Alien_Freak |
<Alien_Freak> what does typeof return.... it looks like an int from the doc i found but i can't seem to do something like: int x = typeof(z); |
| 373 |
Alipha |
<Alipha> I foret a lot of g's. they're always causin trouble. |
| 674 |
Alipha |
<Alipha> i can do both.. i get confused sometimes though |
| 996 |
Alipha |
<Alipha> so if we include a file at the bottom of a .cpp, is that a footer? |
| 1121 |
Alipha |
<Alipha> me22: dammit, don't use words that I learned during my history class. I wanted to go through it bitching about all I learn in there is pointless ;-) |
| 1128 |
Alipha |
<Alipha> hence "private" |
| 1196 |
Alipha |
<Alipha> anyone can do it. but if i tell you, then you'll make a dumb quote ;-) |
| 2414 |
Alipha |
<Alipha> <vector.h>? blasphemy. <vector> |
| 2517 |
Alipha |
<Alipha> why are we getting into a huge argument of a /style/ issue? |
| 7157 |
Alistair |
<Alistair> You guys are good at C++ right? |
| 3291 |
Almathea |
<Almathea> whats a wedgie? |
| 4904 |
Almathea |
<Almathea> Go and beat her, what's the problem? |
| 4926 |
Almathea |
<Almathea> I can't understand how one would like to have a deamon written in java. |
| 4963 |
Almathea |
<Almathea> Yeah, boost seems to be a cure to every imaginable idiocy. |
| 5067 |
Almathea |
<Almathea> Mercedes doens't have that thing on the bottom. |
| 5091 |
Almathea |
<Almathea> I knew it was scat? Why tha hell I can't find anything?! |
| 5134 |
Almathea |
<Almathea> You are so fscked in the head. You make me wanna kill all off those that believe in so called allah |
| 5263 |
Almathea |
<Almathea> vhapuinruap4wtfrh8we9fvzpadrg |
| 5366 |
Almathea |
<Almathea> yeah, I looked through column modes, but it doesn't seem to be doing what I need to all apps I need (guess some of them are fscked when it comes to dealing with X-messages). |
| 5424 |
Almathea |
<Almathea> Islam is fskced up young religion, those guys still live in middle ages. |
| 5922 |
Almathea |
<Almathea> are you drugs? |
| 5953 |
Almathea |
<Almathea> I'm an emacs guy and I know what I mean saying an awkward key combo. |
| 5956 |
Almathea |
<Almathea> Spend 10 min in ##c++ and you'll meet 2 idiots and a troll... |
| 6033 |
Almathea |
<Almathea> it actyally does wrko |
| 6034 |
Almathea |
<Almathea> You never exit emacs. |
| 6314 |
Almathea |
<Almathea> grab mazzachre |
| 6352 |
Almathea |
<Almathea> I hate you. |
| 6370 |
Almathea |
<Almathea> That request was not a joke. |
| 6408 |
Almathea |
<Almathea> huh? why wasn't any of blanks grabbed? |
| 6410 |
Almathea |
<Almathea> xystic, go finish eating your dog shit. |
| 6590 |
Almathea |
<Almathea> geordi's using some shit Eelis stole from future, plus it includes shitloads of headers and some magic spells to make it simulate a non-existant standard. |
| 6591 |
Almathea |
<Almathea> I feel like a noob from ##C++ |
| 6911 |
Almathea |
<Almathea> Give me your sister's phone number and we can talk about love. |
| 6974 |
Almathea |
<Almathea> impulze, I'm dating your mom. |
| 6989 |
Almathea |
<Almathea> Fuck me gently. |
| 7002 |
Almathea |
<Almathea> I can easly have my dick sucked for 50 PLN |
| 7003 |
Almathea |
<Almathea> Having actual relationship with a whore might be interesting. |
| 7036 |
Almathea_ |
<Almathea_> I was like, `do you know what traceroute(8) is?' |
| 7047 |
Almathea_ |
<Almathea_> Idiots! Entertain me! |
| 7258 |
Almathea_ |
<Almathea_> web devel is like whoring, some have to do it, just to get money. |
| 7269 |
Almathea_ |
<Almathea_> Wish me luck getting shitfaced. |
| 7989 |
Almathea_ |
<Almathea_> Zharf, establising outgoing connetcinos is borkedn |
| 3769 |
Alvo |
<Alvo> c++ sucks because there are no methods |
| 5005 |
Alvo |
<Alvo> say, how do i quickly implement a minimal std::ostream? |
| 6431 |
Amergin_ |
<Amergin_> momo: never let school get in the way of your education |
| 3384 |
Anand_1 |
<Anand_1> nethack: That ps2/3 game? |
| 3385 |
Anand_1 |
<Anand_1> whats rofl |
| 3391 |
Anand_1 |
<Anand_1> nethack should come bundled with Linux distros |
| 3337 |
Anand_k |
<Anand_k> I am using using namespace std; but its giving me errors |
| 3436 |
Anand_k |
<Anand_k> nolyc:I am idiot |
| 1247 |
Andares |
<Andares> Alipha, we lock up all the athiests in chains for the "holidays" and force them to stay in college. |
| 1714 |
Andares |
* Andares feels gang-banged by ##C++. |
| 1831 |
Andares |
<Andares> Life My Easier Would BE talk Reverse Polish Notation IN people Would TALK IF. |
| 2190 |
Andares |
<Andares> STOP GRABBING PEOPLE FOR NOTHING AT ALL, DAMN IT. |
| 3035 |
Andares |
<Andares> I think my brain may be corrupted. |
| 3231 |
Andares |
<Andares> This is starting to feel less and less like programming and more like sexual violation... |
| 3232 |
Andares |
<Andares> Is this going to require use of write() and pipe()? |
| 4720 |
Andares |
<Andares> But it's so inefficient to waste 2 lines just to initialize a temporary vector. |
| 7702 |
Anddos |
<Anddos> const is stupid |
| 6149 |
AndroidData |
<AndroidData> I'm learning this C++ gig by trial & error, not by buying a book and wasting my time reading it |
| 429 |
Anduin |
<Anduin> vi ruined n'sync |
| 902 |
Anduin |
<Anduin> [1]nooby - Depends. Watching an adult discover his navel isn't the sort of off-topic discussions that should be encouraged though. |
| 953 |
Anduin |
<Anduin> I only download .vbs files. |
| 1589 |
Anduin |
<Anduin> It is a real shame that so many things are impossible to try before asking. |
| 1642 |
Anduin |
<Anduin> openglkid - People who come here for help soon learn better. |
| 1759 |
Anduin |
<Anduin> Ummmmm_ - Don't drag me in to the bot abuse. |
| 5603 |
Angel-SL |
<Angel-SL> i always thought programs run better in release than debug |
| 5604 |
Angel-SL |
<Angel-SL> and whats !grab |
| 973 |
AngryAnt-work |
* AngryAnt-work picks up his head and leaves |
| 7120 |
Anonissimus |
<Anonissimus> if I include "systemtime int;" will it store all in integers? |
| 2925 |
Anthony |
<Anthony> lol at cock |
| 3333 |
Anthony |
<Anthony> dolphins are mammals right |
| 3629 |
Anthony |
<Anthony> orbitz is like steven hawking i bet |
| 3687 |
Anthony |
<Anthony> i just like to grab people |
| 4195 |
Anthony |
* Anthony ribbit |
| 2884 |
AnthonyG |
<AnthonyG> Do you go around the internet searching for things such as: Old man's anus , Etc. All day? |
| 2887 |
AnthonyG |
<AnthonyG> Why would I be here if I did not know? |
| 2893 |
AnthonyG |
<AnthonyG> Wouldn't something like 100^3 be smaller than , Say 104^2? As bit values tend to be smaller than integers>1? |
| 3157 |
AnthonyG |
<AnthonyG> Spell "heh" backwards :) |
| 3264 |
AnthonyG |
<AnthonyG> |lol|=Stfu |
| 3340 |
AnthonyG |
<AnthonyG> He did the Anus thing you speak of |
| 3382 |
AnthonyG |
<AnthonyG> !give |Feto| headache |
| 3490 |
AnthonyG |
<AnthonyG> Religion over IRC is the stupidest thing since C# |
| 3549 |
AnthonyG |
<AnthonyG> almathea: Both instances of anus related stuff were out of context ;) |
| 3633 |
AnthonyG |
<AnthonyG> My client will have a special "LolMode" scheduled to send "/say Lol" every two seconds |
| 3709 |
AnthonyG |
<AnthonyG> I'm going to stop saying stuff that's even remotely grab-worthy |
| 3711 |
AnthonyG |
<AnthonyG> lol I have small penis 8=D |
| 3712 |
AnthonyG |
<AnthonyG> I've never seen a C++ serverside script |
| 3758 |
AnthonyG |
* AnthonyG pokes orbitz hard |
| 3759 |
AnthonyG |
* AnthonyG takes off orbitz's pants, and makes him run backwards through a corn field. |
| 3775 |
AnthonyG |
<AnthonyG> So I was cleaning out my projects bin yesterday night... Removing ones that were sloppy, unfinished, /or terrible. By the time I was finished, the entire dir was deleted.... |
| 4058 |
AnthonyG |
<AnthonyG> Don't raise your voice to me |
| 4060 |
AnthonyG |
<AnthonyG> You think you're real cool templating everything don't you? |
| 4065 |
AnthonyG |
<AnthonyG> It's amazing how trolls can sense each other. |
| 4066 |
AnthonyG |
<AnthonyG> 3rd time today, I don't know what's funny |
| 4086 |
AnthonyG |
<AnthonyG> I have a general purpose red button next to me at all times |
| 4159 |
AnthonyG |
<AnthonyG> I never use friend, my privates need to be kept secure. |
| 4345 |
AnthonyG |
<AnthonyG> svm_invictvs: That's why I stopped grabbing |
| 4348 |
AnthonyG |
<AnthonyG> .... Why is it so wrong for me to have the funs. |
| 4383 |
AnthonyG |
<AnthonyG> Cram enough templates in there and it looks like XML |
| 4452 |
AnthonyG |
<AnthonyG> I thought about(and even started to) grow a bit of hair on my chin... What did I get as a response? "Hey, you missed some" |
| 4461 |
AnthonyG |
<AnthonyG> Atalanta: Did you know that any website with linux and .org is automatically trustworthy enough to have your children? |
| 4522 |
AnthonyG |
<AnthonyG> Blasphemy! |
| 4586 |
AnthonyG |
<AnthonyG> I take C++ as an insult to C++ |
| 4699 |
AnthonyG |
<AnthonyG> idan: I beat down your self-esteem like a farmer does to a limp horse |
| 4733 |
AnthonyG |
<AnthonyG> If I wouldn't have shutdown I would have a way higher uptime than pwned right now |
| 4734 |
AnthonyG |
<AnthonyG> pwned: why did you grab that? |
| 4786 |
AnthonyG |
<AnthonyG> /ignore spoilerz *!*@* |
| 4791 |
AnthonyG |
<AnthonyG> It's annoying me that find_first_of is acting like find_second_of_if_you_feel_like_it |
| 4833 |
AnthonyG |
<AnthonyG> Bigcheese: im in ur generator, drainin ur entropy |
| 4870 |
AnthonyG |
<AnthonyG> premature enterization this morning |
| 4884 |
AnthonyG |
<AnthonyG> AnthonyG: Oh, it's snowing in your area? |
| 4967 |
AnthonyG |
<AnthonyG> C is faster than C++ because it's two characters smaller! |
| 4973 |
AnthonyG |
<AnthonyG> Ah, less than one hundred quest points before I get my amulet |
| 5015 |
AnthonyG |
<AnthonyG> Bigcheese: Pastebin is NOT MAIL |
| 5016 |
AnthonyG |
<AnthonyG> litb: Have you ever mounted an ass? I heard they are actually ride-able. |
| 5018 |
AnthonyG |
<AnthonyG> Their clusters heat hell so you can dine in it. |
| 5032 |
AnthonyG |
<AnthonyG> bloated: Stop highlighting me and learn to be less stupid. |
| 5090 |
AnthonyG |
<AnthonyG> gun is an anagram of gnu. |
| 5198 |
AnthonyG |
<AnthonyG> Lede: Be a grab bait by asking blank how long he soaks his tea bags. |
| 5268 |
AnthonyG |
<AnthonyG> Only the most hardcore security experts run Windows 95. |
| 5277 |
AnthonyG |
<AnthonyG> quilzo: You suck |
| 5298 |
AnthonyG |
<AnthonyG> Hey! I went to resume school! |
| 5300 |
AnthonyG |
<AnthonyG> Lede: Thats it, I'm charging my lasers. |
| 5305 |
AnthonyG |
<AnthonyG> SDL's is like a parachute, but bricks and knives instead. |
| 5367 |
AnthonyG |
* AnthonyG blackmails |
| 5368 |
AnthonyG |
* AnthonyG notes "Game developers can't use threads" - Xbox developer and takes it to #gamedev |
| 5410 |
AnthonyG |
<AnthonyG> Woohoo someone found istheshit.net again. |
| 5412 |
AnthonyG |
* AnthonyG sends a memo saying "You're never here when I need you the most!" |
| 5413 |
AnthonyG |
<AnthonyG> I found miles33's caution sign when you tell him something that may cause confusion. http://www.kristenkamei.com/images/oregon/May_2007/biker.jpg |
| 5414 |
AnthonyG |
<AnthonyG> http://www.forumspile.com/Stupid-Sit_in_the_corner.jpg |
| 5418 |
AnthonyG |
<AnthonyG> The FUK as I call it. |
| 5434 |
AnthonyG |
<AnthonyG> "// TODO: dies ist ein quick and dirty hack." |
| 5452 |
AnthonyG |
<AnthonyG> Oh, a tazer, don't do that bro. |
| 5456 |
AnthonyG |
<AnthonyG> "I am learning C++ (thanks to C++ for dummies xD)" |
| 5457 |
AnthonyG |
<AnthonyG> There's 271 lines containing new, 16 containing free, and 93 containing delete. 0 containing malloc. |
| 5462 |
AnthonyG |
<AnthonyG> blank made a joke, it was sexual. |
| 5495 |
AnthonyG |
<AnthonyG> We could replace Lede with a bot that says "free mason" every few minutes and increase profit seven fold. |
| 5515 |
AnthonyG |
<AnthonyG> One does not simply mirror wikipedia. |
| 5530 |
AnthonyG |
<AnthonyG> I'm going to write a script that calls cat, sell it for $60, and patent the idea of "combining files". |
| 5532 |
AnthonyG |
<AnthonyG> Everyone knows nature was built with COBOL. |
| 5543 |
AnthonyG |
<AnthonyG> Pizzas, I have them. |
| 5599 |
AnthonyG |
<AnthonyG> I used fun twice even, so its twice the fun. |
| 5632 |
AnthonyG |
<AnthonyG> Bigcheese: http://yummycupcakes.com |
| 5635 |
AnthonyG |
<AnthonyG> quilzo: This popcorn reminds me of you. Insignificant, dry, no reason for existance other than temporarily satisfying me. |
| 5645 |
AnthonyG |
<AnthonyG> QT - Made by trolls, for trolls. |
| 5720 |
AnthonyG |
<AnthonyG> If I was in a position to graduate from something, I would give it up for 100 pizzas. |
| 5757 |
AnthonyG |
<AnthonyG> daryl: If I did that it would just get the cat drunk and I fear the relationship would no longer be platonic. |
| 5761 |
AnthonyG |
<AnthonyG> My theory: It all started with a tamagotchi. |
| 5769 |
AnthonyG |
<AnthonyG> I applied the butter so perfectly, I dropped the toast and it landed on it's feet. |
| 5786 |
AnthonyG |
<AnthonyG> I don't care for the comic itself that much, but what they did to the website is exactly what they made fun of in the comics. |
| 5967 |
AnthonyG |
<AnthonyG> A few days ago I had the perfect cheeseburger, it made the coca-cola taste good. |
| 5971 |
AnthonyG |
<AnthonyG> blank doesn't really not like me, he just wants to make himself believe that. |
| 5976 |
AnthonyG |
<AnthonyG> Hm, it seems that fatterfox is better at getting favicons now. |
| 5980 |
AnthonyG |
<AnthonyG> The pencil came at me like a rabid kitten. I was cornered. |
| 5996 |
AnthonyG |
<AnthonyG> for I'm loved by a pretty wonderful boooy! |
| 5997 |
AnthonyG |
<AnthonyG> I never try to be funny. |
| 6036 |
AnthonyG |
<AnthonyG> My resume is so awesome, monster would reject it and tell me I'm too overqualified to get a job. |
| 6048 |
AnthonyG |
<AnthonyG> Now this channel is approaching the idiocy of ##c++. |
| 6624 |
AnthonyG |
<AnthonyG> The slope made by the lack of my frontal lobe makes me aerodynamic. |
| 6981 |
AnthonyG |
<AnthonyG> Well, I can say without doubt my microwave probably doesn't heat pizza as fast as your laptop. |
| 7017 |
AnthonyG |
<AnthonyG> I just played some CTF. It was fun, though I can't decide if it was more fun watching people say "stfu camper noob" whenever a flag is captured, or playing. |
| 7098 |
AnthonyG |
<AnthonyG> Heh, dumb slashdot saying "plug-in hybrids". I thought they were talking about some new software plugin architecture invented 20 years ago. |
| 7163 |
AnthonyG |
<AnthonyG> How do I manage to freudian slip "to". |
| 7164 |
AnthonyG |
<AnthonyG> Quadrescence: I wasn't expecting you to grab me. You got me good there. |
| 7166 |
AnthonyG |
<AnthonyG> Would it make it better if I said I miss 2/5 times? |
| 7168 |
AnthonyG |
<AnthonyG> I want to go back to 1970's and reshape the lisp design to use ampersands instead of parentheses. |
| 7213 |
AnthonyG |
<AnthonyG> The rest is Carbonfat. |
| 7261 |
AnthonyG |
<AnthonyG> I'm actually surprised the mention of lisp hasn't made Adrinael's terminal beep the hamster song or something. |
| 7284 |
AnthonyG |
<AnthonyG> It's like when Walt realised pie is the only thing that doesn't lie. |
| 7308 |
AnthonyG |
<AnthonyG> Iris^: I think the only one here with boobs is you, and maybe Zharf. |
| 7309 |
AnthonyG |
<AnthonyG> Was it #ubuntu that banned you for saying nigger, I bet they're more sensitive to it than actual africans. |
| 7310 |
AnthonyG |
<AnthonyG> I feel like a regular comedian right now. |
| 7311 |
AnthonyG |
<AnthonyG> I mean... I don't even need to bait LimCore anymore. |
| 7391 |
AnthonyG |
<AnthonyG> Zharf: I have a sixth emacs sense. |
| 7711 |
AnthonyG |
<AnthonyG> FauxFaux: Gasp, I see your naked hostname! |
| 7754 |
AnthonyG |
<AnthonyG> You know, I finally got the amulet and all it did was teleport to some hotel with sweet milk and a bed that heals in half the time other beds do. |
| 7822 |
AnthonyG |
<AnthonyG> I'm bored |
| 8047 |
AnthonyG |
<AnthonyG> Windows 95 notepad for great power. |
| 8147 |
AnthonyG |
<AnthonyG> Bait |
| 8248 |
AnthonyG |
<AnthonyG> Oggle oggle oggle |
| 8253 |
AnthonyG |
<AnthonyG> On the second day of Tetris Alexey gave to meee: One I tetrominoe, two S tetrominoes, and an insanely high falling speeeeeed. |
| 8289 |
AnthonyG |
<AnthonyG> Haha |
| 7259 |
AnthonyG_ |
<AnthonyG_> The job of a scripting language in the context of website scripting has no other job than to write markup and read get and post requests. |
| 3732 |
AppleBoy |
<AppleBoy> Eelis: are autotools not licked? |
| 344 |
Arafangion |
<Arafangion> I doubt C++ will be that bad :) |
| 345 |
Arafangion |
<Arafangion> shared_ptr, refractoring is generally making something simple. This was one damn tight line. No unneccessary letters or spaces. |
| 346 |
Arafangion |
<Arafangion> shared_ptr, Without once using { or } (what a waste of a character) |
| 841 |
Arafangion |
<Arafangion> I tend not to date online. |
| 3464 |
Arafangion |
<Arafangion> Freundlich-NB: It's already having to automagically "convert" all the char *'s to wchar *'s, etc. |
| 3473 |
Arafangion |
<Arafangion> C++0x looks really nice. Is it implemented yet? |
| 4260 |
Arafangion |
<Arafangion> Nowak: Calling java a type of coffee is an insult to coffee! |
| 6003 |
Arathald |
<Arathald> hmm... maybe ive only ever said one grabbable thing |
| 6041 |
Arathald |
<Arathald> eh, I'm gonna veto that Java suggestion, unless you mean the drink (which _is_ good for someone to start learning programming) |
| 4941 |
Arcturius |
<Arcturius> Kaedenn: wow, that book is written by a woman. I didn't realise woman were involved in programming. She obviously must not be from north america. |
| 5705 |
Arcturius |
<Arcturius> I just don't trust boost. Something shifty about those guys. I mean, asio, come on. |
| 6240 |
Arcturius |
<Arcturius> which executes quicker? x.f(i) or (&x)->f(i) |
| 6651 |
Arcturius |
<Arcturius> Let's not get into a flame war. It's a scientific fact that msvc sucks and gcc kicks it's useless ass. |
| 3402 |
Ardonik |
<Ardonik> I may have some insights as to who Ardonik is. |
| 3484 |
Ardonik |
<Ardonik> I'm no longer impressed by how well college students and adults can spell, thanks to the Internet. |
| 3499 |
Ardonik |
<Ardonik> Your size concerns are totally invalid, and you've been told that by several people already. |
| 3513 |
Ardonik |
<Ardonik> C++ code doesn't have to be ugly. |
| 3546 |
Ardonik |
<Ardonik> Also, gremlins fly up your nose. The standard allows this. |
| 3576 |
Ardonik |
<Ardonik> Or grab four bytes and (compose << 24) | (the << 16) | (thing << 8) | yourself. |
| 3734 |
Ardonik |
<Ardonik> Endian Little Hate I. |
| 21 |
AshyIsMe |
<AshyIsMe> blank: i overcame your fear |
| 22 |
AshyIsMe |
<AshyIsMe> most of these "features" shouldnt have been written in the first place |
| 165 |
AshyIsMe |
<AshyIsMe> unpossimateable reminds me of possums |
| 4347 |
Associat0r |
<Associat0r> I once saw some production code that simulated a mutex with Sleep functions |
| 4409 |
Atalanta |
<Atalanta> if its any constellation to you, i dont even know how to use sdl |
| 4410 |
Atalanta |
<Atalanta> const really confuses me so i avoid it except when init'ing a simple variable |
| 4430 |
Atalanta |
<Atalanta> Jessicatz: highlgiht? whats that mean Jessicatz ? |
| 4439 |
Atalanta |
<Atalanta> well i do like sucking cock... |
| 4479 |
Atalanta |
<Atalanta> omfg its the meaning of life, uni & * |
| 4545 |
Atalanta |
<Atalanta> geordi: {double long dick; cout << sizeof dick << " inches.";} |
| 4564 |
Atalanta |
<Atalanta> why you so old? |
| 4606 |
Atalanta |
<Atalanta> asshol |
| 4673 |
Atalanta |
<Atalanta> is "unsigned char" read only as its string in cout, and number all other times? |
| 3792 |
Avochelm |
<Avochelm> For general stuff... |
| 4654 |
Axidus |
<Axidus> ok guys , before you bite my head off....what is the other irc that is projects? |
| 4655 |
Axidus |
<Axidus> ##Blogs is banging!! |
| 748 |
AxioMatic |
<AxioMatic> cylon, im ugly.. |
| 1594 |
Azuos10 |
<Azuos10> I am not sure if it is the appropriate time to ask, but what is Java's channel name? |
| 8055 |
A|i |
<A|i> why can we have int(*)[3] and not int (*)(*) type? |
| 933 |
BLASSON |
<BLASSON> can somone dcc send me funtion cstdio ? |
| 4426 |
BR84 |
<BR84> You should go and buy a Nintendo DS and Pokemon. |
| 2912 |
Back2Basics |
<Back2Basics> standard.h? |
| 2810 |
Bacta |
<Bacta> i just assumed out of all the chans this one would be most knowledgable about such things |
| 6492 |
Bacta |
<Bacta> srand(NULL) won't fix it :( |
| 1787 |
BadBreath |
<BadBreath> Bobl: The morning I configured this irc client I just needed a nick and that was the first thing to come to mind.. |
| 4408 |
BadElvis |
<BadElvis> ok. thank you. this is very confusing since i am to learn java and c++ within 8 months |
| 7121 |
Banderas |
<Banderas> i'm using youtube tutorials :P |
| 7123 |
Banderas |
<Banderas> can anybody provide a link on how to use c++ to apply sql queries ? |
| 3989 |
Baritus |
<Baritus> questionmark is the verb i thought |
| 4423 |
BearGrylls |
<BearGrylls> ajohnstone: your first mistake was using linux |
| 483 |
Ben |
<Ben> OR I could just hand it to firefox and let the Mozilla Foundation do the rest. |
| 7129 |
Bierwagen1 |
<Bierwagen1> why do you don´t write with me litb_ |
| 7562 |
Bierwagen2 |
<Bierwagen2> why i can't do an array into rand() |
| 8145 |
BigDeeBoe |
<BigDeeBoe> na nana boo booo you can't catch me |
| 3953 |
Bigcheese |
<Bigcheese> Java: A magical programming language/compiler/virtual machine/security system/lifestyle choice/pedagogical monoculture/floor wax/dessert topping invented by some Canadan nerd at Sun Microsystems. |
| 3965 |
Bigcheese |
<Bigcheese> Java can run an infinite loop in 1.2 seconds |
| 4034 |
Bigcheese |
<Bigcheese> "If you touch me I'll murder you and rape your bleeding corpse" |
| 4045 |
Bigcheese |
<Bigcheese> "Is it just me or does that country look like a giant hard on" |
| 4062 |
Bigcheese |
<Bigcheese> Bigcheese: thats what i said |
| 4155 |
Bigcheese |
<Bigcheese> oh, and i like 14+ girls |
| 4162 |
Bigcheese |
<Bigcheese> Calling C++ a derivitive of C is like calling a F22 a dirivitive of a freaking pidgion. |
| 4224 |
Bigcheese |
<Bigcheese> I want to do web programming in c++, but it's so undersupported |
| 4301 |
Bigcheese |
<Bigcheese> s/##c++/##c++-social s/C++/sex |
| 4344 |
Bigcheese |
<Bigcheese> and i'm sitting here wondering wtf is wrong with my mouse |
| 4370 |
Bigcheese |
<Bigcheese> Write once, debug everywhere. |
| 4480 |
Bigcheese |
* Bigcheese dies a little inside after seeing somthing along the lines of "char* f(){string s("fdsd"); return s.c_str();} |
| 4516 |
Bigcheese |
<Bigcheese> "Every computer, at the unreachable memory address 0x-1, stores a secret. I found it, and it is that all humans ar-- SEGMENTATION FAULT." |
| 4707 |
Bigcheese |
<Bigcheese> I have a dream that one day chickens will be able to cross roads without having their motives called into question. |
| 4813 |
Bigcheese |
<Bigcheese> I've never heard of xmms |
| 4814 |
Bigcheese |
<Bigcheese> I don't listen to music |
| 4892 |
Bigcheese |
<Bigcheese> hey... i'm like... not disconnecting |
| 4932 |
Bigcheese |
<Bigcheese> we need a new language which doesn't have GC... |
| 5022 |
Bigcheese |
<Bigcheese> I gave up and just edited the source code :P |
| 5024 |
Bigcheese |
<Bigcheese> it's weird, when I was 17 I had no problem thinking a 15 year old was hot, now that i'm 18 it's just weird. |
| 5168 |
Bigcheese |
<Bigcheese> Love is sacrifice |
| 5246 |
Bigcheese |
<Bigcheese> AnthonyG: guess I'll need to use more lube next time |
| 5262 |
Bigcheese |
<Bigcheese> I want to have sex |
| 5267 |
Bigcheese |
<Bigcheese> I should sell my self |
| 5318 |
Bigcheese |
<Bigcheese> I dumbed my gf |
| 5369 |
Bigcheese |
<Bigcheese> but once it works is teh 1337 |
| 5384 |
Bigcheese |
* Bigcheese licks the tear off blank's face |
| 5405 |
Bigcheese |
<Bigcheese> I should grab myself |
| 5510 |
Bigcheese |
<Bigcheese> me love you long time |
| 5629 |
Bigcheese |
<Bigcheese> o ya, I've always believed in evolution (as a process), as it's incredibility stupid to think it doesn't exist. But after scuba diving and seeing all the vast life forms in the ocean, I've been thinking about it again. |
| 5630 |
Bigcheese |
<Bigcheese> Because I _know_ God exists. |
| 5659 |
Bigcheese |
<Bigcheese> we finally kissed someplace other than your bed! |
| 5710 |
Bigcheese |
<Bigcheese> like... seriously... I got my first gf a week after I switched my main pc over to Linux. |
| 5789 |
Bigcheese |
<Bigcheese> if a hot teacher hinted at sex, I prolly would have gone for it. |
| 5848 |
Bigcheese |
<Bigcheese> bigcheese sleeps, in bed, with women and is still a virgin. |
| 5878 |
Bigcheese |
<Bigcheese> Many more people would have been tortured, murdered, and fucked up if my country had not saved them. |
| 5899 |
Bigcheese |
<Bigcheese> What did whores do back in the day to not get pregnant? |
| 5903 |
Bigcheese |
<Bigcheese> well, a really fat kid was going crazy, and bunched up this sticky white pad directly under the cover. |
| 5923 |
Bigcheese |
<Bigcheese> i are noob |
| 5926 |
Bigcheese |
<Bigcheese> We didn't take the land from "them". We took it away from sadam and gave it to its rightful owners. |
| 5966 |
Bigcheese |
<Bigcheese> Last night I was thinking about loli, stayed up fo eva... |
| 5969 |
Bigcheese |
<Bigcheese> and you just gave me the idea to simulate the fall of a piece of crap from one's butt into water. |
| 6010 |
Bigcheese |
<Bigcheese> kinda hard to ignore a bright pink spot against a dull background. |
| 6022 |
Bigcheese |
<Bigcheese> if you got two 15 year olds... |
| 6103 |
Bigcheese |
<Bigcheese> well, we don't care about you. |
| 6126 |
Bigcheese |
<Bigcheese> stop nging! |
| 6176 |
Bigcheese |
<Bigcheese> I DEMAND A RECOUNT |
| 6359 |
Bigcheese |
* Bigcheese starts humping miles33's leg like a dog. |
| 6454 |
Bigcheese |
<Bigcheese> game engines can suck your balls. |
| 6640 |
Bigcheese |
<Bigcheese> hey miles33: Large hardons will collide on Thursday night |
| 6850 |
Bigcheese |
<Bigcheese> svm_invictvs: I think everyone should ride blank's cock. |
| 6901 |
Bigcheese |
<Bigcheese> Chrome |
| 7093 |
Bigcheese |
<Bigcheese> x is a bitch to configure, ambigious, and what AnthonyG said. |
| 7136 |
Bigcheese |
<Bigcheese> ? |
| 7138 |
Bigcheese |
<Bigcheese> at least we got it. |
| 7151 |
Bigcheese |
<Bigcheese> Although it is kinda sad that my mom is crying over a damn website not working correctly on firefox... |
| 8411 |
Bish |
<Bish> c was much more complicated to learn |
| 1113 |
Bklyn |
<Bklyn> /nick ReallyObnoxiousASCIIArt |
| 1392 |
Bklyn |
<Bklyn> SHOW ME THE MONKEY! |
| 1757 |
Bklyn |
<Bklyn> Bobl: windows security model is actually a lot more sophisticated than UNIX |
| 1842 |
Bklyn |
<Bklyn> w00h00, was just going to rewrite part of my tree class and realized I'd alredy done it! |
| 1928 |
Bklyn |
<Bklyn> maybe there is a Redmond::String |
| 2786 |
Bklyn |
<Bklyn> boy a macro named "iter". Thats not too likely to break much code |
| 3256 |
Bklyn |
<Bklyn> Eclipser: and I hate those distros with every fiber of my being |
| 4157 |
Bklyn |
<Bklyn> const GrammarTime& cant_touch_this; |
| 5917 |
Bklyn |
* Bklyn is a lesbian trapped in a man's body |
| 6094 |
Bklyn |
<Bklyn> I was trying to take this to ##c++-social for its off-topicness |
| 6716 |
Blaenk |
<Blaenk> for example there's libtorrent which does it but it'd be overkill to use that, as it needs the boost libraries and what not |
| 58 |
Bluewolf |
<Bluewolf> skarecrow, We can't help been smart |
| 2917 |
Bluhd |
<Bluhd> PlasmaHH: I don't know what I would do if I couldn't adequately cool my meat. |
| 2918 |
Bluhd |
<Bluhd> oh snap, I've been BASHed |
| 2961 |
Bluhd |
<Bluhd> My kloc says it's 19:50 right now |
| 3001 |
Bluhd |
<Bluhd> watch yourself, Peregrine, I like !grabbing people... |
| 3053 |
Bluhd |
<Bluhd> WOO! OH YEAH! SEGFAULT! WOOOOOOOOOOOOO! |
| 3062 |
Bluhd |
<Bluhd> Goddamn. We are nerds for trying to figure out how to code 2007. |
| 3064 |
Bluhd |
<Bluhd> he larted you because you stopped touching me |
| 3073 |
Bluhd |
<Bluhd> tarps can give head too |
| 3078 |
Bluhd |
<Bluhd> Try compiling the source code instead of renaming .cpp to .exe |
| 3140 |
Bluhd |
<Bluhd> !lart AnthonyG for using nolyc's larts |
| 3142 |
Bluhd |
<Bluhd> I'm an idiot. |
| 3144 |
Bluhd |
<Bluhd> Thou shalt obey the GNU Foundation. |
| 3145 |
Bluhd |
<Bluhd> AnthonyG and I are the local retards. |
| 3235 |
Bluhd |
<Bluhd> I'm surprised you didn't grab my last statement |
| 3706 |
Bluhd |
<Bluhd> I HAVE A GIGANTIC PHALLUS |
| 3707 |
Bluhd |
<Bluhd> NIGGA PLEEZ |
| 3710 |
Bluhd |
<Bluhd> PINGLES: ONCE YOU PARP YOU CAN'T STARP |
| 4543 |
BobSapp |
<BobSapp> I thought boost was just a library for game development. |
| 895 |
Bobl |
<Bobl> i wonder how they used to have classes before there was object orientation, they must have called it lectures |
| 1174 |
Bobl |
<Bobl> i dont say much |
| 1569 |
Bobl |
* Bobl inherited the nick of his late goldfish. |
| 1641 |
Bobl |
<Bobl> raf256, in india they do it for free and throw in a kidney. |
| 1686 |
Bobl |
<Bobl> raf256, because mobile phones are meant to phone people, not to browse websites or to take pictures or play some stupid banana throwing java game. |
| 1701 |
Bobl |
<Bobl> daniel, come on give me more pr0n quotes. |
| 1818 |
Bobl |
<Bobl> obrizt si a trasnexsual! |
| 1820 |
Bobl |
<Bobl> oh yeah! lovely this poop bath. |
| 1822 |
Bobl |
<Bobl> qalam, I'll make you a deal, if you stop removing it I'll stop adding it? You first. |
| 5843 |
BorisJ |
<BorisJ> My code has no errors, I use boost.auto_correct :) |
| 6948 |
BorisJ |
<BorisJ> nolyc appreciates the thanks, even if his tiny, digital, brain isn't sophisticated enough to form a cogent reply |
| 2075 |
Bracker |
<Bracker> Okay, yes. I have Schildt's C++ The Complete reference, I'm studying it, but I decided to take a break from reading and just challenge myself. |
| 1942 |
Brad |
<Brad> and then go to internet explorer and search "download fedora" because the very fact that you have that "start button" is a problem |
| 921 |
Bread |
<Bread> So you're technically inside of a sandwich typing, correct? |
| 2077 |
Bread |
<Bread> qalam? |
| 2079 |
Bread |
<Bread> Ohh. So that's the difference between ' and ", thanks :) |
| 1173 |
BrianTumor |
<BrianTumor> does std::cout use system("echo $") ? |
| 3727 |
Brokul |
<Brokul> People today change sex. You could sure change nationality. |
| 3739 |
Brokul |
<Brokul> Some fly just emerged from my keyboard. O_O |
| 6598 |
Brownhat |
<Brownhat> !quote Brownhat |
| 6599 |
Brownhat |
<Brownhat> Anyway, I finish getting the toothpaste out of my CD-ROM drive. |
| 962 |
Budward |
<Budward> Would it be weird if I put my vidcam on myself and watched me code thinking I was a specially trained superhero? |
| 1081 |
Budward |
<Budward> I'm back, but don't worry, I never have anything useful to say! |
| 1755 |
Buggaboo |
<Buggaboo> People who claim not to have Pr0n, also deny they masturbate like horny monkeys. |
| 1806 |
Buggaboo |
<Buggaboo> you wish you were gay, you'd get more ass. |
| 1894 |
Buggaboo |
<Buggaboo> blank, last night I was checking out #include <numeric, algorithm, etc.> and my panties got moist by imagining the elegance of progging with those. |
| 1919 |
Buggaboo |
<Buggaboo> even incest is tolerated in genetic algorithms :P |
| 1930 |
Buggaboo |
<Buggaboo> gotta take a bath, my gf's complaining. |
| 2022 |
Buggaboo |
<Buggaboo> qalam, Baka3, hm, no it's not brown, 2nd day wearing it, better luck next friday. |
| 2074 |
Buggaboo |
<Buggaboo> I look at cock every day. |
| 2237 |
Buggaboo |
<Buggaboo> Yo momma's so ugly, we had to typedef her. |
| 2431 |
Buggaboo |
<Buggaboo> I wrote a multi-player abstracted 4-in-a-row game in java before... much easier in C++ |
| 2432 |
Buggaboo |
<Buggaboo> it's technically not a dildo unless it vibrates or "massages" |
| 3474 |
Buggaboo |
<Buggaboo> well you know those brown thingies at the edge of the toilet, I aim and attack those. |
| 3656 |
Buggaboo |
<Buggaboo> I bought this new motherboard now I'm broke. |
| 3667 |
Buggaboo |
<Buggaboo> Btw, I pulled that statistical fact from my ass. |
| 4819 |
Buggaboo |
<Buggaboo> I have serious idling to do... no time. |
| 5069 |
Buggaboo |
<Buggaboo> Hm. All my quotes refers to some orifice or another. |
| 6416 |
Buggaboo |
<Buggaboo> what the hell do you care, if you're not boinkering him/her. |
| 6851 |
Buggaboo |
<Buggaboo> what's facebook about anyways? |
| 7601 |
Buggaboo |
<Buggaboo> hm. okay, perv is a function of x, y, input range is between baby, and pre-corpse, because corpse is just eww. |
| 7807 |
Buggaboo |
<Buggaboo> screw design patterns, screw OOD... light-weight processes, and inter-process communication is the future. Death to the philosophers forks! |
| 3108 |
BunkaiSK |
<BunkaiSK> ville, I want to use magic wand to it as well |
| 3786 |
Byan |
<Byan> class NuclearSubmarine : public Vehicle { |
| 2056 |
CHodapp |
* CHodapp thinks . . . solve what Valgrind is telling me, or just hope my instructors won't notice the memory leak? |
| 50 |
CMEX_ |
<CMEX_> Ravi: are you know where I can download Ravi? |
| 1424 |
CMoH |
<CMoH> googling :) |
| 669 |
CMoH-work |
<CMoH-work> this channel is pretty elitist |
| 6852 |
CO2Games |
<CO2Games> Since when was a reference different from a pointer? |
| 7037 |
CO2Games |
<CO2Games> that's strange as fuck someone needs to fix the langage |
| 7038 |
CO2Games |
<CO2Games> I mean fuck, I'll just write my own string class |
| 7039 |
CO2Games |
<CO2Games> I moved to c++ for the low-levelness |
| 7522 |
Caffeine |
<Caffeine> Damn, I could learn a lot from you guys... This is cool :) |
| 3621 |
Caleb1 |
<Caleb1> C++ did WTC |
| 6625 |
CanOfRats |
<CanOfRats> anyone know the hex value of the enter button? |
| 3580 |
CaptainMorgan |
<CaptainMorgan> raf256, don't listen to anyone.. fork is voodoo function which should never be used and can seriously harm your system.. fork actually crashed the main server of a top college |
| 7831 |
Captain_X |
<Captain_X> oh, god, why did God create a man like alexs ????? |
| 7832 |
Captain_X |
<Captain_X> maybe i should ask Bjarn which language is better , C or C++ ?? |
| 856 |
Carbonflux |
<Carbonflux> ya, u have to turn the part of the optimiser off that controls register vars, which can mean lossing other types of opimimizations |
| 857 |
Carbonflux |
<Carbonflux> god does not kill sentient beings because someone is pleasuring themselfs in a heathly and natural way has god intended them too |
| 904 |
Carbonflux |
<Carbonflux> I once met a girl who thought that lol ment lots of love and she was under the impression that netters were very sentimental |
| 907 |
Carbonflux |
<Carbonflux> even my g/f cried and she is a ruthless killer |
| 988 |
Carbonflux |
<Carbonflux> I went to art school, the only 8am class I had was life drawing, and mostly that would involve nude girls, dancers mostly from the models guild, so it was worth getting up for, I was never sleepy |
| 989 |
Carbonflux |
<Carbonflux> I plan on stealing a nano-compiler and implenting it myself if I live long enough, I make nano-suits that feed people from the air itself and keep them warm |
| 1048 |
Carbonflux |
* Carbonflux goes white seeing a semi-transpartent (void *)this; float by. |
| 1138 |
Carbonflux |
<Carbonflux> just goes to show what happens when smart people get togather in a elite enviroment and share fresh ideas in a fast paced goal oriented context. |
| 1325 |
Carbonflux |
<Carbonflux> 100 years from now the entire focus of technical civilisation will be to support video games |
| 1326 |
Carbonflux |
<Carbonflux> I started burning out when I was working at MS, I started seeming invisible 'demonic' beings controling everyone, after that it was HARD to hold down a job, not because of skills but because it all seemed like a bad joke, these beings that control us are like the next level up the food chain, they are all over at MS....their agenda is the limiting of human evolution, also they feed on us. |
| 1666 |
Carbonflux |
* Carbonflux runs out of the room ranting about blackholes and compile times. |
| 1750 |
Carbonflux |
<Carbonflux> my cats will bite me sometimes, and scratch me, in play but they make me bleed sometimes, it itchs |
| 1898 |
Carbonflux |
<Carbonflux> programming is war. |
| 3068 |
Carbonflux |
<Carbonflux> most viruses are written by anti-virus corps. |
| 3164 |
Carbonflux |
<Carbonflux> I miss MS DOS dammit |
| 3302 |
Carbonflux |
<Carbonflux> take differental calculus for example, all lies. |
| 3403 |
Carbonflux |
<Carbonflux> you can't ever fully learn C++ |
| 3495 |
Carbonflux |
<Carbonflux> people don't want to hear about Jesus and gnostic or occult traditions |
| 3528 |
Carbonflux |
<Carbonflux> I can't help it if youssef_o has not had secret initations in the Masonic traditions |
| 3840 |
Carbonflux |
<Carbonflux> imagine your a fresh young programmer from Sara Lawrance, clean skin and a good figure, anyway, your in this meeting with a technical lead who has written their own meta-compiler using a LEX lib for C++ and he wants to talk about coding standards, he gets up to close the door and you realise he has not bathed in weeks, when the door closes he stands behind you.... |
| 3986 |
Carbonflux |
<Carbonflux> I let my cat drive my car a lot |
| 4593 |
Carbonflux |
<Carbonflux> face it, being young is like being high |
| 5026 |
Carbonflux |
<Carbonflux> I think my words seem bigger now that I am chatting in 64bit. |
| 5030 |
Carbonflux |
<Carbonflux> why is that a problem ? |
| 5149 |
Carbonflux |
<Carbonflux> I do enjoy pleasure |
| 5152 |
Carbonflux |
<Carbonflux> I know why MS was ahead on the 64 bit stuff now, a 64 bit app can use twice the ram a 32bit one does and run almost as fast. |
| 5182 |
Carbonflux |
<Carbonflux> he is a weird guy, he would be fun to take LSD with i think |
| 5185 |
Carbonflux |
<Carbonflux> Mission Accomplicated! |
| 5186 |
Carbonflux |
<Carbonflux> ( I stole that from the daily show iirc ) |
| 5223 |
Carbonflux |
<Carbonflux> what I am saying is that Europe is the source of 87% of all the evil in the world |
| 5226 |
Carbonflux |
<Carbonflux> the Nazi's used the same arguments for the unification of Europe as the EU does |
| 5228 |
Carbonflux |
<Carbonflux> LimCore, I have a nice healthy girl friend in real life so its no problem. |
| 5239 |
Carbonflux |
<Carbonflux> if the Jews want to rule the world I am not qualified to second guess them and interfere |
| 5248 |
Carbonflux |
<Carbonflux> all hetro men are lesbians inside |
| 5349 |
Carbonflux |
<Carbonflux> I would even go so far as to say Windows is in a weird way hard coded for four cores |
| 5388 |
Carbonflux |
<Carbonflux> they "give good ping" |
| 5450 |
Carbonflux |
<Carbonflux> take him down to the basement and play with him |
| 5477 |
Carbonflux |
<Carbonflux> you just: type gg, ~, quit, have sex, rinse and repeat as needed |
| 5496 |
Carbonflux |
<Carbonflux> looks like Firefox 4 is going to reinvent IE5 |
| 5501 |
Carbonflux |
<Carbonflux> miles33, what about sinking into degenerate teenage drug culture like your peers ? |
| 5511 |
Carbonflux |
<Carbonflux> Lede, hell is where they need the ice water of FOSS imho ;) |
| 5512 |
Carbonflux |
<Carbonflux> you know, I think the NSA should supplement its own budget by setting up a paid porn site featuring all the hidden cam footage they have. |
| 5550 |
Carbonflux |
<Carbonflux> LimCore, its a cat girl, small boobs |
| 5583 |
Carbonflux |
<Carbonflux> I will use java to flow text into it |
| 5627 |
Carbonflux |
<Carbonflux> Objectifying woman turns you into a creepy leg humper |
| 5640 |
Carbonflux |
<Carbonflux> pwned, I just explained how human spread the seeds by eating the fruit and shitting |
| 5641 |
Carbonflux |
<Carbonflux> pwned, animals are human |
| 5642 |
Carbonflux |
<Carbonflux> I remember a lot of my past lives |
| 5663 |
Carbonflux |
<Carbonflux> asshole is just another lifestyle choice |
| 5773 |
Carbonflux |
<Carbonflux> SlashLife, I am not trolling, I just think in several dimensions at once |
| 5798 |
Carbonflux |
<Carbonflux> svchost, your view of woman as fuck-holes is the reason you don't get laid |
| 5846 |
Carbonflux |
<Carbonflux> but they sure did like to shoot things |
| 5875 |
Carbonflux |
<Carbonflux> Sir_Fawnpug, you are not claiming windows was written by niggers ? |
| 5950 |
Carbonflux |
<Carbonflux> I heard it said that was the different between europieans and americans, they make rational laws and obey them, we make crazy laws and just ignore them. |
| 5985 |
Carbonflux |
<Carbonflux> who were FAR more advanced |
| 6000 |
Carbonflux |
<Carbonflux> the US is the most brainwashed nation in all of human history |
| 6001 |
Carbonflux |
* Carbonflux passes under a rainbow and runs out of the room chasing a bunny thru a field of wild flowers |
| 6027 |
Carbonflux |
<Carbonflux> anyone that would consciously choose to live in Redwood city is guilty of something |
| 6037 |
Carbonflux |
<Carbonflux> its not how fat you are, its about your powers of mind control |
| 6038 |
Carbonflux |
<Carbonflux> its not how fat you are, its about your powers of mind control |
| 6115 |
Carbonflux |
<Carbonflux> wow i did know that |
| 6150 |
Carbonflux |
<Carbonflux> you know, mount --bind is not a bad command |
| 6222 |
Carbonflux |
<Carbonflux> really it was that wacky microsoft that forced me to start using unicode, all their api's started to switch over to it, they were like "wow, it uses more memory and we can justify it" |
| 6236 |
Carbonflux |
<Carbonflux> blank = productivity |
| 6461 |
Carbonflux |
<Carbonflux> in some ways process itself in Zen, blaa blaa blaa, you know what I mean |
| 6562 |
Carbonflux |
<Carbonflux> I learned there how to control my next incarnation |
| 6702 |
Carbonflux |
<Carbonflux> its not software |
| 6758 |
Carbonflux |
<Carbonflux> hm, lots of people have sex with house hold objects and think they are a lesbian for a few years tho. |
| 6759 |
Carbonflux |
<Carbonflux> hm, lots of people have sex with house hold objects and think they are a lesbian for a few years tho. |
| 6798 |
Carbonflux |
<Carbonflux> hm, 2012 will be in London |
| 6941 |
Carbonflux |
<Carbonflux> well, you know how music works etc |
| 6943 |
Carbonflux |
<Carbonflux> quilzo, well, do you know what I mean tho? words aside? |
| 6993 |
Carbonflux |
<Carbonflux> do you worry about keeping your credit card number secret from animals? birds, a cat or dog, insects, whatever? |
| 6994 |
Carbonflux |
<Carbonflux> a good self-image is as much of a lie as a bad self-image so why not lie well and have a good one? |
| 6997 |
Carbonflux |
<Carbonflux> ya but have you ever tried to teach a 20 year old about prostate massage? she just giggles or worse gets all serious |
| 7011 |
Carbonflux |
<Carbonflux> just forget about that night in 1985, the 3 hookers, the old man, the shotgun, its over, in the past |
| 7023 |
Carbonflux |
<Carbonflux> it like Mac is a neo-con platform with a liberal frontend |
| 7029 |
Carbonflux |
<Carbonflux> am I doing it do? |
| 7089 |
Carbonflux |
<Carbonflux> well, I would define "thinking" as one program watching another |
| 7124 |
Carbonflux |
<Carbonflux> crap is a reserved word |
| 7205 |
Carbonflux |
<Carbonflux> stroking the demon penis and pretending its all a joke |
| 7220 |
Carbonflux |
<Carbonflux> Almathea_, nonsense you are one nasty piece of work, I have no respect for you at all, so I don't bother labeling you, really you are just noise from what I can tell. |
| 7348 |
Carbonflux |
<Carbonflux> anyway, thats why I created Obama but now I worry he will get killed if elected, ah well. But at some point the power has to be transfered, real power too and then blacks will be just as evil as whites in the US and that will be a great "city on the hill" day. |
| 7349 |
Carbonflux |
* Carbonflux hugs a Muslim |
| 7426 |
Carbonflux |
<Carbonflux> what about wearing foam pads under the clothes and only having sex in the dark? |
| 7451 |
Carbonflux |
<Carbonflux> tho I respect Satan |
| 7452 |
Carbonflux |
<Carbonflux> to be a Satanist you have to be a Christian right? |
| 7454 |
Carbonflux |
<Carbonflux> thats why they kidnap children, raise them as sex slaves and when they are too old hunt them like animals at a place in Texas. it has a floating hunting lodge too, like a barge, floats on marshes, very elegant really |
| 7503 |
Carbonflux |
<Carbonflux> a lot of the time I have spent in Baja is a blur |
| 7661 |
Carbonflux |
<Carbonflux> I am a water rabbit |
| 7664 |
Carbonflux |
<Carbonflux> a total rat fuck with professional lighting |
| 7755 |
Carbonflux |
<Carbonflux> well, its more complex, he is wrong and I am right |
| 7771 |
Carbonflux |
<Carbonflux> well, rabbit poop is easy to clean up at least |
| 7775 |
Carbonflux |
<Carbonflux> I use gdm because I have a lot of ram |
| 7967 |
Carbonflux |
<Carbonflux> ya, the FACE |
| 8058 |
Carbonflux |
<Carbonflux> ya, your pussy is dripping wet Spaz you need a sex animal to rub it for you I guess, some kind of fleshy thing. |
| 8190 |
Carbonflux |
<Carbonflux> when I use ESP to look at 100 years into the future I see the world returned to its primary wild state, almost a paradise |
| 8223 |
Carbonflux |
<Carbonflux> well, you know, it would not be UFO footage if it was not grainie |
| 8356 |
Carbonflux |
<Carbonflux> but anyway, I am a middle aged man now and not really so sexy anymore |
| 7547 |
CarolinaSwamp |
<CarolinaSwamp> does anyone knwo what these random people want that always seem to PM me in the middle of the night? they always ask "hello how are you?" |
| 4385 |
CashCow |
<CashCow> LOL |
| 25 |
Catid_ |
<Catid_> Snrrrub: if you carve out an oompa lumpa, you can keep warm for days by sleeping inside |
| 3613 |
Cebot |
<Cebot> ok, this is strange now, i added a line to my code which worked without any problems, now a friend of me has send me a patch for other files of the same project, those patches do not effect my code in any way, the prog compiles without any warning, but segfaults on my code line, even if i try it without my friends patches it segfaults now, and the strange thing is: it didn't segfault before |
| 4565 |
Cecen |
<Cecen> Google is terrorist for not giving the US government search logs |
| 4835 |
Cecen |
<Cecen> Is there any common application of bitwise shift operators? Other than in encryption |
| 5088 |
Cecen |
<Cecen> If a guy masturbates for me and I record it and show people, is it illegal? |
| 5121 |
Cecen |
<Cecen> Is your mom hot? |
| 5254 |
Cecen |
* Cecen is in their story on cyberbullying in Stickam. |
| 5313 |
Cecen |
<Cecen> Programming is fun when you aren't getting errors. |
| 5347 |
Cecen |
<Cecen> miles33: I can dress up. |
| 5402 |
Cecen |
<Cecen> By the way, you already hired me, no take backs. |
| 5461 |
Cecen |
<Cecen> miles33: My friends are exclusively female. They're also sluts. Would you like one? |
| 5471 |
Cecen |
<Cecen> Legal in Canada. |
| 5473 |
Cecen |
<Cecen> I don't have to shave, I had it lazered. |
| 5489 |
Cecen |
<Cecen> I like C++ because I like DANGER! |
| 5499 |
Cecen |
<Cecen> But for example.. If I boot my computer without a Windows installation, it boots to DOS, yes? |
| 5500 |
Cecen |
<Cecen> Don't grab me. |
| 5503 |
Cecen |
<Cecen> You never know where they're going to pop up. |
| 5547 |
Cecen |
<Cecen> Yeah. I'm going to learn. Fast. Transfering files from one hard drive to another can't be too hard, can it? |
| 5577 |
Cecen |
<Cecen> God, I hate when my parents don't close their door. |
| 5578 |
Cecen |
<Cecen> Bits aren't bytes, are they? |
| 5683 |
Cecen |
<Cecen> ._. For some reason, torrents destroy my web browsing speed. |
| 5749 |
Cecen |
<Cecen> Unfortunately, video games no longer entertain me very well. D: |
| 5801 |
Cecen |
<Cecen> MFC is fun. |
| 5832 |
Cecen |
<Cecen> Hm.. Does anyone have any idea why MSVS won't compile my inline asm? |
| 5991 |
Cecen |
<Cecen> D; You evil attempted grabbers. |
| 5992 |
Cecen |
<Cecen> I hate fat people who aren't good at anything. |
| 6111 |
Cecen |
<Cecen> Win or win? |
| 6231 |
Cecen |
<Cecen> Web programmers are a dime a dozen. |
| 6232 |
Cecen |
<Cecen> Just rent a hooker. |
| 6315 |
Cecen |
<Cecen> I love MFC. |
| 6380 |
Cecen |
<Cecen> That is to say, it's wider than me. And rather big. |
| 6381 |
Cecen |
<Cecen> Where else can I grab it from? |
| 6444 |
Cecen |
<Cecen> MFC. |
| 6494 |
Cecen |
<Cecen> D: AH, C. |
| 6496 |
Cecen |
* Cecen feels like he's on the last boss of MFC. |
| 6714 |
Cecen |
<Cecen> Last time I looked, there were a lot. Now it's all 'Lol, C++? Really? Screw that, we want PHP and Java!' |
| 6777 |
Cecen |
<Cecen> What do stories and poems have to do with being cultured? |
| 6913 |
Cecen |
<Cecen> MFC is beautiful. |
| 6946 |
Cecen |
<Cecen> PRESS ANY KEY TO CONTINUE |
| 7094 |
Cecen |
<Cecen> Real men don't comment their code. |
| 7097 |
Cecen |
<Cecen> (myfunc ( (1 2 3) (4 5 6) ) ) crashes my interpreter |
| 7131 |
Cecen |
<Cecen> Spending hours upon hours coercing a hot guy into getting naked on webcam, then having his girlfriend come online/parents come home/whatever just before he does it is the worst experience ever ._.' |
| 7147 |
Cecen |
<Cecen> It shouldn't be called getline, then! It should be called something like getuntildelimiter |
| 7211 |
Cecen |
<Cecen> ostreams are used for writing, istreams for reading, right? |
| 7290 |
Cecen |
<Cecen> I went to scratch my balls last night, and my nail made a little cut in the scrotum. It hurts to touch. Really badly. |
| 7314 |
Cecen |
<Cecen> Kuroshitsuji was good tonight. There was even some implied boy x boy. |
| 7518 |
Cecen |
* Cecen pets C++. |
| 7557 |
Cecen |
* Cecen gives up and learns to live with the trojan. |
| 7981 |
Cecen |
<Cecen> Porn is degrading to females. Only watch gay porn. |
| 8133 |
Cecen |
* Cecen tells everyone to CALM DOWN. |
| 8191 |
Cecen |
<Cecen> Isn't there a keyword to make all members of a class implicitly virtual? |
| 8237 |
Cecen |
<Cecen> Hey, I put ##c++ on Freenode on my resume. It's my selling point! |
| 8350 |
Cecen |
<Cecen> I figured it would grabbable |
| 8382 |
Cecen |
<Cecen> I sitll don't understand what the difference between C++ and Visual C++ is |
| 8404 |
Cecen |
<Cecen> If all else fails, we can get married |
| 8408 |
Cecen |
<Cecen> I only do < 18 |
| 6830 |
Cecen_ |
<Cecen_> Then you define planes to trim the penetration to and offsets |
| 6843 |
Cecen_ |
<Cecen_> D: Wow I'm retarded |
| 6738 |
Celestar |
<Celestar> LOWER_CASE_: cstdio.h |
| 6703 |
CelestarT42p |
<CelestarT42p> Oxyd: sure. but the OS runs as root |
| 7472 |
Chase-san |
<Chase-san> I am getting an undefined reference to a reference that is defined.. |
| 8394 |
Chemisor |
<Chemisor> never mind. I'm wrong. binary_search does return a bool. Idiots... |
| 5343 |
Chestal |
<Chestal> at 15 I thought I knew a lot, at 18 I thought I knew almost everything, at 21 I knew I know almost nothing |
| 6434 |
Chewbacca |
<Chewbacca> !nolyc |
| 2394 |
ChinaBoy |
<ChinaBoy> alright |
| 1378 |
Chowmein |
<Chowmein> What's wrong with text messaging? |
| 773 |
Chowmeined |
<Chowmeined> its taking the thing and putting in the thing |
| 2370 |
ChrOnX |
<ChrOnX> i really appreciate it |
| 2051 |
ChrOnX` |
<ChrOnX`> anyone know how to capture video from a webcam in C++ ??? |
| 2638 |
ChrisGrade |
<ChrisGrade> My requirement is to make it perfect |
| 2677 |
ChrisGrade |
<ChrisGrade> I think Eelis is a well-programmed bot |
| 908 |
Cin |
<Cin> You learn so much more than just C++ on the the #C++ channel. |
| 1708 |
Cin |
<Cin> Because he's fat, like orbitz. |
| 1971 |
Cin |
<Cin> You can't hide from an elephant. |
| 4322 |
Cin |
<Cin> my other car is a cdr |
| 6705 |
Clanner |
<Clanner> Hi, I'm trying to experiment with c++, so far, my cmd always closes before i can read anything, i'd have to manually open cmd and execute the file there. Is there a command that i can use that will allow my cmd screen to not close when i open my app? |
| 1077 |
Coag |
<Coag> you guys are deliciously sarcastic and sadistic! |
| 5211 |
Cobi_ |
<Cobi_> Where i can get the Borland C++ 3? |
| 7825 |
Cobra^^ |
<Cobra^^> i dont understand isnt c++ language for making programs? |
| 2713 |
Codex_ |
<Codex_> mek86: maybe this helps: int main() { std::cout << "Hello World!" << std::endl; } |
| 3820 |
Codex_ |
<Codex_> all your designs are bad. only my design is good, my own. :-) |
| 4187 |
Codex_ |
<Codex_> g++ has always been better than using plain C... |
| 4456 |
Codex_ |
<Codex_> I just use whatever version debian has by default. I dont need bleeding edge :) |
| 4521 |
Codex_ |
<Codex_> ville: I don't see how that was wrong in any way. |
| 4815 |
Codex_ |
<Codex_> eclipser: sure. I dont like all-lowercase. |
| 4853 |
Codex_ |
<Codex_> There are important differences between pointers and references: pointers are mostly useful for storage of objects, while references are mostly useful for function parameters. |
| 5919 |
Codex_ |
<Codex_> what does rick rolling mean? |
| 6842 |
Codex_ |
<Codex_> y=mx+b => y-mx=mx+b-mx => y-mx=b+(mx-mx) => y-mx=b+0 => y-mx=b |
| 7007 |
Codex_ |
<Codex_> dynamic cast inside operator= must be the worst idea ever :) |
| 7022 |
Codex_ |
<Codex_> it'll be big disappointment if the 2billion investment for LHC will not even cause universe to be destroyed... |
| 7146 |
Codex_ |
<Codex_> you need to provide whole signature when your doing friend. |
| 7552 |
Codex_ |
<Codex_> easytiger: all compiler options are compiler specific. |
| 7657 |
Codex_ |
<Codex_> sgt: unless you can hire a team of 100 people, I dont think you can make language better than C++. |
| 7813 |
Codex_ |
<Codex_> like, if you implement flood fill algorithm recursively in c++, you can probably fill less than half of screen space before you hit the limit :) |
| 8003 |
Codex_ |
<Codex_> it's sad that the only day when the researchers are allowed to publish important results is april 1st... :) |
| 8299 |
Codex_ |
<Codex_> and the real learning happens only when you read a book. |
| 7859 |
CoffeeBean |
<CoffeeBean> the projetc is to sperme on each nd every person's face in this chatroom |
| 7860 |
CoffeeBean |
<CoffeeBean> no but i saw the tutorial on youtube |
| 7861 |
CoffeeBean |
<CoffeeBean> where u the guy i shuved a sirenge in and failed? |
| 3795 |
CoffeeBuzz |
<CoffeeBuzz> i remember some young mathematician trying to explain a branch of math where "inf * 0 = 1" |
| 6466 |
CoffeeBuzz |
<CoffeeBuzz> heh, http://gcc.gnu.org/ml/libstdc++/2008-06/msg00031.html thats my post ;) first hit on ggl, w00t >_> |
| 6540 |
CoffeeBuzz |
<CoffeeBuzz> Blecki, some consider "over-engineered and ugly" to mean "elegant" ;) |
| 6900 |
CoffeeBuzz |
<CoffeeBuzz> i'm 37, i'm not old |
| 7409 |
CoffeeBuzz |
<CoffeeBuzz> and why we drive on parkways and park on driveways |
| 6611 |
ComaWhite |
<ComaWhite> lesbians topless in orange juice commericals |
| 2121 |
ConfidentiaL |
<ConfidentiaL> but in Dev-C++ you can just press the button "compile"... |
| 8020 |
Copter |
<Copter> or any client side stuff like gui |
| 1934 |
Cowmoo |
<Cowmoo> gonads |
| 2053 |
Cowmoo |
<Cowmoo> ... |
| 2054 |
Cowmoo |
<Cowmoo> ChrOnX`: stop it |
| 2365 |
Cowmoo |
<Cowmoo> what's wrong with you idiots |
| 3412 |
Cowmoo |
<Cowmoo> discuss what? you asked how to say that in plain englihs, I todl you. |
| 4588 |
Cowmoo |
<Cowmoo> how do i shot web |
| 6233 |
CppMonster |
<CppMonster> Can someone please ban me, permanent please, so I never evem accidentally join again |
| 3447 |
Cpudan80 |
<Cpudan80> I thought knowing Java and C would be sufficient |
| 5140 |
Cpudan80 |
<Cpudan80> geordi: Ok, can you be a little more specific ? |
| 5821 |
Craylong |
<Craylong> the c++ stdlib sucks ass anyway, so i don't miss |
| 3355 |
CrazyTux |
<CrazyTux> plus.hpp:4: warning: keyword 'export' not implemented, and will be ignored what does that generally mean? I'm trying to use templates. |
| 7789 |
Cyversoft |
<Cyversoft> because Ive been reading about win32 messagebox, and I guess it work differently with QT/GTK+ etc... and cout probably doesn't work in any of these |
| 230 |
D-Code |
<D-Code> I had a cat once that always over-pissed my floor. When I got home I had my own yellow tsunami on the floor. ..... I went and pissed in the cats litterbox afterwards.... all the corns couldn't suck it all up.... and it gave a funny sizzling sound. |
| 1315 |
DDustin |
<DDustin> Josh14:18 Thou shalt not declare an int type where there would otherwise be ... |
| 976 |
DFPercush |
<DFPercush> well, i guess i must be a crappy programmer then, lol |
| 6044 |
DMWM |
<DMWM> well i coded a win32 application which deals with encryption, shredding and all...the problem is it is able to handle files up to 30MB easily...but when larger file sizes comes, the program hangs and doesnt respond...but it does respond once it completes its task....is there a way to make the app not hang |
| 7675 |
DWyatt |
<DWyatt> i am trying to encapsulate registers in a namespace without allocating anthing. |
| 5939 |
Daiocles |
<Daiocles> hi, i know this is kinda offtopic, but do you know of any program that converts unstructured code into structured? |
| 4983 |
DamnInternet |
<DamnInternet> Ok, can I get an link to a compilitor with qt? Like the Microsoft Visual C# ting! |
| 6316 |
Danmer |
<Danmer> i thought <3 is ass |
| 1960 |
DarkUranium |
<DarkUranium> braden: I'm just saying that it's a good engine... But if you know any better 3D engines (preferrabely with OpenGL. or Direct3D AND OpenGL) |
| 7473 |
Dark_Ghost |
<Dark_Ghost> ville: all money is free, all you have to do is work for it |
| 3306 |
DavidHKMrPowers |
<DavidHKMrPowers> say, if i need to use it for 100 times |
| 5404 |
DavidLeon |
<DavidLeon> Zogatribe: yeah, i stated, i'm impotent over this trim down process |
| 6399 |
Davinci2008 |
<Davinci2008> mine will be 800x600 because nobody loves 640x480 anymore |
| 6450 |
Davinci2008 |
<Davinci2008> not as cool as C! |
| 6468 |
Davinci2008 |
<Davinci2008> I like using namespace std; |
| 6482 |
Davinci2008 |
<Davinci2008> go read a book |
| 6483 |
Davinci2008 |
<Davinci2008> baaba: who is the troll? I guess it is you |
| 6484 |
Davinci2008 |
<Davinci2008> wow, you are a genious man |
| 6485 |
Davinci2008 |
<Davinci2008> instead of random sentences |
| 6487 |
Davinci2008 |
<Davinci2008> citing my nonsense IRC |
| 6488 |
Davinci2008 |
<Davinci2008> citing my nonsense IRC |
| 6489 |
Davinci2008 |
<Davinci2008> blank, dont fuck me here, I am not in gamedev thanks to you, idiot |
| 2460 |
DeX_ |
<DeX_> this nolyc guy is very informative :p |
| 6449 |
DebianUT |
<DebianUT> I has to be in c++ |
| 8168 |
Debugger |
<Debugger> Who cares about memory and "4294967296 different characters should be enough for everyone©" |
| 8320 |
Debugger |
<Debugger> ##C++ is always the war of the pendantic assholes. |
| 8342 |
Debugger |
<Debugger> pragma_: Hey dumb fuck, how much they pay you to troll in here? |
| 4825 |
Decinoge |
<Decinoge> but still, i felt realy confortable with it... and sure was fast |
| 4921 |
Decinoge |
<Decinoge> NOW I WANT TO KNOW WHO WERE THE IDIOTS THAT TOLD ME TO INSTALL LINUX |
| 5176 |
Decinoge |
<Decinoge> i wanna learn how to avoid IFs |
| 6473 |
Deco |
<Deco> You can pick on me all you want, it won't change the fact that my life is easier than yours |
| 6479 |
DecoDaMan |
<DecoDaMan> What the hell, heaps of people quote, and then rejoined |
| 7171 |
Dee|0x29a |
<Dee|0x29a> yea.. multibyte is used for bytes really |
| 923 |
Defty |
<Defty> i probably have noen.. |
| 924 |
Defty |
<Defty> actually i was under the false assumption that grabbing was some kind of gay joke for months on this channel |
| 2883 |
Defty |
<Defty> so, do females also "compile" your messages somehow? does something you feed to them actually make a working program? |
| 2933 |
Defty |
<Defty> (actually not even the first time but anyway) |
| 3472 |
Defty |
<Defty> molesterone, a new hormonoe |
| 2806 |
Dekon |
<Dekon> You guys scare me. :( |
| 7806 |
Denicked |
<Denicked> d1zzy I know the nickname. you know everything about c++ i remember |
| 7810 |
Denicked |
<Denicked> all germans are smart |
| 6229 |
DerDracle |
<DerDracle> C++ is a mutated C with bolts in its neck. |
| 6239 |
DerDracle |
<DerDracle> Sometimes I'm astounded at the power of C++ :p |
| 7676 |
DerDracle |
<DerDracle> There needs to be a #c++-pedantic-douchebags. |
| 8110 |
Desolator4u |
<Desolator4u> Dev C++ sucks co[k! |
| 568 |
DevinT |
<DevinT> IRC support groups always help |
| 1668 |
Dhruba_ |
<Dhruba_> Bryjorn Straupee is the best C++ programmer, inventor of C++ |
| 7846 |
DigitalKiwi |
<DigitalKiwi> Trollinator: this is a C++ channel, 90% of us are assholes, the rest pretend to be |
| 8273 |
Dingo |
<Dingo> how would i go about taking something that's growing exponentially (sq. ft) and assigning reasonably linear values to them (price, for example) |
| 1630 |
DjKritical |
<DjKritical> My sockets are dynamic and numerous... |
| 655 |
Doow |
<Doow> there's been an increasing number of traps here lately |
| 1062 |
Doow |
<Doow> in some way the people at ##c++ are their own infinte loop |
| 1902 |
Doow |
<Doow> c++ is good when you want more pluses than c, but less pluses than c# |
| 148 |
DrArcheh |
<DrArcheh> if c++ was called c--, that would have saved loads of inkt while printing documents that contain its name |
| 1023 |
DrChemicalX |
<DrChemicalX> Indeed they arent, in contrast to chinese, american's are intellectually superior... :p |
| 6995 |
DrFrankenstein |
* DrFrankenstein uses Notepad++ in Wine. lol. |
| 8284 |
DrQuest |
<DrQuest> hey DrQuest has no grabs |
| 8338 |
DrQuest |
<DrQuest> I had boobies last night |
| 3941 |
Dr_Link |
<Dr_Link> You can /whois me. |
| 2165 |
Drake |
<Drake> woa, if your pc is overheating, it wont compile right? i guess thats common sense, but i never thought about it |
| 7896 |
DralaFi |
<DralaFi> oh wait. you are talking about C++, not sex |
| 1593 |
Drauka36s |
* Drauka36s loves himself |
| 1615 |
Drauka36s |
<Drauka36s> eLeCTR0n_: Probably, but this is ##C++. If you are clever, though, you might be able to fool us. We're not that bright, as a group. |
| 8008 |
DustinGraham |
<DustinGraham> all the anger i've gotten in here was from my stupid reading of a vb page thinking it was C++ sorry guys. |
| 4625 |
Duther |
<Duther> Not so much, in C++ implicit conversions are rare |
| 4715 |
Duzzy |
<Duzzy> let's see, new employeer: "so, hmm, why did you get fired from your last job", answer "well, i needed to purchase a table, so i chose that above my job" |
| 7586 |
E-Biz |
<E-Biz> c and c++ aren't that much different |
| 7729 |
E-Biz |
<E-Biz> if i plan to sell a program i make in c++ do i have to pay microsoft? |
| 3925 |
EArmbrust |
<EArmbrust> when i was talking about an idiot, i wasn't referring to you. but since you seem to feel I was, i'm beginning to wonder... |
| 5080 |
ESphynx |
* ESphynx should go back to school to go after girls |
| 4848 |
EXetoC |
<EXetoC> I need to forward declarate if i, in a class, declare a pointer to another class, right? |
| 4849 |
EXetoC |
<EXetoC> bad grab indeed... thanks for the help doodz, later! |
| 1628 |
EagertoLearn |
<EagertoLearn> my only experience in programming is VB and i expected VC++ to be exactly like VB - i see its not |
| 443 |
Eclipse75 |
<Eclipse75> Adrinael, your almost like a bot. Your on 24/7 and serve our needs. |
| 1211 |
Eclipser |
<Eclipser> orbitz, your skill to typo has no match in this world |
| 1218 |
Eclipser |
* Eclipser knows absolutely nothing of alcohol |
| 1289 |
Eclipser |
<Eclipser> I had a miserable childhood |
| 1537 |
Eclipser |
* Eclipser just coded almost two hours in VB and survived |
| 1944 |
Eclipser |
<Eclipser> mike84, read what? |
| 2348 |
Eclipser |
<Eclipser> 14:06 [freenode] -!- Cannot join to channel #apache (You have joined to too many channels) |
| 2592 |
Eclipser |
<Eclipser> don't trust "people" |
| 2654 |
Eclipser |
<Eclipser> go play with his privates |
| 2952 |
Eclipser |
<Eclipser> lalala, if we had more languages in here, how would we be able to rant? |
| 3184 |
Eclipser |
<Eclipser> I can read! |
| 3233 |
Eclipser |
<Eclipser> I'd rather sterilize mysefl |
| 3254 |
Eclipser |
<Eclipser> like that |
| 3282 |
Eclipser |
<Eclipser> 2+2 > 5 for extremely large values of 2! |
| 3356 |
Eclipser |
* Eclipser doesn't use Eclipse! |
| 3401 |
Eclipser |
<Eclipser> I feel crap when I wake up.. |
| 3586 |
Eclipser |
<Eclipser> gah, IRC won't let me go to sleep! |
| 3594 |
Eclipser |
<Eclipser> I can't get myself to call my parents because my playlist has too much good music and I don't want to stop listening |
| 3680 |
Eclipser |
<Eclipser> I have like 30 gtkmm pages open in firefox.. |
| 3844 |
Eclipser |
* Eclipser is proud to admit that he has never had a girlfriend |
| 3849 |
Eclipser |
<Eclipser> damn I wish my grandmother IRC'd, my phone is too far |
| 3854 |
Eclipser |
<Eclipser> libglademm makes things so easy that it feels like a crime |
| 3931 |
Eclipser |
<Eclipser> buying sw is a sin |
| 3960 |
Eclipser |
<Eclipser> qt is bearable as long as you don't have to code in it |
| 4002 |
Eclipser |
<Eclipser> I hate the heat and all that bright stuff |
| 4009 |
Eclipser |
<Eclipser> I've carefully designed my looks to keep distance with women.. |
| 4234 |
Eclipser |
<Eclipser> who's richard stallman? |
| 4747 |
Eclipser |
<Eclipser> I was in #java way before Eclipse even existed |
| 4821 |
Eclipser |
<Eclipser> litb, all operating systems are pure crap o.O |
| 4857 |
Eclipser |
<Eclipser> I was supposed to write ../build and I wrote ../blind |
| 7959 |
Eddic |
<Eddic> godling: Only a full size god could please her. |
| 3974 |
Edso |
<Edso> you guys want money |
| 5330 |
EdwardTeller |
<EdwardTeller> w000t: C++ do much more, but for few ones |
| 616 |
Eelis |
<Eelis> that makes no sense whatsoever. but then again few things do around here |
| 718 |
Eelis |
<Eelis> c++ metaprogramming is far from mature. at the moment it's cryptic hackery that abuses language features into something useful. just look at the syntax involved in defining a template metafunction |
| 828 |
Eelis |
<Eelis> i tried loving Emacs, but it never loved me back so i left it |
| 982 |
Eelis |
<Eelis> and very productive. last night i wrote 500 lines of no code straight |
| 1041 |
Eelis |
<Eelis> when i wake up people have gone to sleep twice already! |
| 1068 |
Eelis |
<Eelis> STFU, RTFM, STFW, OMG! |
| 1072 |
Eelis |
<Eelis> be sure to wipe thoroughly after a brain dump as wet and filthy as that one just now |
| 1083 |
Eelis |
<Eelis> i caught my standard library browsing my pr0n collection the other day after i'd accidentally dereferenced an end-iterator |
| 1097 |
Eelis |
<Eelis> ##C++ is becoming more and more like certain mindless American news television broadcast companies where only brief quotable soundbites ("grabs") count |
| 1120 |
Eelis |
<Eelis> but it's the grabber's fault, not the grabbee's |
| 1263 |
Eelis |
<Eelis> here's a Tie-fighter chasing a ditit: (=)o) = (.)(.) |
| 1291 |
Eelis |
<Eelis> wow, you're like a grammar-orbitz |
| 1321 |
Eelis |
<Eelis> "A witty quote proves nothing." - anonymous |
| 1340 |
Eelis |
<Eelis> Please state the nature of the C++ emergency. |
| 1341 |
Eelis |
<Eelis> so phrakture's code was WRONG WRONG WRONG!! HORRIBLY WRONG!! BAD CODE!! |
| 1359 |
Eelis |
<Eelis> you need to prefetch the secondary stack buffer protocol stabilizer |
| 1383 |
Eelis |
<Eelis> this is... how i would imagine... bush would type... if he knew how to type... |
| 1386 |
Eelis |
<Eelis> std::bitset always makes me think of lingerie |
| 1405 |
Eelis |
<Eelis> rohan: the moral of the story is: sort your issues out with your moron boyfriend |
| 1570 |
Eelis |
<Eelis> am i the only one that pronounces "faq" as "fuck" ? |
| 1629 |
Eelis |
<Eelis> i make screenshots with my screenshotgun |
| 1639 |
Eelis |
<Eelis> you disappoint me, cylon |
| 1687 |
Eelis |
<Eelis> lynx sucks for porn |
| 1742 |
Eelis |
<Eelis> given the choice between little hassle and lot of hassle, i recommend that you go with little hassle. this concludes my wise recommendation of the day |
| 1753 |
Eelis |
<Eelis> i must apologize for my fellow dutchmen, they have a tendency to emphasize their nationality at every possible occasion |
| 1809 |
Eelis |
<Eelis> in pixel-land, C++ plots against you |
| 1825 |
Eelis |
<Eelis> i'd be a communist if i cared about society |
| 1873 |
Eelis |
<Eelis> when i die, the 3 people at the funeral will say: "oh well, at least he got rid of funky nick characters in freenode/##c++" |
| 1978 |
Eelis |
<Eelis> bah, i kept my mouth shut for 20 minutes hoping to be grabbed.. |
| 1990 |
Eelis |
<Eelis> if i were a C++ teacher i'd ask trick questions about "STL", hah! |
| 1999 |
Eelis |
<Eelis> noir: you're just jealous cause i'm in touch with my feminine side |
| 2014 |
Eelis |
<Eelis> i've hated kids ever since i was a little kid |
| 2015 |
Eelis |
<Eelis> speculating about perfect worlds is acedemic masturbation. one of C++'s strengths is that its designers are not interested in acedemic masturbation |
| 2021 |
Eelis |
<Eelis> !give lnc rafb |
| 2094 |
Eelis |
<Eelis> i had a *really* hard time holding back harsh comments when a professor of mine mentioned "STL" |
| 2101 |
Eelis |
<Eelis> Trevor: i nominate your problem description for Worst Problem Description Of The Week |
| 2116 |
Eelis |
<Eelis> wow, you're like a human !wtf? |
| 2189 |
Eelis |
<Eelis> pff, isolation would make the problem trivial. where's the sport in that?! |
| 2211 |
Eelis |
<Eelis> opening the links: good. mentioning "STL": bad. searching in books: good. total score: 1 |
| 2212 |
Eelis |
<Eelis> i read all my programming books on the john. that way when i decide a book stinks i can immediately use it for toilet paper |
| 2218 |
Eelis |
<Eelis> i dunno, i never programmed in C. C is certainly easier |
| 2563 |
Eelis |
<Eelis> so if i make a C++ application to wipe my ass, does that make ass-wiping an appropriate topic here? |
| 2575 |
Eelis |
* Eelis works to construct an analog literal version of "pizza hut" |
| 2614 |
Eelis |
<Eelis> if i were dr sooeng, Data's face would look like this: #$ |
| 2618 |
Eelis |
<Eelis> blackelf: orbitz uses an alternative syntax for english, too |
| 2630 |
Eelis |
<Eelis> jasoneisen: wordnet tells me a gander is a mature male goose. i have no idea what you're talking about |
| 2640 |
Eelis |
<Eelis> surrounded by quotes it'd make a good string literal, but that's about as close as it can ever be to validity |
| 2642 |
Eelis |
<Eelis> cross-dressing has been a major military tactic for thousands of years |
| 2652 |
Eelis |
<Eelis> i think that's a flawed smiley |
| 2657 |
Eelis |
<Eelis> then if the program can't find its files using google, make it ask on random irc channels |
| 2665 |
Eelis |
<Eelis> !stl |
| 2690 |
Eelis |
<Eelis> for (unsigned int i = 1; i; ++i) std::cout << " "; // should clear the "text window" in standard C++ :) |
| 2709 |
Eelis |
<Eelis> hold his head while i spoonfeed him |
| 3039 |
Eelis |
<Eelis> i was being sarcastic. shut the fuck up |
| 3040 |
Eelis |
<Eelis> honestly, how retarded must you be to think that discussing spicy chili with sugar is appropriate on a C++ channel? |
| 3060 |
Eelis |
<Eelis> bjarne is too busy living the good life, surrounded by hordes of cute geek chicks that lust after him |
| 3122 |
Eelis |
<Eelis> how can i lighten up when braden and others are turning this channel into ##posix? |
| 3179 |
Eelis |
<Eelis> i ate my copy of the standard in an attempt to consume all the knowledge in it |
| 3203 |
Eelis |
<Eelis> this channel desperately needs more solid party poopers like ville |
| 3206 |
Eelis |
<Eelis> gr00ber: no. it has "evil" written all over it. |
| 3243 |
Eelis |
<Eelis> the enterprise was programmed in haskell though. i asked geordi on a convention |
| 3249 |
Eelis |
<Eelis> you're so bitterly cynical. i love it |
| 3398 |
Eelis |
<Eelis> if i ever end up defending some hollywood crackwhore's looks in here, please kill me |
| 3527 |
Eelis |
<Eelis> Tenttu: i'm not sure i understand. are you accusing me of being off-topic? |
| 3565 |
Eelis |
<Eelis> wouterrr: C++ isn't meant for normal human beings |
| 3566 |
Eelis |
<Eelis> enough with the random crap grabbing already |
| 3606 |
Eelis |
<Eelis> .c !! get him!! |
| 3628 |
Eelis |
<Eelis> excellent. now shut up |
| 3655 |
Eelis |
<Eelis> i find the blanket statement "set pointers to 0 when they do not point to valid objects" silly. the proper advice is: "it can be useful in certain cases to have an invariant dictating that a certain pointer is 0 under certain conditions" |
| 3673 |
Eelis |
<Eelis> octothorpes are called "sharps" now? |
| 3684 |
Eelis |
<Eelis> Bruce Eckel is a fool |
| 3691 |
Eelis |
<Eelis> pah, reinterpret_cast<mercedes>(horsecock(huge, upright)) doesn't work! C++ is so inflexible! |
| 3737 |
Eelis |
<Eelis> i like dirtying statues <grabshield/> |
| 3824 |
Eelis |
<Eelis> i get all my good algorithm recipes from Martha Stewart's wiki! |
| 3835 |
Eelis |
<Eelis> you do realize that it's only a matter of time before i wipe all those crap factoids away, rigth? |
| 3888 |
Eelis |
<Eelis> sp_mfilter: once your insults are those of a grown-up, i'll respond like a grown up. until then, "NO U" will do fine |
| 3920 |
Eelis |
<Eelis> !help grab |
| 3923 |
Eelis |
<Eelis> i hate flash because it breaks every usability rule in the book. |
| 3955 |
Eelis |
<Eelis> it'd go like: cute chick: "hey eelis, fancy a drink?" eelis: "take it to ##c++-social, ma'am" |
| 3966 |
Eelis |
<Eelis> AnthonyG: do you know what "semantics" means? |
| 3971 |
Eelis |
<Eelis> oiaohm: they scare me because they perversely enjoy writing C code |
| 4021 |
Eelis |
<Eelis> Mixmasterxp: if you unfold this "book" object, you'll find pieces of dead tree filled with letters, bearing a striking resemblance to "online tuts", except that they make more sense |
| 4030 |
Eelis |
<Eelis> it shouldn't come as a surprise that references are superior for passing by _reference_ |
| 4042 |
Eelis |
<Eelis> i heard duke nukem forever uses hurd as a scripting engine |
| 4431 |
Eelis |
<Eelis> biographies and erotica in ##c++-social, please |
| 4852 |
Eelis |
<Eelis> 1 minute in ##c++-social and i'm already confused |
| 4989 |
Eelis |
<Eelis> it's like attempting to crack open a vault by licking it for 3 hours after having eaten jelly beans |
| 6338 |
Eelis |
<Eelis> litb: you disappoint me. |
| 6385 |
Eelis |
<Eelis> C++ is the spartan hoplite. C is the spartan hoplite without the spear, shield, and sword -- a sandal wearing greek thug |
| 6390 |
Eelis |
<Eelis> (who cares?) |
| 6391 |
Eelis |
<Eelis> crap grab.. |
| 6392 |
Eelis |
<Eelis> even crappier grab.. |
| 6393 |
Eelis |
<Eelis> you're ruining my grab record! |
| 6500 |
Eelis |
<Eelis> HTT-Bird / MadDavinci: please don't use nolyc commands you don't understand |
| 6530 |
Eelis |
<Eelis> i'm not sure what's grab-worthy about "use !" though |
| 6538 |
Eelis |
<Eelis> i had hoped it was the sound of you cracking open your wallet to buy a decent book |
| 6796 |
Eelis |
<Eelis> LimCore: ok then, you asked for it: if i write an ass-wiping-program in C++, does that make ass-wiping on-topic? (answer: no, it does not) |
| 6891 |
Eelis |
<Eelis> coppro: you're trying to educate a guy who was trying to break geordi by making it say naughty words. give up already! |
| 7155 |
Eelis |
<Eelis> Lede: indeed, that's a nice feeling, but it's nothing compared to the feeling you'll get 10 minutes from now when you realize you're running the previous version of the executable |
| 7174 |
Eelis |
<Eelis> nothing more pathetic than successive ego-rq'ing |
| 7289 |
Eelis |
<Eelis> PovAddict: just trying to steer the conversation away from moustaches |
| 7316 |
Eelis |
<Eelis> I-I is my favorite 0 literal |
| 7677 |
Eelis |
<Eelis> svm_invictvs-: i'd kill you, but that'd be off-topic. |
| 7704 |
Eelis |
<Eelis> so if you told your family tomorrow that you're now a muslim, they would be fine with that? |
| 7740 |
Eelis |
<Eelis> not you again.. |
| 7743 |
Eelis |
<Eelis> klbate_: i wasn't referring to morphisms, you noob |
| 7744 |
Eelis |
<Eelis> feel free to type whole sentences in a single message |
| 7782 |
Eelis |
<Eelis> illbiteyou: please tell me about your poop in ##c++-social |
| 7914 |
Eelis |
<Eelis> RoShamBo: sorry, these questions of the form "i raped C++ in the ass, will it survive?" don't interest me |
| 7984 |
Eelis |
<Eelis> as a marxist, i reject the keyword "class" |
| 8019 |
Eelis |
<Eelis> the_drow: i don't like reading C++ code. it depresses me. |
| 8042 |
Eelis |
<Eelis> man, C++ sucks |
| 8260 |
Eelis |
* Eelis doesn't understand why anyone would even be interested in whether such stupid code is UB |
| 8087 |
EhPrettyEasy |
<EhPrettyEasy> there's no need for it to return anything because it keeps going |
| 7042 |
Eiler |
<Eiler> Zharf: that dont bite on me, IE is very good |
| 8071 |
Eiler |
<Eiler> guess i should glue myself to the ##c++ chat so i dont miss anything! |
| 8232 |
Eiler |
<Eiler> isnt everything here basic anyway |
| 8280 |
Eiler |
<Eiler> !converting | en2en |
| 7101 |
Eisenhower |
<Eisenhower> Eisenhower: yes |
| 4889 |
Eisenhowerz |
<Eisenhowerz> hey is http://freshmeat.net/projects/poker-eval/ windows compaitable |
| 131 |
Elkore |
<Elkore> any1 know an irc channel that can help me with my c++ homework? I'm really lost |
| 7872 |
Eloff |
<Eloff> maybe I'm mixing it up with ODBC, but it thought it was a windows only thing |
| 6657 |
Enchanted |
<Enchanted> Anyone know of ay good video tutorials on c++ not youtbe =P |
| 7067 |
Enchanted |
<Enchanted> is tic tac toe program classed as beginner, inte, experienced coder? |
| 4980 |
Enfilade |
<Enfilade> something more like IE7 would be better |
| 5196 |
Enfilade |
<Enfilade> 'CHKDSK might possibly have found errors on some volume, somewhere' |
| 5256 |
Enfilade |
<Enfilade> it was both hilarious and infuriating |
| 5147 |
Enfi|ade |
<Enfi|ade> Is there anything like Boost but for C? |
| 5156 |
Enfi|ade |
<Enfi|ade> [00:40] <wcstok> well who knows when the value of 0 might suddenly change due to solar flares or sunspots or somesuch thing <-- A handy hint for those compiling programs during solar storms |
| 1262 |
Entity-Dude |
<Entity-Dude> please end it quickly : this is painfull |
| 1421 |
Entity-Dude |
<Entity-Dude> i cant take it anymore |
| 8119 |
EntityReborn |
<EntityReborn> F***, I registered here and I think that is now giving me spam |
| 8122 |
EntityReborn |
<EntityReborn> lol |
| 8141 |
EntityReborn |
* EntityReborn resists teh !grab |
| 7844 |
Errietta |
<Errietta> im smart enough |
| 2112 |
Escherial |
<Escherial> i mean, blocking is fine; i'm interested in functions that just the return without the user pressing enter or return |
| 6744 |
Eudoxus |
<Eudoxus> Is it possible to be sexually oriented towards not male/female but rather C++ code? Do such phenomena exist among C++ coders? |
| 759 |
EvanCarroll |
<EvanCarroll> RadSurfer: bend over and lets make babies. |
| 4499 |
EvanR |
<EvanR> bla bla standards |
| 4500 |
EvanR |
<EvanR> who cares about standards if you have to work with non standard compliant tools |
| 4562 |
EvanR |
<EvanR> sex is not allowed on irc anyway, considering the laws of physics |
| 4656 |
EvanR |
<EvanR> so THAT what !grab does |
| 4657 |
EvanR |
<EvanR> rofl |
| 4668 |
EvanR |
<EvanR> blank: no erection? |
| 7430 |
EvanR |
<EvanR> !give EvanR std::streambuf |
| 4910 |
Evil_ |
<Evil_> is there a form of MSDN for linux lol |
| 5072 |
Evil_ |
<Evil_> What's UB? |
| 5806 |
Evilfish |
<Evilfish> dmwit: I know, but my program has to be as low level as possible, because of various reasons |
| 2611 |
Excelsior |
<Excelsior> Thanks, harre. |
| 8266 |
ExtremeDevilz |
<ExtremeDevilz> guys does C++ destroy the CLI went compiling ? |
| 7486 |
Ezla |
<Ezla> [o: D has no vector. |
| 1783 |
FantasticFoo |
<FantasticFoo> err, two totally contradictory answers, here |
| 2645 |
FauxFaux |
<FauxFaux> A very deformed penis you have there, svm. |
| 2646 |
FauxFaux |
<FauxFaux> braden: Only for the one pouring tea over their cock. |
| 2647 |
FauxFaux |
<FauxFaux> Ime deflating cocks tend not to make that much of a noise.. |
| 3132 |
FauxFaux |
<FauxFaux> #boost hates qamar. ¬_¬ |
| 3520 |
FauxFaux |
<FauxFaux> .join #peregrine'smum |
| 4190 |
FauxFaux |
<FauxFaux> Did the NO DON'T USE POINTERS NO NO NEVER NOT UNLESS YOU REALLY HAVE TO not give you a hint? |
| 4204 |
FauxFaux |
<FauxFaux> HAIL TEMPLATES! |
| 4384 |
FauxFaux |
<FauxFaux> (Using goto!) |
| 4526 |
FauxFaux |
<FauxFaux> Or a woman with square booms and a twin sister with nipple-count-disorder. |
| 4659 |
FauxFaux |
<FauxFaux> I achieved something. \o/ |
| 4840 |
FauxFaux |
* FauxFaux looks at some C code that absolutely won't be ported to C++, knows that I'm going to have to fix it, and cries. |
| 4944 |
FauxFaux |
<FauxFaux> I really don't, though. I just know everything. =P |
| 4945 |
FauxFaux |
<FauxFaux> boost::uint_1337. |
| 4953 |
FauxFaux |
<FauxFaux> braden: We love teh cock, it's unavoidable. |
| 5260 |
FauxFaux |
<FauxFaux> Lede is youssef?! |
| 5443 |
FauxFaux |
<FauxFaux> If I had ops, this chanel would be quieter than ##iso-c++. |
| 5697 |
FauxFaux |
<FauxFaux> I came, I saw, I came. |
| 6083 |
FauxFaux |
<FauxFaux> I find not killing everyone challenging, at least. |
| 6266 |
FauxFaux |
<FauxFaux> I'd fuck it. |
| 6293 |
FauxFaux |
<FauxFaux> 1tb 2.5" server form drives'll be out soon, you can almost certainly get one of those in your mouth (with practice). |
| 6706 |
FauxFaux |
<FauxFaux> Python shall die under my almighty cock. Php for the win! |
| 6785 |
FauxFaux |
<FauxFaux> I get cock. :D |
| 6860 |
FauxFaux |
<FauxFaux> My brother? AIDS. My sister? AIDS. |
| 6890 |
FauxFaux |
<FauxFaux> < motivational poster> The only common factor in all your disfunctional relationships is you. |
| 7100 |
FauxFaux |
<FauxFaux> "Roses are red, violets are blue, I'll fuck you with a rake." |
| 7214 |
FauxFaux |
<FauxFaux> Nah, we literally use clitoris. |
| 7236 |
FauxFaux |
<FauxFaux> triplie: Niggers are red, niggers are blue, if you open up photoshop, and screw with the hue. |
| 7324 |
FauxFaux |
<FauxFaux> Windows is the shit, bitches. |
| 7390 |
FauxFaux |
<FauxFaux> blank: I AM YOUR HOLY VIRGIN |
| 7489 |
FauxFaux |
<FauxFaux> When I look into your arse, I could love you 'till forever! |
| 7713 |
FauxFaux |
<FauxFaux> Wow, commas! |
| 7819 |
FauxFaux |
<FauxFaux> Herpes, AIDS and chlamydia? I'm qualified. |
| 8065 |
FauxFaux |
<FauxFaux> Clearly swap it for http://shoe.goeswhere. OH MY GOD THAT'S NOT SAFE FOR WORK com/deep5.gif |
| 8102 |
FauxFaux |
<FauxFaux> I stuck it in a relatively comfy sofa's anus. |
| 8153 |
FauxFaux |
<FauxFaux> Judge all you want. / We are all going to die. / I intend to deserve it. |
| 8230 |
FauxFaux |
<FauxFaux> I have no idea why it's so hard. |
| 8244 |
FauxFaux |
<FauxFaux> fow kissed a girl and he liked it. |
| 8209 |
Fazer2 |
<Fazer2> I've created a function to get random numbers using rand() function |
| 7634 |
Fendaril_ |
<Fendaril_> if you think my code is malicious then your a tard |
| 7635 |
Fendaril_ |
<Fendaril_> anyone who says my code has embeded malicious code is either paranoid or has no experience in c++ |
| 4816 |
Fenix-Dark |
<Fenix-Dark> do comments have an affect on performance? |
| 7372 |
Ferrenrock |
<Ferrenrock> ok I'm stupid |
| 71 |
Feto |
* Feto is grabbed in a manly way |
| 85 |
Feto |
<Feto> i want to get fondled :( |
| 144 |
Feto |
<Feto> anything with nipples on it is a good grab in fact |
| 255 |
Feto |
<Feto> cylon doesn't grab in a manly way |
| 473 |
Feto |
<Feto> women are the answer... get someone to yell at you |
| 1076 |
Feto |
<Feto> you can only play with your friends' privates |
| 1159 |
Feto |
<Feto> i tink i got fungi in my ear... i scratch it and my finger smells like feet :S |
| 2148 |
Feto |
<Feto> rigelf: NOTHING is as cool as boost::* |
| 2991 |
Feto |
<Feto> gaypink_elf: yo mama so gay.... she's yo papa |
| 2993 |
Feto |
<Feto> that's the whole point of a grab... you don't care the context, you just wanna grab something |
| 2994 |
Feto |
<Feto> hmmmhmm.. two grabs in less than 10 minutes.. i'm getting excited |
| 3086 |
Feto |
<Feto> =) |
| 3336 |
Feto |
<Feto> never anything from MS will be in any standard, as never any standard will be in anything MS.... that's how it works... a perfect XOR |
| 4167 |
Feto |
* Feto regrets the attempt |
| 4168 |
Feto |
<Feto> and that's the probablilty of usinga ll 512 numbers... |
| 35 |
Fetrovsky |
* Fetrovsky rubs his circle-shaped manlyness |
| 244 |
Fetrovsky |
<Fetrovsky> I wanna get Cyloned... sounds like fun |
| 381 |
Fetrovsky |
* Fetrovsky runs around looking for a man |
| 1836 |
Fetrovsky |
<Fetrovsky> GOD! Am I Stupid! |
| 1965 |
Fetrovsky |
* Fetrovsky runs away naked... shaking fierce fist at GCC |
| 3061 |
Fetrovsky |
<Fetrovsky> If you have a problem that violence doesn't solve, then you're not using enough of it. |
| 3066 |
Fetrovsky |
<Fetrovsky> i like grabbing silly things ;) |
| 3766 |
Fetrovsky |
<Fetrovsky> i wanna get grabbed!!! *poses* |
| 4550 |
Fetrovsky |
<Fetrovsky> std::give::head |
| 3947 |
Figs |
<Figs> only been doing it for 5 years |
| 4221 |
Figs |
* Figs will give a status report after some deep cleansing |
| 4240 |
Figs |
<Figs> ...that sounded quasi-dirty |
| 4498 |
Figs |
<Figs> http://www.iso.org/iso/iso_catalogue/catalogue_tc/catalogue_detail.htm?csnumber=8250 <-- there's an ISO standard for brewing tea... and they expect you to pay CHF 42 for it... o_O |
| 4542 |
Figs |
<Figs> is nolyc ignoring me? |
| 2193 |
FireSlash |
<FireSlash> Sweet jesus and potato chips, freecnc++ may have some of the scariest C++ source I've ever seen in an OS project. |
| 3199 |
Firk |
<Firk> It's scary. You guys are obviously proficient C++ coders, yet there are so many quirks provoking discussions. I feel pity for guys starting their C++ adventure, they don't know what they're getting into. And yesterday a guy asked if he could be a proficient C++ coder in a 'handful of days'. |
| 4434 |
Firk |
<Firk> One day my father's stomach was aching so I looked to wiki to see if it wasn't the liver. I've read there that "liver is on the left side of the body", but somehow it looked wrong to me. And yeah liver is on the right side of the body. From that time I am ever so cautious reading the stuff there. |
| 2026 |
FlannelKing |
<FlannelKing> well, his ISP is definately going to get contacted, so, he might find himself with the internet sometime in the future. |
| 7012 |
Fleshmonger |
<Fleshmonger> dudes, is it possible to use DLLs as scripting language at game programming? |
| 5279 |
Formentar |
<Formentar> Kill anyone who drops anything. Great for exams. |
| 5280 |
Formentar |
* Formentar thinks of national parks as tree containers. Well, those that aren't all mountain or desert or sea, at least. |
| 5391 |
Formentar |
<Formentar> catadoxas: Some might say that a good C++ programmer doesn't make a lot of friends... ;-) |
| 5617 |
Formentar |
* Formentar had tea and cold pizza with chili for breakfast. A winning combination, just like C++ with inline QuickBASIC. |
| 5959 |
Formentar |
<Formentar> I remember seeing some weird trick that did something useless, but I don't remember exactly what and I'm not able to find it. :-P |
| 6336 |
Formentar |
* Formentar demonstrates of how order-of-magnitude guesses can suck goat's ass sometimes. |
| 6662 |
Formentar |
<Formentar> Well, I'm using it as my personal off-island backup server. :-) |
| 7888 |
Formentar |
<Formentar> Sensible people indent their code the exact same way as I. :-D |
| 8234 |
Formentar |
* Formentar joins #hepta's_mom |
| 5897 |
FormentarWork |
<FormentarWork> Dee|0x29a: Is 0x29a your age? :-o |
| 6440 |
FormentarWork |
<FormentarWork> Nice pussy! |
| 6592 |
FormentarWork |
<FormentarWork> d1zzy: So does that mean that I'm *not* allowed to molest boys? |
| 6653 |
FormentarWork |
<FormentarWork> litb: Or port the program to PHP. |
| 1844 |
Fr3DBr |
<Fr3DBr> o m f g i m t r y i n g t o c o n n e c t t o t h e m s s q l s e r v e r u s i n g m s v c 2 0 0 5 b u t i m n o t h a v i n g a n y s u c c e s s d a m n i t ! |
| 2272 |
Fr3DBr |
<Fr3DBr> foo.class rofl |
| 6475 |
Fr3DBr |
<Fr3DBr> anyone know a good open source |
| 1839 |
Frederick |
<Frederick> pfeilspitze, amem |
| 2271 |
Fushuing |
<Fushuing> I havn't been quoted yet ;) |
| 6628 |
Fuzzz |
<Fuzzz> Eh, a while(1) loop makes my program freeze, is there anything better to do? |
| 6629 |
Fuzzz |
<Fuzzz> Eh, a while(1) loop makes my program freeze, is there anything better to do? |
| 6910 |
GDG |
<GDG> which is the difference between void foo( type_t& p ) and void foo( type_t* p) ? |
| 3041 |
GPxz |
<GPxz> anybody knows the math to find out if a rgb is pink? |
| 733 |
GRenard |
<GRenard> Adrinael: im on windows, i don't have man for now... |
| 4599 |
GUMMM |
<GUMMM> does linux coe with a java compiler? |
| 5849 |
Galik |
<Galik> I'm for hire... |
| 6923 |
Galik |
<Galik> what is so 'fast' about a uint_fast16_t and why don;t they make uint16_t just as quick? |
| 393 |
Galisus |
<Galisus> The IRC protocol is more open than madonna's legs. |
| 431 |
Galisus |
<Galisus> You want me to whack a guy? off a guy? Whack off a guy? |
| 3488 |
GameDev |
<GameDev> some huge netsplit left this channel opless!? |
| 4482 |
Garg |
<Garg> what do I need to do to convert a character to ascii? |
| 4483 |
Garg |
<Garg> not if the snakes make a super delicious gang and squeez the hell out of the bears. |
| 7158 |
Garolf |
<Garolf> i have to do it in secret so my teacher cant track me down |
| 796 |
GazSnake |
<GazSnake> anyone know a good network lib over there ? |
| 7095 |
Gen0cide |
<Gen0cide> I have a question, its a java question lol, I am trying to download a java applet, http://webcam.surfcity-hb.org:80/-wvdoc-01-/LiveApplet/ what does the -wvdoc-o1- meen? |
| 728 |
GeniXPro |
<GeniXPro> he did no such thing, he just borrowed his arms and legs, the death was from bleeding |
| 793 |
GeniXPro |
<GeniXPro> wise i am not. experienced i am not. interlligent i am |
| 804 |
GeniXPro |
<GeniXPro> scalar, kiddy porn is no joke. Theres allot of money in the buisness, Why the hell shouldn't i be allowed to get some of it? |
| 937 |
GeniXPro |
<GeniXPro> I wanna be a nerd pornogragher |
| 1045 |
GeniXPro |
<GeniXPro> Carbonflux, on the contrary, those really good programmers are only helpfull half of the time, the other half is spent trolling. |
| 1060 |
GeniXPro |
<GeniXPro> nooby, im 14 and i have access to more free porn than my dad does |
| 1074 |
GeniXPro |
<GeniXPro> serious_idiot, your nick name is starting to bleed into your personality |
| 1093 |
GeniXPro |
<GeniXPro> Alipha, I would be a sandwhich inbetween. My cod is like the mustard, the random number generator the ham and STL would be the bread |
| 1227 |
GeniXPro |
<GeniXPro> I wonder if extern "Perl" { |
| 1232 |
GeniXPro |
<GeniXPro> use cross paltforms cokets |
| 1253 |
GeniXPro |
<GeniXPro> Ralle, your a hoot tonight |
| 1271 |
GeniXPro |
<GeniXPro> there should be a lisp to boost::lambda coverter |
| 1272 |
GeniXPro |
<GeniXPro> lambda makes my skin bubble with black spots. Last time i got the lambdas, i had to stay in bed for a week |
| 1273 |
GeniXPro |
<GeniXPro> poor or not, he grabbed me, so i'm gonna file assault on him. |
| 1304 |
GeniXPro |
<GeniXPro> me22 has grabbed me one to many times, but when i called the police, they just grabbed me to and started laughing |
| 1310 |
GeniXPro |
<GeniXPro> Comparitivly, only 2.8% of grabs have the word "c++" in them. It seems like people like grabbing about grabbing more than they grab about c++. |
| 1344 |
GeniXPro |
<GeniXPro> egnlsih is to perl as finish is to python |
| 1346 |
GeniXPro |
<GeniXPro> QMario, i need a job |
| 1347 |
GeniXPro |
<GeniXPro> I sue you, you sue me, lets make everytne ha-a-py |
| 1412 |
GeniXPro |
<GeniXPro> I know you would like that blank, but the rest of us see stripping for old men as a joke rather than a nightly activity |
| 1419 |
GeniXPro |
<GeniXPro> QMario, remember the wonkas |
| 1465 |
GeniXPro |
<GeniXPro> hey i'm not gay *yet* |
| 1610 |
GeniXPro |
<GeniXPro> Penguin___, you made a useless grab |
| 1684 |
GeniXPro |
<GeniXPro> ps3 is gonna be soooooooo powerfull people are gonna run xbox360 emulators on it |
| 1768 |
GeniXPro |
<GeniXPro> who gives a shit when you have Lakota herbel tratments |
| 1771 |
GeniXPro |
<GeniXPro> joshcryer, its ridiculassly simple |
| 1788 |
GeniXPro |
<GeniXPro> GIAHRA Is A Homemade Recursive Acronym |
| 2000 |
GeniXPro |
<GeniXPro> Peregrine, i'm making sense! |
| 2001 |
GeniXPro |
<GeniXPro> get over here and let me prove you otherwise bitch |
| 2003 |
GeniXPro |
<GeniXPro> Money, poke me in the *** |
| 2005 |
GeniXPro |
<GeniXPro> Noldo, so if we replicate our own mind, we should be able to solve the halting problem |
| 2012 |
GeniXPro |
<GeniXPro> I know allot of people who would kill to see me dead |
| 2357 |
GeniXPro |
<GeniXPro> pundai, don't be homophobic, take it in the arse |
| 1228 |
Gentle |
<Gentle> if the world was unix, somebody should disallow Mr. Bush's account to rais "killall -9 arab" |
| 1261 |
Gentle |
<Gentle> in the early 80s it was quite common to release ASM code in printed form :) |
| 1462 |
Gentle |
<Gentle> blank, be gentle to the trouts, they don't deserve to hit all those people's heads all the time |
| 3467 |
Germanaz0 |
<Germanaz0> the users in this channel are very poor |
| 3468 |
Germanaz0 |
<Germanaz0> .. |
| 1947 |
GghaseM |
<GghaseM> So C++ has no fast learnining path to it |
| 1950 |
GghaseM |
<GghaseM> no I do't mean masturbatng dude |
| 4368 |
GhostlyDeath |
<GhostlyDeath> I don't use an emulator |
| 4553 |
GhostlyDeath |
<GhostlyDeath> See MS owns Mac: http://www.microsoft.com/mac/ |
| 5123 |
GhostlyDeath |
<GhostlyDeath> I kept getting a copy constructor is private but then I made it a pointer and now it works |
| 1756 |
Ghosty |
<Ghosty> lol at porn selection..... i dont think its worth backing up porn these days..... its all over the place |
| 1779 |
Ghosty |
<Ghosty> ok to paste something, i just tryed to read up on XOR and its like F**king rocket science |
| 8131 |
Ginto8 |
<Ginto8> !rq edoceo` |
| 2446 |
GirlPower30 |
<GirlPower30> my daddy put it there |
| 6059 |
Gizmore |
<Gizmore> a good strategy against bugs is good code |
| 1111 |
Gliptic |
<Gliptic> max word length on IRC is eight letters, so we must say Micros~1 |
| 1702 |
Gliptic |
<Gliptic> stop with the lame grabs! |
| 1853 |
Gliptic |
<Gliptic> GCC knows |
| 1945 |
Gliptic |
<Gliptic> Brad, stop it |
| 1967 |
Gliptic |
<Gliptic> phrakture, purple monkey dishwasher |
| 2187 |
Gliptic |
<Gliptic> Vampir, C++ coders also use shoes, can I ask about shoes here? |
| 2191 |
Gliptic |
<Gliptic> raf256`, please, your quota of bad grabs ran out after 10 minutes |
| 2299 |
Gliptic |
<Gliptic> we should all have | in our nicks so that raf256 can't grab stuff |
| 2418 |
Gliptic |
<Gliptic> can we ban raf256 from using !grab |
| 2451 |
Gliptic |
<Gliptic> I'm turning into orbitz |
| 2518 |
Gliptic |
<Gliptic> linux__alien, I'm wrong |
| 2561 |
Gliptic |
<Gliptic> or wait, it does |
| 2792 |
Gliptic |
<Gliptic> adding 1 adds 1 |
| 2947 |
Gliptic |
<Gliptic> NIH is reinventing the wheel for the only reason that you didn't make it yourself |
| 4294 |
Gliptic |
<Gliptic> Metabol, stroustrup is wrong |
| 4566 |
Gliptic |
<Gliptic> if you cut down on your "lol"s, you could have time to insert those few characters you save by writing retarded aolisms |
| 4608 |
Gliptic |
<Gliptic> "+" is a LITERAL STRING |
| 4646 |
Gliptic |
<Gliptic> we need twolinegrab |
| 4951 |
Gliptic |
<Gliptic> but really, the quote db needs some good quotes, obey Adrinael! |
| 5173 |
Gliptic |
<Gliptic> I can sizeof fucking anything |
| 5191 |
Gliptic |
<Gliptic> PlasmaHH, so it's not really machine code |
| 6595 |
Gliptic |
<Gliptic> on Adrinael's toaster, I think pointers are represented as (address^e (mod n)) for some unknown, large, two factor integer n |
| 2100 |
Gliptic__ |
<Gliptic__> the only way to guarantee that it will be created is to actually create it |
| 6157 |
GlossyBRDF |
<GlossyBRDF> vawjrwr: im converting a lot of code from using variables to using pointers, thanks to a late discovery |
| 3943 |
Godot |
<Godot> I want to make absolutely sure that I can thwart the pirates with my serial keys. |
| 4651 |
Goezzi |
<Goezzi> because std:string is so bloat? |
| 4653 |
Goezzi |
<Goezzi> what is that !grab? |
| 4843 |
Goezzi |
<Goezzi> ah, the country where all sociall life is coordinated by mobile phone |
| 5238 |
Goezzi |
<Goezzi> only rape people if you know on fore hand you can get away with it |
| 2031 |
Goflo |
<Goflo> Is GNU Pascal a good C++ compiler? |
| 5379 |
Golfgeo|Coding |
<Golfgeo|Coding> :-P |
| 5712 |
GomoX |
<GomoX> I can't return a reference because C++ won't let me |
| 4328 |
Gonzo |
<Gonzo> opengl = C.... boost = uber crack pot superman volta C++ |
| 7052 |
GoodFella |
<GoodFella> anyone know how to make a dynamic array class? |
| 8051 |
Gracenotes |
<Gracenotes> no reason :o |
| 6197 |
Graduation |
<Graduation> Sapient: if I know how to user C very well, does that's mean I don't need Assymply at all ? |
| 3152 |
Greenphone |
<Greenphone> take that, integrate it into a new copy of Windows and voila, Windows Toilet Edition! |
| 274 |
Grey |
<Grey> I'm just an idiot on IRC, |
| 4121 |
Grifer |
<Grifer> what exactly does feks 'include std::endl;', I need to use those and iostream without .h, else gcc gives a warning |
| 318 |
Guest62767 |
<Guest62767> shut up if u dont know the answer |
| 1509 |
Guest63490 |
<Guest63490> can somebody help me? big paypal cash reward |
| 7816 |
Guest8411 |
<Guest8411> auto int userInt; for example? |
| 292 |
GyrosGeier |
* GyrosGeier wonders whether you need special software to quit IRC |
| 2795 |
GyrosGeier |
<GyrosGeier> [入力] 作成するコントロールを識別する文字列。CLSID、ProgID、URL または生の HTML を指定できます。CLSID を指定する場合は、中かっこ ({}) で囲みます。生の HTML を指定する場合は、先頭に MSHTML: を付けます。 |
| 3308 |
GyrosGeier |
<GyrosGeier> crazy_pete, so I'm tainted |
| 3583 |
GyrosGeier |
* GyrosGeier has a WLAN with a weak WEP key that shows goatse |
| 3756 |
GyrosGeier |
<GyrosGeier> my iterators always ask the iterators from the STL that they enslaved to do the dirty work |
| 3797 |
GyrosGeier |
<GyrosGeier> Inside, you haven't seen arrays of function pointers returning arrays of function pointers then |
| 3875 |
GyrosGeier |
<GyrosGeier> EArmbrust, there is the right 10%, the wrong 10%, and goatse |
| 3926 |
GyrosGeier |
<GyrosGeier> When I have no idea at all, I go to the toilet and take a dump. If the problem is still unsolved after that, it cannot be done. |
| 3951 |
GyrosGeier |
<GyrosGeier> I do not have whitespace issues |
| 4047 |
GyrosGeier |
<GyrosGeier> smells like what I just did, only a few times more insane |
| 6049 |
HM |
<HM> do { irc(); eat(); code(); sleep(); } while (girl.not_dead_yet()) |
| 6051 |
HM |
<HM> what the hell is a grab? |
| 6052 |
HM |
<HM> sorry |
| 2403 |
HS^ |
<HS^> well why use a std::string when you have a array of chars? |
| 2404 |
HS^ |
<HS^> deallocation.. ? thats something c++ invented |
| 176 |
HansZ |
<HansZ> you guys are bot addicted |
| 3992 |
HarryR |
<HarryR> All I'm trying to do is apply concepts from Java and PHP that I've used to C++ |
| 3993 |
HarryR |
<HarryR> but it's like psychology, you're not really talking to the psychologist, but talking to yourself :) |
| 1963 |
HeliosTech |
<HeliosTech> it's 100% C C++ |
| 1689 |
Hhhhh |
<Hhhhh> and offering his anus |
| 7148 |
HideousNashimoto |
<HideousNashimoto> A million threads, is it done like this? for(int i=0;i<10000000;i++) createThread(); ?? |
| 7654 |
HideousNashimoto |
<HideousNashimoto> HELLO, HOW TO convert int to char* IT IS EMERGENCY |
| 291 |
Hipo |
<Hipo> Yeah, debuggers are for people who can't code. |
| 3602 |
Hotmog |
<Hotmog> me and 3 other kids started... spice boys :( |
| 6818 |
Hydrant |
<Hydrant> sqrt(3) is irrational |
| 7232 |
Hydrant |
<Hydrant> the more people I meet who use VB, the more I wish there was an asteroid headed for the earth |
| 7233 |
Hydrant |
<Hydrant> This reminds me of the company some time back that was advertising nuclear proof computer equipment for some sort of thing that could survive a nuclear blast... you gotta wonder who would care after that |
| 5572 |
Hyphenex |
<Hyphenex> Ste|Juice: if I move it to public, I get this Football.h:27: error: ?int Person::salary? is inaccessible |
| 5064 |
ICQnumber |
<ICQnumber> how fast is this geordi? looks like it is damn faster then my box... |
| 2560 |
IHK |
<IHK> nice, 2 warnings, i uncomment #include "Vector.h" and i get 29 errors :D |
| 4114 |
IceKnight |
<IceKnight> blank, cause you never throw your opinions about linux, if you did, you would gt trashed no matter how much you prove your opinion |
| 8386 |
IgnisInCaelum |
<IgnisInCaelum> 'Gettin bashed by fow |
| 5684 |
Imnotabot |
<Imnotabot> stfu u need C++ for faggots nobody cares sohail |
| 5685 |
Imnotabot |
<Imnotabot> C++ doesnt take more than 6 months to learn lol |
| 1026 |
Inside |
<Inside> You shall no longer use "undefined behaviour" but rather "awesome functionality" |
| 1050 |
Inside |
<Inside> *squeak* *squeak* *squeak* *squeak* *squeak* *squeak* *squeak* *squeak* *squeak* |
| 1379 |
Inside |
<Inside> Is there a function for uh.. negating a value ( pos to neg, neg to pos)? I don't see one in cmath, I know it won't be hard to add, but I'd rather not rewrite code, ya know |
| 1380 |
Inside |
<Inside> Oh yes, I've been naughty! |
| 1763 |
Inside |
<Inside> freenode.net/c++, the internet's biggest sausage party. |
| 1769 |
Inside |
<Inside> I only have gay quotes >_> |
| 1795 |
Inside |
<Inside> Smack your teacher over the head if they insist that they're teaching you c++ but you're including .h files and having you do funky useless pointer arithmetic |
| 3054 |
Inside |
<Inside> Hahaha =_= another inside joke. |
| 3071 |
Inside |
<Inside> lol open sores >_> |
| 3082 |
Inside |
<Inside> Jesus fucking christ, I swear to god that no matter what pwned says, someone will !grab it. He could say "omg, the sky is blue!" and people'd be like "ZOMG !grab pwned" and then someone will quietly masturbate in a PM to nolyc while looking through the trivial things that pwned says. |
| 3084 |
Inside |
<Inside> Although that would've been funny to have two "I have gay quotes" quotes. |
| 3171 |
Inside |
<Inside> touch_my.penis |
| 3217 |
Inside |
<Inside> "Mother error: Attempting to access private bits of Daughter" |
| 3220 |
Inside |
<Inside> We were just sexually molested by pointers as little children. |
| 3266 |
Inside |
<Inside> Oooh.. you can use emu fat as lube.. |
| 3361 |
Inside |
<Inside> bronaugh: If you're alluding to being a woman, please stop. Everyone knows that there are no women on the internet. |
| 3378 |
Inside |
<Inside> And the neighbors would complain if I stuck my butt out the window and squeezed one out. |
| 3449 |
Inside |
<Inside> I cry when I code ;( |
| 3453 |
Inside |
<Inside> Having a small penis is actually a good thing -- you can stick it in far more places than a larger penis. |
| 3556 |
Inside |
<Inside> blackelf: Actually no, I don't remmember doing anything along the lines of unary operators in gradeschool 0_o. |
| 3570 |
Inside |
<Inside> No idea why it was sticking upright and.. lubricated. |
| 3577 |
Inside |
<Inside> what's what a quote? |
| 3658 |
Inside |
<Inside> __asm { /* some incredibly inefficient inline asm goes here */ } |
| 3735 |
Inside |
<Inside> instead of doing it in chat |
| 3741 |
Inside |
* Inside is made of utter failure. |
| 3794 |
Inside |
<Inside> nullity!! |
| 3796 |
Inside |
<Inside> "During a blue moon during a typhoon in the third month of the fourth year of the seventeenth reigning japanese emperor this function may return -1. Make sure to check this return value." |
| 3809 |
Inside |
<Inside> nobody can top raf256, that's true. |
| 4174 |
Inside |
<Inside> anusol ftw |
| 4223 |
Inside |
<Inside> You're helping the video game industry move towards brighter and more distant goals. |
| 4352 |
Inside |
<Inside> Gay is the new straight, duh. |
| 4353 |
Inside |
<Inside> Kind of a running competition between the two of us who can sleep with the most people. |
| 4361 |
Inside |
<Inside> lars-: If you're trying to out idiot us, you're failing. |
| 4549 |
Inside |
<Inside> Long time no fuck |
| 4901 |
Inside |
<Inside> The initializtor list? |
| 4954 |
Inside |
<Inside> arafangion_: I dunno, my handjob side business never really did take off |
| 4977 |
Inside |
<Inside> Everytime you buy a standard (actually, 10 of them) one of the standards writers receives a check to buy one prostitute and lots of beer. This helps the standard writer to work for 3 or 4 more days on the standard. |
| 5426 |
Inside |
<Inside> Indeed, listen to inside, he is a fountain of information that sounds right but is slightly wrong leading to hours of playing LET'S FIND THE ERROR |
| 6135 |
Inside |
<Inside> She's such a slot |
| 6244 |
Inside |
<Inside> that and I forgot how to modify my client to not connect here anymore. |
| 6254 |
Inside |
* Inside gnaws on his spleen. |
| 7018 |
Inside |
<Inside> what if I want to create a free app but don't want my code to be released? |
| 7019 |
Inside |
<Inside> Your definition of free is different from mine. |
| 7535 |
Inside |
<Inside> They have the best autistic savants working on compilers and chip design. |
| 7651 |
Inside |
<Inside> You get one free dumb question per some intermediate time interval, the next you get yelled at. |
| 7662 |
Inside |
<Inside> C++ is the end-all be-all of languages. |
| 7768 |
Inside |
<Inside> where is my cyberpunk future of massive global networks running on abandoned mainframes and so on? |
| 8296 |
Intreq |
<Intreq> thanks for the hel guys |
| 7215 |
Ir0nMan |
<Ir0nMan> you said winfag first |
| 7516 |
Iradieh |
<Iradieh> please stop spamming the channel godling |
| 7133 |
Iris |
<Iris> Sucking is not always a bad thing. |
| 7243 |
Iris^ |
<Iris^> Then you're like umm not getting warmed up enough during foreplay. |
| 7246 |
Iris^ |
<Iris^> I better be careful what I say here. |
| 7249 |
Iris^ |
<Iris^> blank, someone I know made an interesting comment about me. The difference between most girls on the internet and me is that most girls would pull a hot looking pic off the internet and claim that it's them, but I pull a pic off the internet and tell people this is what I look like but I don't claim the pic to be me. |
| 7257 |
Iris^ |
<Iris^> I do not smoke, drink, do drugs, or have sex. |
| 7293 |
Iris^ |
<Iris^> I'm looking for the bodystocking that Britney Spears wore in her Toxic video. |
| 4947 |
JCD_ |
<JCD_> if you noob then i who?? oO |
| 6630 |
JDuke128 |
<JDuke128> hi , i want to dedect , computer is not being used person is afk not watching video or moving mouse and keyboard |
| 6642 |
JDuke128 |
<JDuke128> hi , i ve heard about , i can make hosting just by using satellite antenna , is it right ? |
| 7247 |
JORDIGH |
<JORDIGH> BLANK: I HEAR THAT TOO MUCH LUBE IS A PROBLEM WITH OLDER WOMEN, BUT I'VE NEVER BEEN WITH ANYONE OVER 45. |
| 7364 |
JaJA_9_6_1995 |
<JaJA_9_6_1995> Shut up I will fry you in C# |
| 7365 |
JaJA_9_6_1995 |
<JaJA_9_6_1995> !renualt |
| 3693 |
Jabka |
<Jabka> what will be faster to call a func from header file like CTIME and math or to recreate the func localy in my file ? |
| 2749 |
JacNet |
<JacNet> nolyc: Oooh. |
| 562 |
Jacco |
<Jacco> :O.str() |
| 614 |
Jacco |
<Jacco> How do I make programs not segfault? |
| 3307 |
Jafet |
<Jafet> we'll all be using brainfuck in 10 years, mind you, be prepared... |
| 3514 |
Jafet |
<Jafet> You need to enter the scope explicitly, declare it and walk out like the Queen of England. |
| 3525 |
Jafet |
<Jafet> If Wikipedia is lucid, you'd better stay away from 4chan. |
| 3562 |
Jafet |
<Jafet> This guy is so grabbable! |
| 3567 |
Jafet |
<Jafet> binary_find will also do a Google search, look in your closet and ask Adrinael. |
| 3574 |
Jafet |
<Jafet> Python is just a really leet calculator that happens to ship with it's own programming language. |
| 3595 |
Jafet |
<Jafet> I take three blue pills every day, after meals. Using a spoon, which exists. |
| 3617 |
Jafet |
<Jafet> Sunday morning grabfest!!! |
| 3643 |
Jafet |
<Jafet> I wonder when the ops will unban me. I hope they haven't forgotten, like the op in #math did. |
| 3806 |
Jafet |
<Jafet> raf256: Either you're a genius or you're stupid. |
| 3848 |
Jafet |
<Jafet> Well, it's liks masturbating. You can't get there all at once... |
| 3940 |
Jafet |
<Jafet> ben: ##C++ is not visual. We program in raw, unadorned, inscrutable code. |
| 4006 |
Jafet |
<Jafet> Interestingly, Win XP shows the "Preparing to hibernate..." screen when waking up. |
| 4007 |
Jafet |
<Jafet> If you're doing low-level brain-mangling legacy hacking, you could have some Perl Grey, it's really potent. |
| 4011 |
Jafet |
<Jafet> Neither can I hack into your boxen to see what your codii and errata are. |
| 4012 |
Jafet |
<Jafet> Let your fingers glide over the keyboard... |
| 4104 |
Jafet |
<Jafet> Like five AOLers on New Age Buzzword antisteroids. |
| 4158 |
Jafet |
<Jafet> I don't eat icecream. |
| 4185 |
Jafet |
<Jafet> "Ubuntu is an African word for 'I can't configure BSD!'" |
| 4194 |
Jafet |
<Jafet> !lart Kaedenn for saving the C++ world |
| 4198 |
Jafet |
<Jafet> Damn I need to get better grabs so the chances that people will spot the lame ones approaches zero. |
| 4227 |
Jafet |
<Jafet> Be different: comform. |
| 4241 |
Jafet |
<Jafet> JNI is 99% excruciating pain, 0.9% dark evil and 0.1% Javanese coffee. |
| 4267 |
Jafet |
<Jafet> You can use my fifth amendment too, I don't need it at the moment. |
| 4339 |
Jafet |
<Jafet> Cheating is boring unles you can make money from it. |
| 4340 |
Jafet |
<Jafet> If you wanted to grab me you could have just asked... |
| 4367 |
Jafet |
<Jafet> Yay, I can get wxWidgets to do what I want in my head. Now to move it to real life... |
| 4702 |
Jafet |
<Jafet> <Aardwolf> Java is like C++ on coffee |
| 4708 |
Jafet |
<Jafet> The Ignobel should give their own peace prize to Al just to piss him off. |
| 4746 |
Jafet |
* Jafet larts scaryAardvark |
| 4754 |
Jafet |
<Jafet> The way to eternal happiness is a copy of the C++0x Standard, opened to the table of contents, pressed firmly and warmly against one's manboobs. |
| 4756 |
Jafet |
<Jafet> Stroustrup touched me in places no one else has touched me before. |
| 4803 |
Jafet |
<Jafet> Wow, three consecutive orbitz lines spelled flawlessly. |
| 4811 |
Jafet |
<Jafet> If a philosopher joined the mafia, would he make you an offer you couldn't understand? |
| 4844 |
Jafet |
<Jafet> double does cop with very small and very large numbers. |
| 4908 |
Jafet |
<Jafet> Say that again so we can grab it. |
| 4927 |
Jafet |
<Jafet> Goezzi, ever heard your fart echo before? Not that that's ontopic either, but... |
| 5019 |
Jafet |
<Jafet> raylistic, well, good fucking luck. http://norvig.com/21-days.html |
| 5034 |
Jafet |
* Jafet hits Kaedenn with a nonstandard, half-patented, ISO-endorsed open standard Microsoft cluebat |
| 5035 |
Jafet |
<Jafet> A design pattern is a hack around a misfeature of the language. |
| 5036 |
Jafet |
<Jafet> s/trick/design pattern/ |
| 5039 |
Jafet |
<Jafet> Firefox doesn't leak! It... um... caches stuff! In memory! |
| 5162 |
Jafet |
<Jafet> Still, which programmer doesn't like to be worshipped for shipping a late, buggy, featureless product to hungry adolescent groupies. |
| 5212 |
Jafet |
<Jafet> Real men don't learn. Real men know. |
| 5218 |
Jafet |
<Jafet> With the advent of CSS, you don't have to. Just steal someone else'e design. |
| 5241 |
Jafet |
<Jafet> absentia: If you can solve it in Lisp, you can solve it in C++ and keep your job. |
| 5286 |
Jafet |
<Jafet> Massively Moronic Online Recreation for Primitive Gratification |
| 5321 |
Jafet |
<Jafet> Python is for gay men. |
| 5644 |
Jafet |
* Jafet eats a phallic piece of shortbread |
| 5717 |
Jafet |
<Jafet> s/k/ks/ |
| 6081 |
Jafet |
<Jafet> "When you look at a line of code and say 'I don't like this', that's a bug. When you look at a line of code and say 'What the fuck is this', that's a defect." |
| 6090 |
Jafet |
<Jafet> GO - Go Online. |
| 6143 |
Jafet |
<Jafet> evelyette, if the standard doesn't forbid compilers from inserting satanic messages into your object code, your compiler is allowed to do it. |
| 6190 |
Jafet |
<Jafet> I don't know how I'd pronounce "!". It's supposed to be the Windows alert thunking sound. |
| 6201 |
Jafet |
<Jafet> Bleh, 0x should just include Boost.python; half its problems would be solved. |
| 6264 |
Jafet |
<Jafet> That's a good idea. You could even invest in yourself. |
| 6265 |
Jafet |
<Jafet> Fuck you, Google. |
| 6272 |
Jafet |
<Jafet> Heh, ⚧ Unicode 26A7;MALE WITH STROKE AND MALE AND FEMALE SIGN;So;0;ON;;;;;N;;;;; |
| 6287 |
Jafet |
<Jafet> Hentai: Slimy, vivid tentacles crawling over you, sucking your sweat-shiny breasts, feeling around inside your drooling mouth, contorting your bound limbs, wrapped around your torso, reaching for your ready... hey! Why is it pixelated?! |
| 6288 |
Jafet |
<Jafet> Underhanded or obfuscated? |
| 6311 |
Jafet |
<Jafet> 70% of all statistics can be made to say 80% of things with 90% certainty 100% of the time. |
| 6343 |
Jafet |
* Jafet runs from miles33_'s fucking |
| 6344 |
Jafet |
<Jafet> litb, fail. |
| 6363 |
Jafet |
<Jafet> xystic must be the most normal person in this channel. |
| 6364 |
Jafet |
<Jafet> xystic must be the most normal person in this channel. |
| 6367 |
Jafet |
<Jafet> Mmm pederasty. |
| 6379 |
Jafet |
<Jafet> Jessicatz, you'll have to have the surgery all over again though! |
| 6395 |
Jafet |
<Jafet> When I become a respected C++ guru and write an introductory book I will call it "C Plus Plus tutorial for Numbskulls in 42 Minutes with g++", just to piss you all off. |
| 6418 |
Jafet |
<Jafet> !c-philosophy is <reply> The C way is to stop whining and just do whatever works. |
| 6425 |
Jafet |
<Jafet> !rq mazzachre |
| 6426 |
Jafet |
<Jafet> innocent from now on! |
| 6437 |
Jafet |
<Jafet> K&R 1 and 2 are about as different as the two Testaments... |
| 6513 |
Jafet |
<Jafet> Remember that the second "O" stands for "oriented" not "obsessed"... |
| 6514 |
Jafet |
<Jafet> I recommend veiset stays away from X11 hacking until he has defeated the fifth boss and advanced his Beard to level 3. |
| 6515 |
Jafet |
<Jafet> painy, because screens are programmed in Java. |
| 6517 |
Jafet |
<Jafet> C++ is about as powerful as a sledgehammer with a loose head. |
| 6577 |
Jafet |
<Jafet> I come to IRC to watch godling call people retards. |
| 6763 |
Jafet |
<Jafet> Real game developers write games in vim with OpenGL. |
| 6864 |
Jafet |
<Jafet> Platform-independent is like wearing a kilt. Cross-platform is like a guy wearing a bra with a golf club printed on it. |
| 6907 |
Jafet |
<Jafet> StarCraft is only stressful if you're aiming to win. |
| 6955 |
Jafet |
<Jafet> Try Myspace if you want to make friends. |
| 7064 |
Jafet |
<Jafet> And... you like C++ because it's an even more fucked up language...? |
| 7267 |
Jafet |
<Jafet> It exists if you want it to! |
| 7488 |
Jafet |
<Jafet> Sometimes I wish I paid Linux distro developers for their work, so that I could fire them. |
| 7645 |
Jafet |
<Jafet> CAN I HAVE PIC OF YOU SO I CAN SEE WHAT YOUR EYES LOOK LIKE |
| 7709 |
Jafet |
<Jafet> But Eelis is the weird haskell guy so he doesn't count |
| 7912 |
Jafet |
<Jafet> Haskell wraps your brain around YOU!! |
| 7922 |
Jafet |
<Jafet> Grabbable grab shields, who knew |
| 7945 |
Jafet |
<Jafet> I'd use M-x butterfly, but emacs can be such a bother to set up |
| 8004 |
Jafet |
<Jafet> mereandor, don't use exceptions. Your design is probably wrong. Exceptions are for exceptional circumstances, not for collecting and preserving in vinegar |
| 8012 |
Jafet |
<Jafet> In 3000 years we will all be running in digital mazes powered by biotechnological computers carved from sentient trees |
| 8088 |
Jafet |
<Jafet> I suck cocks |
| 8114 |
Jafet |
<Jafet> I herd u liek pointers so I accidentally a pointer to ur pointer so u can point while u point |
| 8192 |
Jafet |
<Jafet> extern "Java" { |
| 8231 |
Jafet |
<Jafet> Normally I'd grab that on sight |
| 8269 |
Jafet |
<Jafet> HAY GAYS IMMA BACK |
| 7024 |
Jafet1 |
<Jafet1> The problem with good testcases is that people competent enough to make them don't ever need to. |
| 5082 |
JakeConnor |
<JakeConnor> Tu13es: i learned c++ yesterday from the tutorials on cpluscplus.com :) |
| 3088 |
Jakku |
<Jakku> im using a tutorial off google. |
| 4810 |
JamieT |
<JamieT> Is there anyone here that would be willing to tutor me for $20 (or more, its negotable) per hour for help with a programming assignment.. I am using a small application called visual logic.. the prograaming assignment is supposed to be pretty easy |
| 6729 |
JangoSan |
<JangoSan> its been 10 years since I last touched c++, but please dont ignore me |
| 6754 |
JangoSan |
<JangoSan> If you want it portable use Java |
| 7612 |
Javafet |
<Javafet> Sense not made! |
| 1697 |
Jayinwww |
<Jayinwww> why not sexialzation ? |
| 2131 |
Jayinwww |
<Jayinwww> I had hosting with this company who had no idea what they were doing so I freaked out of them for 5 days straght until they actually fixed everything, they asked me if I needed anything else, and I said 'how about a ****job' they canceled my account the next hour, ahhhh good times |
| 1099 |
Jaywalker |
<Jaywalker> lol, wow... atleast you guys aren't as bad as ##php |
| 4885 |
Jessicats |
<Jessicats> I got spellcorrected |
| 2836 |
Jessicatz |
<Jessicatz> grabbing him? pervert. |
| 2920 |
Jessicatz |
<Jessicatz> did you know that its dangerous to milk someone elses bull? |
| 2939 |
Jessicatz |
<Jessicatz> c++0x will have a section about WoW plugins. I bet. |
| 2949 |
Jessicatz |
<Jessicatz> deadchip is in your code? |
| 3002 |
Jessicatz |
<Jessicatz> I'm spelled with a leetic z |
| 3008 |
Jessicatz |
<Jessicatz> if raf256 were klingon I could detect him by sniffing on his "engine exhaust" |
| 3021 |
Jessicatz |
<Jessicatz> insults against russians and hermaphrodites. good day for my russian tg friends... |
| 3063 |
Jessicatz |
<Jessicatz> :( |
| 3072 |
Jessicatz |
<Jessicatz> yea really, its everyday-like that things catch fire out of the blue |
| 3216 |
Jessicatz |
<Jessicatz> is there such thing as a linux p0rn distro? |
| 3444 |
Jessicatz |
<Jessicatz> or what does "no fuck" refer to |
| 3446 |
Jessicatz |
<Jessicatz> I feel I need to write something on myspace |
| 3557 |
Jessicatz |
<Jessicatz> no, nothing serious. I write only mmorpgs. with make_mmorpg() |
| 3564 |
Jessicatz |
<Jessicatz> developers, developers, developers, developers! |
| 3575 |
Jessicatz |
<Jessicatz> a shell is also a gui |
| 3679 |
Jessicatz |
<Jessicatz> raf256: you said manboosts |
| 3747 |
Jessicatz |
<Jessicatz> even my dad can use linux |
| 3803 |
Jessicatz |
<Jessicatz> I could fuck you in the ass if that's what you mean |
| 3827 |
Jessicatz |
<Jessicatz> qamar I fooled you :P |
| 3865 |
Jessicatz |
<Jessicatz> you play too much nethack when: you look down both sids of the corridor, start to sweat and then realize you're looking at your email address |
| 3914 |
Jessicatz |
<Jessicatz> any place which is more far away than the distance chair <-> fridge is wasted time |
| 3915 |
Jessicatz |
<Jessicatz> I helped me |
| 4000 |
Jessicatz |
<Jessicatz> BASIC compiler VS C# Compiler = a fight C# cant win |
| 4020 |
Jessicatz |
<Jessicatz> I don't know what cp stands for |
| 4075 |
Jessicatz |
<Jessicatz> jessicatz - the way its meant to be fucked |
| 4176 |
Jessicatz |
<Jessicatz> girls dont irc |
| 4178 |
Jessicatz |
<Jessicatz> lick my shiny metal booty |
| 4200 |
Jessicatz |
<Jessicatz> that's why I'm Jessicatz, and not Jessic++atz |
| 4297 |
Jessicatz |
<Jessicatz> "error: you have a weird ass" |
| 4346 |
Jessicatz |
<Jessicatz> I'm licking the keyboard cable with my tongue to do 1s and 0s, that's MY IDE! |
| 4366 |
Jessicatz |
<Jessicatz> on Adrinaels game pad are only two buttson "(" and ")" |
| 4374 |
Jessicatz |
<Jessicatz> everyone knows toddlers without teeth yet are best |
| 4670 |
Jessicatz |
<Jessicatz> Google - Because we are so fucking rich, we can afford it |
| 4694 |
Jessicatz |
<Jessicatz> geordi: class quantum { bool operator() const { return (int)rand()%2; } }; |
| 4808 |
Jessicatz |
<Jessicatz> mourning department |
| 4842 |
Jessicatz |
<Jessicatz> I think the border between emo and eclipser is thin |
| 4850 |
Jessicatz |
<Jessicatz> when textmode games come into fashion again, my pc will be high-end |
| 4869 |
Jessicatz |
<Jessicatz> you watch too much internet |
| 4915 |
Jessicatz |
<Jessicatz> it means the api fails at succeeding |
| 5059 |
Jessicatz |
<Jessicatz> uglui |
| 5125 |
Jessicatz |
<Jessicatz> I held some balls. |
| 5148 |
Jessicatz |
<Jessicatz> worldly pleasures satisfy me |
| 5180 |
Jessicatz |
<Jessicatz> I won't suck your thing |
| 5181 |
Jessicatz |
<Jessicatz> nigga stole my line |
| 5189 |
Jessicatz |
<Jessicatz> jk idk my ff jill |
| 5227 |
Jessicatz |
<Jessicatz> Bigcheese: I ejaculated |
| 5231 |
Jessicatz |
<Jessicatz> triplie: blank hurts gay little girls' tits with his penis and their anus |
| 5363 |
Jessicatz |
<Jessicatz> miles33: you don't deserve my hate |
| 5415 |
Jessicatz |
<Jessicatz> I made a pun referencing goddamn penises |
| 5419 |
Jessicatz |
<Jessicatz> this channel got fucked |
| 5465 |
Jessicatz |
<Jessicatz> miles33: I feel deep shame |
| 5468 |
Jessicatz |
<Jessicatz> miles33: don't grab such stupid tihngs |
| 5524 |
Jessicatz |
<Jessicatz> we will come when you're 19, so that you're old enough for sex but not old enouhg to have a gun |
| 5589 |
Jessicatz |
<Jessicatz> blank is so old, he has had his midlife crisis twice |
| 5614 |
Jessicatz |
<Jessicatz> paste or gtfo |
| 5869 |
Jessicatz |
<Jessicatz> google is chargin its lazerz |
| 5870 |
Jessicatz |
<Jessicatz> GET IT |
| 5876 |
Jessicatz |
* Jessicatz browses cosplay board on 4chan looking for blank |
| 6409 |
Jessicatz |
<Jessicatz> cockgrab alert |
| 6412 |
Jessicatz |
<Jessicatz> semen! |
| 6419 |
Jessicatz |
<Jessicatz> emacs doesn't need a physics engine! |
| 6424 |
Jessicatz |
<Jessicatz> more reason to grab his ass off |
| 6428 |
Jessicatz |
<Jessicatz> in a manly way. |
| 6925 |
Jessicatz |
<Jessicatz> I think piman should be busy eating me |
| 7016 |
Jessicatz |
<Jessicatz> why would anyone want to know when I get my dick sliced off? |
| 7060 |
Jessicatz |
<Jessicatz> who knows which objects already visited that bitch of a class |
| 7134 |
Jessicatz |
<Jessicatz> some day, Adrinael is going to replace that picture with an actual cock |
| 7363 |
Jessicatz |
<Jessicatz> also, whenever gender is an issue I'm here to bring further confusion |
| 7758 |
Jessicatz |
* Jessicatz mans piman |
| 8068 |
Jessicatz |
<Jessicatz> sometimes I fantasize. |
| 8287 |
Jessicatz |
<Jessicatz> Cecen: I mean like, you can't help but dreaming about menly mens |
| 8346 |
Jessicatz |
<Jessicatz> (why do I feel like a lisp expression) |
| 4601 |
Jessicatz_ |
<Jessicatz_> my unix is online for so long now, it was online even before unix had timestamps |
| 4683 |
Jessicatz_ |
<Jessicatz_> well, a girl gives fanservice to the local geeks here by supplying a naughty topic, and you guys, being all nerdy, need to critizize it |
| 3020 |
JetSnaiL |
<JetSnaiL> Sulo_Seppa, your mother sucks good. Ask her to help you with C++, if you won't unbderstand. |
| 5154 |
Jids |
<Jids> anyone? or can anyone give me a list of all that they know? |
| 195 |
Jimmer |
<Jimmer> wow, i didn't even know there was a try catch in c++ |
| 4449 |
Jimmio |
<Jimmio> I read in a tutorial somewhere that strings exist, is this true? |
| 4609 |
Joanki123 |
<Joanki123> i always thought you were a female, too, litb |
| 3976 |
Joey_ |
<Joey_> I would go with zlib, but I was thinking it might be a security flaw for it being open source. |
| 4029 |
Joey_ |
<Joey_> does iostream inherit stdio and stdlib? |
| 6784 |
John2 |
<John2> char* line2 = const_cast<string>(line); ? that isnt working.. |
| 7576 |
Johnnyho |
<Johnnyho> you guys heard of knuth? my teacher said I couldn't graduate if I didnt know who he was |
| 2964 |
Johnnyzer0 |
<Johnnyzer0> we all know the best english speakers are japanese |
| 7693 |
JonesB |
<JonesB> lol std::carrier |
| 8203 |
Jontte |
<Jontte> lifes not worth living anymore.. OO is java.. soon theyll tell me linux kernel is java |
| 1466 |
Joon-Gun |
* Joon-Gun wonders if the pope will go out and say : Dont have sex, dont use condoms, Learn C++!! |
| 1474 |
Joon-Gun |
<Joon-Gun> Make sex robots not war |
| 3640 |
JordiGH |
<JordiGH> Aww, I thought I was grabbed. |
| 3678 |
JordiGH |
* JordiGH lovingly fondles orbitz's butt in a manly, manly supermacho kinda way. |
| 4399 |
JordiGH |
<JordiGH> We help you in exchange for good karma. |
| 4721 |
JordiGH |
<JordiGH> vector<yermom> moms = [mom1, mom2, mom3]; |
| 4722 |
JordiGH |
<JordiGH> It's like those Megaman dates. In year 20xx, standard was brewing. |
| 5879 |
JordiGH |
<JordiGH> \o/ |
| 5970 |
JordiGH |
<JordiGH> Carbonflux: Are you one of those long-bearded suspender Unix hippies? |
| 6007 |
JordiGH |
* JordiGH licks sexy Jordi's ear. |
| 6084 |
JordiGH |
<JordiGH> nmap is how l33t h4xx0rz like Trinity send their pirate signal into The Matrix. |
| 6211 |
JordiGH |
<JordiGH> xystic: I'm gonna give C++ one last chance to clean up its act... |
| 6845 |
JordiGH |
* JordiGH misses bash.org |
| 6914 |
JordiGH |
<JordiGH> ESphynx: don't lie. I bet you have wet dreams of Ballmer. |
| 6929 |
JordiGH |
<JordiGH> What's the expression? Better one in hand than one in the bush? |
| 6976 |
JordiGH |
<JordiGH> Typoing "cunt" is so much more fun. |
| 7041 |
JordiGH |
<JordiGH> C++ would be an awesome language if it weren't for C. |
| 7170 |
JordiGH |
<JordiGH> Wait, wtf am I defending C++? |
| 7189 |
JordiGH |
<JordiGH> Linux didn't build. |
| 7192 |
JordiGH |
<JordiGH> Like a good Mexican, I'm stealing jobs. |
| 7199 |
JordiGH |
<JordiGH> Right now, I just want silly flash porn games. |
| 7242 |
JordiGH |
<JordiGH> Well, there's still saliva and the mouth. |
| 7248 |
JordiGH |
<JordiGH> Sorry, guys. I seriously can't keep doing this capslock thing. I think my IQ just dipped even lower because of it. |
| 7251 |
JordiGH |
* JordiGH encrypts his homemade pr0n. |
| 7255 |
JordiGH |
<JordiGH> Let's just say I've just been doing stupid things with my penis lately, and I need to pause and reflect for a while about what I should do with it in the future. |
| 7270 |
JordiGH |
<JordiGH> !lart C++ |
| 7301 |
JordiGH |
<JordiGH> LimCore: I'm saying we're penis buddies you and I. |
| 7331 |
JordiGH |
<JordiGH> THIS IS THE WAY GOD INTENDED THINGS TO BE DO NOT TAMPER WITH THE NATURAL ORDER OF THINGS! |
| 7394 |
JordiGH |
<JordiGH> Pancreas are sexy. |
| 7395 |
JordiGH |
<JordiGH> You guys say the stupidest things sometimes. |
| 7408 |
JordiGH |
<JordiGH> You mock our romance because you are jealous, but Iris^ and I are meant to be. |
| 7467 |
JordiGH |
<JordiGH> Qt apps still use heathen keybindings, but I have hope that they too can be converted some day. |
| 7468 |
JordiGH |
<JordiGH> He may have her in body, but I will always keep her essence. |
| 7572 |
JordiGH |
<JordiGH> I want ++, not C. |
| 7602 |
JordiGH |
<JordiGH> I hope this is some good dead baby mathematics we're about to witness. |
| 7606 |
JordiGH |
<JordiGH> Ham Roar. |
| 7633 |
JordiGH |
<JordiGH> WE ARE ALL WALL-E. |
| 7710 |
JordiGH |
<JordiGH> We want to hear what the girls are saying before the tentacle stuffs their mouth! |
| 7715 |
JordiGH |
<JordiGH> Nah, it's the physicists who think that the universe is written in mathematics. Mathematicians are the ones that think that they don't need a universe to do mathematics. :-) |
| 7728 |
JordiGH |
<JordiGH> I wish I had boobs. I'd be unstoppable. I'd swing them from a mace and smite my enemies. |
| 7808 |
JordiGH |
<JordiGH> I suppose tentacles are a subtle and clever metaphor for cocks. |
| 7876 |
JordiGH |
<JordiGH> Here we talk about piracy and boobs but mostly boobs. |
| 8040 |
JordiGH |
<JordiGH> What the hell.. is there no way to put her cootch in an ostream? |
| 8054 |
JordiGH |
* JordiGH has a HUMONGOUS edick. srsly |
| 8059 |
JordiGH |
* JordiGH has infinite respect for cocksuckers. |
| 8112 |
JordiGH |
<JordiGH> 我对您盼望.file.txt |
| 8196 |
JordiGH |
<JordiGH> I don't know my password. It's 25 random printable ascii characters. It's embedded into my muscle memory, and I cannot reproduce it under duress. |
| 8199 |
JordiGH |
* JordiGH humps Quadrescence's GNU/leg. |
| 8243 |
JordiGH |
<JordiGH> What trolling eye could match thy fearful trolletry? |
| 8288 |
JordiGH |
<JordiGH> ##c++ is Disneyland compared to #perl. |
| 8337 |
JordiGH |
<JordiGH> It's got the boss and like four women in there too, doing whatever it is they do. |
| 8345 |
JordiGH |
<JordiGH> Tell us about your huge cock, Formentar. |
| 8377 |
JordiGH |
<JordiGH> I hate myself, obviously. |
| 7638 |
JoshDreamland |
<JoshDreamland> comp sci teaches you how to spend 12 weeks learning java |
| 2691 |
JustinC |
<JustinC> Yeah. I'm not some $2 hooker! |
| 4935 |
K-41 |
<K-41> i know in PHP, you can use [A-Z] or some kind.. is this implemented in C++ also? |
| 7180 |
KAHR-Alpha |
<KAHR-Alpha> it makes me wonder, between an array and a vector, which one takes the most memory? |
| 4146 |
Kaedenn |
<Kaedenn> I start to worry when I write code that compiles fine... |
| 4154 |
Kaedenn |
<Kaedenn> references = omigawd, in my room, right now. |
| 4295 |
Kaedenn |
<Kaedenn> Girls are 1) fun and 2) a waste of time. |
| 4354 |
Kaedenn |
<Kaedenn> hah, I went from "Yakitate!! Japan" to C++, in Wikipedia, but sadly I had to go through sex and Java. |
| 4364 |
Kaedenn |
<Kaedenn> while(); takes up 50% cpu |
| 4394 |
Kaedenn |
<Kaedenn> I truly am an incompetent programmer. |
| 4402 |
Kaedenn |
* Kaedenn has never used a debugger, and still retains his OMGCOMMENTEVERYTHINGUNTILITSTOPSCRASHING THENUNCOMMENTANDFINDOUTWHATCRASHES THENFIXITBYCHANGINGBECAUSEYOUSHOULDKNOWWHAT'SWRONGBYNOW approach for dealing with segfaults. |
| 4447 |
Kaedenn |
<Kaedenn> kk, todo: 1) sleep, 2) wake up and borrow Eelis's brain tomorrow morning, 3) recompile Adrinael's ventromedial hypothalamus, and 4) make sure I don't segfault the universe again |
| 4570 |
Kaedenn |
<Kaedenn> rswarbrick ##c++ is full of sarcasm, insanity, incompetence and ego. the perfect place for me. |
| 4751 |
Kaedenn |
<Kaedenn> gah, running windows on linux on windows and trying to get multi-platform programming done is outright impossible. |
| 4788 |
Kaedenn |
<Kaedenn> Gah. Translating C++ code to Intel assembly is like trying to solve world hunger by chewing bubble gum. |
| 4969 |
Kaedenn |
<Kaedenn> You have reached Overseer of Incompetence Kaedenn A. Neseta, of the Department of Redundancy Department, of Integrated Oxymorons, Unlimited. Please leave your message after the tone. |
| 6556 |
Kaedenn |
<Kaedenn> I encrypted my high school work in a .pgp file, and now I have no idea how to decrypt it. |
| 6879 |
Kaedenn |
<Kaedenn> if Eelis was on the committee, c++0x would be a bit different |
| 2643 |
Kai |
<Kai> I'm not sure about that. Lots of things in C++ are simple. |
| 6558 |
Karpar |
<Karpar> i was done by one of my friends. |
| 5265 |
Kasreyn |
<Kasreyn> maximum name length in a linux 2.6.23.1 using raiser fs seems to be 244. |
| 5110 |
Kasreyn_ |
<Kasreyn_> BSTR = BullshitString ? |
| 7910 |
KazaLite |
<KazaLite> What does the const member function qualifier do? |
| 7057 |
Kazan |
<Kazan> geordi: { string str = "You need to"; str += " read a book"; cout << str; } |
| 7275 |
Kazan |
* Kazan sings "look at my enormous penis" |
| 7436 |
Kazan |
* Kazan is fireproof |
| 301 |
KeZZeR |
<KeZZeR> i'm highly educated, i have a degree in ms paint |
| 7438 |
Kebab_King |
<Kebab_King> / Xzibit: Sup dawg. We heard you like comments, so we put a comment in yo code so you can read while you code. |
| 7553 |
Kebab_King |
<Kebab_King> facebook is the best sexual harassing tool ever |
| 3346 |
Keltus |
<Keltus> there are barely any standard C++ compilers out there |
| 4688 |
Keltus |
<Keltus> winapi is not that much pain |
| 534 |
Ketzu |
<Ketzu> Why is it so friggen hard to give me a link to functors that i've been asking for for like a half hour |
| 917 |
Khelz |
<Khelz> microsoft is the inventor of C++ and HTML |
| 6021 |
Killerfox512 |
<Killerfox512> ? |
| 3674 |
Kinggg |
<Kinggg> THIS CAHNNEL IS FULL OF NEWBIES |
| 530 |
Kira |
<Kira> Join me in my bed of knowledge and let's engage in intellectual intercourse. |
| 531 |
Kira |
<Kira> However, it cannot be compared to Stroustrups or the living C++ encyclopaedia on two legs (aka Adrinael). |
| 550 |
Kira |
<Kira> I have a piece of code that's never run when I don't step through it in debug mode. |
| 5751 |
Kiruwa2 |
<Kiruwa2> nvm... this is the internet |
| 3085 |
Kiryn |
<Kiryn> i perfer apple os over nix anyday |
| 3957 |
Kiryn |
<Kiryn> im so happy to be back on windows :D |
| 4440 |
Kiryn |
<Kiryn> float is imaginary and double is real correct? |
| 7031 |
Kitka1 |
<Kitka1> Guys I want to dump a bunch of utility functions in a "utils.cc/utils.h" file. Can anyone tell me the signature of a typical function in such a file? I assume it'll have static in it |
| 4175 |
Kjelle |
<Kjelle> oooh. i did it! it works! deciphered a javascriptscramblet trojan code in C++ (as an ubernoob i am proud) |
| 3292 |
Kludgy |
<Kludgy> surgy: AnthonyG has it right! :) |
| 7874 |
Kniht |
<Kniht> trying to write java in c++ is just org::example::utility::exceptions::Failure::Hard |
| 7880 |
Kniht |
<Kniht> honestly, "plz halp me compile so can crack friendz" would've been a better start |
| 7903 |
Kniht |
<Kniht> I'm not gay |
| 7905 |
Kniht |
<Kniht> generic: "pointers" is how von neumann spells "pain" |
| 7913 |
Kniht |
<Kniht> Eddic: what do you mean? friends? |
| 8250 |
Kniht |
<Kniht> nikki93: it's better to have everyone think you might be an idiot than to open your mouth and prove it |
| 8311 |
Kniht |
<Kniht> Miesco_: you really think the needs of some random guy you met online will match up with yours? |
| 8186 |
Koper |
<Koper> Well then you have alzheimer's |
| 8204 |
Koper |
<Koper> Let's pretend I'm 5 |
| 8224 |
Koper |
<Koper> lol.. If you say "malformed" I imagine the poor variable with 3 eyes and only 1 leg :/ |
| 5167 |
Kornholijo |
<Kornholijo> !badaol Bigcheese |
| 6534 |
KucukMubasir |
<KucukMubasir> templates, types and using decleration ville |
| 7773 |
KucukMubasir |
<KucukMubasir> guys, how do you keep up with the chat's messages? Do you read them periodically [ e.g every 2 hours], or do you keep a log and read those when you have a free time, or You don't even read all of the messages? What is your method , I know this sounds absurt... |
| 8354 |
KukMan |
<KukMan> I have many numbers of color, can I create picture from them? |
| 447 |
KungFu |
<KungFu> VB is junk |
| 4900 |
Kuryn |
<Kuryn> back to my windows programming |
| 8053 |
L-Spiro |
<L-Spiro> ##C++-Social: New low not reached in over 20 minutes! |
| 6 |
LIM |
<LIM> Once I was hidding in the reeds along the shore of a river during the day. Some indians started floating by in skin boats. I felt I had to take them out from my hiding spot. so I started flinging 3.5" floppies at them. |
| 29 |
LIM |
<LIM> but I like to be an hour past obvious |
| 36 |
LIM |
<LIM> prop|fan: you're a genius at being an idiot |
| 38 |
LIM |
<LIM> you are saying what I'm saying. however you are confused. |
| 55 |
LIM |
<LIM> D is a vampire hunting programing language |
| 62 |
LIM |
<LIM> :( |
| 196 |
LIM |
<LIM> gnu is such a slut |
| 210 |
LIM |
<LIM> ¥€§! haha |
| 218 |
LIM |
<LIM> I'm a LIMited edition of myself |
| 233 |
LIM |
<LIM> I'm not actually a student, but I play one on TV |
| 234 |
LIM |
<LIM> I'm not actually a doctor, but if I was four out of five of me would prescribe Marajuana to people who ask if they can ask a question in ##c++. |
| 308 |
LIM |
<LIM> I type oh shit^H^H^H^H I fucked up^H^H^H^H^H^H^H^H^H need to fix this shit^H^H^H^H. |
| 432 |
LIM |
<LIM> there's nothing more on topic than c++ coders talking about women |
| 435 |
LIM |
<LIM> I was a teenage pancake |
| 477 |
LIM |
<LIM> ville: you are a fast learner... but not fast enough hahahaha! |
| 570 |
LIM |
<LIM> AMAZING!! |
| 591 |
LIM |
<LIM> plus I can spell 1337 |
| 596 |
LIM |
<LIM> I'm awaiting the Google Pron search engine |
| 633 |
LIM |
<LIM> starwars is actually a movie about samurais in jamaica on the ganja |
| 637 |
LIM |
<LIM> C++ is not a faith based programming language |
| 673 |
LIM |
<LIM> 4000/8 = 500.00000000000000000000 |
| 760 |
LIM |
<LIM> I never should have washed my cloak and dagger costume. |
| 815 |
LIM |
<LIM> I probably have $50 of worthless coins |
| 821 |
LIM |
<LIM> now it's playboy plamates versus black people. |
| 832 |
LIM |
<LIM> all the all your base are belong to us songs are belong to you |
| 870 |
LIM |
<LIM> cowbell++ |
| 905 |
LIM |
<LIM> you said "WIDNOWS", idiot |
| 940 |
LIM |
<LIM> it can flawlessly generate any random number you give it |
| 1001 |
LIM |
<LIM> <ElmerFudd> it's a twap |
| 1022 |
LIM |
<LIM> if I was a rabbit I would be running towards the female rabbits...screw fighting. |
| 1027 |
LIM |
<LIM> humans: 6,474,752,776 mastodons: 0 |
| 1331 |
LIM |
<LIM> I once was on my brothers shoulders, and he told me a joke and made me laugh, and I sparyed lemonade all over his head from my nose. He was not happy, and neither was I, because lemonade burns! |
| 1364 |
LIM |
<LIM> we'd name this channel ##std but then we'd get all sorts of sickos in here, unlike the sickos we have now... |
| 1404 |
LIM |
<LIM> you can't #define nothing |
| 1480 |
LIM |
<LIM> I am everyman |
| 3958 |
LIM |
<LIM> c++ doesn't have dialog boxes. |
| 4441 |
LIM |
<LIM> quoted from sgi stl docs on map: Note that the definition of operator[] is extremely simple: m[k] is equivalent to (*((m.insert(value_type(k, data_type()))).first)).second. Strictly speaking, this member function is unnecessary: it exists only for convenience. |
| 1435 |
LaEnigma |
<LaEnigma> "I find people that use vectors to much are afraid of change" |
| 1437 |
LaEnigma |
<LaEnigma> Orbitz: where'd that come from? |
| 1438 |
LaEnigma |
* LaEnigma randomly licks orbitz |
| 1453 |
LaEnigma |
<LaEnigma> she's in advertising |
| 7871 |
Lain |
<Lain> any teachers in here? |
| 8384 |
Lain |
<Lain> does C# deprecate C++? |
| 8396 |
Lain |
<Lain> if there is no circuitry that supports boot from usb at POST |
| 6328 |
LamerC |
<LamerC> I may use a factory-based approach instead. |
| 4108 |
Larl |
<Larl> C++Builder is great for companies looking to reduce time to market. |
| 5014 |
Laurent_ |
<Laurent_> but that's the thing, it would be elegant to have i as a singleton |
| 1572 |
LazyMukke |
<LazyMukke> should i uses classes instead of linked lists ? but are they still dnamic ? |
| 4712 |
Lectus |
<Lectus> I learned by learning ASM first. After all it's just syntax. Compile and run until it actually runs! |
| 4764 |
Lede |
<Lede> blank wait, you mean you are not orbitz? |
| 4772 |
Lede |
<Lede> ? |
| 4778 |
Lede |
<Lede> xystic go die in a grease fire |
| 4839 |
Lede |
* Lede lets a horse walk on Eclipser |
| 4940 |
Lede |
<Lede> blank isnt a dick head |
| 4971 |
Lede |
* Lede grabs blank |
| 4990 |
Lede |
<Lede> everyone knows pokeballs run linux |
| 4991 |
Lede |
* Lede ->sleep(typedef<template<float(this->that->this(delete this(delete that<T>))>>); |
| 5000 |
Lede |
<Lede> woh, woh, i go away for a few minutes and this turns into #gaybar |
| 5139 |
Lede |
<Lede> circumcised, pledge something, ???, PROPHET! |
| 5145 |
Lede |
<Lede> or he will just smell very bad |
| 5206 |
Lede |
<Lede> i don't you want to grab that .. |
| 5244 |
Lede |
<Lede> xystic: too bad you got your money back :( |
| 5252 |
Lede |
<Lede> Dr.Carbonflux or: How I Learned to Stop Worrying and Love the Jews |
| 5253 |
Lede |
<Lede> thanks clone |
| 5261 |
Lede |
<Lede> i know what a paper towel is |
| 5269 |
Lede |
<Lede> xystic: go fuck yourself oke? |
| 5270 |
Lede |
<Lede> xystic: asshole |
| 5271 |
Lede |
<Lede> xystic: i think you should just lose your legs in a horrible car accident |
| 5273 |
Lede |
<Lede> xystic: i hope you wake up without legs \o/ |
| 5307 |
Lede |
<Lede> nice grab |
| 5312 |
Lede |
<Lede> i want a pocket size blank |
| 5316 |
Lede |
<Lede> miles33: get of my lawn then! |
| 5355 |
Lede |
<Lede> Carbonflux: why am i evil |
| 5407 |
Lede |
<Lede> !GOOGLE amazon terrorist handbook |
| 5408 |
Lede |
<Lede> it was full moon, i couldnt stop myself |
| 5420 |
Lede |
* Lede is stunned by FauxFaux's words |
| 5444 |
Lede |
<Lede> xystic: are you sick in the mind or something |
| 5447 |
Lede |
<Lede> xystic: did a muslim steal your lunch and you are now holding a grudge? |
| 5449 |
Lede |
<Lede> Carbonflux: go play with your masonic dick |
| 5487 |
Lede |
<Lede> i don't see how that relates with dicks |
| 5590 |
Lede |
<Lede> !rq svm_invictvs |
| 5673 |
Lede |
<Lede> crazy_pete: there is only false information on wikipedia when you don't agree with it and only correct information when you agree with it! |
| 5675 |
Lede |
<Lede> !trolls |
| 5701 |
Lede |
<Lede> pwned: there is this flavour of gayness in your quotes |
| 5713 |
Lede |
<Lede> !calc 1+1 |
| 5731 |
Lede |
<Lede> fart! |
| 5742 |
Lede |
<Lede> lol |
| 5760 |
Lede |
<Lede> irc is an auto-refreshing forum! |
| 5763 |
Lede |
<Lede> i think i like something Zharf likes |
| 5807 |
Lede |
<Lede> The light at the end of the tunnel may be an gigantic oncoming goatse.cx like thing |
| 5825 |
Lede |
* Lede sings |
| 5885 |
Lede |
<Lede> Almathea: why don't you go outside and hang out with your neo-nazi friends |
| 5898 |
Lede |
<Lede> it's not possible to form babies from two sperm cells |
| 5915 |
Lede |
<Lede> i just bought a beard trimmer and i trimmed like my left side and it shut down and won't turn on again, i look like an idiot now |
| 5930 |
Lede |
<Lede> i wonder if there are homeless people because they forgot where they lived and gave up searching |
| 5932 |
Lede |
* Lede unleashes pedobear onto the stage |
| 5935 |
Lede |
<Lede> i thought my eyes where fucked up for a sec |
| 5941 |
Lede |
<Lede> time for sleep faggots! |
| 5945 |
Lede |
<Lede> Statistically, if you see this quote then you have invoked the `rq' way too many times, I suggest you take a break and find something else to do. |
| 5946 |
Lede |
<Lede> !qrab Almathea_ |
| 6032 |
Lede |
<Lede> i'm so childish |
| 6093 |
Lede |
<Lede> my stomach just said "fuck you, i'm an anteater" with an Irish accent |
| 6100 |
Lede |
<Lede> fucking christian scumbag |
| 7685 |
Lede |
<Lede> i prefer #Gaybar |
| 7732 |
Lede |
<Lede> AnthonyG: i hope you get sucked up by a gigantic space anus! |
| 7733 |
Lede |
<Lede> imagine if there was a tongue like thing attached to the inside of your anus to clean your butt |
| 7734 |
Lede |
<Lede> anus could be a nice place |
| 7764 |
Lede |
<Lede> gratis is african for i can't afford a windows license |
| 7957 |
Lede |
<Lede> as long as your balls don't touch mine, it's not gay |
| 7972 |
Lede |
<Lede> it's steroids on steroids! |
| 8169 |
Lede |
<Lede> it's a c++ sect that worships iostream.h |
| 8193 |
Lede |
<Lede> i'm the universe, i'm the uuuuniiiiiiiveeeeerse, suck my diiiiiiick!! i'm the universe! |
| 8341 |
Lede |
<Lede> i floss every day.. |
| 8409 |
Lede |
<Lede> a girl has larger breasts, larger hips, a vagina and a brain that redefines logic |
| 8415 |
Lede |
<Lede> brb, im going to feed my penguins |
| 7165 |
LeeLokHin |
<LeeLokHin> Hm. So all we use on this channel is DOS windows? |
| 4739 |
Leo1989 |
<Leo1989> Is functions overloading required for game devlopment? |
| 3894 |
Lexiw |
<Lexiw> i rewrite my smart ptr on every new project, copy and paste requires too much time |
| 6746 |
LiNERROR |
<LiNERROR> it's at 127.0.0.1, but i already had everything they had... |
| 5077 |
LiQuiDninja |
<LiQuiDninja> ill use structs and normal C arrays until i can buy a quad core DDR4 MOBO |
| 2966 |
Libster |
<Libster> Yes, this is my new non-gay nick. Get used to it. I however, am still very gay. |
| 1852 |
Life- |
<Life-> and it isn't. |
| 4966 |
LimCore |
<LimCore> uhm... svm_invictvs, what where you doing reading gaygamer.net anyway? |
| 5017 |
LimCore |
<LimCore> lol: I prefer to xor.... twice for security |
| 5224 |
LimCore |
<LimCore> what exacy did europe wrong? |
| 5225 |
LimCore |
<LimCore> !ungrab |
| 5283 |
LimCore |
<LimCore> how come noone grabbed that |
| 5336 |
LimCore |
<LimCore> if you read this message via !seen LimCore after 2008-03-15, then the idiot doctors killed by badly applied anaesthesia |
| 5373 |
LimCore |
<LimCore> lol, grab me grabbing this duouble quote: <Walt> triplie, is your code leet? <triplie> Walt: jokes as code, void function |
| 5445 |
LimCore |
* LimCore doesnt like how there is no good roole for doubling of characters in english |
| 5528 |
LimCore |
<LimCore> wtf I suck |
| 5619 |
LimCore |
<LimCore> what a surprise |
| 5621 |
LimCore |
<LimCore> someone wants second grab |
| 5622 |
LimCore |
<LimCore> No_grab™© |
| 5633 |
LimCore |
<LimCore> do you have to marry the chicken first? |
| 5638 |
LimCore |
<LimCore> quilzo: a good grab of me is the last one, because it makes me look like an idiot =) |
| 5639 |
LimCore |
<LimCore> why noone grabbed my deepthought about religion. which was perfectly logical btw |
| 5715 |
LimCore |
<LimCore> I wonder do I won at life? |
| 5743 |
LimCore |
<LimCore> ----- first peson that speaks below this line must grab Lede -------- |
| 5747 |
LimCore |
<LimCore> so you prefer music over sex? can you phrase that in one, grabbable line |
| 5759 |
LimCore |
<LimCore> If Samurai lack honor, they can steal some of it from Ninja while they are bussy watching naruto |
| 5782 |
LimCore |
<LimCore> svchost1: yes, a computer carefully dropped from 10th floor is a deadly weapon against infrantry |
| 5785 |
LimCore |
<LimCore> I think dilbert.com company suffers from similar probles as portred in the strips, some clueless moron business guy said "hey, lets make a stupid new page, silly animations, and other things to piss off users" |
| 5795 |
LimCore |
<LimCore> usa sucks more then php and vb combined |
| 5803 |
LimCore |
<LimCore> OpenBush |
| 5877 |
LimCore |
* LimCore avoided grab |
| 5988 |
LimCore |
<LimCore> seriously Carbonflux, Im going to give you IRC speeding ticket. How are we supposed to grab it? |
| 6042 |
LimCore |
<LimCore> java is imho better language then python |
| 6047 |
LimCore |
<LimCore> By lifting this toilet sit you hearby accept the following EULA |
| 6281 |
LimCore |
<LimCore> s/unknown reason/my mistake |
| 6573 |
LimCore |
<LimCore> I dont know how xystic can work for company responsible for most of child porn |
| 6643 |
LimCore |
<LimCore> no, the solution is to mark some grabs as best grabs and add !gq (good quote). perhaps with voting-karma system |
| 6644 |
LimCore |
<LimCore> Windows world ripps off and fucks the end user, Linux world ignores the end user. |
| 6813 |
LimCore |
<LimCore> oh dman |
| 6814 |
LimCore |
<LimCore> . |
| 6815 |
LimCore |
<LimCore> I need ops to build DB of EVERY IP |
| 6816 |
LimCore |
<LimCore> if you are reading this, then codeshot again missgrabbed me. HA! fail. |
| 6858 |
LimCore |
<LimCore> I have running _water_, AND jesus. |
| 6872 |
LimCore |
<LimCore> braden: stop grabbing obvious grabwhore |
| 7004 |
LimCore |
* LimCore lolz at stupid ass americans |
| 7256 |
LimCore |
<LimCore> consider constant: KIDSEXCHANGE vs KidsExchange That naming convention is idiotic. |
| 7282 |
LimCore |
<LimCore> Im bussy, lol |
| 7307 |
LimCore |
* LimCore eval('noob\\languages\\for_web\\php\\stupid\\namespaces::lol("zomfg")'); |
| 7352 |
LimCore |
<LimCore> Americans are strange... Really crazy, if you ask me... |
| 7708 |
LimCore |
<LimCore> lambda [^] will beam up all local variables to the enterprise |
| 7736 |
LimCore |
<LimCore> ok quick noone is here! repeat the previous-then-last line, svm_invictvs, and I will grab the correct one |
| 2889 |
LiquidEngineer |
<LiquidEngineer> there is no FORTRAN |
| 3985 |
LittleCheesePuff |
<LittleCheesePuff> would a template or a class with a function be more suitable for the creation of a cube |
| 7385 |
Lokin |
<Lokin> namespace std is a general declaration as opposed to <iostream.h> |
| 5504 |
Loli-chan |
<Loli-chan> i like watching porn and playing video games with Bigcheese |
| 5505 |
Loli-chan |
<Loli-chan> hes sleeping in my bed |
| 5506 |
Loli-chan |
<Loli-chan> well nolyc can suck balls |
| 5521 |
Loli-chan |
<Loli-chan> the part where i said bigcheese was sleeping in my bed was a lie |
| 5552 |
Loli-chan |
<Loli-chan> does anyone here have sensative skin |
| 5649 |
Loli-chan |
<Loli-chan> can we do it again miles! |
| 5660 |
Loli-chan |
<Loli-chan> ud be amazed about how many guys would want to see themselves with boobies |
| 5661 |
Loli-chan |
<Loli-chan> id love to see my baby kick ass |
| 5687 |
Lolichan |
<Lolichan> i actually believe girls are stupid |
| 5688 |
Lolichan |
<Lolichan> Bigcheese: imma game babe, want to join? |
| 5693 |
Lolichan |
<Lolichan> i just like her big tats |
| 5714 |
Lolichan |
<Lolichan> shes just too slutty looking |
| 5890 |
LordMetroid |
<LordMetroid> I should have coded... Not I am not! :( |
| 7048 |
Lost29 |
<Lost29> hello... i have a segfault :) |
| 2525 |
LtChambers |
<LtChambers> dynamically allocate the vector and delete it? sigh... |
| 2552 |
LtChambers |
<LtChambers> The question is, how leaky is hell? |
| 2829 |
LtChambers |
<LtChambers> mirc just gave me a compiler error |
| 3681 |
LtChambers |
<LtChambers> if I fall asleep on the keyboard I may learn by osmosis |
| 6799 |
LtChambers |
<LtChambers> x.find(5) is objectively prettier than find(x, 5) |
| 8098 |
Luminax |
<Luminax> take us to pointers of pointers of pointers oh great one ! |
| 4386 |
LuxStellae |
<LuxStellae> I know a guy who waxed his ass and told too many people |
| 2860 |
M477 |
<M477> which editor is better for c++ in suse c/c++ or kde/c++ ???? |
| 6180 |
MM|Deja |
<MM|Deja> any who know why is not happening anything in notepad.exe?, http://codenotes.se/325/ |
| 1920 |
MTecknology |
<MTecknology> hell_lord, is there any way to edit source code in an IDE? |
| 4403 |
MTecknology |
<MTecknology> how do I do it with char? - sorry, I'm a noob :P |
| 4404 |
MTecknology |
<MTecknology> is an if/else block good programming language in C++? |
| 2972 |
MacGyverNL |
<MacGyverNL> No, syphilis, web pages could, unfortunately, since I'm running windows as admin, infect my computer. |
| 8322 |
Mackintosh |
<Mackintosh> anyone know how to exit a channel using irssi? |
| 6498 |
MadDavinci |
* MadDavinci stabs Eelis to pieces |
| 6499 |
MadDavinci |
<MadDavinci> I did not know crap was shit |
| 142 |
Madlax |
<Madlax> PERL: the language that looks the same before and after encryption |
| 3242 |
Madsy |
<Madsy> Hit(); me22->with(golfclub); for ever unless(me22->accept(APPLE(EULA))); |
| 3745 |
Madsy |
<Madsy> Perhaps we should start #emo-c++ |
| 4956 |
Madsy |
<Madsy> Most Java code I've seen simply allocates everything, uses it everywhere and pray to God that the GC works. |
| 4957 |
Madsy |
<Madsy> And doing texture fetches in the vertex shader is slow. |
| 5041 |
Madsy |
<Madsy> And char is _always_ 8 |
| 4801 |
Maenad |
<Maenad> well i want to burn morrowind from teh intarwebz so it will run on my bro's xbox 360 |
| 7209 |
Magicblaze007 |
<Magicblaze007> is there a paste tool that allows for larger files...pastebin gives an error on an 8MB file. |
| 6865 |
Maior |
<Maior> (roughly, 200k lines, 15+ years old, written by people on crack) |
| 7465 |
Maior |
<Maior> uh, if you're programming in linux, you're using C, not C++ |
| 5545 |
Malekith |
<Malekith> its like C but with stuf Plussed on |
| 5546 |
Malekith |
<Malekith> it will be a clone of World of Warcraft |
| 5179 |
ManUpstairs |
<ManUpstairs> metabol, this is my first time on IRC, so I don't really know anything |
| 7006 |
Markers |
<Markers> Anyone in here play World of Warcraft by any chance? |
| 7741 |
Mathematicz |
<Mathematicz> I get the code part of c++ just scopes and etc is what i find hard learning |
| 5398 |
Mazzachre |
<Mazzachre> critical event: "Beer level too low"... |
| 5753 |
Mazzachre |
<Mazzachre> Corona beer is really good for that... |
| 5824 |
Mazzachre |
<Mazzachre> Carbonflux: You Budhist? Or just acting strange? :D |
| 5889 |
Mazzachre |
<Mazzachre> LimCore: I only played around 12-16hours a day... Nothing unhealthy in that... |
| 5986 |
Mazzachre |
* Mazzachre considers going gay :) Easier... but... |
| 3155 |
McBain |
<McBain> ville: i've edited the testcase - http://jcatki.no-ip.org/fncpp/TestCase |
| 7142 |
McHomy_ |
<McHomy_> horse sperm? |
| 1849 |
Mech0z |
<Mech0z> that makes me 2 years older than him if its even true so I dont think I would be called a pervert but thats pretty much off topic |
| 625 |
Meckros |
<Meckros> is there a good channel for personal problems? |
| 2846 |
MegaR0m |
<MegaR0m> k thks ... im a little less aware of threads now |
| 3018 |
MegaRom |
<MegaRom> fuck ? u for real ? i thought using linux is the best for compilin shit |
| 3019 |
MegaRom |
<MegaRom> sieg heil fucker |
| 1025 |
Megan001 |
<Megan001> so none of you pricks can help me? |
| 7667 |
Megzlna |
<Megzlna> everyone on the committee is a newb |
| 7668 |
Megzlna |
<Megzlna> if I pass a nontype member function pointer, I have to provide the 'C', because templates cannot figure out the type of nontypes |
| 8256 |
MercedesBenz |
<MercedesBenz> I made program in console : a * b * c , all are integers. When I add numbers its working , when I add char program stops , but program is in do { } while (stopper = 'n') , so why char to integer stops program? |
| 5085 |
Meronik |
<Meronik> how do I learn how to learn? |
| 2840 |
Metabol |
<Metabol> Let's troll more scientifically |
| 2971 |
Metabol |
<Metabol> 1989, 1999, 2009, it's like a comet |
| 3092 |
Metabol |
<Metabol> Ogre is well-designed, it has *Singletons* |
| 3094 |
Metabol |
* Metabol heard a rumour that DNF *is* finished, it came down to 14 million LoC. Next week they're going to see if it compiles |
| 3119 |
Metabol |
<Metabol> yo mama is so fat, she was the model for the std::string interface |
| 3138 |
Metabol |
<Metabol> propfan: if you want to win any C++ debate, just remark "right, yeah. MFC does it that way, too" |
| 3215 |
Metabol |
<Metabol> wow, braden rules my world |
| 3247 |
Metabol |
<Metabol> hey, keep it organized - "functions.cpp", "variables.cpp", "classes.cpp" |
| 3270 |
Metabol |
<Metabol> noobs hear OpenGL screaming in the night, "wrap me! wrap me!" |
| 3275 |
Metabol |
<Metabol> there should be a binky does template metaprogramming |
| 3280 |
Metabol |
<Metabol> loufoque: all I know about Borland is the boost headers are crowded with stuff like BOOST_WORKAROUND(__BORLANDC__, <= 0x600) |
| 3299 |
Metabol |
<Metabol> I run a little mockup of paypal.com and some online banks on my server. I really should put up a sign on my access point, "please do not connect", all these passwords are filling up my disks |
| 3318 |
Metabol |
<Metabol> Great. Probably yet another textmode roguelike MMORPG set in the Brokeback Mountain universe |
| 3324 |
Metabol |
<Metabol> I thought they did that for good luck |
| 3372 |
Metabol |
<Metabol> Sometimes I wish I wasn't so confused and clueless, but the feeling usually passes quickly |
| 3413 |
Metabol |
<Metabol> Could have been Doctor Dastardius in his majestic Zeppelin of Doom |
| 3415 |
Metabol |
<Metabol> I log ##c++ and I edit the logs afterwards, adding things like "you're right Metabol, again" and "Right, Metabol, never saw it that way before" |
| 3418 |
Metabol |
<Metabol> When I was in Turkey I visited this dental student and she had a bowl of pills. She liked the blue ones |
| 3489 |
Metabol |
<Metabol> haha in #boost the boost team themselves can't even get bjam2 to work |
| 3494 |
Metabol |
<Metabol> maybe there should be a ##c++-social-social |
| 3501 |
Metabol |
<Metabol> Just watching blank chat is like reading a brand new quote database |
| 3519 |
Metabol |
<Metabol> I wonder if she does schoolgirl outfits too |
| 3521 |
Metabol |
<Metabol> I could see him blushing from all across the internets |
| 3547 |
Metabol |
<Metabol> I use this channel primarily for emotional support |
| 3569 |
Metabol |
* Metabol goes back to work on his seminal paper " '#define goto jump' considered awesome" |
| 3582 |
Metabol |
<Metabol> heh, quote from a phonecall. "We thought about going out on Thursday to celebrate that we're done with the project. If we get it done, that is. Uh...Thursday...is that tomorrow?" |
| 3598 |
Metabol |
<Metabol> No mercy in ##c++ |
| 3638 |
Metabol |
<Metabol> Argh, it's impossible to win against rational people on irc |
| 3676 |
Metabol |
<Metabol> I tried telling a woman to shave once. Damn, she got mad |
| 3682 |
Metabol |
<Metabol> Black Metal band names are like "Archaeotragico Bloodmassacrebath Reverendum" |
| 3717 |
Metabol |
<Metabol> a cell phone inside a tv makes no sense |
| 3722 |
Metabol |
<Metabol> I was zapping satellite tv once, I remember coming across some Polish channel, showing a foreign soap. They had one guy doing all the voiceovers, men, women, everyone. Kinda weird. |
| 3784 |
Metabol |
<Metabol> Karl Marx already wrote a book on fair labor I think |
| 3793 |
Metabol |
<Metabol> s/antidisestablishmentariansim/antidisestablishmentarianism |
| 3799 |
Metabol |
<Metabol> I never knew a channel that made me google and wikipedia as much as this one |
| 3810 |
Metabol |
<Metabol> If I were to rob a bank, I think I'd wear an mp3 player playing "rednex - cotton eye joe.mp3" perpetually, to get me wired. And I could jump around to the rhythm if it came to a machine gun shootout with the cops |
| 3841 |
Metabol |
<Metabol> someone admits he was wrong on irc. Armageddon is near |
| 3983 |
Metabol |
<Metabol> yes, it's good. I remember nothing, bt it's good |
| 3984 |
Metabol |
<Metabol> zeroflag, you made your point, excellent trolling/argument this time. But maybe that's enough, don't you think? |
| 4001 |
Metabol |
* Metabol meanwhile notes that next grab will be #4000 |
| 4027 |
Metabol |
<Metabol> leave MFC alone, it's old and it can't defend itself! |
| 4107 |
Metabol |
<Metabol> coding in assembly is writing love letters to the hardware |
| 4172 |
Metabol |
<Metabol> ##c++ is a place where everyone is patient, courteous and precise |
| 4189 |
Metabol |
<Metabol> !rq blank |
| 4246 |
Metabol |
<Metabol> I hope there is not Jafetishism as well |
| 4315 |
Metabol |
<Metabol> single process is more efficient |
| 4437 |
Metabol |
<Metabol> sometimes when I learn things by bits and pieces, the bits and the pieces come together and I gain insight. That never happened to me with streams |
| 4519 |
Metabol |
<Metabol> everything I do on irc, I do for the women |
| 4628 |
Metabol |
<Metabol> Usually I use multiple exclamation marks and question marks, for great energy |
| 4629 |
Metabol |
<Metabol> maybe on some women's channel now they are discussing whether feigning interest in some self absorbed guy's guitar playing helps scoring with him |
| 4649 |
Metabol |
<Metabol> or !rq glen_quagmire. Or simply !rq, to get blank |
| 4690 |
Metabol |
<Metabol> s/he C/he uses C |
| 4693 |
Metabol |
<Metabol> I don't know about C++, but glen_quagmire is context-free grammar |
| 4701 |
Metabol |
<Metabol> she is more of a man than you'll ever be and more of a woman than you'll ever get! |
| 4774 |
Metabol |
<Metabol> this was like standing in an elevator almost by yourself(hi EvanR), muttering something to yourself and suddenly there's Adrinael on the one side behind you and hrnt on the other calling you on it |
| 1711 |
Metrick |
<Metrick> anyone know any good mp3 channels on this net? |
| 7513 |
MexxiTank |
<MexxiTank> ty, include header for std;;out? |
| 2841 |
Micah71381 |
<Micah71381> Of course, I get a completely useless error. |
| 7700 |
MichaelS44 |
<MichaelS44> No, I think C is perfect in every way... Both visually and aesthetically |
| 8330 |
Miesco |
<Miesco> I dont even have a problem with windows API, just the shell and the uncontrolibility |
| 6668 |
Mike[0] |
<Mike[0]> well, apparently, the inference is that I am a beginner... which is true, in the sense that, I'm not a c++ person, however, don't simply assume that, because you never saw me in here before, that I won't get that I need a compiler and a book... I asked if anyone knew of a snippet out there that showed an example of pointers and the passs by reference concept |
| 2916 |
MisterN |
<MisterN> damn is there a c++ channel anywhere where people are not strange? |
| 3131 |
MisterN |
<MisterN> Okiesmokie: fstream.h is nonstandard |
| 3136 |
MisterN |
<MisterN> Adrinael: i can't do that as i never read the standard and don't intend to do so. but must all truth about c++ be dictated by the standard? |
| 7329 |
MisterN |
<MisterN> gowrav: you can't grab yourself it seems |
| 7595 |
MisterN |
<MisterN> rocketmagnet: it would be better if you weren't wrong every time. |
| 6810 |
Mitsuo |
<Mitsuo> i have a rogue segmentation fault in my code, what do i do? |
| 4022 |
Mixmasterxp |
<Mixmasterxp> enum is something like an array? |
| 4023 |
Mixmasterxp |
<Mixmasterxp> thats a compiler written in mirc scripting? |
| 8189 |
MoKu23 |
<MoKu23> i have 2 variable GAUJ2R481WO4A0XMD, GM66T61NOEQ6DBHUR, can i generate the next variable? |
| 4217 |
Mod_Man |
<Mod_Man> im dumb |
| 2002 |
Money |
<Money> rememvber i have a damn screwdriver in my hand, don't fuck wit me |
| 2004 |
Money |
<Money> can i fuck your feet? |
| 4970 |
Monk-e |
<Monk-e> I hate arrays now. |
| 3358 |
Mopa |
<Mopa> are C codes allowed here? :O |
| 3987 |
Mortable |
* Mortable gained stdcpp window |
| 5458 |
Mossa |
<Mossa> I am just trying to get a clue what you guys talk about, because I found out that there are a lot of things that I just misunderstood about programming, seems the reason that I am no way as good as you people are. |
| 2708 |
Mot |
<Mot> is it possible to execute DOS commands with C++? |
| 2787 |
Mot |
<Mot> \s is the escape char for whitespace right? |
| 3287 |
Mott |
<Mott> unlike most CS majors, i have sex [with girls]. |
| 7653 |
MrCase |
<MrCase> who said that coding while slightly drunk is unproductive? after 3 guinness i saw a solution to something that has been bothering me since 6am yesterday. |
| 7998 |
MrDes |
<MrDes> i do not have any book. i am not going to spend 8000 dollars on a text book for a course i do for 4 months |
| 5612 |
MrQ |
<MrQ> i've done a few projects for a local compony in c++ using desing Patterns ,so i'm already qualified programmer in c++ BUT one can NEVER be fully read up on a progamming language |
| 920 |
MrSassyPants |
<MrSassyPants> the only thing that gets clearer and clearer is that my code's a mess =D |
| 7428 |
Mr_ |
<Mr_> I just need it fast |
| 2891 |
Mr_Awesome |
<Mr_Awesome> on irc, everyones sexy, even me |
| 2922 |
Mr_Awesome |
<Mr_Awesome> according to the highly professional and reliable piece of literature Sams Teach Yourself C++ in 24 Hours, the STL *is* a separate library, blank |
| 3116 |
Mr_Awesome |
<Mr_Awesome> blank: if i pretend im a woman, will you pay me? |
| 3125 |
Mr_Awesome |
<Mr_Awesome> braden: ive been around the block a few times, and let me tell you, that was no strap-on |
| 3185 |
Mr_Awesome |
<Mr_Awesome> yay im no longer a dumbass |
| 3303 |
MuffY |
<MuffY> the fundamental assumptions of maths, that make the sum of the angles of triangles 180 degrees, that make 1+1=1, those assumptions, and proving why those assumptions make the triangles and the graphs happen, are just way too damn complicated to explain in highschool, when you only need to get some feeling of abstraction |
| 1451 |
Muskrat_24 |
* Muskrat_24 blows bubbles |
| 1054 |
Mws |
<Mws> but comfortable also |
| 8348 |
MyName |
<MyName> i h ave no compiler |
| 8360 |
N00b |
<N00b> the bots there to be screwed with.. |
| 6665 |
NTAUTHORITY |
<NTAUTHORITY> does anyone know how to edit the Blue Screen of death file in C++ |
| 6666 |
NTAUTHORITY |
<NTAUTHORITY> oh thank you :D |
| 2065 |
NaN |
<NaN> Hello, is it possible to do somtehing like this: * / ** /*** /**** / *** / ** / * (but vertical) in only one for? |
| 2066 |
NaN |
<NaN> ALL YOUR RESPONSES ARE TOTALLY WRONG |
| 7217 |
NaN |
<NaN> I don't mind jokes |
| 698 |
Na_Kun |
<Na_Kun> omg u r loozerz bcuz windoz is goooood n entrnet xplorr is goodz |
| 5166 |
NameAlreadyInUse |
<NameAlreadyInUse> "is this female a canditate for future pair bonding (y/n)" |
| 5250 |
NameAlreadyInUse |
<NameAlreadyInUse> they think "red meat" and expect meat that is #FF0000 |
| 5436 |
NameAlreadyInUse |
<NameAlreadyInUse> an infinite stream of puke could power a turbine and solve the worlds power crisis |
| 5796 |
NameAlreadyInUse |
<NameAlreadyInUse> i always thought C would be the washing machine language of choice |
| 7355 |
NauarchLysander |
<NauarchLysander> Is there a header one has to include to be able to use the XOR operator (^)? |
| 7356 |
NauarchLysander |
<NauarchLysander> nolyc: Ok, mom. |
| 7357 |
NauarchLysander |
<NauarchLysander> Isn't there SOME possibility to xor two ints in the whole C++ standard library!!?? |
| 7375 |
NauarchLysander |
<NauarchLysander> nolyc: What are you doing? Why are you repeating my posts? |
| 3626 |
Nazcafan |
<Nazcafan> please compile, please compile |
| 8265 |
Nazcafan |
<Nazcafan> Nazca is a precolombian civilisation that was in south of peru waaaay before the Incas |
| 215 |
NeoThermic |
<NeoThermic> I read 'testcase' as 'testicals' |
| 7425 |
NerdFencer_ |
<NerdFencer_> whats_in_a_name: still not getting the behavior that I want, but at least it works |
| 433 |
NeverDream |
<NeverDream> hey! take your coding questions to a code-relevent channel! like ##kinkyhentai ! |
| 607 |
NeverDream |
<NeverDream> my knowledge of PHP or Perl or anything else commonly used to make bots is close to nil |
| 618 |
NeverDream |
* NeverDream slaps orbitz on the ass in a manly way |
| 621 |
NeverDream |
<NeverDream> but I'm a gnome! |
| 634 |
NeverDream |
<NeverDream> sex and rainbow sprinkles... mmm... |
| 3285 |
NightBlade |
<NightBlade> im gonna do stuff like make fat jiggle, hair and clothes move |
| 3208 |
Nightmare |
<Nightmare> how do you do plus or minus in c++? like ball_x +-? is that right/ |
| 7501 |
Nike_ |
<Nike_> !help niggers sockets |
| 7177 |
NineVolt |
<NineVolt> it's all about maximizing compile time. |
| 3572 |
Ninina |
<Ninina> tis a sad world |
| 3652 |
Ninina |
<Ninina> purr, meow and hiss |
| 5600 |
Niptech |
<Niptech> nolyc, use <user nick>, to highlight the line. |
| 4871 |
Nixcheese |
<Nixcheese> I do that a lot when I try to type ', as it's right next to enter |
| 1490 |
Noet |
<Noet> he could have: ( const char * & ch) if he wanted ^ |
| 6546 |
Noimnot |
<Noimnot> litb: Noimnot |
| 1673 |
Noldo |
<Noldo> must - resist - grab |
| 1895 |
Noldo |
<Noldo> cylon is not a native english speaker |
| 2498 |
Noldo |
<Noldo> is it pedophilia if the kid is dead? |
| 1130 |
Nonsense |
<Nonsense> sorry in advance for my stupidity |
| 2321 |
NoonienSoong |
<NoonienSoong> quilzo: i am speaking a variant of English called Polish |
| 4886 |
NoorulIslaam |
<NoorulIslaam> whats_in_a_name, <|839393938|> thats my pic, nude |
| 603 |
Norika |
<Norika> Jacco it doesn't work because you lack great justice |
| 3316 |
Nou_S |
<Nou_S> Don't call yourself a tard. That's other people's job. |
| 3334 |
Nou_S |
<Nou_S> I pretended to play it. It was really a cardboard box and some rocks |
| 3335 |
Nou_S |
<Nou_S> I am so old I remember when crazy_pete was young. |
| 3366 |
Nou_Storm |
<Nou_Storm> If you have to ask about rand() you don't need real randomness. |
| 8130 |
Nuwanda |
<Nuwanda> :E, the extended version. now with 200% more embedded frustration |
| 1952 |
OUAH |
<OUAH> because *it seems also C-style |
| 7848 |
O__o |
<O__o> i am programming C here, can i use ostream in C? |
| 4336 |
Oax |
<Oax> oh no wonder you guys seem like fucking geniuses compared to efnet |
| 3593 |
Obfuscate |
<Obfuscate> Daniwan_: I feel your pain, however, if no one can help you, no one can help you. Try crying in a corner, it might be more effective than bitching on IRC. |
| 5480 |
Obfuscate |
<Obfuscate> nulledboy: C++ has everything C has, with a few different quirks, plus another encyclopedia worth of features. You can like it or hate it for that very reason. |
| 948 |
Octalthorpe |
<Octalthorpe> If God didn't want us to eat animals, why are they made of food? |
| 1406 |
Oejet |
<Oejet> Does #C++ have a parallel off topic/overflow channel? |
| 3866 |
Ogata |
<Ogata> this->isSparta(); |
| 3421 |
Okiesmokie |
<Okiesmokie> Hmm, you can call main if it's not the entry point, right? |
| 3612 |
Okiesmokie |
<Okiesmokie> I am not going to repeat myself multiple times just so you can sit there and masturbate to my text. |
| 6755 |
OlafSchneider |
<OlafSchneider> Functional programming is great for building solutions to solved problems. |
| 5190 |
OldWolfNZ |
<OldWolfNZ> i swear you get dumber each day |
| 5381 |
OldWolfNZ |
<OldWolfNZ> while( not vagina.find(cock) ) { double balls; } |
| 5662 |
OldWolfNZ |
<OldWolfNZ> dont quote me on that though |
| 955 |
Oleg_ |
<Oleg_> people, I love the fact that you're cool, not some C++ geeks |
| 1140 |
Oleg_ |
<Oleg_> how do I make the string constant "I want love" an integer constant? |
| 1146 |
Oleg_ |
<Oleg_> Adrinael: I can use vim to program in the machine language? |
| 6982 |
Oleg_ |
<Oleg_> LOL, I was watching "Buffy" episodes for most of the night, then I started studying function calls. I find them fascinating. |
| 7035 |
Oleg_ |
<Oleg_> I am puzzled about how to program with only 1s and 0s |
| 7085 |
Oleg_ |
<Oleg_> Upgrade your computer if it has only the 80286 CPU |
| 2979 |
OliverX |
<OliverX> I don't fantasize about making a blue whale sound like a guitar though |
| 323 |
Om |
<Om> There's no point learning 10 languages which all do the same things. |
| 7753 |
OmegaDeus |
<OmegaDeus> LimCore we should get together and get started making our own language for web applications and beyond :D |
| 205 |
Ooble |
<Ooble> bytes are *always* 8 bits |
| 1187 |
Ooble |
* Ooble resists the temptation to give a perverted and immature response. |
| 2316 |
Oort |
<Oort> orbitz is a 12 year old girl trapped in a 50 year old mans body |
| 2813 |
Oort |
<Oort> Its so ironic to write CAPS LOCK with the Shift-Key. |
| 4504 |
Oort |
<Oort> orbitz is the only known person who can give jimmygoon an orgasm via anal stimulation |
| 6322 |
Operator |
<Operator> computers have no walls or fences, why would we need windows or gates? |
| 4664 |
Orakio |
<Orakio> Does GCC/C++ support generics or something to the same effect? If so does anyone know any good webpages documenting this as I am finding that my searches seem to only bring up articles with limited information and stuff about java or c#.. |
| 7579 |
OrtVouslex |
<OrtVouslex> I need a program that checks if my program terminates. |
| 7490 |
Osah |
<Osah> How can i style my Application -- Look at MS Office 2007 -- it looks nice... any tutorials on making my apps visually good looking |
| 8391 |
Osirian_ |
<Osirian_> "Don't do that; You'll get Cancer..." |
| 1382 |
Osurac |
<Osurac> this channel is awesome it should be a TV show |
| 2879 |
Owe__ |
<Owe__> morvellous microsoft API |
| 2881 |
Owe__ |
<Owe__> how do i let sizeof() return zero? |
| 3027 |
Ox41464b |
<Ox41464b> zeroflag, i got one vcexpress, but my teacher will not accept.cpp that cannot be compile on TurboC++ |
| 8254 |
Ox90_ |
<Ox90_> ville: you are an idiot |
| 868 |
Oxyd |
<Oxyd> Forget the useless crap and do learn some even more C++! |
| 1080 |
Oxyd |
<Oxyd> false is true only if you are taling to a woman. Fortunately, C++ is not a woman. |
| 1242 |
Oxyd |
<Oxyd> How dare you forget namespaces?? Make that never happen again or I shall seek you and eat you! |
| 1536 |
Oxyd |
<Oxyd> Cylon's only half-alive. He used to be a human, but then he died in a tragic accident and most of the parts of his body were replaced by machine parts. |
| 1739 |
Oxyd |
<Oxyd> Actually asm + GUI is a killer combination. For the programmer mainly. |
| 1998 |
Oxyd |
<Oxyd> I'm looking forward to people coming here and asking us to google a program for them, because `Hey, it might be written in C++!'. |
| 2068 |
Oxyd |
<Oxyd> NaN: Get a girlfriend. You need to fuck. Seriously. |
| 2083 |
Oxyd |
<Oxyd> qalam and raf256 both as ops. |
| 2464 |
Oxyd |
<Oxyd> OCalmDown -- an IRC operator's language. |
| 2641 |
Oxyd |
<Oxyd> This channel focuses on telling people that it focuses on C++. |
| 2650 |
Oxyd |
<Oxyd> Even bot-abuse has been automatized now. This channel no longer needs humans. |
| 2823 |
Oxyd |
<Oxyd> You've got to pretend you're a machine if you want to talk to Eelis. |
| 4760 |
Oxyd |
<Oxyd> Linux source is beautiful.. The last time I read through it, I almost didn't throw up. x) |
| 4933 |
Oxyd |
<Oxyd> You should prefix your classes with your surname to protect your intellectual property. |
| 4960 |
Oxyd |
<Oxyd> Clearly, we must respond less than one minute, otherwise no-one wants to ask us a question. |
| 4962 |
Oxyd |
<Oxyd> I'm gonna devise some 'Lotate Left' operation, so I can have LOL instruction. |
| 5866 |
Oxyd |
<Oxyd> It's not about the quoting, it's about the grabbing. |
| 5916 |
Oxyd |
* Oxyd is a beautiful, young woman in a boy's body. |
| 5918 |
Oxyd |
<Oxyd> I think we've already got a few quotes like this. |
| 6025 |
Oxyd |
<Oxyd> So that you don't accidentally write a well-formed program? |
| 6312 |
Oxyd |
<Oxyd> It's t3h Unix philosophy! Write tons of small crap and stick them together to make Big Shit! |
| 6658 |
Oxyd |
<Oxyd> Just do a #define jump goto and use that. |
| 6687 |
Oxyd |
<Oxyd> No, you want HeapAlloc! |
| 6704 |
Oxyd |
<Oxyd> "Kidding" sounds like something a paedophilliac would do.. |
| 6792 |
Oxyd |
<Oxyd> fcky: I think lot of people don't know C, they just somehow manage to compile the shit and make it not segfault 80% of the time. |
| 7421 |
Oxyd |
<Oxyd> I have irssi set up to autoreplace <3 with ♥. |
| 7927 |
Oxyd |
<Oxyd> Hm, that snippet turned out to be more useless than I'd thought. |
| 7977 |
Oxyd |
<Oxyd> If they want to dodge the restrictions and shoot their balls off, just let them. |
| 8332 |
Oxyd |
<Oxyd> Yeah. But many geeks are -- for some reason -- obsessed with having as much three-letter disorders as possible. |
| 7377 |
OzoneNerd |
<OzoneNerd> Eelis: My step-brother died in a static_cast accident. |
| 5880 |
P90 |
<P90> What does grab do? |
| 7898 |
PLEASEHELP |
<PLEASEHELP> i dont even know how to use this chat room, but can someone hack bebos? or bebo passwords? |
| 2667 |
PNULL |
<PNULL> im a pointer to NULL! |
| 3729 |
Pacheco1 |
<Pacheco1> Eelis: you are about as "fair and balanced" as Fox news |
| 1704 |
Palithius |
<Palithius> how can you tell when the operating system is idle in Linux ? |
| 8111 |
Panarchy |
<Panarchy> Wow, you guys are truly stupid. How could you not know how to make a pause in C++? |
| 2855 |
Parody |
<Parody> Jessicatz - you can talk about sex in pm with me :> |
| 5046 |
PartyB0y |
<PartyB0y> I need some C++/C coder wich knows about counter strike anticheats. |
| 2959 |
PauloRS |
<PauloRS> I'm not familiar with bitwise operatorsa |
| 1136 |
Pencilo |
<Pencilo> Part of me tells me not to click on images sent over IRC, the other is like "Weeee!!!" |
| 1606 |
Penguin___ |
<Penguin___> int* is definitely not a type |
| 1607 |
Penguin___ |
<Penguin___> there are no types |
| 1889 |
Percotz |
<Percotz> std: using babab ?= |
| 1216 |
Peregrine |
<Peregrine> The goddamned IDIOTS that come here. AAAAHHH! |
| 2152 |
Peregrine |
<Peregrine> RogueJedi, Go get some caffine. |
| 2902 |
Peregrine |
<Peregrine> Stubbing brains it more painful than toes |
| 2977 |
Peregrine |
<Peregrine> Whee, you can cut cabins in half with C++! |
| 3000 |
Peregrine |
* Peregrine goes off to develop a midi flute |
| 3070 |
Peregrine |
<Peregrine> Oh, lol, I hate virtual desktops. Couldn't figure out why someone was using Peregrine. Ghosted him, then became peregrine, and a moment later PeregrineFalcon shows up. Left another window open. :/ |
| 3219 |
Peregrine |
<Peregrine> bit wise and byte foolish? |
| 3510 |
Peregrine |
<Peregrine> Ahh, a delcious banana netsplit |
| 3522 |
Peregrine |
<Peregrine> Oh crap, this is IRC? I thought I was on AIM! |
| 3523 |
Peregrine |
<Peregrine> ::function() |
| 4658 |
Peregrine |
<Peregrine> Atalanta, If I want to see this channel, there's always Tor |
| 4992 |
Peregrine |
<Peregrine> Finally! 5.5 fucking hours for someone to redo my breaker box. |
| 7264 |
Peregrine |
<Peregrine> Isn't air travel wonderful? Breakfast in London, dinner in New York, luggage in Brazil. |
| 1911 |
Peregrine_Falcon |
* Peregrine_Falcon really needs to say more grabbable things |
| 3653 |
Peregrine_Falcon |
<Peregrine_Falcon> A New York City ordinance prohibits the shooting of rabbits from the rear of a Third Avenue street car -- if the car is in motion. |
| 7280 |
Petein |
<Petein> does c++ be compined with java code? |
| 8007 |
Petein |
<Petein> ville: and its more easier to find methods using "." rather than -> in c++ |
| 1134 |
PeterHu |
<PeterHu> i have no hands, you insensitive clod! |
| 1176 |
Phati |
<Phati> Adrinael: mom |
| 3328 |
Phylo |
<Phylo> it is SO annoying not being able to debug... |
| 7531 |
PhyloGenesis |
<PhyloGenesis> I know how I COULD go about this. I could create yet another programming language in three hours using tools that people have made online |
| 4763 |
PinTail_1 |
<PinTail_1> I must say a big THANK YOU to all the monitors and moderators of this channel. Although I have been a C++ developer since the language was first generally publicly available around 1983 or so, it has not been until the past few months that I have felt that I finally truly understand some of the subtle power of the language; particularly template meta programming. I think a significant part of that confidence has come from asking a few seemingly n |
| 4875 |
PinTail_b |
<PinTail_b> I knew a guy that had his foreskin made into a wallet; when he rubbed it, it turned into a briefcase |
| 4876 |
PinTail_b |
<PinTail_b> http://en.wikipedia.org/wiki/Alpheus_Felch |
| 4913 |
PinTail_b |
<PinTail_b> forward decelerartion, is that something like braking ? |
| 8371 |
Plagius |
<Plagius> the difference is unicode is always 16 bits and UTF isnt |
| 8372 |
Plagius |
<Plagius> so counting chars is faster in unicode than UTF |
| 762 |
PlasmaHH |
<PlasmaHH> *snief* again no quote from me |
| 1028 |
PlasmaHH |
<PlasmaHH> now its season, you get 3 std::strings for the price of 4 |
| 1030 |
PlasmaHH |
<PlasmaHH> my lunch just ruined my monitor... |
| 1110 |
PlasmaHH |
<PlasmaHH> I said M$ not M$ ... the irc server must have converted it |
| 1148 |
PlasmaHH |
<PlasmaHH> statistical analysis showed that 87% of the people who looked at adrinaels pasted links died because of eye-cancer |
| 1184 |
PlasmaHH |
<PlasmaHH> spola: I heard that the first version of gcc4 appeared when catting /dev/urandom |
| 1185 |
PlasmaHH |
<PlasmaHH> I once put a small sign, well a sticky note on our university elevator saying "defect". A few days later, someone came to repair it... |
| 1188 |
PlasmaHH |
<PlasmaHH> Inside: php is easy to learn. after a few minutes you write your first program, after an hour you implement your first security bug, just like the pros do ! |
| 1203 |
PlasmaHH |
<PlasmaHH> hm, flash doesnt seem to work in elinks :( |
| 1209 |
PlasmaHH |
<PlasmaHH> well I have lots of lines of tested code, unfortunately they dont compile :/ |
| 1212 |
PlasmaHH |
<PlasmaHH> boost::please has been deprecated in favor of boost::beer |
| 1221 |
PlasmaHH |
<PlasmaHH> punkstar: well every window would have been wrong for that question :P |
| 1226 |
PlasmaHH |
<PlasmaHH> hm, I didnt know that there are parser errors in php, it just used what I gave it always ... |
| 1233 |
PlasmaHH |
<PlasmaHH> narf, cant this guy just keep one nick so its easier to ignore him |
| 1288 |
PlasmaHH |
<PlasmaHH> you can get the whole internet on 4434 blue-ray dvds... or without porn, on 4 cds |
| 1290 |
PlasmaHH |
<PlasmaHH> omg, I was telnetted ! |
| 1433 |
PlasmaHH |
<PlasmaHH> paste in /dev/null |
| 1493 |
PlasmaHH |
<PlasmaHH> loufoque: actually no, we have a relay bot installed to a mirror universe |
| 1494 |
PlasmaHH |
<PlasmaHH> loufoque: by beeing rounder, thus having a lower friction when rolling down the street... c++ tends to hang on the ++ |
| 1511 |
PlasmaHH |
<PlasmaHH> I tried to explain that its against the global project guidelines to have variable names that are easy to understand, so they said they only want to use it internally, not in interfaces... |
| 1669 |
PlasmaHH |
<PlasmaHH> perl is about so many ways that you dont debug code, you just write it another way again |
| 1732 |
PlasmaHH |
<PlasmaHH> blank: you know, because of the warmth, I prefer thermonuclear devices |
| 1743 |
PlasmaHH |
<PlasmaHH> _Codex: dont stretch it too much or it will break and explode in your face ;) |
| 1774 |
PlasmaHH |
<PlasmaHH> people who come here and ask "why doesnt c++ does not have feature XXX" do that because they are annoyed that their php code does not compile with a c++ compiler |
| 1843 |
PlasmaHH |
<PlasmaHH> me22: to understand recursion, you first must understand recursion |
| 1851 |
PlasmaHH |
<PlasmaHH> hm, does it sometimes happen to you too that you have put something somewhere and just cant remember? and then dream of it, where you exactly see where it is? but then yo dont remember the dream anymore? |
| 1937 |
PlasmaHH |
<PlasmaHH> raii is orbitzish for iraq |
| 1972 |
PlasmaHH |
<PlasmaHH> qalam: I have the feeling that its the most ignored nick in here, beside you ;) |
| 2023 |
PlasmaHH |
<PlasmaHH> class Eelis extends cylon |
| 2070 |
PlasmaHH |
<PlasmaHH> then whats web 2.1? a security fix? |
| 2071 |
PlasmaHH |
<PlasmaHH> Bklyn: we all here only train advanced secret trolling techniques |
| 2097 |
PlasmaHH |
<PlasmaHH> you can make cannabis with old bread ? |
| 2114 |
PlasmaHH |
<PlasmaHH> dont feed qalam |
| 2118 |
PlasmaHH |
<PlasmaHH> qalam: I compiled linux on a i386 16MHz with 8MB ram |
| 2140 |
PlasmaHH |
<PlasmaHH> anyone knows a good python book? Im a beginner so it must be a really advanced one.. |
| 2206 |
PlasmaHH |
<PlasmaHH> "Why have an optimized OS when you easily can sell millions of crappy ones?" PlasmaHH |
| 2219 |
PlasmaHH |
<PlasmaHH> cromo: dont pay attention to ville, he just tried to help |
| 2259 |
PlasmaHH |
<PlasmaHH> dolphin: you just said "dont use boost" without any reason. thats like running naked into a gay pub |
| 2319 |
PlasmaHH |
<PlasmaHH> every grab can be done better, unless its one of mine |
| 2349 |
PlasmaHH |
<PlasmaHH> I wonder if you can do morse code with thermonuclear weapons |
| 2359 |
PlasmaHH |
<PlasmaHH> struct escape { int i; } // escape pod ? |
| 2421 |
PlasmaHH |
<PlasmaHH> I just invented the ultimate use for xml... an image format, where the pixel order of the data does not matter! <pixel location_x=223 location_y=213 class="image_part" id="the_red_one_over_there" style="background-color: #FF0000" >description of it goes here (not displayed)</pixel> |
| 2474 |
PlasmaHH |
<PlasmaHH> I once had a template that could grow weed, but never one that could grow binaries. or mass binaries |
| 2495 |
PlasmaHH |
<PlasmaHH> wow, my program can now ultrafast count the memory it wastes... |
| 2500 |
PlasmaHH |
<PlasmaHH> cardone: you dont have to write your nick, the irc clients do it automatically for you |
| 2501 |
PlasmaHH |
<PlasmaHH> roods: ah, you were the one coming here for weeks now, stating "I started learning C++ today" ? |
| 2508 |
PlasmaHH |
<PlasmaHH> why does someone who does not wear a tie wants to use .NET? |
| 2512 |
PlasmaHH |
<PlasmaHH> it is. how do you thinkt he first compiler appeared? cat /dev/urandom > gcc-1.0 |
| 2549 |
PlasmaHH |
<PlasmaHH> and the others? cdrom languages? |
| 2568 |
PlasmaHH |
<PlasmaHH> I finished a mmorpf. well it got dragged sidewards and came out as a total c++ rewrite of cat |
| 2591 |
PlasmaHH |
<PlasmaHH> hm.... "ping timeout - host is currently having dinner" |
| 2608 |
PlasmaHH |
<PlasmaHH> kroep: play in private |
| 2613 |
PlasmaHH |
<PlasmaHH> yeah vax then, at least a V was there |
| 2616 |
PlasmaHH |
<PlasmaHH> SHIFT HAPPENS |
| 2656 |
PlasmaHH |
<PlasmaHH> it depends. when you constantly slap people while talking about the weather, its definetly some habit you should get rid of. |
| 2658 |
PlasmaHH |
<PlasmaHH> shit. outside is weather |
| 2725 |
PlasmaHH |
<PlasmaHH> (its like cinema, just without seeing something) |
| 2909 |
PlasmaHH |
<PlasmaHH> well at least the great thing about java is that it only runs on one platform |
| 2923 |
PlasmaHH |
<PlasmaHH> test_case(qamar_) == lowercase; |
| 2973 |
PlasmaHH |
<PlasmaHH> must look funnny. let me see if I have some time to laugh. |
| 2990 |
PlasmaHH |
<PlasmaHH> #define lol wtf |
| 2997 |
PlasmaHH |
<PlasmaHH> for C# go to ##CLSID{32ffadf324-fadf43534535-fadfadf-3455335} |
| 3017 |
PlasmaHH |
<PlasmaHH> Jessicatz: we are not arguing, we have a constructive discussion |
| 3087 |
PlasmaHH |
<PlasmaHH> it would be like -frandom-crashes or -fdont-really-calculate-additions-just-guess |
| 3360 |
PlasmaHH |
<PlasmaHH> DarkUranium: this is a c++ channel, not a nicer interface to google |
| 3371 |
PlasmaHH |
<PlasmaHH> pwned: just zip C:\ and ship it |
| 3386 |
PlasmaHH |
<PlasmaHH> Anand_1: I just own nolyc, nothing more and nothnig less |
| 3623 |
PlasmaHH |
<PlasmaHH> atreyu: sorry to bother you that much, since we want something from you, and not you from us, but would you be so kind as to also paste the code that lead to that error, if it is not too much work? |
| 3723 |
PlasmaHH |
<PlasmaHH> I use a naming scheme of randomly typing a random number of valid characters for variable names |
| 3813 |
PlasmaHH |
<PlasmaHH> someone should make software cores so having 1000 threads makes sense. |
| 3862 |
PlasmaHH |
<PlasmaHH> put your credit card information in a comment just below main |
| 3884 |
PlasmaHH |
<PlasmaHH> no, c# is always faster than c++. sp_mfilter already proved it. |
| 3907 |
PlasmaHH |
<PlasmaHH> newGuy: it is. this channel is not a humanoid interface to your documentation. |
| 3962 |
PlasmaHH |
<PlasmaHH> the best programming concept is language oriented programming. for every problem, you first write a language which you can easily use to solve it |
| 4529 |
PlasmaHH |
<PlasmaHH> i - (-1) is 10 times faster than ++i on my machine!!!111oneone |
| 5055 |
PlasmaHH |
<PlasmaHH> my editor allows to open files and look at them |
| 5058 |
PlasmaHH |
<PlasmaHH> catunda: we are not your human interface to google |
| 5084 |
PlasmaHH |
<PlasmaHH> in c# you have to worry less about anything you do, you are pampered like a baby and the language will tell you if you pooped yourself |
| 5111 |
PlasmaHH |
<PlasmaHH> "lets see what software there is I could clone to learn programming" is one of the worst approaches in learning programming ever. its right after trying to learn from pwned |
| 5325 |
PlasmaHH |
<PlasmaHH> (this will be really funny if someone !rq s it after their dead) |
| 5338 |
PlasmaHH |
<PlasmaHH> you mean someone else could have reused the same number for another ip? |
| 5852 |
PlasmaHH |
<PlasmaHH> omfg. get out of my eyes. php "dev" trying to do c++ |
| 6072 |
PlasmaHH |
<PlasmaHH> !give vagothcpp windows |
| 6089 |
PlasmaHH |
<PlasmaHH> houston, we have an Adrinael! |
| 6138 |
PlasmaHH |
<PlasmaHH> someone should make gcc multithreaded... |
| 6144 |
PlasmaHH |
<PlasmaHH> and again it turns out that programming is luckily not for everyone |
| 6438 |
PlasmaHH |
<PlasmaHH> then it could theoretically really be possible |
| 6451 |
PlasmaHH |
<PlasmaHH> I recently thought that it could be a good idea to read the books I recommend myself... |
| 6452 |
PlasmaHH |
<PlasmaHH> KucukLucy: good and on paper and to read. so nothing for you obviously |
| 6497 |
PlasmaHH |
<PlasmaHH> thedarkone: weird things ask for weird solutions, like a testcase |
| 6505 |
PlasmaHH |
<PlasmaHH> pvh_sa|wrk: the other way round, you are cooperating with c++ now :P |
| 6516 |
PlasmaHH |
<PlasmaHH> you got to love those mistranslated error messages "os no support driver!" |
| 6647 |
PlasmaHH |
<PlasmaHH> all the passing by value. not using std::string where needed...all the c-ish functions, spaghettiy von neumann layoutnot using proper containers, zero-one-infinity violations... bah |
| 6733 |
PlasmaHH |
<PlasmaHH> yeah, that said in a channel where we normally pour sugar into peoples assholes |
| 6756 |
PlasmaHH |
<PlasmaHH> dlopen() is ub. |
| 6768 |
PlasmaHH |
<PlasmaHH> matt1: sure, we are just here to please you and to pour sugar into your ass |
| 6920 |
PlasmaHH |
<PlasmaHH> d1zzy: why do you need to get out for sex? |
| 6942 |
PlasmaHH |
<PlasmaHH> no sex as in no sex. not even the clinton variant. |
| 7559 |
PlasmaHH |
<PlasmaHH> ##C++ is not a nicer interface to google |
| 7560 |
PlasmaHH |
<PlasmaHH> thats the gazillionth time this same thing is grabbed... |
| 7561 |
PlasmaHH |
<PlasmaHH> [22:50:54] <MisterN> <PlasmaHH> orbitz: [22:49:59] <orbitz> why do people paste what someone said in responding to it <-- I have no idea <-- neither do i <-- is this irony? <-- gah, stfu, you are spamming my console |
| 7564 |
PlasmaHH |
<PlasmaHH> Bierwagen2: impulze is so right. |
| 7873 |
PlasmaHH |
<PlasmaHH> DralaFi: scroll up in your backlog for the last 1<<32 hours |
| 7986 |
PlasmaHH |
<PlasmaHH> litb: too late, we now think you are a complete moron |
| 8036 |
PlasmaHH |
<PlasmaHH> a pointer thats smarter than you |
| 8096 |
PlasmaHH |
<PlasmaHH> it was one of those guys fresh from university that got indoctrinated by the "the constant factor in the landau symbol does not count" |
| 8258 |
PlasmaHH |
<PlasmaHH> pasteles: so are you saying that you cannot explain it in english, or that english lacks the expressiveness to explain your problem? |
| 8308 |
PlasmaHH |
<PlasmaHH> I mean obviously php is so much more related to posix than what nolyc has to offer |
| 8318 |
PlasmaHH |
<PlasmaHH> !grab Simon1245 |
| 6167 |
PlasmaHH_ |
<PlasmaHH_> litb: my container is bigger than yours |
| 6168 |
PlasmaHH_ |
<PlasmaHH_> hell_lord: and what do you do then, since you cannot express such low level things like a 3d algorithm in that language? |
| 338 |
PointyHat |
<PointyHat> that is good news for people who love bad news |
| 6829 |
Pokshun |
<Pokshun> I come from Java land, I know all about "overengineering". |
| 5028 |
Polarina |
<Polarina> Who wants to design with me a intepreted computer programming language? |
| 7613 |
Polarina |
<Polarina> !quote Polarina |
| 7616 |
Polarina |
<Polarina> I have splash screens while my C++ VM is loading. |
| 6549 |
Pora |
<Pora> well boobies with acral-lentiginous melanoma between them |
| 7161 |
PovAddict |
<PovAddict> say that again so we can !grab it |
| 8276 |
PovAddict |
<PovAddict> go fork yourself |
| 7183 |
Powerover |
<Powerover> why do U think that? STL isn't very fast, the best way is write your own stack, heap, etc, |
| 3055 |
Pradalover |
<Pradalover> anybody here familiar with ruby on Rails..The Ruby On Rails Channel is full of Morons |
| 542 |
Prawntasm |
<Prawntasm> I like making up variable names. It's all the fun of... naming stuff, with none of the responsibility of a pet. |
| 92 |
Prime |
<Prime> I'll think of something smart to say someday too... |
| 235 |
Prime |
<Prime> The best practice is doing what you want, and learning things to accomplish it. |
| 239 |
Prime |
<Prime> ##C++, manly tea sippers making fun of eachother. |
| 322 |
Prime |
<Prime> I had this dream last night about a multi-user programming editor. Each user controlled his own cursor, and they all edited the same file at the same time. |
| 418 |
Prime |
* Prime kills some of the feverish excitement by pointing a few void pointers to themselves |
| 485 |
Prime |
<Prime> Stable? Isn't that like where horses sleep? |
| 535 |
Prime |
<Prime> That's because cylon wasn't written in Common Lisp. |
| 555 |
Prime |
* Prime spanks rubicant |
| 743 |
Prime |
<Prime> Why's producing vapourware such a laborious task? |
| 646 |
Prodos8 |
<Prodos8> orbitz : i had problems with C++ and c++ i now cast all tolower, and then my function how sends it to the speciual room works right |
| 2024 |
Promit |
<Promit> i just forget sometimes when i'm on a roll that not everybody can keep up, you know how it is. you get all excited about the topic and bam |
| 2032 |
Promit |
<Promit> i can draw realistic looking people, but i think that might be due to a vision impairment i have that causes everyone to look like stick figures |
| 1145 |
Prototyp1X29A |
<Prototyp1X29A> Esotericisms: take a pen and draw some obscene figures in your c book, and voila there is your c++ programming book |
| 2505 |
Pseudonym |
<Pseudonym> C++ is actually in a quantum superposition between "sucks completely" and "rocks completely". It falls into one of those states when you try it out on a project. |
| 2962 |
PsyMar |
<PsyMar> It's easy to use your computer as a web server. Just turn off your firewall and post your IP address in a warez chan |
| 2615 |
Psybur |
<Psybur> Interesting. My compiler bitches if I make it #include <iostream.h>, but it doesnt work if I ommit the .h |
| 1215 |
QMario |
<QMario> Oh, okay. Thank you. I am new to headers. :) |
| 1249 |
QMario |
<QMario> Does C++ have its own GUI? |
| 1250 |
QMario |
<QMario> Why can't everyone just use the same C++, and stop the confusion? |
| 1254 |
QMario |
<QMario> Why isn't "new" the same in C++ as in Java? |
| 2863 |
QMario |
<QMario> Hee. |
| 7245 |
QUADRESCENCE |
<QUADRESCENCE> no one will grab that |
| 349 |
Qantourisc |
<Qantourisc> pwned: lol think i found it .. i'm compiling with gcc again instead of G++ :D |
| 1921 |
Qantourisc |
<Qantourisc> what do do with integer when trying to write a crosscompatible program ? (i.e. A database with a socket) |
| 1968 |
Qantourisc |
<Qantourisc> any emacs users ? (since #emacs is not a friendly channel) |
| 3112 |
Qantourisc |
<Qantourisc> nolyc: the error comes from int& Function(){return 1;} |
| 6958 |
Quadrescence |
<Quadrescence> impulze: If you wanna be happy for the rest of your life, Never make a pretty women your wife, Go for my personal point of view, Get an ugly girl to marry you. |
| 7061 |
Quadrescence |
<Quadrescence> get outta my mouth, ya'damn hot dog |
| 7480 |
Quadrescence |
<Quadrescence> DID I HEAR PORN? |
| 7605 |
Quadrescence |
<Quadrescence> triplie: missyjane costs $7.43 after Bernanke's over-estimating decrease of the interest rate. |
| 7965 |
Quadrescence |
<Quadrescence> fow: Use Debian or ... UBUNTU. |
| 8198 |
Quadrescence |
* Quadrescence ejagnulates. |
| 8242 |
Quadrescence |
<Quadrescence> Good news everyone! Firefox 3.5b4 is now even slower than before! |
| 8405 |
Quadrescence |
<Quadrescence> Cecen: Haha, you should record it. |
| 1178 |
Quequeg |
<Quequeg> only good football is my foot slowly massaging my balls. ;) |
| 4922 |
RaDa-X |
<RaDa-X> I am a good man |
| 1810 |
Rachel |
<Rachel> got a dick stuck infront of my vigina |
| 278 |
RadSurfer |
* RadSurfer takes an anti-kinky vaccine |
| 672 |
RadSurfer |
<RadSurfer> Î <--- official boner character |
| 758 |
RadSurfer |
<RadSurfer> talk about gay! |
| 852 |
RadSurfer |
<RadSurfer> ok! who has seen da return of da Furby commercials ? |
| 930 |
RadSurfer |
<RadSurfer> one of these days, soon, being gay is da only way to be cool. |
| 1164 |
RadSurfer |
* RadSurfer Does like 'em hairy. |
| 1165 |
RadSurfer |
<RadSurfer> definitely huggable. |
| 1166 |
RadSurfer |
<RadSurfer> did you know: coders exchange trade secrets while they cuddle. its the only way they can. everyone else might be listening. |
| 1167 |
RadSurfer |
<RadSurfer> ok. thats enough grabs. I'm gettin bruised. |
| 1168 |
RadSurfer |
<RadSurfer> I likes dat. |
| 3273 |
Radagaisus |
<Radagaisus> yeah, sorry my humor ins't based on linux distributions |
| 153 |
Raf256 |
<Raf256> real programers use Visual Basic. |
| 1483 |
RaidAtWork |
<RaidAtWork> raf256, Uhh, you are sitting in an IRC channel, a channel that revolves around C++, a programming language, there are 367 other people in here besides you, and you are pretenting to be in an RPG .. hrm .. |
| 1976 |
RaidAtWork |
<RaidAtWork> If people didn't "reinvent the wheel" we wouldn't have the software technology we have today |
| 2027 |
RaidAtWork |
<RaidAtWork> deadchip, class Child : public Mom, public Dad, private Mailman { |
| 2038 |
RaidAtWork |
<RaidAtWork> Hehe, the only thing I really remember about dutch is "neuken in de keuken" :P |
| 2125 |
RaidAtWork |
<RaidAtWork> orbitz, And you've got pornication issues |
| 2156 |
RaidAtWork |
<RaidAtWork> The city is on fucking drugs .. The circus is in town and they decided they are going to parade the elephants down Main street right through downtown during rush hour |
| 2372 |
RaidAtWork |
<RaidAtWork> My fiancee is going to kill me, I spilled a drop of Sesame Chicken sauce on my new shirt :( :P |
| 2448 |
RaidAtWork |
<RaidAtWork> qalam, The gay flag isn't even a rainbow (Pay close attention to the colors) |
| 2458 |
RaidAtWork |
<RaidAtWork> 15 minutes and counting till the I get to enjoy some time off from sitting here doing nothing at work but talking on the IRC, atleast at home I can talk on the IRC in comfort! |
| 1102 |
RaidLapTop_ |
<RaidLapTop_> Your destiny may lie in the art of shoveling cow shit |
| 2845 |
RaidWork |
<RaidWork> Haha .. <girl> Hi all ... <##C++> Holy shit! A chick .. Uhh .. Hey baby, wanna see my unsigned long pointer? .... <girl> wtf? /quit |
| 2895 |
RaidWork |
<RaidWork> So yeah, I'd be more than happy to work there .. Morals are pointless, morals won't feed my kids or put them through college |
| 2896 |
RaidWork |
<RaidWork> vi sucks in everything |
| 3026 |
RaidWork |
<RaidWork> Ox41464b, Or you could spend less time than it took to think of that nickname, and download a free, recent compiler |
| 3029 |
RaidWork |
<RaidWork> Ox41464b, Doing 'using namespace std;' is stupid, wrong, ignorant, childish, foolish, idiotic, etc, etc |
| 3030 |
RaidWork |
<RaidWork> raf256, I could care less if you agree with me or not, you don't work for me and I don't have to see your code every day, I don't give a shit if you do 'namespace titties = std;' and type 'titties::string' everywhere |
| 3031 |
RaidWork |
<RaidWork> The VC++/VC++.NET form builder is absolutely pathetic, I've seen better dialog builders for mIRC script dialogs, than that thing |
| 3166 |
RaidWork |
* RaidWork imagines Metabol walking down the street, seeing another person walk by, and saying "std::valarray is messed up, pass it on" |
| 3226 |
RaidWork |
<RaidWork> pwned, Celius requires decimal points to be as accurate as farenheit |
| 3669 |
RaidWork |
<RaidWork> ha .. Everytime I play these scratch off lotto tickets I win |
| 2753 |
Raider1 |
<Raider1> curveater, How long did it take you to type all that crap out ?? ... I find it hard to believe you typed all that out and not once did you say to yourself "What the hell am I doing?? This can't be the best way" |
| 2756 |
Raider1 |
<Raider1> raf256, Got laid at 3am this morning, I'm good till the woman gets out of work tonight |
| 2791 |
Raider1 |
<Raider1> In fact, the government here is coming up with a new plan .. They are going to put GPS units in hybrids to track milage usage, so the money you save on fuel, you'll have to pay in milage taxes, so the government can make up for the taxes lost on hybrids |
| 2793 |
Raider1 |
* Raider1 runs around outside with a blowtorch in an attempt to stop the snow from falling |
| 3044 |
Raider1 |
<Raider1> Man I'm a fucking moron |
| 3417 |
Raider1 |
<Raider1> Other times I take either a Perc and a Vic, or a Perc and a Codeine, or a Vic and a Codein |
| 3536 |
Raider1 |
<Raider1> Obfuscate, But compilers also undergo many many many years of development utilizing the compiled knowledge of dozens to hundreds to thousands of different developers which could equate to a combined several hundred thousand years worth of programming experience, versus you. |
| 3644 |
Raider1 |
<Raider1> Eelis, For the 78485728905th time in the last what, 3-4 years ?? I really don't care what you think .. As always, you know how to /ignore |
| 3765 |
Raider1 |
<Raider1> womblesong, Your macro is completely useless .. Not only is it useless, its stupid, and makes it extremely easy to confuse people |
| 3821 |
Raider1 |
<Raider1> I know nothing! I'm a fraud! I've achieved everything in my life through pure luck and chance, and all that I've achieved is pure fake |
| 3851 |
Raider1 |
<Raider1> *shrug*, I saw the word "method", my nolyc trigger finger was itchy, so I scratched it :P |
| 5178 |
Raider1 |
<Raider1> heheh .. I've made several IRC clients, and still like mIRC better |
| 1085 |
Raider_ |
<Raider_> The next offroad truck I build will have a snorkel that goes all the way to the roof |
| 2232 |
Raider_ |
<Raider_> uh ok, woman is home, better clean up all the boxes from the new stuff heh |
| 4252 |
Ralith |
<Ralith> >_> |
| 4412 |
Ralith |
<Ralith> Inside: it's probably just an improbable permutation of the gargling. |
| 1251 |
Ralle |
<Ralle> is there a big difference between php and c++? |
| 1252 |
Ralle |
<Ralle> is there a different between compiling in windows and linux? |
| 7235 |
RavenSlay3r |
<RavenSlay3r> I should start getting my news from ##C++ |
| 1495 |
Ravi_ |
<Ravi_> yes, C++ is a good place to kill hours |
| 2580 |
RaydenGRABABLE |
<RaydenGRABABLE> and want to rescale it from -5 to 5 |
| 2718 |
Raz |
<Raz> ah crap, this book is explaining set with other things I haven't learned yet |
| 7776 |
ReBoot77 |
<ReBoot77> C++ is so confusing! i love it! |
| 1592 |
Reikinio |
<Reikinio> Eelis: :), i didn't understand what you said "dinkumware reference" what is that? |
| 7169 |
Repentinus |
<Repentinus> Can I hace const std>]] |
| 3248 |
Rethguals |
<Rethguals> omg! __d's nickname is against channel policy :p |
| 5558 |
Rev_ |
<Rev_> microsoft is probably named after it's founder's nether regions |
| 6609 |
Rick_7777 |
<Rick_7777> that's why I said I looked for *volunteers*, not *mercenaries* |
| 3771 |
Ricket |
<Ricket> nolyc: thanks for the help, I appreciate it |
| 4327 |
Riyonuk |
<Riyonuk> so an engine is like a level maker for just you, so you dont have to constantly code? |
| 994 |
Robert_W_ |
<Robert_W_> how can i realisize a dynamic object cout in a list? |
| 6321 |
Robin__ |
<Robin__> Jafet, there are Classes in ASM but they are HARD to find :P |
| 4729 |
RockerMONO |
* RockerMONO fixes the echo issue |
| 6887 |
Rodrigo_M |
<Rodrigo_M> anybody can help me with vb.net and sql? |
| 6888 |
Rodrigo_M |
<Rodrigo_M> i tried #vb.net but nobody is live |
| 2151 |
RogueJedi |
<RogueJedi> Peregrine: Will do. If I'm doing something obviously stupid I'm going to be upset and never code again without caffeine. |
| 7459 |
Roland123 |
<Roland123> computers have so much ram these days.... some memory leakage shouldn't be a problem :D |
| 763 |
Roots |
<Roots> Oh, I initally read the above as if you were learning C++ from god himself. I was like "WTF!? There's C++ in the bible???" |
| 1073 |
Roots |
<Roots> When I have a question about life, the first place I come to for answers is #sdl |
| 1248 |
RuDeDoGg |
<RuDeDoGg> their OS is fairly priced |
| 2837 |
Run |
<Run> !quote Jessicatz |
| 5153 |
Run |
<Run> I don't understand this... I'm filling a vector with data... but in the end, it contains rubbish :/ |
| 5159 |
Run |
<Run> Carbonflux: I remove all asserts before selling it as closed source - then I can always say that their filesystem must have been too corrupted. ;) |
| 6811 |
Run |
<Run> I think that every IRC network should make a database of EVERY IP. If a new IP connects that has never been on IRC before, it should only be allowed to join #newbies and #help for a week, unless it is specifically invited by an op with IP that has already been on IRC for a year. |
| 6817 |
Run |
<Run> I log everything |
| 6962 |
Run |
<Run> So, gay is definitely good imho. |
| 4590 |
Runtime |
<Runtime> Learn assembly then C++ will come naturally |
| 4603 |
Runtime |
<Runtime> It is the best, theres no question of opinion |
| 4679 |
Runtime |
<Runtime> Any dudes around? |
| 4680 |
Runtime |
<Runtime> Of course, James Bond is always cunning and resourceful |
| 4686 |
Runtime |
<Runtime> In other networks there arent many active people, and many jerks |
| 4687 |
Runtime |
<Runtime> Cause I'm a l33t h4x0r and I needed to impress a hot girl |
| 4704 |
Runtime |
<Runtime> HI! Wooters! |
| 4709 |
Runtime |
<Runtime> Yeah |
| 4710 |
Runtime |
<Runtime> later |
| 4753 |
Runtime |
<Runtime> I'm gonna party at the zoo |
| 6213 |
Ryuho |
<Ryuho> hey i'm coding in C++ right now, what a coincedence |
| 6214 |
Ryuho |
<Ryuho> wow geordi is pretty awesome |
| 5087 |
S4nD3r |
<S4nD3r> hi there... who could help me in R++ ?? |
| 6726 |
SAHChandler |
<SAHChandler> is there anything in iostream that basically performs the equivalent of a /clear in IRC? |
| 1256 |
SBNet |
<SBNet> i would use MSVC 6 but i don't feel like updating it so it will be compatible with the C++ Standard |
| 4584 |
SGspecial150 |
<SGspecial150> I am reading I am learning and if I wanted to pay someone I would call tech support |
| 4251 |
SJrX |
<SJrX> I think I'll do this in PHP |
| 8278 |
SN95 |
<SN95> dont stick it in unless you know its solid |
| 1613 |
SP|Sorren |
<SP|Sorren> you people are strange. |
| 8219 |
Sa[i]nT |
<Sa[i]nT> Anyone know of an advanced tutorial focusing on the many uses of structs? |
| 5122 |
SadraY |
<SadraY> i have a .cpp file how can i convert that to a .o file? |
| 1605 |
SamWeasley |
<SamWeasley> Someone knows a good Wiki system in C/C++? |
| 4341 |
Samonoske |
<Samonoske> where would i put cin.get::std(); to get my exe to stay on the screen longer. I cannot find the return 0; |
| 3429 |
Sandesh |
<Sandesh> I even encountered a book recently with the title "how to learn c++ through java!" :) |
| 2683 |
SauLus_ |
<SauLus_> I also do blank |
| 1924 |
Saulius |
<Saulius> raf256, since his nick was LeBronJames, i assumed he was the basketball player, now i'm starting to think, that he lied :( |
| 7821 |
Sausage |
<Sausage> Boner. |
| 4278 |
Schroeder2 |
<Schroeder2> PhyloGenesis: yes, ##gaybuttsex |
| 7466 |
SciF0r |
<SciF0r> the only UB is little vs big endian imo ;) |
| 545 |
ScornInPC |
<ScornInPC> can u analize my code? |
| 2058 |
Scorp1on |
<Scorp1on> ok then something easier. how would one program a port-forwarder? |
| 2210 |
ScriptDevil |
* ScriptDevil is looking for a Herb Schildt book , was his fav java author |
| 6708 |
ScriptKidde |
<ScriptKidde> can anybody tell me a homer pc user guide ? Please ? :) |
| 4536 |
SeanConnery |
<SeanConnery> godling, your dad's playboy collection is not a library |
| 4665 |
SeanConnery |
<SeanConnery> I have found that the best C++ program is the one that is not written at all |
| 4818 |
SeanConnery |
<SeanConnery> I thought sizeof(std::string) should give you the length of the string? |
| 4959 |
Sean_ |
<Sean_> What are some of the benefits of C++ over RealBasic? |
| 4414 |
Securicore |
<Securicore> Thanks for the help... very mature |
| 859 |
Selecter |
<Selecter> I suppose all englishman code VisualBasic |
| 8262 |
Serpardum |
<Serpardum> but remember, as soon as you make something foolproof they come out with a better fool. |
| 3475 |
ServerCrash |
<ServerCrash> is there any method of converting bash script to c++ executable ? |
| 7883 |
SeySayux |
<SeySayux> since my program only compiles with gcc, i can rely on that behaviour |
| 8118 |
SeySayux |
<SeySayux> In your words, 'I tried to buy a Renault in a Renault shop, but there were no salesmen available, so I came into this Ford shop. I told you that I'd like a car and went to Renault. You responded that you don't sell Renaults. So I said; I don't bother, just give me a ****ing car!' |
| 8226 |
SeySayux |
<SeySayux> 7) I wrote my own array class, tons better than c arrays, boost::array, std::array or any other **** for that matter |
| 8227 |
SeySayux |
<SeySayux> 10) Since I already need to reimplement most of the STL (not counting stuff that's in C++0x, as it isn't yet official), then I better reimplement everything... |
| 8257 |
SeySayux |
<SeySayux> popen? is that plural for pope? |
| 8336 |
SeySayux |
<SeySayux> !give vagothcpp realos |
| 8366 |
SeySayux |
<SeySayux> That I don't have to write class Exception : public GCAble, public Serializable, public HasSlots, public WellIThinkThatsAllObjectCurrentlyDoesAndIAintGonnaAddMore |
| 8392 |
SeySayux |
<SeySayux> kniht: Honestly, do I look that stupid? |
| 2413 |
Shadow_mil |
<Shadow_mil> a vecwho? |
| 2449 |
Shadow_mil |
<Shadow_mil> Hmmmm... How am I to react to a function requireing a variable type of void? |
| 3589 |
Shadow_mil2 |
<Shadow_mil2> Adrinael, so namespaces are kinda like objects |
| 943 |
Shadowcat |
<Shadowcat> I'm willing to bet that my gentoo stage1 optimized GCC beats the crap out of MSVC++ |
| 3860 |
Shaffox |
<Shaffox> i thought g++ was better than gcc, or am i wrong ? |
| 6382 |
Shammah |
<Shammah> My thing spins like hell ._. |
| 6525 |
Shammah |
<Shammah> Thinking too much in C++ |
| 6241 |
SherlawkDragon |
<SherlawkDragon> what is 666? |
| 6242 |
SherlawkDragon |
<SherlawkDragon> 01000100 01001111 00100000 01001001 01010100 00100001 |
| 6317 |
SherlawkDragon |
<SherlawkDragon> I couldn't find that on CPlusPlus.com |
| 6586 |
SherlawkDragon |
<SherlawkDragon> I'm not putting a 18-wheeler's wheel on my sports car, that'd be stupid. |
| 6594 |
SherlawkDragon |
<SherlawkDragon> vawjrwrk> they're not trying to be incompatible. it's everyone else who wants to stay on obsolete principles |
| 6597 |
SherlawkDragon |
<SherlawkDragon> DO IT LIVE!! FUCK IT!!! |
| 5070 |
Shifty |
* Shifty wonders if the cheese is bald |
| 3975 |
Shona |
<Shona> it worked on the other compiler |
| 2527 |
Shoooooot |
<Shoooooot> how do you call another function from main()? |
| 1700 |
Shootdown |
<Shootdown> what is the Englisg name for "punteros" ? Pointers ? |
| 7891 |
SilentPenguin |
* SilentPenguin is unquoteable |
| 1428 |
Silex |
<Silex> emacs is a nice OS, but it lacks a good text editor |
| 1987 |
Silex |
<Silex> struct bread : public base{}; void bake(base b){} bake(bread()); // the bread was sliced |
| 2363 |
Silex |
<Silex> There are only 10 types of people in teh world, those who think they know the joke, those who don't get it, and those who know more than base 2. |
| 2596 |
Silex |
<Silex> run windows to run wmare to run linux to run wine to run remotelyanywhere and take control of the windows box and close wmware |
| 6092 |
Silex^^ |
<Silex^^> you might want to explain yourself Lede |
| 8317 |
Simon1245 |
<Simon1245> _NeonTiger_, Oh so i have to make my own program to make a game? |
| 4891 |
SirChasm |
<SirChasm> i basically wanna run some cout statements only in debug mode. from what i'm reading, I can do that by doing "assert(std::cout << "hello"); |
| 5023 |
Sir_Fawnpug |
<Sir_Fawnpug> I bet the spanish take particular offense to having their language reduced to a library. |
| 5117 |
Sir_Fawnpug |
<Sir_Fawnpug> (But I just woke up) |
| 5808 |
Sir_Fawnpug |
<Sir_Fawnpug> NameAlreadyInUse, it's OK to violate the standards if my code works only some of the time! |
| 5809 |
Sir_Fawnpug |
<Sir_Fawnpug> I had to debug a coworker's code, he had some variable in it named "woob". I asked him if he knew what it did, and he replied with a blank stare. |
| 6004 |
Sir_Fawnpug |
<Sir_Fawnpug> Hold on, my ashtray caught on fire again |
| 7541 |
Sir_Fawnpug |
<Sir_Fawnpug> This world needs more pornographic robots. |
| 6228 |
Sivam |
<Sivam> hmm, let me try again. it sucks me here |
| 6821 |
SkipStaa |
<SkipStaa> Looking to hire a professional programmer, please contact me via PM if interested |
| 5337 |
Skwerl |
<Skwerl> 0/n is zero, and n/1 is n |
| 7442 |
Skylar33 |
<Skylar33> anyone know how to turn .jad file to .java |
| 4799 |
Slade |
<Slade> the #winapi ppl aren't answering, and its a simple SQL query question |
| 5811 |
Slam___ |
<Slam___> sorry, i did found in 3 section |
| 4432 |
SlashLife |
<SlashLife> Everyone knows that 6*9 is 42 :/ |
| 6104 |
SlashLife |
<SlashLife> First thing that popped into my mind: "On no, not /ANOTHER/ Oblivion gate. >_<" |
| 6396 |
SlashLife |
<SlashLife> Formentar: Oh, darn. // end padding |
| 6711 |
SlashLife |
<SlashLife> It artificial intelligently decided to ignore you. |
| 6889 |
SlashLife |
<SlashLife> Formentar: C++ and sex are mutually exclusive. :< |
| 7901 |
SlashLife |
<SlashLife> Uhh ... |
| 2779 |
Slowking_Man |
<Slowking_Man> YOU SHALL NOT PASS VOID* |
| 2816 |
Slowking_Man |
<Slowking_Man> !give cancer boost |
| 3555 |
Slowking_Man |
<Slowking_Man> I program on a Commodore 64 |
| 444 |
Smak |
<Smak> Mmmm, pus... its whats for dinner |
| 445 |
Smak |
<Smak> Yea, once you have sucked a zit dry off someone elses body, it takes alot to gross you out. |
| 514 |
Smerdyakov |
<Smerdyakov> godling, I think he did not succeed in be funny! |
| 2663 |
Smirnov |
<Smirnov> if I use boost it'll be a lot harder to wrap my code later with swig |
| 2678 |
Smirnov |
<Smirnov> we have dynamic execution, why not dynamic code? |
| 4995 |
Smirnov |
<Smirnov> litb: why would i need books? i told you im getting a degree in this field |
| 2780 |
Smokey` |
<Smokey`> Java shits me off something chronic,. |
| 259 |
SnakeChomp |
<SnakeChomp> ville: well I assume I did, but vs2003 is claiming that it "cannot convert from 'int' to 'int'" |
| 313 |
SnakeChomp |
<SnakeChomp> its free, its a book, read it |
| 780 |
SnakeChomp |
<SnakeChomp> the quotes database sucks |
| 836 |
SnakeChomp |
<SnakeChomp> Adrinael: tell me you edited your face because that just make me rofl for sec there |
| 1078 |
SnakeChomp |
<SnakeChomp> it should be "read the fabulous manual" |
| 1202 |
SnakeChomp |
<SnakeChomp> Wow, auto_ptr really doesn't suck when you use it for what it was desinged to be used =p |
| 1375 |
SnakeChomp |
<SnakeChomp> damn you windows |
| 1393 |
SnakeChomp |
<SnakeChomp> it rejoined when i didnt want it to and reconnected after being ghosted |
| 1394 |
SnakeChomp |
<SnakeChomp> xchat sucks is all |
| 1396 |
SnakeChomp |
<SnakeChomp> my brain proceeded to hurt |
| 2475 |
SnakeChomp |
<SnakeChomp> Adrinael: do you have any hobbies asside frmo amassing a collection of completely random pictures |
| 2700 |
SnakeChomp |
<SnakeChomp> deadchip: I answered your question. You then disputed my answer. That sir is an argument |
| 2800 |
SnakeChomp |
<SnakeChomp> deadchip: you are attempting to redeem yourself, but such a task is indeed impossble and only gives us more ammo for later |
| 2926 |
SnakeChomp |
<SnakeChomp> brennanos: eleventy million seconds squared |
| 4663 |
SnakeChomp |
<SnakeChomp> evilgeek: if you have hundreds of millions of something, you cannot even index an array of them with a 32bit integer. So, obviously you are on a 64 bit platform, and obviously you have way more memory than existnig 32bit platforms, so again, 4 bytes makes no difference |
| 4684 |
SnakeChomp |
<SnakeChomp> help mode disengaged. returning to sleep mode. |
| 7127 |
SnapyGapi |
<SnapyGapi> in dev c++ theres a error `bool' is now a keyword |
| 7568 |
SnoFox |
<SnoFox> [o: I've only seen a few Mac users; they seem smart but act like tards. |
| 28 |
Snrrrub |
<Snrrrub> I've met some horny squirrels. |
| 1773 |
Snrrrub |
<Snrrrub> hooray for contentation. |
| 1862 |
Snrrrub |
<Snrrrub> you know, every time I type python it comes out as "pythong" first... |
| 1863 |
Snrrrub |
<Snrrrub> I hate how this channel keeps me from what I'm doing instead of helping me with my problems. :P |
| 7935 |
Snrrrub |
<Snrrrub> whaa, is that the only one?! |
| 7936 |
Snrrrub |
<Snrrrub> That wasn't a better quote :( |
| 7938 |
Snrrrub |
<Snrrrub> People grabbed the lamest quotes ever for me. |
| 7940 |
Snrrrub |
<Snrrrub> So Borat-esque. |
| 1303 |
SoNiKu |
<SoNiKu> wow, my brain just rebooted |
| 1507 |
SoNiKu |
<SoNiKu> actually, i never knew the difference between /dev/random and /dev/uranmom, though I honestly never attempted to look it up |
| 1627 |
Solarion |
<Solarion> Eelis: does concrete programming cement good programming practices? |
| 903 |
SoleKiller |
<SoleKiller> like norton ghost only without the norton |
| 4531 |
Sonicadvance1 |
<Sonicadvance1> Can someone awesome teach me how to be awesome? :D |
| 2247 |
SonnyBurnett |
<SonnyBurnett> Does somebody have a plotPixel function for C++ using asm inline? |
| 2249 |
SonnyBurnett |
<SonnyBurnett> pwned, using int's is very slow |
| 4589 |
Sortkatt |
<Sortkatt> I am looking forward to going hard-and-heavy at some regular expressions |
| 5187 |
Sortkatt |
<Sortkatt> ah.. there it is :) I remember reading that somewhere.. |
| 5251 |
Sortkatt |
<Sortkatt> gentoo faq about optimization: " Things are really unstable and I'm using -O9 -ffast-math -fomit-frame-pointer optimizations. What gives?" |
| 6397 |
Sortkatt |
<Sortkatt> xystic: thanks. I has been corrected :) |
| 6587 |
Sortkatt |
<Sortkatt> piece of junk that has less errors than your granma on rollerblades! |
| 6707 |
Sortkatt |
<Sortkatt> I should really get a t-shirt with the following letters in capital: SFINAE |
| 4745 |
Sortkatt_ |
<Sortkatt_> bah... i'll just make a template |
| 4824 |
Sortkatt_ |
<Sortkatt_> how nerdy are you if you call your girlfriends breasts "dangling pointers" |
| 5737 |
Sortkatt_ |
<Sortkatt_> All this talk from weirdos gives me a hardon |
| 5043 |
Spacecat_ |
<Spacecat_> k one more question for you guys, i need a list of what every command does on c++ |
| 4180 |
Spark |
<Spark> because getting configure to do anything is like getting an elephant to tap dance |
| 4563 |
Spark |
<Spark> to be fair, i haven't seen any evidence suggesting everyone is a preop transexual balancing a cheap dildo on his/her head |
| 5207 |
Spark |
<Spark> the wii isn't powerful enough for std::string |
| 6954 |
Spark |
<Spark> it's easy to add syntax that does not overlap with existing programs |
| 7551 |
Spark |
<Spark> the best students already know how to program anyway, so it's a joke |
| 8331 |
Spark |
<Spark> usually when you get a girl friend, you stop having a life |
| 7916 |
Spaz |
<Spaz> (insert comments about your mother here) |
| 7990 |
Spaz |
* Spaz is done |
| 7993 |
Spaz |
<Spaz> Almathea_, stop grabbing people for no reason. |
| 7996 |
Spaz |
<Spaz> you only grab when it's something funny. |
| 8052 |
Spaz |
<Spaz> yeah, i'm competing for the world idiot title |
| 8109 |
Spaz |
<Spaz> "yo i'm fappin' wit mah homies" |
| 8115 |
Spaz |
<Spaz> i'm not one of those crazy idiots you see on TV |
| 8240 |
Spaz |
<Spaz> fow, i like the sound of mp3's more than FLAC tbh. |
| 8247 |
Spaz |
<Spaz> I'm coocoo for cocoa puffs! |
| 6786 |
Speeder |
<Speeder> there are a way to not use headers on C++? |
| 6271 |
Speedo_ |
<Speedo_> jordan__ : It is a whole processing stuff. Widing is or more less influenced by thiord oirder binary assesments the kernel scheduler grants for any running local objects. Bytes are processed alongway with that mere randmoness in mind. Nobody can predict an electron in the processor's carrier. |
| 6273 |
Speedo_ |
<Speedo_> frobb : The reader's point of view is irrelevant. |
| 6276 |
Speedo_ |
<Speedo_> Spark : Ahok.Do the bullets impact on the skybox ? |
| 6403 |
Speedo_ |
<Speedo_> Before getting married I plan to have a big mansion full of girls :) |
| 5276 |
Spell |
<Spell> Can plz. sb. tell me a good (Mouse and Keyboard-)Input Lib for games? I´ve searched in web but I didnt found something. |
| 5258 |
Spion |
<Spion> I have no grabs :( |
| 5311 |
Spion |
<Spion> and I never divide by zero (always add + 0.01 in the cases where the divider could be zero) |
| 5394 |
Spion |
<Spion> I'm not sure howcome beer is so connected with boobs |
| 5666 |
Spion |
<Spion> linked boobs |
| 5670 |
Spion |
<Spion> How much bits would a bitset set if a bitset could set bits? |
| 5887 |
Spion |
<Spion> 2gigs is enough for just about anything I can think of |
| 6582 |
Spion |
<Spion> YouTube is a very great tube, on it you can see people who have made moving pictures, and put their moving picture through a bunch of gigawatts, and gilgabites, until it is on YouTube's tubes. These tubes can be viewed by other chaps and can be put on other tubes, so whether you're watching a moving picture about flying machines or the new telegraph, you can always receive jollys at YouTube, and have a gay ol' time. |
| 6699 |
Spion |
<Spion> Though I did lol @ "<miles33> triplie: it was those damn dirty apes wasnt it? <triplie> miles33: most distro's don't ship with them" |
| 7367 |
Spion |
<Spion> om-nom-nom |
| 7604 |
Spion |
<Spion> Drinking on IRC beats drinking alone. |
| 7718 |
Spion |
<Spion> Feel dirty as much as you like. |
| 7737 |
Spion |
<Spion> Unless you're in the slave market. |
| 5576 |
Spion_ |
<Spion_> What is the first program of an emo programmer? Goodbye World |
| 5648 |
Spion_ |
<Spion_> quilzo, but I wanted to see how you play when you are sober |
| 5937 |
Spion_ |
<Spion_> I will undress if you give me 12 |
| 1830 |
SqUe |
<SqUe> Peregrine_Falcon I am begging for help :( |
| 107 |
Squall` |
<Squall`> pedantic: you're my favorite gcc switch <3 |
| 121 |
Squall` |
<Squall`> i find endangered dolphins much more satisfying |
| 199 |
Squall` |
<Squall`> blank has lots of PMS |
| 252 |
Squall` |
<Squall`> you people suck at grabbing me where i want to be grabbed |
| 2105 |
Squall` |
<Squall`> diego_, people were mean to me too. Until I killed one of the regulars. That's the only way to get respect around here. Oh, and you can't kill me either. It's a channel rule. |
| 2234 |
Squall` |
<Squall`> I think glen_quagmire, quilzo, and raf256 are all the same person. |
| 2308 |
Squall` |
<Squall`> raf256, dude, everyone knows C++ sucks. |
| 2318 |
Squall` |
<Squall`> Darn, I was trying to get that quote grabbed... |
| 2378 |
Squall` |
<Squall`> PlasmaHH, Oh, um... I thought calling things bloated makes me look smarter. |
| 3659 |
Squall` |
<Squall`> What kind of perverted sicko plays with pointers? |
| 7126 |
Square |
<Square> I was thinking of making a program like skype that does audio and video, accept with lower latency, and you can implement it into facebook, myspace, and cellphones. so you could call your friends that are logged into facebook and stuff |
| 7159 |
Square |
<Square> in c++ pointers seem to just point to some number. I dont see any hex with 0x |
| 3442 |
Squider |
<Squider> hey does anyone have some free food in the fridge near palo alto CA? |
| 3695 |
Squider |
<Squider> agh let me just add that to the list of things i wish i never said |
| 3716 |
Squider |
<Squider> do you know the 4000 first digits of 24 * Inf ? |
| 2167 |
Srecko |
<Srecko> Why would you use C++ if you can use C? |
| 2170 |
Srecko |
<Srecko> I am uselles |
| 3692 |
StaZ[home] |
<StaZ[home]> me22 i know and i love to disturb you guys -_- |
| 2899 |
StaZ[work] |
<StaZ[work]> people here don't speak, they call nolyc :P |
| 1223 |
Starbuck |
<Starbuck> Anduin i'm a fairly stupid compiler. |
| 8172 |
Statharas |
<Statharas> this channel was supposed to help.... -.- |
| 3058 |
Stellar |
<Stellar> #winapi ? how do I get there from here? |
| 7187 |
Stigggy |
<Stigggy> im good with while loops but i dont much about for |
| 1322 |
StoneCybh |
<StoneCybh> pwned: nah, i just wear 'em dirty |
| 1307 |
StoneCypher |
<StoneCypher> godling: to answer that makes a petty argument, but unfortunately it's also the surest way to get you to not waste time with some asinine sexual theory. it's been almost 14 hours. |
| 3218 |
Stryyker |
<Stryyker> I guess Jesus died for the sins and masturbation is a sin to some. He earned the right to tug away. |
| 3788 |
Stryyker |
<Stryyker> One day I'll understand my logs of this channel :) |
| 316 |
SubZero |
<SubZero> what is agood book to learn design patterns |
| 3045 |
Sulo_Seppa |
<Sulo_Seppa> when inheritance is stretched over the base class to the superclass like a condom will it be used as would a superclass to a predefined class to which is holding the base class to inherit the superclass? |
| 4878 |
Sunk |
<Sunk> i still have nightmares about being around those muslims.... horrible.. just horrible people |
| 879 |
Supaplex |
<Supaplex> hell: ... goto hell; |
| 8159 |
SuperHead22 |
<SuperHead22> why while(2) it works betterthan while (1) ? |
| 7960 |
Superman25 |
<Superman25> mature is overrated |
| 7963 |
Superman25 |
<Superman25> is ville a bot? |
| 2137 |
Suprano- |
<Suprano-> omg i never saw such expressions |
| 3283 |
Suzy_Creamcheese |
<Suzy_Creamcheese> i totally want to have a butch transvestite alter ego where i'd be named suzy, and be in a synth-riot-grrl band |
| 3296 |
Suzy_Creamcheese |
<Suzy_Creamcheese> yeah, i normally comment my code when i'm stoned, cause otherwise i get confused and want to go to sleep |
| 7823 |
Sybil |
<Sybil> pragma_> ville: he's not thinking about code, unfortunately -- he's bullshitting about knowing how to program. |
| 3095 |
TAsn |
<TAsn> profile? what's that? |
| 2598 |
TD |
<TD> is nolyc a bot or a person with a lot of macros? |
| 812 |
TRK |
<TRK> wtrf does the word semenpore mean? |
| 3524 |
TTT |
<TTT> are you idiot? |
| 1258 |
Tae |
<Tae> i already have a book, im not gonna go and read another one |
| 5845 |
TaffyMonster |
<TaffyMonster> the teacher kept insisting that "int" meant integer in all cases except for the main function when it apparently meant "initialize" |
| 5322 |
Talemon |
<Talemon> hey, can someone offer me an article or a document on how to implement a text parser? |
| 5332 |
Tanya |
<Tanya> *** |
| 7797 |
Tefaj |
<Tefaj> Is that your right or my right? |
| 4631 |
TeleTubbies_|_ |
<TeleTubbies_|_> I forgot, I already know. |
| 6210 |
Terabyte |
<Terabyte> hey i just found a random symbol in some source code, symbol is anybody know what this is? |
| 6603 |
Terabyte |
<Terabyte> they seem to be funny quotes |
| 7683 |
Terabyte |
<Terabyte> where do these quotes come from? |
| 7851 |
Terabyte |
<Terabyte> hahar! i said fuck on the internet |
| 7826 |
Terabyte_ |
<Terabyte_> twobytes, well it compiles, but what's a segfault? |
| 7110 |
Tetracomm |
<Tetracomm> Ok, so #include <s*> then? |
| 306 |
TheBunny |
<TheBunny> Crap, dinner, I'll finish this later... |
| 2385 |
TheDebugger |
<TheDebugger> Ah! Corba! OMG! I can't stand that, bye |
| 8340 |
TheDracle |
<TheDracle> Debugger, .NET is awesome, it was engineered by the same guy who made Borland C++. C# is a great language, just not significantly different or better than Java. |
| 4105 |
TheGoldDIggah |
<TheGoldDIggah> sorry, i never really used nix systems or opensource for that matter |
| 5548 |
TheLorax |
<TheLorax> I'm so pumped for the next C++ standard. |
| 6146 |
TheLorax |
<TheLorax> who assigns the rq's? |
| 6170 |
TheLorax |
<TheLorax> I feel so powerful |
| 8152 |
TheVinn |
<TheVinn> In C++, friends can access each others' private members. |
| 8376 |
TheVinn |
<TheVinn> my definition of stl is any header file with templates |
| 339 |
The_SShow |
<The_SShow> im in a bind with tcp/ip |
| 8301 |
Theyain_the_Fox |
<Theyain_the_Fox> That was my problem, although after compiling my system started to shut down -_- Thats a very peculiar error to get just because I forgot the final ";" after declaring a class. |
| 3067 |
Thordon |
<Thordon> 640k should be enough for anybody |
| 6931 |
Tiganah |
<Tiganah> i need a comand that executes a song.. anyone knows?? |
| 6933 |
Tiganah |
<Tiganah> does exist any comand in c++ that execute a file... like execute xxx.mwv... so the windos media player will open and it will sing the music? |
| 7429 |
Tiko9 |
<Tiko9> Guys, to create an unordered std::set, would i just define an '==' function and have that has the sorting criterion? |
| 4356 |
Timbooooo |
<Timbooooo> i dont know what a class is |
| 7593 |
Tnooth |
<Tnooth> I bet you are head programmer at bell labs and you're keepin it a secret |
| 738 |
Toke |
<Toke> maybe i shouldnt be doing cpp if i cant even tell whats going on in irc |
| 3648 |
TomStrong |
<TomStrong> Ok Tanks sweet hearts its working now :) |
| 6132 |
TomyLobo |
<TomyLobo> 80% of the idiots on your company make up the 20% above you :) |
| 6158 |
TomyLobo |
<TomyLobo> { channel hashashcplusplus; }{ void *MFC; } // see? not in the scope |
| 6173 |
TomyLobo |
<TomyLobo> your IQ fits in a bool! |
| 6270 |
TomyLobo |
<TomyLobo> and ! is the opposite of ! |
| 6526 |
TomyLobo |
<TomyLobo> geordi, remoot everything |
| 6623 |
TomyLobo |
<TomyLobo> meoblast001 that exception occurs on UFO sightings |
| 6638 |
TomyLobo |
<TomyLobo> codeshot the standard does not mention what happens if i scratch my butt while running the program. does that make it UB? |
| 6671 |
TomyLobo |
<TomyLobo> xystic grabs only female people |
| 6675 |
TomyLobo |
<TomyLobo> !grope impulze |
| 6916 |
TomyLobo |
<TomyLobo> i'm tempted to grab that, Run :) |
| 7104 |
TomyLobo |
<TomyLobo> it means you seeked in a file with contents that are against the law in your country |
| 7176 |
TomyLobo |
* TomyLobo grips blank |
| 7450 |
TomyLobo |
* TomyLobo trips over his internet wire, bangs his head on the table and tumbles onto his bed |
| 7581 |
TomyLobo |
<TomyLobo> no self-grabbing |
| 7582 |
TomyLobo |
<TomyLobo> !smite vagothcpp |
| 7716 |
TomyLobo |
<TomyLobo> hence buffer overflows are off-topic here |
| 7939 |
TomyLobo |
<TomyLobo> my longjmp() returns, what do i do? |
| 2178 |
Trashcan |
<Trashcan> what's grab :( |
| 7122 |
Traveler2 |
<Traveler2> wait so why does a while statement loop if you input a really large number? |
| 1596 |
TreMobyl |
<TreMobyl> it compiles with -pedantic, is that what you mean? |
| 4077 |
Trent |
<Trent> How do I add a library to my c++ project? |
| 7575 |
Troll |
<Troll> its official I'm a troll |
| 3517 |
TrollAndProud |
<TrollAndProud> Hehe, talk about banning -- I was banned the other day form #suse for standing up for America |
| 7384 |
Trollinator |
<Trollinator> well, perhaps there is somewhere. But not in the C++ Standard librar. |
| 7386 |
Trollinator |
<Trollinator> PHP isn't designed at all. |
| 7565 |
Trollinator |
<Trollinator> and rvalue refs are a disaster waiting to happen |
| 7678 |
Trollinator |
<Trollinator> STFU: of course they are. |
| 7833 |
Trollinator |
<Trollinator> why? my code doesn't have bugs. |
| 7890 |
Trollinator |
<Trollinator> !stdcpp jobs |
| 1377 |
Tronic |
<Tronic> Haven't I ever said anything interesting :/ |
| 1709 |
Tronic |
<Tronic> I hate GCC not having a -Wall-and-I-really-mean-all |
| 3093 |
Tronic |
<Tronic> Does GNU alloca() work if used inside initialization list? |
| 5478 |
Tronic |
<Tronic> I'll ditch C++ now and switch my all project to PHP instantly. |
| 4617 |
Tronic_ |
<Tronic_> That benchmark sucks because the compiler can potentially optimize away all your code. |
| 7893 |
Tryme |
<Tryme> pwned art fag? |
| 6019 |
TsuruyaSan |
<TsuruyaSan> What's bad is the fact I don't have any juicy horse cock shoved up my ass yet. |
| 6063 |
TsuruyaSan |
<TsuruyaSan> I want to know if there are any safe proxies out there. |
| 6064 |
TsuruyaSan |
<TsuruyaSan> And your point is? I'm much less retarded than a lot of people on the tubes. |
| 6065 |
TsuruyaSan |
* TsuruyaSan falls to the ground in a puddle of spoog. |
| 6067 |
TsuruyaSan |
<TsuruyaSan> All fish is edible. You might get poisoned, you might die, but you can damn well chew it and swallow |
| 6169 |
Tuff|Deja |
<Tuff|Deja> Any who can api hook good? |
| 5062 |
Tulga |
<Tulga> I have simple java program. my platform moved to freebsd and I cannot use java now. how to convert java source to c++ source? |
| 4100 |
TuomasT |
<TuomasT> I get a lot of help here, but sometimes this channel is just useless. I just want to read & set bits and then implement it. I don't want to learn the abc of bit operations in c++. |
| 6250 |
TurboBoost |
<TurboBoost> Yeah I remember, there was a time when I watended to program this awesome MMORPG where you can fish and eat noodles and have like Naruto hair and dance lots of dancing ! |
| 6462 |
TwMadCow |
<TwMadCow> Im writing a new client that's gonna be doing a lot of XML communication, should I use MFC or Qt? |
| 767 |
TwinkleSprite |
<TwinkleSprite> WeLsHWiZaRd.. I want my dick back now, please. |
| 1407 |
Uatec_ |
<Uatec_> unfortunately my knowledge of C++ is all derived from Java... |
| 5735 |
Ububegin |
<Ububegin> Forget about what i want to acheive... void getData(int*& data) { data=originalData} how to change this code, so that "*" can be replaced with "[]"... can it be done or not |
| 1729 |
Ummmmm |
<Ummmmm> I like my women like i like my coffee - in a plastic cup |
| 1735 |
Ummmmm |
<Ummmmm> fart oo man y |
| 1901 |
Ummmmm |
<Ummmmm> to understand recursion, first you need to understand recursion. |
| 1760 |
Ummmmm_ |
<Ummmmm_> err |
| 1766 |
Ummmmm_ |
* Ummmmm_ shudders at the concept of void* |
| 7964 |
UnderTaker |
<UnderTaker> BRB i need to apply my special toothpaste to my 14 cavitys as i dont floss =( |
| 6110 |
UnknowVector |
<UnknowVector> i can thank the bot |
| 2123 |
Unskill3d |
<Unskill3d> ill try to understand that shit |
| 984 |
Urikiller |
<Urikiller> directx is faster, more options, not only graphic, and some video cards alreadh have some parts of directx as hardware |
| 986 |
Urikiller |
<Urikiller> imnplenatmentaion is stupid word |
| 1034 |
Urikiller |
<Urikiller> and ur spoilled food won't make me change my mind |
| 1036 |
Urikiller |
<Urikiller> or just do it simoutinooiuytsly |
| 6783 |
VImtermute |
<VImtermute> ville i like my c++ c-ish |
| 2767 |
Valina |
<Valina> what's C ++? |
| 5686 |
Ve^Nin |
<Ve^Nin> I know how to do it human-style, but not computer-style |
| 711 |
Velocity |
<Velocity> Somethings confuse me too. Like the standards. |
| 632 |
Veratien |
<Veratien> Yeesh, Bush's idiot children are everywhere... |
| 7629 |
Vertelemming |
<Vertelemming> Biology is Just That Freakin' weird. |
| 7679 |
Vertelemming |
<Vertelemming> So many of the concepts important to C-style strings are important to use of pointers in general. And you'll definitely use pointers. |
| 4946 |
Vex[1] |
<Vex[1]> can you please write me an example orbitz |
| 7926 |
ViRUS |
<ViRUS> alexs: no pants + beer ... isn't that what most ppl. are looking for? |
| 5097 |
ViaSanctus |
<ViaSanctus> how can i compile a .NET c++ project without .NET ? |
| 1309 |
VisViva |
<VisViva> oh my my cylon is really a bot |
| 4306 |
Voltazeger |
<Voltazeger> my lawnmower runs on TAPWATER |
| 6832 |
VonhintenHOME` |
<VonhintenHOME`> I dunno, might want to find a new name.. not sure about the market for a game about a sausage made by vasiline games |
| 2771 |
Vratha |
<Vratha> sohail is a genius! |
| 2988 |
Vratha |
<Vratha> indeedly do |
| 3188 |
Vratha |
<Vratha> you guys are assholes! |
| 3191 |
Vratha |
* Vratha pseudo-grabs pwned's crouch |
| 3197 |
Vratha |
<Vratha> i whack it a lot |
| 1637 |
Waldo |
<Waldo> How can I listen to sounds with c++? |
| 724 |
Walley |
<Walley> So that's what grab is eh. I thought it was just cylon brutally grabbing and violating the specified user. |
| 5141 |
Walt |
<Walt> "let's have me penetrate you" |
| 5170 |
Walt |
<Walt> Lede, yeah yeah, I only have one |
| 5377 |
Walt |
<Walt> [06:44] <Walt> triplie sex? [06:44] <triplie> Walt: und your mother, das verboten |
| 5509 |
Walt |
<Walt> then you had surprise buttsecks, and now she's in pain |
| 7137 |
Walt |
<Walt> stuoid bot |
| 7469 |
Walt |
<Walt> svm_invictvs, the reason I asked is because I know pretty muc al torrents are shit and spyware, and I need a clean XP t try stuff out in Virtualbox |
| 7610 |
Walt |
<Walt> Didn't we used to be more people in here? |
| 7793 |
Walt |
<Walt> blank, you did it wrong. You see, in leetspeek pwned is spelled pwn3d. The second level of pwned is the of course pwn2d for two reasons. One, it goes with the leetspeek agenda to not follow standards(counting down instead of up for a higher rank of pwn), and the obvious 2 in the word. |
| 8064 |
Walt |
<Walt> I am here now? |
| 8082 |
Walt |
<Walt> Quadrescence, that's so way above my head I can't even see it as a dot |
| 8222 |
Walt |
<Walt> I have started getting the impression I am actually a rather good programmer compared to the average in the industry, and it's frightening me :/ |
| 8329 |
Walt |
<Walt> "I became a programmer so that I can create and control other people and sexually abuse them" |
| 6350 |
Walt_ |
<Walt_> I jave chescake! |
| 6351 |
Walt_ |
<Walt_> oic, you just like grabbing 18yearold boys |
| 6365 |
Walt_ |
<Walt_> the phrase is: I win! |
| 6491 |
Walt_ |
<Walt_> does anyone have any directions on how to do it in a good way? |
| 6519 |
Walt_ |
<Walt_> I am getting some "Hai THAR!11!!" underpants |
| 6520 |
Walt_ |
<Walt_> For a decent amount of good cake anyone can grab me, in underpants or not. |
| 7266 |
Weeble |
<Weeble> just tell me if array[nA] = Fn; seems right |
| 7625 |
Weeblwonder |
<Weeblwonder> i understand, code is a very anal thing |
| 5728 |
What |
* What lamers? |
| 2120 |
WhitePerson |
<WhitePerson> is this the White Peoples channel? |
| 7344 |
Wiz_KeeD |
<Wiz_KeeD> cin<<x int y[x]; |
| 2025 |
Wizze_Kid |
<Wizze_Kid> i wish basic was as easy as C++ |
| 2595 |
Wraithan |
<Wraithan> Is there a good reason to use #ifndef HEADER_H in header files typically? |
| 3274 |
X3N_ |
<X3N_> no compile errors now !... it just segfaults |
| 1234 |
XaXXon |
<XaXXon> this has got to be the most off-topic channel of all time |
| 1459 |
XaXXon |
<XaXXon> but I didn't, now did I? |
| 1926 |
XaXXon |
<XaXXon> oh that's what "!grab xaxxon" does.. fuck, I just thought they were fags |
| 2802 |
XaXXon |
<XaXXon> Dekoff: always look both ways before allocating additional heap memory |
| 4634 |
Xargo |
<Xargo> C# is alot, alot, better |
| 6841 |
Xexr |
<Xexr> idiot question: in vs2008, my cursor has changed to a block so it replaces rather than edits, how do I change it back? |
| 5859 |
Xiados |
<Xiados> how do i recognise a variable? |
| 1260 |
Xiphoris |
<Xiphoris> really? I auditioned for a porno onetime but they said my weewee was too small :[ |
| 2324 |
Xiphoris |
<Xiphoris> how about C+=Boost |
| 2714 |
XpyXt |
<XpyXt> in .net you cannot use sdk |
| 2715 |
XpyXt |
<XpyXt> zeroflag me cago en tu puta madre |
| 1268 |
YUY0x7 |
<YUY0x7> !quote YUY0x7 |
| 1284 |
YUY0x7 |
<YUY0x7> yuck |
| 1568 |
Yaeyama |
<Yaeyama> chron: if you shift left, the most significant bitch (the bitch on the left) gets her ass kicked into the street |
| 7188 |
Yuyi |
<Yuyi> l300g13, delete what you new, delete[] what you new |
| 3614 |
Zaba |
<Zaba> PlasmaHH, i thought you ain't a compiler/linker |
| 3616 |
Zaba |
<Zaba> a/s/l means arch/sys/lang in geekworld |
| 3808 |
Zaba |
<Zaba> i can write a program that prints "Segmentation fault" without havint that string in sources! |
| 6709 |
ZachS |
<ZachS> this is probably the easiest question ever asked in this channel, but is there a way to make an array with values like ARRAY[a], instead of having an integer within the brackets (ARRAY[1])? |
| 1910 |
Zao |
<Zao> o/~ 99 little bugs in the code, 99 little bugs in the code, you fix one little bug, 100 little bugs in the code, ... o/~ |
| 2491 |
Zao |
<Zao> The purpose of the GPL is to keep the weird programmers out of professional software ;) |
| 2529 |
Zao |
<Zao> Interestingly enough, orbitz code is flawless. |
| 2622 |
Zao |
<Zao> Debugging is all about finding out where you messed up. |
| 2626 |
Zao |
<Zao> "Waa, it crashes when I type invalid code." - "Don't write invalid code." |
| 2661 |
Zao |
<Zao> You'd segfault faster than the knickers drop on nolyc |
| 2843 |
Zao |
<Zao> Never underestimate the amount of free time on the internet. |
| 2866 |
Zao |
<Zao> Error checking is for people who makes errors. |
| 2867 |
Zao |
<Zao> Meh, I don't think I have a quote that doesn't have grammar errors :| |
| 2956 |
Zao |
<Zao> I've found that the C++ standard is a decent reference for the C++ standard library. |
| 3178 |
Zao |
<Zao> Which is about seven too many. |
| 3511 |
Zao |
<Zao> Tea is better than Cocoa. |
| 3558 |
Zao |
<Zao> how to crosspost in several channels? |
| 3764 |
Zao |
<Zao> Raider1: No, womblesong and his curiously retarded template definition |
| 3776 |
Zao |
<Zao> If you want to be retarded, go do so in ##c++-social. |
| 3899 |
Zao |
<Zao> Raider1: Congratulations on successfully spawning a newbie. |
| 3929 |
Zao |
<Zao> The problem with witty factoids is the stream of "lol" you get. |
| 3996 |
Zao |
* Zao rubs up against Slowking_Man and purrs. |
| 4133 |
Zao |
<Zao> RMS ought to hire Mr. Goatse to promote open source. |
| 4183 |
Zao |
<Zao> exDM69: Ah. I give up on some users after a while, so I didn't look at tit. |
| 4207 |
Zao |
<Zao> This is /ignore country. Population, you. |
| 4212 |
Zao |
<Zao> pcompassion: According to Ye Olde Standard, .find returns size_type |
| 4225 |
Zao |
<Zao> C++ is like -social. Just a bunch of smalltalk :) |
| 4245 |
Zao |
<Zao> Brute force programming, one token at a time. |
| 4276 |
Zao |
<Zao> Now LISP, that's quality academic masturbation. |
| 4332 |
Zao |
<Zao> <grabguard> |
| 4333 |
Zao |
<Zao> The world is not only g++ and MSVC |
| 4375 |
Zao |
<Zao> The Boost Software License is freer than free. |
| 4421 |
Zao |
<Zao> namespace nih { |
| 4436 |
Zao |
<Zao> I like Theo. The OSS world needs more assholes :) |
| 4463 |
Zao |
<Zao> UIs are best duct taped on as an ugly afterthought to beautiful code. |
| 4743 |
Zao |
<Zao> YOU SPAMMERS YOU! |
| 5200 |
Zao |
<Zao> The first one burns in my eyes. |
| 5339 |
Zao |
<Zao> I am all that is man, since I just used template template parameters. |
| 5973 |
Zao |
<Zao> acetoxy: I've heard that armv7 assembly is much more expressive than C++. |
| 6055 |
Zao |
<Zao> Now I need to wash my hands after touching MFC. |
| 6507 |
Zao |
<Zao> Must be damaged by object obsessed languages :P |
| 6936 |
Zao |
<Zao> Reasonably normal people, like you and me. |
| 7361 |
Zao |
<Zao> I wondered how the heck meth helps mazzachre with things. |
| 7396 |
Zao |
<Zao> Finnish compiling, perkele! |
| 7946 |
Zao |
<Zao> Yes, it's the high resolution boar. |
| 8089 |
Zao |
<Zao> MercedesBenz: The power of a language is mostly limited by the dimwit behind the keyboard. |
| 8143 |
Zao |
<Zao> Indirect rendering is bad, mkay? |
| 8297 |
Zao |
<Zao> I used to use my geordi to educate mortals on the finer points of UB :) |
| 2621 |
Zao- |
<Zao-> oh, crap. |
| 5127 |
Zarin |
<Zarin> u ignore me, i abuse u u ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu ignore me, i abuse uu i |
| 2982 |
ZenOswyn |
<ZenOswyn> actually it would be to see if you all could help me find a simpler way to write some code that i haven't written because i want to see if there's a simpler way to do it. |
| 1279 |
Zenethian |
<Zenethian> See! I can dance with a corncob in your butt. |
| 5003 |
Zharf |
<Zharf> wtf... ftw.. SAME DIFFERENCE |
| 5071 |
Zharf |
<Zharf> a < b ? (a < c ? c : a) : (b < c ? b : (a < c ? a : c)) not like this... I think i got confused myself |
| 5078 |
Zharf |
<Zharf> I was just hoping someone would've grabbed me instead of throwing bad jokes around |
| 5210 |
Zharf |
<Zharf> c++0xffffff |
| 5401 |
Zharf |
* Zharf just read all of xkcd and can now really say that it's crap |
| 5725 |
Zharf |
<Zharf> I didn't want to go guessing what stdin number was |
| 5931 |
Zharf |
* Zharf laughs at the pathetic people who watch eurovision |
| 5951 |
Zharf |
<Zharf> seems my school email spambox has 11896 spam |
| 5964 |
Zharf |
<Zharf> anyone of you play gunbound? |
| 6109 |
Zharf |
<Zharf> why would anyone want to use xmms code |
| 6114 |
Zharf |
<Zharf> bloodlines rocks |
| 6162 |
Zharf |
<Zharf> wait, no I ownt' |
| 6320 |
Zharf |
<Zharf> the world has been full of fail since it materialised |
| 6374 |
Zharf |
<Zharf> hamblivion, if you write good code, there's no need for a debugger |
| 6626 |
Zharf |
<Zharf> fucking debian |
| 6688 |
Zharf |
<Zharf> miles33, wikipedia lies |
| 6693 |
Zharf |
<Zharf> the whole concept of MMO is crap |
| 6765 |
Zharf |
<Zharf> I never found c++filt output readable, I prefer unfiltered |
| 6922 |
Zharf |
<Zharf> my head was transformed |
| 7001 |
Zharf |
<Zharf> I must be doing something wrong if you think I'm awesome :> |
| 7030 |
Zharf |
<Zharf> you guys suck |
| 7062 |
Zharf |
<Zharf> my ISP blocked w3.org because it supposedly has child porn |
| 7190 |
Zharf |
<Zharf> none can beat me! |
| 7283 |
Zharf |
<Zharf> returned an empty paper after figuring out that I'd have to write 2-3 A4 pages long SQL query to answer one question |
| 7317 |
Zharf |
<Zharf> Almathea_, I don't do girls |
| 7330 |
Zharf |
<Zharf> I never knew linux could be so full of crap until I installed kubuntu.. |
| 7333 |
Zharf |
<Zharf> I'm probably not a human being because I can't install úbuntu |
| 7336 |
Zharf |
<Zharf> for five days I tried to get kubuntu to work and failed... and I just now installed debian and configured it for a really dumb user in two hours |
| 7354 |
Zharf |
<Zharf> why would a whiner want to hear someone elses whines |
| 7369 |
Zharf |
<Zharf> omnomnoomonomnomnom |
| 7405 |
Zharf |
<Zharf> UML is for losers |
| 7406 |
Zharf |
<Zharf> Almathea_, remind me again when it's christmas |
| 7407 |
Zharf |
<Zharf> what reliability? |
| 7417 |
Zharf |
<Zharf> they're all equally crap |
| 7420 |
Zharf |
<Zharf> final countdown is a good song! |
| 7422 |
Zharf |
<Zharf> no need to blame anyone, extinction of the human race is a good thing |
| 7431 |
Zharf |
<Zharf> reminder to self, don't throw a grenade in a small sealed room |
| 7440 |
Zharf |
<Zharf> night |
| 7637 |
Zharf |
<Zharf> blank, man having a penis doesn't imply that god has a sense of humour |
| 7674 |
Zharf |
<Zharf> no but I have IRC in my toilet |
| 7739 |
Zharf |
<Zharf> my dad said I was giggling in my sleep last night |
| 7759 |
Zharf |
<Zharf> ok I think I know what's wrong with me |
| 7762 |
Zharf |
<Zharf> no, but I do have doobie brothers! |
| 7809 |
Zharf |
<Zharf> Almathea_, libboost-dev is 1.34, libboost1.37-dev is 1.37 |
| 7917 |
Zharf |
<Zharf> FUCKING NETWORK DAMAGER |
| 7925 |
Zharf |
<Zharf> !lart mama |
| 7999 |
Zharf |
<Zharf> I don't make design decisions based on sense |
| 8033 |
Zharf |
<Zharf> stop confusing me |
| 8154 |
Zharf |
<Zharf> who broke splitnode |
| 8156 |
Zharf |
<Zharf> a friend of mine went to lotr:fotr premier without any kind of costume and everyone recognized him as gimli |
| 8208 |
Zharf |
<Zharf> real coders don't need to debug |
| 8293 |
Zharf |
<Zharf> the internet has erased the need for life |
| 8325 |
Zharf |
<Zharf> it's decent/good |
| 8379 |
Zharf |
<Zharf> I think I should start doing what the rest of my family and relatives are doing... drive a cab.. |
| 8416 |
Zharf |
<Zharf> gimme a public key and I'll put it on your thingie |
| 7596 |
ZoFreX |
<ZoFreX> Some people, when confronted with a problem, think "I know, Ill use regular expressions." Now they have two problems \o/ |
| 4976 |
Zogatribe |
<Zogatribe> I recommend Windows, MSVC and MFC for creating a GUI app for beginners |
| 6077 |
Zogatribe |
<Zogatribe> scanf is for bearded C freaks |
| 6509 |
Zogatribe |
<Zogatribe> I have checked the ASM and it is quite efficient |
| 8116 |
Zogatribe |
<Zogatribe> so now you know all about dynamic C style arrays you can stop using them and start using containers |
| 8117 |
Zogatribe |
<Zogatribe> just stfu unless you have something useful to say, std::set is a tree which is a linked data structure so I don't have a clue as to what you might mean |
| 8210 |
Zogatribe |
<Zogatribe> you are acting like a retard Fazer2 |
| 4907 |
Zola |
* Zola thanks |
| 1122 |
Zombie |
<Zombie> I'm changing a few things to help it make morer logical sensee. |
| 430 |
ZorbaTHut |
<ZorbaTHut> "Yes, I sell used panties professionally, but my real passion is collecting stamps with pictures of rocks." |
| 7135 |
Zuka |
<Zuka> i dont want to fucking talk about rubbing your own penis! |
| 5730 |
Zurking |
<Zurking> i prefer the kinda bot that you runs on other peoples computers and idles in your favorite chat room to do you evil bidding |
| 6939 |
Zuu |
<Zuu> i dont intend to install a c++ compiler |
| 8029 |
Zyuka |
<Zyuka> we're humans, remember? |
| 1498 |
[-Temp]Supreme |
<[-Temp]Supreme> stop denying me from knowledge |
| 688 |
[0xBoTNeTBusTr] |
<[0xBoTNeTBusTr]> blank, but i love fat chicks.. and they love me .. because i love them, and if i didn't they wouldn't get any love. |
| 2987 |
[1]Whisper |
<[1]Whisper> i usually use xchat in linux and im using my wife's windows box |
| 4652 |
[LG]AMR |
<[LG]AMR> started a project at school to create a MMO, we were given a few c++ files, but the engine we are working with works in python and java, and i am lost as my aproach |
| 7529 |
[ZAF]-Coral |
<[ZAF]-Coral> ZAF = SOUTH AFRICA |
| 6224 |
[[matt]] |
<[[matt]]> there has to be a boostless way... |
| 789 |
[floyd] |
<[floyd]> pkrumins: yeah, i know, that's what i usually refer to my pr0n movies, too, a lecture in fluid motion dynamics ;) |
| 823 |
[floyd] |
<[floyd]> i find ICC to perform a lot better on paper than in reality, rubicant :/ |
| 893 |
[floyd] |
<[floyd]> just because i have the looks doesn't mean i am in fact gay. |
| 944 |
[floyd] |
<[floyd]> i'm only pink on fridays. |
| 2461 |
[floyd] |
<[floyd]> QT.... I cannot understand how people miss the Troll in TrollTech. |
| 2463 |
[floyd] |
<[floyd]> raf256: In fact, I'd rather be raped in jail than use that setup. |
| 2494 |
[floyd] |
<[floyd]> Every time you rebuild your kernel, your penis shrinks. Hope you can afford..... |
| 2886 |
[floyd] |
<[floyd]> Has anyone ever written a gcc flag randomizer script that would try all permutations until it finds one that forces gcc to compile without errors/warnings? |
| 6045 |
[o |
<[o> he must be in love with me :) |
| 6230 |
[o |
<[o> hlfshell: **argv is a OBFUSCATED array of strings |
| 7160 |
[o |
<[o> FUCK THESE C0DERZ THAT DONT KNOW THE DIFFERENCE BETWEEN C AND C++ AND PUT C/C++ IN THEIR CURRICULUM |
| 7286 |
[o |
<[o> impulze: but you are gay and I dont mind |
| 7404 |
[o |
<[o> fuck the namespaces :) |
| 7481 |
[o |
<[o> yeah! a cast suppress the warning |
| 7539 |
[o |
<[o> I am testing the actual code |
| 7578 |
[o |
<[o> I love my nick |
| 8261 |
[o |
<[o> \__U_/ |
| 7237 |
^Pho[T]on |
<^Pho[T]on> oh snap, u serius, thats screwed thankx tho. kalven and HM2 |
| 887 |
^hEllL0rd |
<^hEllL0rd> i almost had fun once in this channel |
| 1508 |
^hEllL0rd |
<^hEllL0rd> i just sucked real hard until i couldn't taste sweetness anymore |
| 1523 |
^hEllL0rd |
<^hEllL0rd> care for a cup of my urine blank? |
| 1553 |
^hEllL0rd |
<^hEllL0rd> if i keep drinking civet poo coffee i might not make it to 71 though |
| 1558 |
^hEllL0rd |
<^hEllL0rd> apparently i'm not a great pick either cause coffee shop girl totally denied me :~( |
| 1561 |
^hEllL0rd |
<^hEllL0rd> i prefer to slap women on the ass but, i've been known to paddle a male rump if the occasion warrants it |
| 1564 |
^hEllL0rd |
<^hEllL0rd> phrakture: i'm not angry at you i just wish you didn't exist |
| 1620 |
^hEllL0rd |
<^hEllL0rd> but have you been experienced? well, i have |
| 1633 |
^hEllL0rd |
<^hEllL0rd> i love bash.org :) |
| 1651 |
^hEllL0rd |
<^hEllL0rd> it's like, well, we had a buncha shit so we decided to make a command called pragma and give it a million different args to do all the crap we didn't want to stick anywhere else |
| 1655 |
^hEllL0rd |
<^hEllL0rd> raf256: i am always high |
| 8362 |
^kitchen |
<^kitchen> !rq "^kitchen" |
| 8367 |
^kitchen |
<^kitchen> pragma_: so why isn't it in me yet? |
| 5483 |
_Chaotics_ |
<_Chaotics_> what you mean by c++ ? |
| 5485 |
_Chaotics_ |
<_Chaotics_> 6 F:\E\0\0.cpp `beep' is not a member of `std' |
| 1320 |
_Codex |
<_Codex> rubicant: sure |
| 1514 |
_Codex |
<_Codex> size doesn't matter. |
| 6998 |
_FReeZ |
<_FReeZ> You STFU, you fucking stupid dicksucking retarded motherfucker motherfucking ! |
| 2059 |
_Felix |
<_Felix> How do I turn IntelliSense in VS 2005 off? Please! |
| 4894 |
_Garfield_ |
<_Garfield_> how do you snarf in japanese? |
| 1713 |
_Infinity_ |
<_Infinity_> It's suposed to be easier with an IDE |
| 3579 |
_MaTRiX_ |
<_MaTRiX_> so if they are, how they earn money for life? |
| 4757 |
_MaTRiX_ |
<_MaTRiX_> how to avoid buffer overflow? |
| 6196 |
_THEGOD |
<_THEGOD> im the god. |
| 6207 |
_THEGOD |
<_THEGOD> i think my brain mowed it to recyler. |
| 6340 |
_THEGOD |
<_THEGOD> blank god will allways be with you. you hwe no choice to survide.! |
| 6341 |
_THEGOD |
<_THEGOD> yeah some machines hawe boiltin functions.:) |
| 676 |
_W_ |
<_W_> well lets not ruin the joke in the name of accuracy |
| 5351 |
_Z-Batman_ |
<_Z-Batman_> is there a way to chance pointer manually ? |
| 5385 |
__catron_ |
<__catron_> I HATE THIS KEYBOARD!!!! |
| 1590 |
__d |
<__d> IRC participants who think all of IRC revolves around them = lol |
| 2541 |
__mikem |
<__mikem> This is a registered nick name, I can't change it |
| 2819 |
__mikem |
<__mikem> darnit |
| 2820 |
__mikem |
<__mikem> s/prelease/prelease |
| 3257 |
__mikem |
* __mikem wonders why people think globals are bad |
| 742 |
__pundai__ |
<__pundai__> that u_int32_t is a certifiable genius |
| 776 |
_aniasis |
<_aniasis> .Net > boost |
| 1236 |
_boto |
<_boto> marry x-mas :-) |
| 1238 |
_boto |
<_boto> cylon: why did you masturbate ? |
| 1240 |
_boto |
<_boto> I like cylon |
| 4965 |
_mastro_ |
<_mastro_> there some good link/book that explain all the difference between c++ and java? |
| 3167 |
_pHI_ |
<_pHI_> pwned: don't call me dumb please, i feel offended |
| 6909 |
_sick |
<_sick> ok someone can give me virtual slap :-P i had the same typo in my real code that i made in the dummy code ^^ |
| 1431 |
_spanner_ |
<_spanner_> Go stand at the back of the class. You will be initialised last. |
| 3059 |
_syphilis_ |
<_syphilis_> The Art of Computer Programming, Volume 4: MFC and DirectX |
| 3129 |
_syphilis_ |
<_syphilis_> i think he meant networking library, not sockets library |
| 3290 |
_syphilis_ |
<_syphilis_> C++ isn't OO enough, it should support std::vector<Object> like in Java |
| 3898 |
_vlad_ |
<_vlad_> I know this is C++ channel, but you guys are probably the smartest guys in IRC |
| 5002 |
`m0 |
<`m0> is that namespace compatible for linux? |
| 6692 |
a0132771 |
<a0132771> how can i make that a float? |
| 4209 |
a9913 |
<a9913> woah, my screen's dancing to the tune of the music i'm playing.... either that, or the cable is loose |
| 5135 |
a9913_ |
<a9913_> hmm.... strange.... i get an error about mac/All.h including windows.h.... on linux... |
| 2975 |
aFlag |
<aFlag> hi, have anyone been having trouble with g++ on debian? |
| 7511 |
aFlag |
<aFlag> I call delete (((X))), I usually even indent the parenthesis, one inside the other, but then again I'm a lisp programmer... |
| 7840 |
aJynks |
<aJynks> I am a zoo keeper |
| 6464 |
aLexa |
<aLexa> i'm a self teaching c++ girl ... what would you expect from me ... i'm taking everything from the basics |
| 6465 |
aLexa |
<aLexa> don't you wory,i wish i could have been a boy ;) |
| 4736 |
a_s_ |
<a_s_> How intelligent is nolyc? |
| 4737 |
a_s_ |
<a_s_> Not so long a life. The garbage collector came this way some three hours ago and took all the new allocated objects. |
| 4988 |
a_s_ |
<a_s_> asking an off-topic question causes undefined behaviour. |
| 7931 |
a_s_ |
<a_s_> I propose a new character traits concept to be called 'mood'. Indexing into a string will segment-fault or not, depending on the mood::colour value! |
| 8093 |
a_s_ |
<a_s_> You think I was trying to make sense? Man you flatter me. |
| 3456 |
aa^way |
<aa^way> Is it possible to implement C and Java, by that i mean you will go to some Java game like minigolf, and then start generating hits and so on? |
| 2132 |
aaaa |
<aaaa> I am using microsoft |
| 3214 |
aalhamad |
<aalhamad> hi whats the diffrence of return 1 and return 0? |
| 2728 |
aav |
<aav> there's no random number generator in the standard lib is there? |
| 7585 |
abebae |
<abebae> #include <drama> |
| 4717 |
abhi |
<abhi> i hv recently migrated 2 c++ frm c so i wil take sm time to gt usd to it i thnk.. |
| 4723 |
abhi |
<abhi> wats dynamic_caste?? |
| 74 |
absentia |
<absentia> KHAAAAAAAAAAAAAAN! (shakes clenched fist in the air) |
| 129 |
absentia |
<absentia> I tend to hit things flat... |
| 273 |
absentia |
* absentia is creeping features |
| 315 |
absentia |
<absentia> I feel like I'm coding in pigeon c++ |
| 890 |
absentia |
<absentia> <-- idiot. |
| 2201 |
absentia |
<absentia> dude, our last guy came down.... we picked'm up at the airport..was with us all day.. he was asking if WPB was safe -- I said not in some places.. he went back to his hotel at night -- and 4 cops with guns drawn jumped him.. handcuffed'm.. threw'm to the ground.. accused him of being a crack dealer. told the guy he had to leave the state. |
| 2788 |
absentia |
<absentia> I submitted a bug to larry wall for perl.. way back when... saying that some math function was returning incorrect results ...so he changed the mange page so that the results matched the man page. that was the lat bug I ever submitted. |
| 4041 |
absentia |
<absentia> I just keep adding stars.. and when I get to 4, I just stop coding the program. |
| 4087 |
absentia |
<absentia> ya, and then you could have pie in_your_face, instead of interface. |
| 4088 |
absentia |
<absentia> use the source, Luke. |
| 4089 |
absentia |
<absentia> I tend to spend hours reading ward wiki depth first. |
| 4214 |
absentia |
<absentia> plus, I am far from an expert at anything 'cept generating segfaults. |
| 4362 |
absentia |
<absentia> OMGWTFLERN2CODEIN21MINUTESOOHDONUT++ |
| 4363 |
absentia |
<absentia> No! stop grabbing my crappy ones! |
| 4365 |
absentia |
* absentia has a 417 step plan to achieve ultimate mediocrity. |
| 4459 |
absentia |
<absentia> holy crap -- it compiled. |
| 4752 |
absentia |
<absentia> I missed using punch cards at college, by 1 year. |
| 4854 |
absentia |
* absentia turned a "bug" (or difficult to solve issue due to current design) into a "security feature" |
| 4863 |
absentia |
<absentia> I'm so geeky, my first three girlfriends became unix sysadmins (after me) |
| 4948 |
absentia |
<absentia> windows installed some update under my vmware and I had to reboot |
| 5038 |
absentia |
<absentia> it shuld be a crime to let me program. |
| 5099 |
absentia |
<absentia> screw it, I put all the code in one method |
| 5100 |
absentia |
* absentia asks pwned to bring whirled peas. |
| 5101 |
absentia |
<absentia> holy shit, I've been grabbed more today in this channel than I was on my wedding night! |
| 5309 |
absentia |
<absentia> :wq! |
| 5310 |
absentia |
* absentia waits for the slim version of the Macbook Air. |
| 5319 |
absentia |
<absentia> protect my private parts. |
| 5494 |
absentia |
<absentia> impressive. |
| 6185 |
absentia |
<absentia> Stop! Lamer Time! |
| 6782 |
absentia |
<absentia> omgwtfitsolongbbq |
| 7102 |
absentia |
<absentia> ham matches over 1000 words in my app |
| 7103 |
absentia |
<absentia> ungrab me, b!tch |
| 8163 |
absentia |
* absentia forgot this channel was all 'bout groping. |
| 8164 |
absentia |
<absentia> I can't do it, the bot ignores me.. because I'm so lame. |
| 6870 |
aceofspades19 |
<aceofspades19> I hope std C++ doesn't have the notion of gay platoons |
| 6876 |
aceofspades19 |
<aceofspades19> LimCore: people that call other people noobs are usually noobs themselfs |
| 6952 |
aceofspades19 |
<aceofspades19> yay |
| 6953 |
aceofspades19 |
<aceofspades19> STOP!, its peter time! |
| 5585 |
acetoxy |
<acetoxy> Programming is all about luck. |
| 5842 |
acetoxy |
<acetoxy> We were doing Rails-stuff, and he had 5 books about Rails, but he didn't know anything about it. |
| 6078 |
acetoxy |
<acetoxy> I feel free this weekend, my girlfriend is away! YEAH!! I can do whatever I want! |
| 6524 |
acetoxy |
<acetoxy> But imagine an input device like a theremin. |
| 7128 |
acetoxy |
<acetoxy> My mom is calling me right now. I dont like talking to her. She talks a lot about nothing. |
| 7464 |
acetoxy |
<acetoxy> My internet has been destroyed! |
| 7997 |
acetoxy |
<acetoxy> What a strange dream... I had set 4 alarms on my phone to wake me up, and each alarm was a git pull, and then something was compiling in the background... |
| 8002 |
acetoxy |
<acetoxy> Alright: Sourceforge sucks and they're getting away with it. |
| 8005 |
acetoxy |
<acetoxy> I wish I had started with ballet when I was 4 |
| 4013 |
acg |
<acg> I like Borland 5.02 be cause I learned on it, but it's kinda old |
| 6740 |
adriaticc |
<adriaticc> d1zzy: the 8mb limit! you know! the elves will get you if you go past it |
| 3901 |
aegray |
<aegray> or do they |
| 2605 |
aep |
<aep> i never saw a working third party lib in my life |
| 2969 |
aep |
<aep> somehow i dont like the diea of suing msdn for portable code |
| 3034 |
aep |
<aep> what are boners? |
| 7287 |
aep |
<aep> and you don't shove a finger up your butt while peeing? |
| 7338 |
aep |
<aep> finally i can talk like a 3 years old |
| 7413 |
aep |
<aep> now get me a chessburger and a spoon so i can incooperate blanks brain properly |
| 7427 |
aep |
<aep> they're full of idiots despite they dont even talk about penises like we do |
| 7524 |
aep |
<aep> proper war might solve that |
| 7791 |
aep |
<aep> well passing gods is not that hard. just leave behind the burden of seaking ther truth |
| 7792 |
aep |
<aep> seand: no, and we dont hire people without experience, also my entitre team are vikings |
| 7850 |
aep |
<aep> i want to quit this open source crap |
| 8079 |
aep |
<aep> just becouse its turing complete doesnt mean its an actual programing language |
| 8094 |
aep |
<aep> they suck out your brain, make products from it and throw you away |
| 8410 |
aep |
<aep> the muscle that moves the lower part of the arm |
| 5342 |
afat |
<afat> Hello, I have learned how to program in C++ and Java, by reading book. What do I need to do to get a job in this field? |
| 5120 |
affluxes |
<affluxes> srand(rand()) :) |
| 3909 |
agentx0r |
<agentx0r> shoot me |
| 3934 |
agentx0r |
<agentx0r> all i know is, any java program ive ever used has been slower than shit, and must not have made use of this magical program that makes java not slow as shit. |
| 3939 |
agentx0r |
<agentx0r> boost will secede from the standard and we'll have a c++ civil war |
| 3944 |
agentx0r |
<agentx0r> i think i may end up just buying a sniper rifle and shooting people instead of coding a game in which i'm a sniper. it would save me a lot of time. |
| 3949 |
agentx0r |
<agentx0r> i think from now on, instead of telling people to make a testcase, we should tell them to make a book case, and then go buy a book and read it, then PUT it on the bookcase |
| 3963 |
agentx0r |
<agentx0r> i installed g++, try to compile hello world, and i get over 700 errors |
| 3969 |
agentx0r |
<agentx0r> i don't have a drinking problem. i have a not drinking problem. |
| 4026 |
agentx0r |
<agentx0r> genixpro, that's why jesus invented rape |
| 4137 |
agentx0r |
<agentx0r> brb i'm going to go outside and find a leaf to mail to the bank |
| 4173 |
agentx0r |
<agentx0r> brb i need to go jerk off to the A&E special about the B.T.K. Killer |
| 4188 |
agentx0r |
<agentx0r> my version supports sexual favors for correct guesses though |
| 4232 |
agentx0r |
<agentx0r> if windows were a girl, i'd kidnap her, rape her anally (in the ass, not the other one), murder her, and then dump her body in a lake. |
| 4263 |
agentx0r |
<agentx0r> runtime and agentx0r, sitting in a tree. c-o-d i-n-g |
| 4312 |
agentx0r |
<agentx0r> blank, why can't we just cuddle? |
| 4360 |
agentx0r |
<agentx0r> java only leads to two things: a drinking problem, and another language. both of which can be achieved without using java in the first place. |
| 5464 |
agentx0r |
<agentx0r> i think the one on there is safe, its not actual nudity, and i drew that dick myself |
| 5466 |
agentx0r |
<agentx0r> miles33, speak for yourself. i've got half an erection |
| 5467 |
agentx0r |
<agentx0r> i havent been here in a while i forget some of the awful things that have been grabbed from me |
| 5522 |
agentx0r |
<agentx0r> these nuts taste amazing. |
| 5561 |
agentx0r |
<agentx0r> unfortunately, im not medicated for any of the disorders i currently have. |
| 5562 |
agentx0r |
<agentx0r> make sure you do that before you ask what !grab means |
| 5573 |
agentx0r |
<agentx0r> this fucking picture is taking forever to upload |
| 5594 |
agentx0r |
<agentx0r> 3. they have nice tits |
| 5733 |
agentx0r |
<agentx0r> just a blank stare |
| 5758 |
agentx0r |
<agentx0r> Bigcheese, you just changed my life. now that i understand math, i will take over the world. |
| 7856 |
agentx0r |
<agentx0r> Carbonflux, i need your brain |
| 7877 |
agentx0r |
<agentx0r> fuck programming. let's just drink beer. |
| 8327 |
agg |
<agg> At least do it the way other idiots do and send nolyc a stream of !rq's instead of copying and pasting from the quote page. |
| 8380 |
agg |
<agg> Now everyone knows you're jealous of my awesome nick. |
| 8381 |
agg |
<agg> All of you are just jealous. |
| 8393 |
agg |
<agg> He's lucky he left before I raped him. |
| 8403 |
agg |
<agg> Garb bait |
| 1488 |
aggieben |
<aggieben> good grief. I should have figured that this would be a fruitless conversation. |
| 288 |
agriffis |
<agriffis> I don't think the topic should change until the current one is no longer funny. |
| 4230 |
ahshah |
<ahshah> oh java..how i miss import java.solve.my.problem.plz.kthxbye |
| 5486 |
aib42 |
<aib42> yeah for(;;) executes infinite loops in under 60 days on most computers |
| 1875 |
aidan |
<aidan> ah, I joined #c but was redirected to #undefined-behaviour |
| 43 |
aitrus |
<aitrus> after being a circus performer for 5 years, i can honestly say: clowns taste funny |
| 1707 |
aj^ |
* aj^ makes sweet love to ASCII |
| 2556 |
aja |
<aja> braden: What are you wearing? |
| 3911 |
aja |
<aja> geordi: Lemme guess, you're piping the output from your compiler into IRC because you think there're people that might not be annoyed by that. |
| 3912 |
aja |
<aja> agentx0r: What idiot put a compile-bot in here? |
| 5871 |
aja |
<aja> You'd be amazed at how much just randomly assaulting someone on the first day goes toward enhancing classroom discipline. |
| 5872 |
aja |
<aja> AlTheKiller: I'm more comfortable masturbating with my left hand. Doesn't mean I think masturbating with your right hand is somehow wrong or inefficient. |
| 6550 |
aja |
<aja> kn0x: If only there were some sort of computer program that could take your code and check its syntax before generating machine code. |
| 6606 |
aja |
<aja> Yuyo: What's wrong with you? Why are you so lazy? Aren't you willing to invest time and energy solving sacrebleu's problem for absolutely no recompense? I mean, anyone can solve problems for people who actually want to give you the information you need to help. |
| 6938 |
aja |
<aja> godling: I have a bunch of dead babies in my abattoir |
| 7108 |
aja |
<aja> Perhaps, someday, we will have sophisticated editors that we can program with our personal preferences. Wait... |
| 7224 |
aja |
<aja> Otacon: If you can't find an implementation of bubble sort on the internet, you can't be helped. Can you even find porn? |
| 7521 |
aja |
<aja> me22: My father calls that "faith-based debugging" |
| 7747 |
aja |
<aja> pist0l-fish: I don't think it's grammatically correct to use "light-weight" and "XML" in the same sentence. |
| 7857 |
aja |
<aja> Hasbro: Just because some of the computers used in doing CGI for ST:Voyager had C++ code on them doesn't make a discussion of Jeri Ryan's ass on-topic here. |
| 8044 |
aja |
<aja> whats_in_a_name: How about if I asser that it came to me in a dream, but I have thousands of bloodthirsty converts who'll kill you and your family if you don't believe what I tell you to? |
| 8083 |
aja |
<aja> God forbid that someone's dreams should be crushed by the truth ... |
| 8135 |
aja |
<aja> me22: Interestingly, "undefined" is clearly defined in the standard. :-) |
| 8148 |
aja |
<aja> Oh. My. God. Did he just call me a pussy!!! That's IT! IT'S ON, MOTHERFUCKER... No. Wait. I'm too lazy. /ignore. |
| 7389 |
ajrisi |
<ajrisi> that, and autotools is just sexy |
| 4925 |
al-_-Gir |
<al-_-Gir> but in C channel the will not tell me the true about C ... |
| 1922 |
alex89 |
<alex89> Visual C++ ist better than C++? |
| 1923 |
alex89 |
<alex89> shut the grab up |
| 4254 |
alexs |
<alexs> Jessicatz is actually female though right? |
| 4262 |
alexs |
<alexs> pfff |
| 4639 |
alexs |
<alexs> ive had a lot of sex from there |
| 4742 |
alexs |
<alexs> MS Word autocorrects Large Hadron Collider to Large Hardon Collider. |
| 4575 |
alexs_ |
<alexs_> lol @ export |
| 4598 |
alexs_ |
<alexs_> 0/0 = 0 |
| 4622 |
alexs_ |
* alexs_ wouldnt be here today without the failure of internet bought condoms |
| 7374 |
alexs__ |
<alexs__> someone should do a study demonstrating a correlation between correlation and causation |
| 3855 |
alkos333 |
<alkos333> What a helpful channel you guys are |
| 3432 |
almathea |
<almathea> the answer is 42 |
| 3433 |
almathea |
<almathea> you've given us his name, we're gonna hunt and kill him! |
| 3500 |
almathea |
<almathea> Funny, how much you can learn about java here, from ppl, who come here and are surprised stupidity constructs ain't working c++. |
| 3668 |
almathea |
<almathea> I'm generally unfunny guy, sad, lonely. How would anyone like to grab me? |
| 3670 |
almathea |
<almathea> My keyboard needs a shower. |
| 3683 |
almathea |
<almathea> Man, someone just told me _he_ loved me, over phone... tis there ma life ends. |
| 3697 |
almathea |
<almathea> Oh, its strange, to talk to the guy of my own nationality and understanding him worse than foreigners. |
| 3702 |
almathea |
<almathea> Ok guys, everybody smile, I'll be taking a picture of this channel. |
| 3746 |
almathea |
<almathea> so there are other `IRC networks' than Freenode? |
| 3852 |
almathea |
<almathea> I didn't leave this room yesterday... |
| 3856 |
almathea |
<almathea> EArmbrust: doubtful anyone would allow you to use compiler on a shell. |
| 3861 |
almathea |
<almathea> AnthonyG: we are talking about ##c++ being polluted with off-topic and youssef. |
| 3906 |
almathea |
<almathea> Who's hex? |
| 4050 |
almathea |
<almathea> !grab ok |
| 4061 |
almathea |
<almathea> You could use pen and paper to create gui apps, or shit on your grass to get nice widget look, I don't care. As long as you don't share that here! |
| 4072 |
almathea |
<almathea> Anyways, night is the time I kill babies, so gotta go stand for my duty. |
| 4177 |
almathea |
<almathea> and caught in almathea's buttoc! |
| 4210 |
almathea |
<almathea> Zao, I just wanted to be stupid, bless. |
| 4213 |
almathea |
<almathea> Grabs with # < 100 are like founders weren't sure if grabbing actually works, so they grabbed bull. |
| 4216 |
almathea |
<almathea> You used to have a clean record, boy, now it's dirty, grabs are like virginity, once youre grabbed you don't care so much any more, and mate with anything that moved and doesn't run away up the tree. |
| 4517 |
almathea |
<almathea> I thought that it's the sexual urge makes you do smart things, to impress women and get them under thee hood. |
| 4724 |
almathea |
<almathea> Heh, we got new mathematica shipped today. I open the box, and find a licence inside telling that opening the box means agreeing to licence. |
| 6616 |
ambika |
<ambika> you told me when we cybered that you were a foxy blonde |
| 6617 |
ambika |
<ambika> i dont wanna be grabbed |
| 6620 |
ambika |
<ambika> so whats this grab thing do again? |
| 7599 |
amz |
<amz> how was that? stupid enough? |
| 919 |
andares |
<andares> Why can't cylon be one of the women prototypes! T_T |
| 7345 |
angerman |
<angerman> impulze: some professor said using new and delete were the appropiate ways to create and destruct objects in c++ |
| 5334 |
anoa |
<anoa> hi. i cant new 1 GB char * buffer. could char ** work instead |
| 1892 |
anshul |
<anshul> PlasmaHH: You are an angel! |
| 1510 |
ant1 |
<ant1> #$*)(#$ |
| 5278 |
anurias |
<anurias> come on help me, i will spam for a good cause |
| 4219 |
aphexer |
<aphexer> sigh, i delete everything irrelevant, and then it compiles |
| 6467 |
arafangion |
<arafangion> Deco, Stup abusing nolyc's templates. |
| 6471 |
arafangion |
* arafangion often defines his own 'string' class, as he likes to have some utility stuff on it. |
| 4220 |
arathald |
<arathald> loufoque: but you can declare an array as a pointer then set its size later, no? |
| 4264 |
arathald |
<arathald> braden: unfortunately, I do not have a built-in ass vibrator in my chair... it just helps me with my code |
| 1582 |
aridese |
<aridese> do i need to do that #ifndef #def ... #endif thing only on headers? or on source too? |
| 7971 |
ariqs |
<ariqs> that's what high level languages are all about. Being confused on a higher level |
| 2705 |
aristotle73 |
<aristotle73> <LachieD> BASIC is the most beautiful programming language ever consturucted. Period. You call all go suck a lemon! |
| 3236 |
arke |
<arke> I have a *Member* in my pants |
| 7366 |
arquebus |
<arquebus> JaJA_9_6_1995: ha ha, thats what they said at microsoft, we dont need C++ lets program all this in python, and you get Vista |
| 4081 |
arrummzen |
<arrummzen> I need to write a hostile letter to the C++ standards committee regarding templates... |
| 4696 |
arrummzen |
<arrummzen> Zao: I'd rather be known for my cock then for my colon. |
| 5048 |
arrummzen |
<arrummzen> w00t, the bot has quote for me. I feel much better about myself now =P |
| 5155 |
arrummzen |
* arrummzen is still looking for an open source girl... |
| 5533 |
arrummzen |
<arrummzen> hehe, that is the great thing about being an academic. You don't have to be the first to think of it, just the first to publish a paper about it =D |
| 2350 |
asabil |
<asabil> :D my littlefinger is going there without my authorisation :D |
| 4052 |
ateufel |
<ateufel> geeks lay other geeks...its not pretty, but it happens. |
| 3369 |
atom |
* atom wonders what that has to do with c++ but remembers the weed debate |
| 5609 |
atom |
<atom> blargg: nah, not even vista's THAT bloated. We're talking worse than ruby here |
| 5618 |
atom |
<atom> does anybody read these grabs? |
| 5624 |
atom |
<atom> so much for ruby propaganda |
| 7028 |
atom |
<atom> endra: I have no idea. For me, I'm yellow on brown. |
| 7525 |
atom_fox |
<atom_fox> HOW DO I PRINT OUT CHARACTERS INSIDE THE ENUM COMMAND |
| 2199 |
aty |
<aty> is there a header for Date class in visual c++? what is its name? |
| 4928 |
au- |
<au-> so it's generally much easier and safer to use than char arrays |
| 5092 |
au- |
<au-> I love C++ |
| 5219 |
au- |
<au-> bush is not as bad as you think |
| 6227 |
au- |
<au-> woot, time to go home. it's been a wonderfully unproductive monday |
| 6249 |
au- |
<au-> I always think goto makes it real easy to see where the code's going |
| 6251 |
au- |
<au-> I won't do much though I'll just sit here and criticize your code |
| 6252 |
au- |
<au-> one day we'll make robots that make robots for making robots |
| 6267 |
au- |
<au-> my balls detect collision too |
| 6268 |
au- |
<au-> you made it sound liek I said something nasty :| |
| 6986 |
au- |
<au-> who needs Love when you have a compiler |
| 6987 |
au- |
<au-> [Excess Flood] <- Ike again? |
| 7013 |
au- |
<au-> but does size matter |
| 7055 |
au- |
<au-> I only knew some self-taught C and almost no C++. But I still got a job as a C++ programmer :D |
| 7225 |
au- |
<au-> friends can touch privates too |
| 7321 |
au- |
<au-> I like space |
| 7594 |
au- |
<au-> Adrinael << "Hello, world!\n"; |
| 7698 |
au- |
<au-> in other words make sure that if your destructors use library functions, destruct them before main() ends |
| 7884 |
au- |
<au-> tip! if you copy & paste something.... make sure you use COPY and not CUT :D |
| 7930 |
au- |
<au-> sure, call me a troll |
| 8072 |
au- |
<au-> this channel is not a C++ tutorial |
| 8149 |
au- |
<au-> The size of a black hole. |
| 8335 |
au- |
<au-> I have no gf, I'm a programmer |
| 8343 |
au- |
<au-> The debugger bugs out while debugging a bug. |
| 4171 |
augnob |
<augnob> oh. I didn't even notice that I talked to myself back then |
| 4196 |
augnob |
<augnob> quilzo: seriously.. :) |
| 974 |
autechre |
<autechre> i dont want to use "this" i just want its address |
| 684 |
awayMunky |
<awayMunky> ok, simple question i never remember... where is std::sin located? cmath? |
| 1988 |
awayfrom |
<awayfrom> but will the ps3 support keyboard/mouse? thats the question |
| 3046 |
awesomess3 |
<awesomess3> Actually C++ == C because it uses the postfix increment. |
| 3650 |
awesomess3 |
<awesomess3> My mother is forcing me to go to my sister's house. She has twins and they always scream at me when I pick them up. My mother always turns against me when she's around my sister. I'd rather stay home and program in C++, what should I do?! |
| 6808 |
ayeee |
<ayeee> sorry, c++ |
| 971 |
azurot1 |
<azurot1> will copying an istream kill me? |
| 1161 |
azuroth |
<azuroth> firmware programmers get all the women |
| 1162 |
azuroth |
<azuroth> the g in windows stands for good |
| 1717 |
azuroth |
<azuroth> ultra cool, glen_quagmire |
| 2849 |
b00 |
<b00> AidyMole, sucki sucki, 10 dolla ? |
| 4769 |
b0r3d |
<b0r3d> so in class B now i implement A's dtor? |
| 5400 |
b0r3d |
<b0r3d> sorry, my question is very advanced |
| 6527 |
baaba |
<baaba> what book? |
| 6767 |
badcom |
<badcom> how i make a sort of the 1 until 4? |
| 6773 |
badcom |
<badcom> can i to use hotkeys in c++? |
| 6780 |
badcom |
<badcom> how i replace the color of a text? |
| 3730 |
bagman |
<bagman> Masturbating sucks. |
| 1413 |
bahblahblahbah |
<bahblahblahbah> how did this topic even come up on C++ channel? |
| 7620 |
banisterfiend |
<banisterfiend> DustyThought: can i have a kiss and a cuddle please. |
| 7800 |
banisterfiend |
<banisterfiend> "C++: an octopus made by nailing extra legs onto a dog." |
| 6604 |
barricades |
<barricades> xystic, yeah, that sucks. seems like bare C++ alone isn't useful for much of anything in the real world |
| 4053 |
basara |
<basara> how fast is reinterpret_cast? does it have any kind of overhead? |
| 4592 |
bashusr |
<bashusr> hi... do i have set a class and all to have a variable that i can change from main that would stay the same within the functions? |
| 1201 |
bassinboy |
<bassinboy> but my book also has a 2 in binary code |
| 3224 |
beg1689 |
<beg1689> try doing me |
| 3267 |
beg1689 |
<beg1689> system("pause"); will pause for you |
| 3297 |
beg1689 |
<beg1689> because im too tired to remember where it goes |
| 1544 |
ben |
<ben> Does anyone implement c++0x yet? |
| 1545 |
ben |
<ben> Using boost is like cheating :/ |
| 2453 |
ben |
<ben> Long compilation means you can get a coffee or something in the meantime. |
| 4205 |
ben |
<ben> What the hell is analogliterals.hpp |
| 4524 |
ben |
<ben> blank is way more regular than me |
| 5315 |
ben |
<ben> pointers are faster |
| 6529 |
ben |
<ben> Apply the logical negation operator! |
| 6542 |
ben |
<ben> ##c++ has no notion of mercy. |
| 6575 |
ben |
<ben> Can we go back to bashing microsoft and windows application developers that was way more fun |
| 7722 |
ben |
<ben> ville: You mean, you are the first among equals in the flat hierarchy society |
| 7730 |
ben |
<ben> You cannot use C++ features in C++ homework, it goes against the entire principle of the thing! |
| 5197 |
bengee_ |
<bengee_> make: g++: command not found ---- what to do? |
| 7527 |
benofsky |
<benofsky> is there a vardump function in c++ like in php? |
| 4119 |
bernardo |
<bernardo> nolyc: take it easy... I thought those irc channels was meant to help... |
| 2384 |
betchou |
<betchou> loufoque: there is something for viewing bad implementation too? |
| 8157 |
bgamari |
<bgamari> sohail, but I'm not entirely sure what abstractions in particular I was referring to |
| 4446 |
bhr |
<bhr> sorry guys efnet is full of morons |
| 4191 |
bhz |
<bhz> Zao nobody cares about C++ standard. MS makes standards, others follow |
| 4116 |
bill-barriere |
<bill-barriere> flash is harder than c++? |
| 6528 |
bill-barriere |
<bill-barriere> the code is 100% correct |
| 6800 |
bill-barriere |
<bill-barriere> meh, would be nice if one could have templated static virtual fonction |
| 6801 |
bill-barriere |
<bill-barriere> cg are the domain of tech artist not programmer |
| 2617 |
blackelf |
<blackelf> class foo { // hmm.. I like orbitz butt |
| 2719 |
blackelf |
<blackelf> oh my god, vim is more sweet then Adrinael's butt |
| 3508 |
blackelf |
<blackelf> dont make me go over to other PC and grab myself from there |
| 1624 |
blahb |
<blahb> maybe I should call bjarny and give him some of my syntax... |
| 4822 |
blanchett |
<blanchett> When in doubt, speak like the Internet. |
| 4823 |
blanchett |
<blanchett> Geez, blog about it already. |
| 5567 |
blanchett |
<blanchett> They make small asians. |
| 1 |
blank |
<blank> jump is the only command we need. |
| 2 |
blank |
* blank rejoices like an umpa lumpa |
| 4 |
blank |
<blank> Communication is a hard process of one guy saying something and the other guy watching porn. |
| 13 |
blank |
<blank> There's no such thing as a blankcake. |
| 24 |
blank |
<blank> AshyIsMe, I want you to want me to want you. |
| 30 |
blank |
<blank> That better be porn. |
| 31 |
blank |
<blank> Jaffa kree! |
| 33 |
blank |
<blank> perl is the turing complete grep. |
| 39 |
blank |
<blank> The 'd' key is right next to each other. |
| 40 |
blank |
<blank> Damn, I forgot what I forgot about. |
| 51 |
blank |
<blank> Gentoo will recompile the bullet and shoot you back. |
| 52 |
blank |
<blank> I can handle cake. |
| 65 |
blank |
<blank> That's more like a woman that's a man. |
| 69 |
blank |
<blank> I'm not gay but my boyfriend is. |
| 79 |
blank |
<blank> rule 189: Every problem in the universe can be solved by finding the right long-haired prettyboy and beating the crap out of him. |
| 82 |
blank |
<blank> Lucky charms is a SOMETIMES food. |
| 87 |
blank |
<blank> Listen, if I can't fondle I can't take you very seriously. Come on. Get real. |
| 98 |
blank |
<blank> We need to concentrate on grabbing jep! |
| 101 |
blank |
<blank> two words: what the hell. |
| 105 |
blank |
<blank> __This line is important for no reason___ |
| 106 |
blank |
<blank> Stop it. You're turning me on! |
| 113 |
blank |
<blank> Typical boy meets girls and kills a god movie. |
| 114 |
blank |
<blank> The sound of the sheep will save me. |
| 116 |
blank |
<blank> I am all woman. |
| 138 |
blank |
<blank> Hrm, I need better fonts. It looked like nipples. |
| 147 |
blank |
<blank> I can't tell. I'm like 5 people in this channel alone. |
| 157 |
blank |
<blank> yes, a seperated integrated assembler is intergrated seperately. |
| 159 |
blank |
<blank> Now I don't have to type like Adrinael. |
| 161 |
blank |
<blank> Oh crap, I just laughed at myself. |
| 162 |
blank |
<blank> Only dinosaurs and UNIX was in Jurassic Park. |
| 168 |
blank |
<blank> All I have to say is to never take a man's advice for men's fashion. |
| 172 |
blank |
<blank> or \moo if it's in the cow universe. |
| 181 |
blank |
<blank> Someone is being pedantic and it's not pedantic. |
| 182 |
blank |
<blank> I have no hidden agenda. Only because my agenda is obvious. |
| 188 |
blank |
<blank> This is why you have the zeroth law: Don't kill humans. Have sex with them insead. |
| 189 |
blank |
<blank> Advice: If your girlfriend starts blowing up your spaceship while in space. It's time to dump her. |
| 193 |
blank |
<blank> I get even with the white man by sleeping with the white woman. Revenge is sexually fullfilling. |
| 198 |
blank |
<blank> I want my nippons to explode. |
| 201 |
blank |
<blank> The good guys use freedomsh. |
| 207 |
blank |
<blank> gcc4 comes with a new changelog. |
| 208 |
blank |
<blank> compile something that only includes Bacteria.h |
| 211 |
blank |
<blank> Ack, this is sucking me into the Linux world. |
| 213 |
blank |
<blank> orbitz, yeah. I screamed like a little girl but you kept on bleeding anyway. |
| 222 |
blank |
<blank> My mom made it pretty clear. She said, "Don't let me catch you with win98 developers." |
| 223 |
blank |
<blank> No, to be a step child you must have a debugger for a parent. |
| 224 |
blank |
<blank> I can't make a pun out of autotools. It's too hard. |
| 226 |
blank |
<blank> The locales books scares me. It has turned pwned into a super hero. |
| 267 |
blank |
<blank> That's a good diea. |
| 275 |
blank |
<blank> I am both inferior and superior. |
| 279 |
blank |
<blank> Damn these bots... why can't they read my mind. |
| 283 |
blank |
<blank> Adrinael, yes I'll marry you. |
| 289 |
blank |
<blank> If I come up to you and show you my nudity the cops won't call it sharing. |
| 293 |
blank |
<blank> The bottom line is logs take up porn space. |
| 295 |
blank |
<blank> Losing one letter doesn't make you an orbitz. |
| 297 |
blank |
* blank cleans Grey's underwear |
| 307 |
blank |
<blank> I see my problem. It's right in my mirror! |
| 312 |
blank |
<blank> I actually listened to people talk about bread way before I heard about yakitate. |
| 331 |
blank |
<blank> That's it. I give in. You all have made me decided to dump C++ for Python. |
| 332 |
blank |
<blank> Being a gay hetrosexual woman. I take offense. |
| 355 |
blank |
<blank> You broke it! |
| 356 |
blank |
<blank> Sometimes headers need the funny bit shaken. |
| 388 |
blank |
<blank> I was just about to have sex. Phew. |
| 389 |
blank |
<blank> I was all alone. |
| 396 |
blank |
<blank> I want to be filled. |
| 400 |
blank |
<blank> So many useless commands. So little time. |
| 405 |
blank |
<blank> Someone should just set up a bash.org site. |
| 409 |
blank |
<blank> You people will grab anything that has a penis in it. |
| 419 |
blank |
<blank> Look at mine! |
| 421 |
blank |
<blank> I believe in hanging kids. |
| 422 |
blank |
<blank> There needs to be a #cylon-training |
| 423 |
blank |
<blank> It would be awesome. We would have a new generation of people who don't use emacs but Word. |
| 424 |
blank |
<blank> Judge, I would like a restraining order on orbitz. |
| 428 |
blank |
<blank> jep is failing behind. He must have found a job. |
| 439 |
blank |
<blank> "Owned by Pwned" is great. :) |
| 441 |
blank |
<blank> Those are my panties I gave you. :( |
| 442 |
blank |
<blank> Hurry up and sleep. The sooner you do it the faster you can drink tea. |
| 448 |
blank |
<blank> That's it, the terrorists must have won. |
| 450 |
blank |
<blank> Don't forget to include <iostream> before sex. |
| 460 |
blank |
<blank> It's more fun to play video games and be rich. |
| 466 |
blank |
<blank> There goes my objective judgement. |
| 468 |
blank |
<blank> That sounds grablicious. |
| 471 |
blank |
<blank> I was hoping for indian as in half naked people who can wrestle buffalos |
| 476 |
blank |
* blank rubs squeeze's tummy |
| 479 |
blank |
<blank> When I have no idea what Adrinael is talking about it usually ends up being something about common lisp. |
| 480 |
blank |
<blank> I was talking about putting kids on the clothes line to dry when they are wet. |
| 484 |
blank |
<blank> I put Adrinael into firefox and all the Mozilla Foundation gave me was tea. |
| 487 |
blank |
<blank> We'll make this place a gay bar yet. |
| 488 |
blank |
<blank> Manhattan is so gay that you can get your clothes fitted just by walking outside. |
| 499 |
blank |
<blank> It'll only let Microsoft figure out who you are. |
| 519 |
blank |
<blank> I switched away from monospace fonts and now boobs look funny |
| 547 |
blank |
<blank> Lynda Carter is HOT. Well, maybe a bit old by now. |
| 548 |
blank |
<blank> Leave him alone. He's on AOL. |
| 549 |
blank |
<blank> No bread for you me22. |
| 551 |
blank |
<blank> Is that slang for he's well hung and likes big breasted men? |
| 553 |
blank |
<blank> Oh man, my brain isn't working. |
| 560 |
blank |
<blank> I can just cry from being so lame. |
| 582 |
blank |
<blank> u_int32_t, you could be the first to make beer to target fat nerds with beards. GNU/budweiser. |
| 584 |
blank |
<blank> Uh-oh. Words I'm typing disappear. |
| 593 |
blank |
<blank> the crappy thing about my nick is that people say it a lot. |
| 595 |
blank |
<blank> stupidity is the number one error around here. |
| 599 |
blank |
* blank sees the words easy, doc, internals and gcc on one line |
| 606 |
blank |
<blank> Word is so close to being Emacs but so far. |
| 608 |
blank |
<blank> Man, these mysteriously disappearing factoids. |
| 609 |
blank |
<blank> whoa, googling for tangas gives you a full moon. |
| 610 |
blank |
<blank> NeverDream, mention penis. Everyone loves grabbing someone who says penis. |
| 613 |
blank |
<blank> Light saber fights should be like a game of chicken. |
| 627 |
blank |
<blank> Man, if it wasn't for Doow we wouldn't have had any C++ questions in the last few hours. |
| 628 |
blank |
<blank> Of course everything in perl can be done with just two random characters used mulitple tiimes in a line. |
| 630 |
blank |
<blank> The quotes database is so polluted it's no more interesting than me talking to myself. |
| 643 |
blank |
<blank> lisp > McDonalds |
| 652 |
blank |
<blank> I heard coders were sexy. I had to stop. |
| 654 |
blank |
<blank> I would grab it if it made sense. |
| 658 |
blank |
<blank> I think I learned how to spell anonymous by using ftp. |
| 662 |
blank |
<blank> He might be a vi user you insensitive tarp. |
| 664 |
blank |
<blank> They just had a scene with underwear and a girl fondling another girl. |
| 670 |
blank |
<blank> me22, it's just blood and sexual poses. |
| 693 |
blank |
<blank> Well, we should have given the comittee firearms and missles. That would have changed a few minds. |
| 696 |
blank |
<blank> I wish I was that rich that I could go running around on stage looking like a monkey. :) |
| 700 |
blank |
<blank> Well, but ugly like a well dressed gay man. |
| 1308 |
blank |
<blank> I hate you encoded. |
| 1316 |
blank |
<blank> I feel Finnish. |
| 1318 |
blank |
<blank> new_bie, just remember that we were friends before you picked an editor. |
| 1319 |
blank |
<blank> The things you forget in 3 months if sex is involved. |
| 1324 |
blank |
<blank> pwned, I think it's time for you to leave IRC. |
| 1328 |
blank |
<blank> Sex makes me angry. |
| 1329 |
blank |
<blank> Once we got !pi to be close to real pi |
| 1330 |
blank |
<blank> I shouldn't complain. I couldn't handle all that sex anyway. :) |
| 1335 |
blank |
<blank> You can suck on my nipple. |
| 1337 |
blank |
<blank> Nothing is as RAD as VB. NOTHING. |
| 1339 |
blank |
<blank> Bass. It's a fish with an ass. |
| 1349 |
blank |
<blank> I want to huggle a well known woman. |
| 1350 |
blank |
<blank> I'm waiting for the version of IRC where you can poke someone in the eye. |
| 1351 |
blank |
<blank> I like RedHat. |
| 1360 |
blank |
<blank> braden, I'm sure I'll mention hookers and orbitz again. |
| 1362 |
blank |
<blank> Hidden in the shadows of 288 nicknames there's a grabber. |
| 1366 |
blank |
<blank> My compiler is on fire. |
| 1368 |
blank |
<blank> I've only been back a few days and you guys already make me work. |
| 1369 |
blank |
<blank> Someone should just make an alias for that. |
| 1373 |
blank |
<blank> I'm reading fan letters to New Kids On The Block |
| 1385 |
blank |
<blank> Don't eat the 0xdeadbeef |
| 1388 |
blank |
<blank> Damn whitespace |
| 1389 |
blank |
<blank> Stop thinking about runtime. You pervert. |
| 1398 |
blank |
<blank> orbitz, people look at me funny because I use pizza as toilet paper. On the dining room table. |
| 1403 |
blank |
<blank> I'm pretty long. |
| 1411 |
blank |
<blank> It's well known that people grab quotes with dicks in it. |
| 1440 |
blank |
* blank loads his humor module |
| 1444 |
blank |
<blank> We only like people who float. |
| 1448 |
blank |
<blank> How about a sexy party? Anyone want a sexy party? |
| 1449 |
blank |
<blank> I gave a magnifying glass to the ants so they could take revenge. It was all fun and games until they burned the Whitehouse down. |
| 1452 |
blank |
<blank> LaEnigma, is it okay if I pretend you're a guy? |
| 1454 |
blank |
<blank> I bet people would grab me too if I was a girl. |
| 1458 |
blank |
<blank> I look good in chaps. |
| 1464 |
blank |
<blank> He's saying that if you learned C++ before you're 15 you won't get laid. Too much of a dork. |
| 1468 |
blank |
<blank> Can we clear the qoutes? I'd like to start over. |
| 1471 |
blank |
<blank> I've grabbed braden too much. His wife is starting to be suspecious. |
| 1473 |
blank |
<blank> make robots not war. |
| 1477 |
blank |
<blank> Don't confuse sexy parties with c++. |
| 1479 |
blank |
<blank> I'm not telling. My feelings are hurt by raf256[laptop]. |
| 1484 |
blank |
* blank rubs his poo on GeniXPro's furniture |
| 1499 |
blank |
<blank> PlasmaHH, do I have a trout stuck in my underwear again? |
| 1503 |
blank |
<blank> If only I could alias grab to something else. |
| 1504 |
blank |
<blank> cylon didn't kill any small children. It is acting a bit weird. |
| 1505 |
blank |
<blank> I bet cylon is smarter than auto_ptr |
| 1520 |
blank |
<blank> I have no hair and am constantly frumpy. |
| 1521 |
blank |
<blank> You could pound her while watching her kiddie porn videos. |
| 1522 |
blank |
<blank> I don't think anyone cares if you drink your own urine. It's when you share it that people are concern. |
| 1524 |
blank |
<blank> multiline grabs are called bash.org |
| 1527 |
blank |
<blank> There's got to be a basement full of overworked EA programmers. |
| 1534 |
blank |
* blank slaps godling on the butt in a manly way |
| 1541 |
blank |
<blank> boost::stalker_ptr knows where you live. |
| 1555 |
blank |
<blank> I certainly hope azzor can find himself a woman. I doubt he can change the toilet paper on his own. |
| 1557 |
blank |
<blank> Hookers. |
| 1577 |
blank |
<blank> You must be new here... |
| 1578 |
blank |
<blank> DUD3 MAH C+ PROBLEM <insert anime porn image here> |
| 1579 |
blank |
<blank> cylon: startkeylogger |
| 1584 |
blank |
<blank> It's hard to take an upskirt photo on IRC. |
| 1601 |
blank |
<blank> What horrible grabs. |
| 1602 |
blank |
<blank> Grabbing is the ebil. |
| 1603 |
blank |
<blank> I knew I was getting old when 13 year old didn't look appealing. |
| 1614 |
blank |
<blank> A c++ compiler. |
| 1621 |
blank |
<blank> I'm setting fire to my weener. |
| 1623 |
blank |
<blank> I use svn to watch porn. |
| 1648 |
blank |
<blank> If they can come up with 'blog' I can come up with something. |
| 1649 |
blank |
<blank> braden made me do it. |
| 1653 |
blank |
<blank> this is probably valid in perl: !#$!%!% |
| 1658 |
blank |
<blank> I think I'll just put cylon on ignore. |
| 1660 |
blank |
* blank ( U up); |
| 1663 |
blank |
<blank> Look at me. I'm green. |
| 1670 |
blank |
<blank> The Internet is scary. |
| 1671 |
blank |
<blank> My penis is small. |
| 1730 |
blank |
<blank> I program in MS Word. |
| 1731 |
blank |
<blank> This is why PlasmaHH doesn't talk much. He prefers to use his chainsaw to express his feelings. |
| 1733 |
blank |
<blank> Bobl, I don't think 80% of the quotes are very good. |
| 1738 |
blank |
<blank> He's not just the guy with manboobs but a tasty meal too. |
| 1752 |
blank |
<blank> I'd like a garbage collector, export and a pony. |
| 1754 |
blank |
<blank> There's so much pr0n to go around I just stream it. |
| 1761 |
blank |
<blank> Now, if we're done with crapping... |
| 1767 |
blank |
<blank> Trust no one and kill the infidels. |
| 1776 |
blank |
<blank> A very large black man grabbed my balls the last time I had to fly. |
| 1786 |
blank |
<blank> I bet you didn't know that you can really grow your penis with spam. |
| 1793 |
blank |
<blank> Dude, RAM is cheap. You don't need all your organs do you? |
| 1797 |
blank |
<blank> More drama happens here than a reality TV show about gay fashion designers. |
| 1798 |
blank |
<blank> Nine months to do something useful. Thirteen years to know it. One day to make you cry. |
| 1800 |
blank |
<blank> pwned, I only drink the sweat of my enemies. |
| 1817 |
blank |
<blank> Damn, it rained so hard outside I thought I was in Seattle. |
| 1856 |
blank |
<blank> Don't listen to them! Use msvc++ 6. Just don't come back here. |
| 1858 |
blank |
<blank> They tried to make me defend Gimp. |
| 1859 |
blank |
<blank> I've been here for 4 years!?! |
| 1860 |
blank |
<blank> I need to watch more gay TV. |
| 1861 |
blank |
<blank> I actually can't tell when someone is going to grab me. |
| 1890 |
blank |
<blank> glen_quagmire is like the person you want to put on ignore but then you'll feel bad because it's like ignoring a retard. |
| 1896 |
blank |
<blank> boost::foot::armor |
| 1897 |
blank |
<blank> It's cute every time it happens. :) |
| 1915 |
blank |
<blank> I'm talking sausage. |
| 1916 |
blank |
<blank> The GNU Hello World had some confusing code with #define and something about Elvis. It wasn't a good thing for me to see. |
| 1917 |
blank |
<blank> I think this whole grabbing me thing is a fad that should be stopped. |
| 1941 |
blank |
<blank> Adrinael, your grabs are horrible too |
| 1949 |
blank |
<blank> four grape juice sticks! |
| 1958 |
blank |
<blank> I'd like a cluster of xbox 360 running slashdot! |
| 1980 |
blank |
<blank> godling, you're going to turn into Carbonflux one day. |
| 1982 |
blank |
<blank> We really need a central place where people can get Internet psychological help. |
| 1989 |
blank |
<blank> Death is for the weak. |
| 1993 |
blank |
<blank> There really needs to be a #WoW-Recovery |
| 2037 |
blank |
<blank> I refuse to eat a Turk. |
| 2042 |
blank |
<blank> aaiieeee! |
| 2192 |
blank |
<blank> You bastards. I hope your dog gets eaten in hell. |
| 2200 |
blank |
<blank> When a Mac is faster than your machine it's obsolete. |
| 2207 |
blank |
<blank> Bagels aren't funny. |
| 2215 |
blank |
<blank> I'd like to have man sex with you in a non gay way. |
| 2222 |
blank |
<blank> And it can't be American Football or rugby where guys stick their fingers up your ass. |
| 2226 |
blank |
<blank> You don't die very fast if all you do is sit in a room and wish you could masturbate. |
| 2228 |
blank |
<blank> It's all fun and games until someone puts it on bash.org. |
| 2229 |
blank |
<blank> Oh and I got a limited edition of elves from LOTR having sex. |
| 2230 |
blank |
<blank> That's nothing. I'm wearing a tarp. Without underwear! |
| 2233 |
blank |
<blank> I worked at a porn company. :P |
| 2242 |
blank |
<blank> Damn, you sing a Backstreet Boys song and people think you're gay. |
| 2243 |
blank |
<blank> Damn you Windows programmers. I'm trying to eat. |
| 2244 |
blank |
<blank> Hey! You can't grab that. I didn't say anything sexy. |
| 2248 |
blank |
<blank> Dude, your compiler probably fits on a 1.44 floppy. |
| 2250 |
blank |
<blank> pwned, don't make godling shoot homosexuals at me again by being a liar. |
| 2281 |
blank |
<blank> The blue pill means you can eat steak. |
| 2285 |
blank |
<blank> It's like xchat has more development than irssi but they're not getting anywhere. |
| 2292 |
blank |
<blank> pundai, I'm a woman. |
| 2294 |
blank |
* blank puts orbitz on his hottest hits list |
| 2296 |
blank |
<blank> [ The template errors are so long that we decided to show you quake with ascii art ] |
| 2297 |
blank |
<blank> It's all fun and games till someone else has to use your code. |
| 2306 |
blank |
<blank> int. Dammit! |
| 2322 |
blank |
<blank> This makes me not want to program even though I'm not programming. |
| 2323 |
blank |
<blank> Wow, if I pay $1500 I get an iPod for free! |
| 2325 |
blank |
<blank> All this talk makes me want to code. I better go do my laundry. |
| 2336 |
blank |
<blank> kre-, I hope you're not one of those bastards with a superior strings class that keeps it all to himself. |
| 2337 |
blank |
<blank> And I have to make my own class heiarchy with the one Object to rule them all. |
| 2340 |
blank |
<blank> Professors are poor example of C++ usages. |
| 2344 |
blank |
<blank> I was born in the Microsoft labs. |
| 2352 |
blank |
<blank> Maybe the Linux kernel needs more fiber. I am not having enough core dumps. |
| 2353 |
blank |
<blank> How nice it must be to not be quoted. |
| 2490 |
blank |
<blank> I speak gay pirate booty. |
| 2499 |
blank |
<blank> Segfault means different things to different people. Like sex. Sometimes people think IRC sex is real. |
| 2555 |
blank |
<blank> Darn, I really wanted to be smarter. |
| 2576 |
blank |
<blank> pwned, you won't get to cross the bridge until you answer the questions, three. |
| 2581 |
blank |
<blank> Dammit, when I get old I'm going to have to hire some young kid to translate shorthand on the Internet. |
| 2583 |
blank |
<blank> I only IRC and watch porn on the Internet. One is a downer and the other an upper. |
| 2584 |
blank |
<blank> I'm going to pee on Bill Gate's face because they didn't make another UNIX! |
| 2666 |
blank |
<blank> It's seems like a common thing people do here for callbacks with C libraries. |
| 2669 |
blank |
<blank> I'm asserting that I don't remember you being this hyper. |
| 2688 |
blank |
<blank> <blank> I actually can't tell when someone is going to grab me. |
| 2692 |
blank |
<blank> Hey! I saw Eclipser laughing! No fun allowed. |
| 2717 |
blank |
<blank> orbitz is so leet he doesn't have to use the keyboard. |
| 2722 |
blank |
<blank> copyup, copyup, copydown, copydown, copyleft, copyright, B, A, Select, Start. |
| 2726 |
blank |
<blank> It's amazing how much error checking can slow you down. |
| 2734 |
blank |
<blank> Crap, I thought I had bought a lot of books. I'm guessing I left them at the book store unbought. |
| 2746 |
blank |
<blank> Black socks are off topic. Please wear green socks. |
| 2747 |
blank |
<blank> Heh, that's awesome, I wouldn't have expected something that looks like C to be templated. |
| 2748 |
blank |
<blank> I hope that was a manly slap. Otherwise people will think you're a fruit. |
| 2754 |
blank |
<blank> Your momma is so fat it's blocking the next standard release. |
| 2755 |
blank |
<blank> Yo momma so fat they had to add a new datatype to C++ called god_damn_freaking_long_long. |
| 2757 |
blank |
<blank> If braden was here he'd whack me for the phrasing. |
| 2758 |
blank |
<blank> glen_quagmire uses myspace to profile. |
| 2772 |
blank |
<blank> Now we know that sohail is a genius. |
| 2775 |
blank |
<blank> Wow, something more boring than sudoku. |
| 2777 |
blank |
<blank> No, the other idiot. |
| 2778 |
blank |
<blank> <scooby> ruttro |
| 2790 |
blank |
<blank> I saw you go to the bathroom. |
| 2807 |
blank |
<blank> Leave your Java expectations at the door. You're here to blow your foot off. |
| 2817 |
blank |
<blank> Just ship your code with a debugger. |
| 2850 |
blank |
<blank> Milk my timbers. |
| 2853 |
blank |
<blank> No, you do what you suck. |
| 2862 |
blank |
<blank> pfeilspitze, I don't do C++ either! |
| 2878 |
blank |
<blank> Stop laughing. You're always having a good time! |
| 2907 |
blank |
<blank> C is an older language. Its standards gets updated first. Then C++ must cry about it and try to incorporate them. |
| 2908 |
blank |
<blank> Fun leads to sex. Sex leads to religion and politics. Which leads Anakin to the dark side. |
| 2938 |
blank |
<blank> I'm religious. |
| 2940 |
blank |
<blank> I think the idea of using C is to be exploited. |
| 2942 |
blank |
<blank> Your manhood is dictated by the size of your emacs configuration file. |
| 2945 |
blank |
<blank> I do homework for fairies. |
| 2946 |
blank |
<blank> Just because I was excited about elf porn doesn't make it right. |
| 2957 |
blank |
<blank> We need more factoids so we don't have to talk to each other. |
| 3005 |
blank |
<blank> I just tell them I'm gay. |
| 3037 |
blank |
<blank> Damn, downloading Fedora Core is preventing me from looking at pictures of braden. |
| 3057 |
blank |
<blank> raf256, will you kiss me? smoochie smoochie? |
| 3101 |
blank |
<blank> I like big cocks! |
| 3102 |
blank |
<blank> You know that you like it when males talk about cocks. |
| 3114 |
blank |
<blank> !rq me |
| 3115 |
blank |
<blank> braden, talk more about Java. I was getting a stiffy. |
| 3117 |
blank |
<blank> What I need is a man that pretends to be a man. |
| 3123 |
blank |
<blank> It turns out it is still big if you don't understand the material. |
| 3127 |
blank |
<blank> A finely tuned man chest can be something to stare at too! |
| 3141 |
blank |
<blank> Mr_Awesome, that's okay. I know you are mean. |
| 3160 |
blank |
<blank> Apple makes me mad at MS too. |
| 3181 |
blank |
<blank> So close. |
| 3182 |
blank |
<blank> I was using the grab database for wisdom. Then it got funny. Now it's just as good as reading this channel without editing. |
| 3183 |
blank |
<blank> When I was a kid I walked bare foot in the snow uphill both ways to get a C++ book and the book sucked. |
| 3187 |
blank |
<blank> The best part is that now we know Vratha sucks. |
| 3190 |
blank |
<blank> Douchbags are clean. |
| 3193 |
blank |
<blank> Vratha, you're smarter when you don't talk about sex. |
| 3195 |
blank |
<blank> Vratha, you're thinking the NT KFC. |
| 3196 |
blank |
<blank> I only grab braden. |
| 3198 |
blank |
<blank> I think the GC would have succeeded more if people had real life friends. |
| 3321 |
blank |
<blank> I have a pirated version of Linux. |
| 3325 |
blank |
<blank> I better name my toilet. |
| 3330 |
blank |
<blank> Oh the other hand, if it looks good enough it's a duck. |
| 3332 |
blank |
<blank> No, I mean if you mention someone's dick someone will grab it. |
| 3339 |
blank |
<blank> I'm too busy writing an entry on how you don't read my blog and commenting. |
| 3364 |
blank |
<blank> I was busy waiting for more snot. |
| 3425 |
blank |
<blank> Whoops, dropped the keyboard. |
| 3426 |
blank |
<blank> hrm. |
| 3455 |
blank |
<blank> I wish I had my bunny ears on me. That way when I go hunting the pray will go 'WTF?' and then I shoot them. |
| 3478 |
blank |
<blank> It is so holy that not even Eelis speaks. |
| 3479 |
blank |
<blank> I can't grab that. It isn't about me. |
| 3480 |
blank |
<blank> Mmm, command thingies. |
| 3482 |
blank |
<blank> I'm not gay but I'd hit that up. |
| 3485 |
blank |
<blank> Okay, is it time for comparing penis size? |
| 3492 |
blank |
<blank> runtime, oh. I can give you a gayer one. |
| 3493 |
blank |
<blank> I would grab that but no one else would laugh. |
| 3504 |
blank |
<blank> hrm, i died. |
| 3515 |
blank |
<blank> I'm going to participate in the Google summer of sleep. |
| 3588 |
blank |
<blank> I saw Resident Evil on the PS1 and it was like looking at bad legos. |
| 3592 |
blank |
<blank> I have wifi. I can stand outside. |
| 3596 |
blank |
<blank> I took out my video card so that I can't use Vista. |
| 3597 |
blank |
<blank> Now I need Coke... |
| 3610 |
blank |
<blank> Wow, I compiled something. |
| 3622 |
blank |
* blank is sorry he had a job |
| 3624 |
blank |
<blank> I want Metabol's baby too |
| 3630 |
blank |
<blank> Note to self: do not write note to selfs here |
| 3631 |
blank |
<blank> I will use BOLD text to fight you. |
| 3632 |
blank |
<blank> I wish we had more fetish places here. |
| 3639 |
blank |
<blank> There was just something about using this small girl killing zombies with a rocket launcher. |
| 3649 |
blank |
<blank> Wow! I want a soccer mom to make my penis erect... |
| 3660 |
blank |
<blank> Learning std::vector might require learning C++ though. How about a more error prone solution? |
| 3671 |
blank |
<blank> There are days when making fun of people don't make me laugh. That's when I know I'm depressed. |
| 3675 |
blank |
<blank> Touch my boobies, they are ripe. |
| 3696 |
blank |
<blank> I miss the old days when an hour was a really long time. |
| 3743 |
blank |
<blank> Yeah, because butt sex sounds dirty. Buttsecks is cute. |
| 3755 |
blank |
<blank> I would be gay if men had vaginas. |
| 3789 |
blank |
<blank> Now I know. |
| 3798 |
blank |
<blank> The best part is that you can't install Vista on a PS3. |
| 3801 |
blank |
<blank> I bath in green tea. |
| 3853 |
blank |
<blank> I get spam on gmail from people spamming the wxWidgets mailing list. |
| 3873 |
blank |
<blank> I am wrong. Lets move on. |
| 3881 |
blank |
<blank> There's just something delicious about this biting him in the ass. |
| 3916 |
blank |
<blank> Hey! We small penis people have feelings! |
| 3922 |
blank |
<blank> I like big dicks. |
| 3942 |
blank |
<blank> I only use IE to download Firefox. :P |
| 3954 |
blank |
<blank> Damn. I feel pwned. |
| 3961 |
blank |
<blank> I can get 7000 lines in ##c++ without ever answering a question. :| |
| 3980 |
blank |
<blank> !qrab Adrinael |
| 3981 |
blank |
<blank> We all welcome you. Except nolyc. |
| 4037 |
blank |
<blank> Is there a relationship without a slight problem? |
| 4071 |
blank |
<blank> Says my vagina! |
| 4090 |
blank |
<blank> 11 hours to download an ISO. I wish they made CD ISOs. |
| 4091 |
blank |
<blank> I'm gay in a can! |
| 4099 |
blank |
<blank> You'll never write a programming language without a beard. |
| 4118 |
blank |
<blank> Wait, why am I adding code for things I might need when I haven't added code for things I do need. |
| 4131 |
blank |
<blank> Don't worry, Java is easy to forget. |
| 4136 |
blank |
<blank> Here's a great comment on from YouTube: uuuuuuu |
| 4141 |
blank |
<blank> You guys are too on topic that you're making the on topic discussion go away. Stop being on topic. |
| 4201 |
blank |
<blank> The best part about using unknown software is that you get to be the expert. |
| 4202 |
blank |
<blank> Chuck Norris does not get or set. He round house. |
| 4215 |
blank |
<blank> Personally, I object to the singleton being the only pattern out there. |
| 4222 |
blank |
<blank> //hey you. if you make more than oen of this i am going to kill your kitten. |
| 4248 |
blank |
<blank> Who would date anyone interested in C++. |
| 4266 |
blank |
<blank> This sense is making me hurt! |
| 4277 |
blank |
<blank> No, he unziped his pants and made a mouth movement that looked like he said 'Sock Me'. |
| 4286 |
blank |
<blank> Heh, that is a nice butt slap. So manly. |
| 4292 |
blank |
<blank> Gah. Everytime braden says anus someone wants to grab it. |
| 4293 |
blank |
<blank> Can we stop looking at my quotes? |
| 4299 |
blank |
* blank imagines Bigcheese with a big beard and a katana telling kids to use free software |
| 4300 |
blank |
<blank> Ha. |
| 4302 |
blank |
<blank> This is why I cut off the cock before I eat the pussy. |
| 4303 |
blank |
<blank> Whores will have sex with you whenever you want. |
| 4311 |
blank |
<blank> freedom nodes! |
| 4313 |
blank |
<blank> gltron once tried to clean it up. While he was on the airplane he edit his code on paper. |
| 4351 |
blank |
<blank> They need to add next page arrows in Web 3.0. |
| 4355 |
blank |
<blank> Mdollarsign backs C++. |
| 4382 |
blank |
<blank> All I know is that the porn server I use was getting MySQL errors. |
| 4387 |
blank |
<blank> I have a big bird in my ass |
| 4388 |
blank |
<blank> I touch my ass all day. |
| 4389 |
blank |
<blank> My ass is so big I need two keyboards to stick in it. |
| 4390 |
blank |
<blank> I wonder who's going to grab my next line. |
| 4391 |
blank |
<blank> I was wonder if there was a set limit. |
| 4397 |
blank |
<blank> I use to walk around dressed in black with robert smith makeup on. |
| 4407 |
blank |
<blank> Someone said dynamic and C++. I think my screen just flashed and killed a kitten. |
| 4416 |
blank |
<blank> Bleah. |
| 4417 |
blank |
<blank> Heh, I saw my first flying penis on Second Life today. |
| 4473 |
blank |
<blank> Size matters. |
| 4478 |
blank |
<blank> Yay, one less person using C++. |
| 4486 |
blank |
<blank> I can download hentai again! |
| 4487 |
blank |
<blank> If you make a sizeof factoid I'll have nothing left to contribute. |
| 4502 |
blank |
<blank> Yes, I would have sex with my mother. |
| 4505 |
blank |
<blank> Oh, now you want to social. You spoony bard. |
| 4513 |
blank |
<blank> I better stop talking about this. I'm always taken back by now the word gay makes people think about man sex. |
| 4518 |
blank |
<blank> Yeah, like drink beer and rape. |
| 4578 |
blank |
<blank> Google doesn't sort for me. |
| 4579 |
blank |
<blank> mine is hotpervertfreeipod |
| 4580 |
blank |
<blank> A futanari girl is best. |
| 4581 |
blank |
<blank> up up down down left right b a start |
| 4600 |
blank |
<blank> I always want it on my nose. |
| 4611 |
blank |
<blank> Wow and Debian Stable is older than I can count. I think I can count to two. |
| 4613 |
blank |
<blank> I love nuggets. |
| 4621 |
blank |
<blank> I sold porn to make money for C++ books. |
| 4623 |
blank |
<blank> Hey wait, I'm not going to be blamed for this topic, am I? |
| 4632 |
blank |
<blank> The Internet stores my porn. How smart is that! |
| 4645 |
blank |
<blank> Nature needs to make more bi women. |
| 4650 |
blank |
<blank> Hee hee, he said new. So dirty. |
| 4676 |
blank |
<blank> Huh, the strange angry old man has a shirt on. |
| 4692 |
blank |
<blank> Jamie Lee Curtis is not turing complete! |
| 4718 |
blank |
<blank> Haven't you heard? C++ sucks! |
| 4727 |
blank |
<blank> IRC is the old MMORPG. |
| 4779 |
blank |
<blank> This is a public channel. |
| 4780 |
blank |
<blank> In that case, I will have hot sex with you. |
| 4792 |
blank |
<blank> Gmail is simple. You sell your soul. You get free email. |
| 4793 |
blank |
<blank> If someone doesn't scream 'What the fuck!' or 'Woohoo!' now and then I think they aren't working. |
| 4800 |
blank |
<blank> I can't even spell Youssef. |
| 4807 |
blank |
<blank> Who knew Youssef was ghetto. |
| 4817 |
blank |
<blank> Showing your middle mouse button is rude in society. |
| 4831 |
blank |
<blank> Great, now I have Christmas songs stuck in my head. |
| 4834 |
blank |
<blank> God is a daemon for the go client. |
| 4837 |
blank |
<blank> I'm so old I remember when Adrinael wasn't an op. |
| 4838 |
blank |
<blank> I'm so old, I remember having a president that could read and write. |
| 4846 |
blank |
<blank> I better quit before my ass is sore. |
| 4847 |
blank |
<blank> miles33: do it again! I'll grab! |
| 4855 |
blank |
<blank> I believe in love with animals. |
| 4862 |
blank |
<blank> I've read Slashdot. I'm well armed. |
| 4864 |
blank |
<blank> For one thing, I wouldn't want a crazy viking attacking me when I am beating up my girlfriend with a shotgun. |
| 4879 |
blank |
<blank> It made me pee in my pants. |
| 4955 |
blank |
<blank> A penis never made me laugh. |
| 4998 |
blank |
<blank> Only take off your pants when men are around. |
| 5007 |
blank |
<blank> Wait, outside isn't SecondLife is it? |
| 5075 |
blank |
<blank> I just paste from the quotes database. |
| 5109 |
blank |
<blank> Tonight we dine in void* |
| 5113 |
blank |
<blank> Me? I don't have a Wii. |
| 5114 |
blank |
<blank> Even chicken doesn't taste like chicken. |
| 5124 |
blank |
<blank> Oh man, and then there was the time I had to be felt up by an attractive black man. |
| 5133 |
blank |
<blank> I forgot I might be gay. |
| 5138 |
blank |
<blank> Lede: dude, Link eats fairies! |
| 5142 |
blank |
* blank squirts on Lede some more |
| 5143 |
blank |
* blank doesn't infinate man juice attack charlls |
| 5146 |
blank |
<blank> I'm Sailor Moon. |
| 5150 |
blank |
<blank> I do enjoy gay sex! |
| 5160 |
blank |
<blank> I call bullshit without reading anything above this line. |
| 5165 |
blank |
* blank is happy he doesn't have to buy Zharf a birthday present |
| 5172 |
blank |
<blank> !qrab bronaugh |
| 5188 |
blank |
<blank> C does not suck. Your grandma is a woman! |
| 5202 |
blank |
<blank> Besides, Carbonflux keeps grabbing all my lines. |
| 5203 |
blank |
* blank cries in the rain for miles33 |
| 5220 |
blank |
<blank> And then I said to Bigcheese, "Look at this horsecock!". |
| 5230 |
blank |
<blank> grab that! |
| 5232 |
blank |
<blank> Grab that! |
| 5236 |
blank |
<blank> No mine! |
| 5237 |
blank |
<blank> !grab Spion in an uncomfortable way with two thongs |
| 5274 |
blank |
<blank> xystic, I hope Lede goes to work for MS and punches you in the face |
| 5275 |
blank |
<blank> I used MD5 on my girlfriend. Her boobs got bigger but I'm not sure they're the right pair. |
| 5295 |
blank |
<blank> That's one small penis. |
| 5299 |
blank |
<blank> Oh, then I don't blame him. I'm cute. |
| 5314 |
blank |
<blank> I failed the turning test. |
| 5335 |
blank |
* blank imagines |
| 5348 |
blank |
<blank> I'm training to be the 12 year old girl with magic powers of goodness that will stop the robot with LUV. |
| 5365 |
blank |
<blank> I am motivated by naked women. |
| 5389 |
blank |
<blank> We need hackers that don't have sex. |
| 5390 |
blank |
<blank> It's not a good day when I forget who I am and start talking to myself. |
| 5411 |
blank |
<blank> I wanted to make it more difficult by not using X. |
| 5423 |
blank |
<blank> Generation NOW is the Spice Girls generation. |
| 5425 |
blank |
<blank> I need to update my about:blank page. |
| 5429 |
blank |
<blank> I'm 4 years old. |
| 5430 |
blank |
<blank> I wish it was heavy and could cut things too. |
| 5433 |
blank |
<blank> Cecen, next time you poo you should eat some of it |
| 5439 |
blank |
<blank> I throw Steve Balmer. |
| 5440 |
blank |
<blank> I like how wet it is. |
| 5455 |
blank |
<blank> I seem to remember horny girls at 13. |
| 5459 |
blank |
<blank> Huh, money made me use PHP too. |
| 5460 |
blank |
<blank> Yeah, I wouldn't want to be publicly traded. |
| 5469 |
blank |
<blank> I'd totally hit that cat. |
| 5472 |
blank |
<blank> Cecen, finally, a gay man that wouldn't have sex with me. |
| 5490 |
blank |
<blank> Mmm virtual men. |
| 5507 |
blank |
<blank> Bleah. Nuclear power leads to mechs. Mechs lead to Voltron. Voltron leads to aliens defeating us and needing a defender. |
| 5513 |
blank |
<blank> The woman mathematician in Numb3rs is so hot. Just like real math women in real life! |
| 5514 |
blank |
<blank> Firefox 4 took no memory 4 years ago. I don't expect it to change now. |
| 5516 |
blank |
<blank> IRC, where typing like a retard is a sport. |
| 5517 |
blank |
<blank> I need bigger boobies. |
| 5519 |
blank |
<blank> I guess no one got grabbed. |
| 5527 |
blank |
<blank> Semen will just make you smell like bleach. |
| 5529 |
blank |
<blank> Fear xystic, for he works for MS. He is the devil! |
| 5536 |
blank |
<blank> It's so true. lede loves xystic. |
| 5537 |
blank |
<blank> Hey, it's 100% blank. |
| 5542 |
blank |
<blank> I disagree with chinaman mostly because people who want to beat me up say that. |
| 5588 |
blank |
<blank> God is a civil engineer. No one else would put the waste disposal facility near the playground. |
| 5596 |
blank |
<blank> Hrm, maybe I was too busy getting ass to be in your clique. |
| 5597 |
blank |
<blank> It's useful when you want to have a three-way with a German and Brit. |
| 5601 |
blank |
<blank> Carbonflux is stealing all my good lines. |
| 5608 |
blank |
<blank> Hrm, I'm missing a cat. |
| 5653 |
blank |
<blank> I shot the C++ compiler but I did not shoot the assembler. |
| 5669 |
blank |
<blank> Being the only PS3 owner in North America has its perks. |
| 5679 |
blank |
<blank> Wait, I don't know what you're asking. |
| 5695 |
blank |
<blank> He has the same problem as me. 20 years of controller experience. |
| 5748 |
blank |
<blank> It's a game killing simulator! |
| 5764 |
blank |
<blank> One day a handsome guy will add it back. |
| 5772 |
blank |
<blank> rand() % blank |
| 5778 |
blank |
<blank> pwned: I will be happy to sex your pooper. |
| 5779 |
blank |
<blank> parkinm2: I will be happy to sex your pooper too |
| 5797 |
blank |
<blank> If I get a little fatter I'll need a bra. |
| 5802 |
blank |
<blank> FYI, if anyone asks, I'm not having butt sex, right now. |
| 5804 |
blank |
<blank> I don't remember MTV playing music. |
| 5828 |
blank |
<blank> That was at least initiative. |
| 5834 |
blank |
<blank> Oh man, I really hope there's no oil in Laos. The last thing it needs is to be liberated. |
| 5837 |
blank |
* blank gets read to grab brady_k |
| 5840 |
blank |
<blank> Pretty much. |
| 5841 |
blank |
<blank> I will ban you for overclocking. |
| 5844 |
blank |
<blank> When I hang out with the math nerds, I'm like the cool guy who plays video games. |
| 5855 |
blank |
<blank> +grab nokmar |
| 5891 |
blank |
<blank> That dude is the sexiest woman in the picture. |
| 5900 |
blank |
<blank> I make nazi jokes all the time. |
| 5905 |
blank |
<blank> The enter has been pressed! |
| 5906 |
blank |
<blank> Amidar: sorry, I'm not going to cybersex with you. |
| 5927 |
blank |
<blank> No graphic artist. Welcome to the Internet and making a game. ;) |
| 5933 |
blank |
<blank> He said 'get off my lawn you ghay people' |
| 5934 |
blank |
<blank> Stop being overly hetrosexual for a second! |
| 5936 |
blank |
<blank> That's no boy. |
| 5962 |
blank |
<blank> Oh yeah, I forgot about Yahoo!. |
| 5963 |
blank |
<blank> I watched the Jet Li and Jackie Chan movie. They had sysadmins in the credit. |
| 5998 |
blank |
<blank> I don't believe freedom is being able to do what you want. |
| 5999 |
blank |
<blank> Finally, now that Jessicatz is here, I can sleep. |
| 6005 |
blank |
<blank> College makes me horny. |
| 6023 |
blank |
<blank> I stabbed a man in Vegas. Just to watch him die. |
| 6026 |
blank |
<blank> Damn you Americans and your obsession with pubic hair! |
| 6029 |
blank |
<blank> Just from personal experience, men and women don't understand each other. |
| 6030 |
blank |
<blank> I like warm and wet too. |
| 6031 |
blank |
<blank> That was so Internet time ago. |
| 6039 |
blank |
* blank waits for Metal Gear Solid 4 to get to his house and be a vegetables for another month |
| 6074 |
blank |
<blank> Wow, there's people who actually want a Heavenly Sword 2. |
| 6075 |
blank |
* blank goes to find plant cum |
| 6080 |
blank |
<blank> I bet. |
| 6097 |
blank |
<blank> Ever watch an anime and make your own story up? |
| 6098 |
blank |
<blank> That reminds me, I am trying to finish MGS4 on the hardest difficulty without killing anyone or getting an alert. |
| 6101 |
blank |
<blank> She was twitching and clawing my feet. |
| 6140 |
blank |
<blank> Have I mentioned that Chrono Trigger looks better than Diablo 3? |
| 6148 |
blank |
<blank> pee pressure. Hrm. |
| 6151 |
blank |
<blank> Dude, IRC looks better than Diablo III! |
| 6161 |
blank |
<blank> Thankfully I don't normally cheat on my girlfriends. |
| 6163 |
blank |
<blank> At a certain point they'll be bigger and younger than me. |
| 6164 |
blank |
<blank> If there was a god I would have boobies. |
| 6171 |
blank |
<blank> Eww, they're going to sit on the grass, naked. |
| 6177 |
blank |
<blank> She spent ten minutes making me feel very uncomfortable while she licked it. |
| 6200 |
blank |
* blank sacrifices his vote to have five people vote for Obama |
| 6212 |
blank |
<blank> Get out now! |
| 6234 |
blank |
<blank> Grab me too! |
| 6235 |
blank |
<blank> m a k e |
| 6243 |
blank |
<blank> I do enjoy that excrement. |
| 6245 |
blank |
<blank> Don't use namespace facility |
| 6259 |
blank |
<blank> You wouldn't know gay if it was up your ass. |
| 6326 |
blank |
<blank> I don't know why they put such big porn and violence on TV! |
| 6329 |
blank |
<blank> No civilian is innocent reminds me of radical muslims. |
| 6331 |
blank |
<blank> X-Chat Aqua is as old as my first Atari. |
| 6332 |
blank |
<blank> Even the Windows version is way ahead of it. |
| 6361 |
blank |
<blank> badum dish. |
| 6368 |
blank |
<blank> I can't tell why I'm more different than Jafet or xystic! |
| 6372 |
blank |
<blank> I like TEAM GOLD ENTERPRISE ULTRA DELUX EDITION EDITION ADDITION better. |
| 6373 |
blank |
<blank> But I really doubt that some of the people who couldn't set up MSVC++ and program hello world has that subscription. |
| 6375 |
blank |
<blank> Jessicatz, I've been one for years! |
| 6376 |
blank |
<blank> xystic, don't say that! |
| 6377 |
blank |
<blank> One time I opened a link here it was a dog licking some woman's vagina. |
| 6389 |
blank |
<blank> See, that was saved by xystic. |
| 6415 |
blank |
<blank> First lede, then Almathea and now Jessicats! |
| 6439 |
blank |
<blank> That's some really nice pussy! |
| 6441 |
blank |
<blank> I lie about what I do. |
| 6470 |
blank |
<blank> We only use MS products here. |
| 6502 |
blank |
<blank> P.S. MS ate my unborn. |
| 6508 |
blank |
<blank> Wow, I haven't read the topic in awhile. I forgot we were suppose to be patient, courteous, and precise. |
| 6510 |
blank |
<blank> You can even make crazy_pete crazy. |
| 6511 |
blank |
<blank> You missed xystic driving crazy_pete insane. |
| 6568 |
blank |
<blank> How dare you marry an American! |
| 6589 |
blank |
<blank> I once used a MS product and hackers took it over to destroy someone's hospital. |
| 6634 |
blank |
<blank> X is old and stale. Like my right to free sex. |
| 6635 |
blank |
<blank> Man, I wonder if this channel could get me laid. |
| 6649 |
blank |
<blank> ambika, so you enjoy games that you play by yourself for 5 minutes wagging a stick? |
| 6650 |
blank |
<blank> I love the 360. |
| 6659 |
blank |
<blank> He said he was a senior software architecture. |
| 6660 |
blank |
<blank> These wet Chinese are kind of hot. |
| 6664 |
blank |
<blank> I'm trying to avoid reading code. |
| 6682 |
blank |
<blank> Oh shit, one of the girls is bleeding. |
| 6684 |
blank |
<blank> You two are both fired. No bonding. |
| 6685 |
blank |
<blank> Actually, maybe I should stop listening to church officials. |
| 6686 |
blank |
<blank> Aren't I the one that should be jizzing... |
| 6690 |
blank |
<blank> [14:57] <miles33> ii boated for george bush |
| 6697 |
blank |
<blank> You've been here all this time and you think HE is weird? |
| 6743 |
blank |
<blank> Heaven forbid. The last thing I want to see is another bot talk like me. |
| 6774 |
blank |
<blank> It would rot and my mutated flesh would eat it. |
| 6803 |
blank |
<blank> I don't feeling like xuiing my life. |
| 7021 |
blank |
<blank> Apple is probably high. |
| 7044 |
blank |
<blank> I just don't like it when it's so obvious they're just playing the people. Look at Britney! Forget you're poor! |
| 7070 |
blank |
* blank mode rebel ON |
| 7073 |
blank |
* blank is having a hard time getting two hands free to type |
| 7082 |
blank |
<blank> It's a thingie that holds other thingies that you can use to provide functionalities. |
| 7112 |
blank |
<blank> Hi, I can't tell that managed C++ is a new language. |
| 7118 |
blank |
<blank> I drink the urine from the dead bodies of my enemies. It has adrenaline flavor. |
| 7125 |
blank |
<blank> I'd rather suck on a fermented apple. |
| 7139 |
blank |
<blank> If you shake it more than three times after you pee, it's masturbating. |
| 7149 |
blank |
<blank> I have more quotes than butt jokes in South Park. |
| 7150 |
blank |
<blank> I give you three seconds to tell us nolyc, or we kill a hostage. |
| 7152 |
blank |
<blank> I was waiting for him to grab me. |
| 7178 |
blank |
<blank> Not using something, sometimes, makes it slower. |
| 7179 |
blank |
<blank> The sound of my ex-girlfriend having sex is annoying. |
| 7200 |
blank |
<blank> My favorite thing in the world is silly flash porn games! grab me. |
| 7202 |
blank |
<blank> With a big fish. |
| 7229 |
blank |
<blank> There's posts of me askings stupid questions about RedHat somewhere. |
| 7241 |
blank |
<blank> I am so not going to have sex with LimCore without lube. |
| 7244 |
blank |
<blank> You can actually get dry during sex too. |
| 7262 |
blank |
<blank> Torture or little girls, not that's a little perverted. |
| 7291 |
blank |
<blank> I just think I'll get it infected if I play with it. |
| 7294 |
blank |
<blank> Amen. |
| 7295 |
blank |
<blank> Those were some really nice vaginas! |
| 7296 |
blank |
<blank> Grabbing me is like pissing in the ocean. |
| 7297 |
blank |
<blank> Mmm, this pork is good. |
| 7370 |
blank |
<blank> Retarded. |
| 7414 |
blank |
<blank> Well, yes and no. Zombie is a racist term for the ghouls. |
| 7439 |
blank |
* blank floats around in space wondering which way up is and farts |
| 7483 |
blank |
<blank> It's funny when I see PHP dudes say C# or Java is hard. |
| 7504 |
blank |
<blank> I'm only offended because someone told me to be. |
| 7510 |
blank |
<blank> You can not handle the hamror. |
| 7538 |
blank |
<blank> It's a bit weird having your editor write code for you. |
| 7540 |
blank |
<blank> Excuse me, I have to find a cucumber. |
| 7627 |
blank |
<blank> Milk is available world wide! |
| 7636 |
blank |
<blank> Getting laid is why my code is buggy. |
| 7643 |
blank |
<blank> "..." -- cloud |
| 7665 |
blank |
<blank> Han Solo is male. Cock is gay. MaleGay. |
| 7721 |
blank |
<blank> I'm starting to want to breed. I'm scared. |
| 7738 |
blank |
<blank> I haven't seen piman defend C. |
| 7751 |
blank |
<blank> That Stroustrup is pretty cute. |
| 7756 |
blank |
<blank> Hi, I'm Senator of Rome. I will be your host today. |
| 7757 |
blank |
<blank> Wow that was painful. But at least it works now. |
| 7769 |
blank |
<blank> Why would you need C and C++ to be consistant when you don't know either? |
| 7801 |
blank |
<blank> I don't have a question? |
| 7976 |
blank |
<blank> Most of the quotes suck. |
| 7979 |
blank |
<blank> G-G-G-G-G-GRAB SHIELD |
| 7983 |
blank |
<blank> +1 insightful |
| 8010 |
blank |
<blank> I was going to say, if you raped a pregnant woman, you can rape two people at once. |
| 8026 |
blank |
<blank> A penis is not sex! |
| 8146 |
blank |
<blank> I want more free whores. |
| 8188 |
blank |
<blank> It started like crap but then it didn't. |
| 8238 |
blank |
<blank> Hey, nobody grabbed me. Today must be a good day. |
| 8277 |
blank |
<blank> I've missed you more than orbitz's mother! |
| 8281 |
blank |
<blank> I wish #sdl had a channel. |
| 8283 |
blank |
<blank> Nothing is harder than the last boss in Tetris. |
| 8417 |
blank |
<blank> I like showing my man nipples. |
| 8418 |
blank |
<blank> Don't ruin my musing. I will !grab you. |
| 6691 |
blank2 |
<blank2> !grab blank |
| 2631 |
blank_screen |
<blank_screen> Once upong a time I had a variable x. I did this with it and now it segfaults. The End. |
| 2632 |
blank_screen |
<blank_screen> hi orbitz. How is your genitals? |
| 2672 |
blank_screen |
<blank_screen> There's snakes in my compiler! I need Samuel L. Jackson! |
| 2707 |
blank_screen |
<blank_screen> orbitz is so elitest he has his own boobies. |
| 2727 |
blank_screen |
<blank_screen> French is useful. You can use it in Canadia! |
| 2742 |
blank_screen |
<blank_screen> laptop keyboards don't grow on trees. |
| 2760 |
blank_screen |
<blank_screen> I don't know if I want to play doctor with braden. |
| 3379 |
blank_screen |
<blank_screen> I'm really like this in real life. |
| 3406 |
blank_screen |
<blank_screen> Damn keyboard. The sex key is next to the cookie key. |
| 3427 |
blank_screen |
<blank_screen> I don't know why your problem works. |
| 3430 |
blank_screen |
<blank_screen> I'm ignoring that no one is doing me. |
| 3448 |
blank_screen |
<blank_screen> I made a channel and banned myself from it. |
| 3785 |
blank_screen |
<blank_screen> Oh no! I bet my enemies will put wheels on the grocery stores! |
| 3790 |
blank_screen |
<blank_screen> VC++6 has a cult following. |
| 5709 |
blank_screen |
<blank_screen> Vegas isn't gay enough. |
| 5711 |
blank_screen |
<blank_screen> What is counter strike? A wargame in the kitchen? |
| 5729 |
blank_screen |
<blank_screen> That's it! I will take revenge! |
| 5112 |
blargg |
<blargg> Oh cool, geordi is a compiler. |
| 5540 |
blargg |
<blargg> JohnHolmes, care to make some sense? |
| 5579 |
blargg |
<blargg> I hate it when I put headphones on for hours, but forget to start any music playing. |
| 5613 |
blargg |
<blargg> Yeah, blargg is a n00b!!! he probably a C programmar |
| 5734 |
blargg |
<blargg> For example, someone may desire to do X, so do action A, while action B would better achieve X. We are asking what X is, not A. |
| 5814 |
blargg |
<blargg> Only experienced C++ programmers are qualified to differ. |
| 8333 |
blez |
<blez> I feel dickless now. |
| 5175 |
bliZZardz |
<bliZZardz> where is int main(){}??? |
| 7975 |
blip- |
<blip-> what does +o do... compile someone to an object file ? |
| 5029 |
bloated |
<bloated> what do you mean quotes |
| 4700 |
bmrtin_ |
<bmrtin_> i got the one by Stroustrap |
| 1724 |
bobby |
<bobby> i'll paste to the copy bin |
| 1737 |
bobby |
<bobby> i love you (if you have boobs) |
| 1784 |
bobby |
<bobby> how do you read an entire window as a string? |
| 7379 |
bobjr777 |
<bobjr777> pen is what? |
| 5428 |
boohoo |
<boohoo> why do I have a ptr of a parent in my myclass? |
| 60 |
bookwarez |
<bookwarez> is there an equavalent of strlen for ints? |
| 975 |
booman |
<booman> i was told c++ was easy to start with |
| 2329 |
bootedcat |
<bootedcat> in which channel can i find indian freelance programmers? |
| 8214 |
boring |
<boring> What a nice nick. |
| 8215 |
boring |
<boring> I have nothing to say. |
| 8216 |
boring |
<boring> Maybe I should be sheitgrab |
| 8217 |
boring |
<boring> Hey, hold your horses! |
| 8218 |
boring |
<boring> I wish you could take Monday off. But then I would get use to it and take Tuesday off. |
| 231 |
bot_builder |
<bot_builder> if you dont delete your pointers you won't have stray ones. |
| 7318 |
boygeorge |
<boygeorge> I wonder who feeds nolyc with all her info |
| 2176 |
bpuzon |
<bpuzon> pwned thanx |
| 4574 |
bpuzon |
<bpuzon> hello, I've just heard that cout/cin streams are "evil". why is that? (no interestineg results retutned by google) |
| 5868 |
bradd |
<bradd> maybe gcc should say "Erron on line 45 : ask for help on ##c++" |
| 6209 |
bradd |
<bradd> the book of google |
| 133 |
braden |
<braden> blank: Just close your eyes and think of Mr. T. |
| 143 |
braden |
<braden> Oyster sandwich action. |
| 348 |
braden |
<braden> shared_ptr: Could you feel my completion keystrokes on your inner thigh? |
| 513 |
braden |
<braden> That's why condoms were invented. |
| 644 |
braden |
<braden> Obey the mullet. |
| 754 |
braden |
<braden> I do a pretty good impression of Sean Connery as Cornholio. |
| 878 |
braden |
<braden> Everybody knows about AIDS. Your professor needs to be informed on the topic of hot girl-on-girl salamander action. |
| 1066 |
braden |
<braden> Pascal is a nerf chisel. |
| 1070 |
braden |
<braden> scalar: that made my penis hide. |
| 1191 |
braden |
<braden> But enough about that guy in my refrigerator. |
| 1200 |
braden |
<braden> You have to be tall enough to ride ##C++. |
| 1243 |
braden |
<braden> IDEs are for housewives and little girls. |
| 1282 |
braden |
<braden> student51: Try to sound more whiney. That might help. |
| 1293 |
braden |
* braden graciously offers his nuts. |
| 1297 |
braden |
<braden> porn also shows you can stick it out. |
| 1333 |
braden |
<braden> Damn. I guess I remember blank as funnier than he really is. |
| 1361 |
braden |
<braden> peterhu: giggling is what generally happened when users saw apps made with it. Followed by a look of disbelief if it was suggested that this was something they should use. |
| 1370 |
braden |
<braden> I want to smoke a fuckin' pancake. |
| 1420 |
braden |
<braden> pkrumins_: You weren't here for why the chicken crossed the road. |
| 1470 |
braden |
<braden> blank: You know the Internet wants to see you wearing a strap-on. |
| 1491 |
braden |
<braden> QMario: Recall your sense of humor is broken. Please don't grab. |
| 1559 |
braden |
<braden> LaEnigma: Damn. And I wanted a velvet Elvis. |
| 1625 |
braden |
<braden> foo.cpp:148: that shit is wack, yo |
| 1751 |
braden |
<braden> choudesh: It's at that point that you ask them if they want you to build them a robot. |
| 1812 |
braden |
<braden> If we cared about society here, we wouldn't be producing more C++. |
| 2017 |
braden |
<braden> Kyrin_: You want Objective Schlong. |
| 2223 |
braden |
* braden makes a mental note never to play rugby with blank. |
| 2305 |
braden |
<braden> Damn. These GUI bloopers on dailywtf are really funny when you're drunk. |
| 2327 |
braden |
<braden> I once had a pointer kill a program just to watch it die. |
| 2354 |
braden |
<braden> me_too: You become a good programmer by arguing about anything and everything. And since you are arguing about arguing, you are leet. |
| 2539 |
braden |
<braden> Damn. I suck. |
| 2557 |
braden |
<braden> aja: Just the webs of the spiders I like to let crawl over my naked body. |
| 2586 |
braden |
<braden> deadchip: I will go automatic on your ass. |
| 2681 |
braden |
<braden> Emigre: Nuts ain't so bad. |
| 2865 |
braden |
<braden> bucky1: IStream UStream We All Stream For... someone shoot me. |
| 2882 |
braden |
<braden> If UML were designed by cows, what would it look like? |
| 3038 |
braden |
<braden> libcurl is a fucking pain in the ass. |
| 3074 |
braden |
<braden> Detachable Penis! |
| 3159 |
braden |
<braden> If loving C++ is wrong, I don't want to be right. |
| 3172 |
braden |
<braden> khaosifix: You should stop developing software and start predicting the future! |
| 3194 |
braden |
<braden> I do not attract competent grabbers. |
| 3213 |
braden |
<braden> Can we stop ##C++? I want off. |
| 3225 |
braden |
<braden> cerealkiller219: You make me want to get "Visual Basic" tatooed on my penis. |
| 3234 |
braden |
<braden> Life's short and hard, like a body building elf / So save the planet and kill yourself / Throw in the towel, 'cause your life ain't shit / No, take the towel and hang yourself with it / If you're feelin' down and out with what your life is all about / Hold your head up high and blow your brains out |
| 3295 |
braden |
* braden is glad he wore heels today. |
| 3320 |
braden |
<braden> svm_invictvs: It is a bad idea to put your dick in a toaster. |
| 3331 |
braden |
<braden> Ouch! That was my penis! |
| 3377 |
braden |
<braden> For instance: raping a fire hydrant: not cool; raping a cougar: cool. |
| 3388 |
braden |
<braden> AnthonyG: I am giving you props. Do not pop a cap in my ass. |
| 3410 |
braden |
<braden> Without context, people will think you just stepped out of the restroom on an airplane. |
| 3620 |
braden |
<braden> Ademan: You may not be ready to appreciate boost::bind. Perhaps you should stick to std::bind1st and std::bind2nd until you do. |
| 3998 |
braden |
<braden> almathea: I didn't know that not doing anything was hard. But knowing that does wonders for my self esteem. |
| 4144 |
braden |
<braden> Bah. Don't type out static_cast there. It's verbose and silly. |
| 4153 |
braden |
<braden> C++ should have ponies. |
| 4208 |
braden |
<braden> Netgod: I can also remove my penis with a cheese grater. That doesn't mean I'm going to. |
| 4249 |
braden |
<braden> "Instead of unwrapping your present this year, honey, just type 'make'." |
| 4257 |
braden |
<braden> And whoever said being an asshole is a thankless job? |
| 4291 |
braden |
<braden> Saying C# is good for Windows development is like saying a cheese grater is good for abrading one's anus. |
| 4428 |
braden |
<braden> Ralith: Let's make out. |
| 4768 |
braden |
<braden> SeanConnery: That is why I have Java code tatooed in concentric circles around my left nipple. |
| 4802 |
braden |
<braden> seldon: You made my testicles cry. |
| 4827 |
braden |
<braden> godling: It's a deal. |
| 4911 |
braden |
<braden> The job of C++ code is to make the compiler its bitch. The longer and harder it is, the better. |
| 5094 |
braden |
<braden> --make-code-not-suck |
| 5104 |
braden |
<braden> hades_: I guess it's better to have contracted PHP than, say, syphilis. |
| 5119 |
braden |
<braden> Walt: Nothing seems hard compared to my erections. |
| 5723 |
braden |
<braden> Flying penises are always fashionable. |
| 5739 |
braden |
<braden> What container would I use to kill a puppy? |
| 6605 |
braden |
<braden> That API is great for tanning leather. |
| 6725 |
braden |
<braden> That only works on TV. |
| 6807 |
braden |
<braden> dudemax: Fail. |
| 6868 |
braden |
<braden> LimCore: I'm sorry, I misspoke. I meant to say: Blow me. |
| 6884 |
braden |
<braden> The future is later. |
| 6945 |
braden |
<braden> The rest of us have been liberated by spaces. We will not be dominated by the fascism of an ASCII character that cannot commit to a single printable representation. |
| 6992 |
braden |
<braden> IllegalCharacter: Once you have truly learned to overload operators, you will no longer need C++. |
| 7071 |
braden |
<braden> pragma_: Sigh. You're not even worth grabbing anymore. |
| 7077 |
braden |
<braden> Wiz_KeeD: Wall sockets. You use them with a fork. |
| 7083 |
braden |
<braden> impulze: A sea turtle can breathe by pumping water in and out of its ass. |
| 7130 |
braden |
* braden skips in circles around litb_, tossing pink cookies. |
| 7184 |
braden |
<braden> darkelite: This is where you're supposed to admit to chickenfucking so someone can grab you. |
| 7185 |
braden |
<braden> As a general rule in software development, if you're not cheating, you're doing it wrong. |
| 7186 |
braden |
<braden> stefodnb: I do not write code for bad programmers at the expense of good ones. |
| 7388 |
braden |
* braden gives nokmar an atomic wedgie. |
| 7523 |
braden |
<braden> godling is a beautiful flower. |
| 7887 |
braden |
<braden> EddieOfTheRocks: We assumed it was a speech impediment. |
| 8011 |
braden |
<braden> You can pass out condoms, but that won't help those intent on fucking themselves. |
| 8061 |
braden |
<braden> comawhite: I also like to sleep on a mattress soaked with whale semen. |
| 8151 |
braden |
<braden> You're going to make me cry. I'm going to play video games. |
| 8175 |
braden |
<braden> \o/ |\o/| o/_ /o\ |
| 1834 |
bradley_ |
<bradley_> I'm like spelling the best tonight |
| 1857 |
bradley_ |
<bradley_> Yo momma so abstract, she functored the entire police force! |
| 1956 |
bradley_ |
<bradley_> guess what i heard my computer teacher say today |
| 1992 |
bradley_ |
<bradley_> Wait! I'm backing up my porn so i can upgrade my OS |
| 2087 |
bradley_ |
<bradley_> man, i feel like a women |
| 5651 |
brady_k |
<brady_k> d1zzy: yeah... that's what happens when you're 12 years old and get raped. |
| 5835 |
brady_k |
<brady_k> metabol: you're back! oh god now i can give you the key to my chastity belt! ohmigod |
| 5836 |
brady_k |
<brady_k> oh no i forgot that works again... |
| 5838 |
brady_k |
<brady_k> "I'm too sexy for my skin, my skin, I'm too sexy for my skin... let me show you mai hairballz" |
| 5924 |
brady_k |
<brady_k> oh right, i forgot that all you guys in here are either non driving hippies or non driving europeans |
| 6088 |
brady_k |
<brady_k> ooh baby CLEAN MY SHEEETS yeahhhh |
| 6406 |
brady_k |
<brady_k> over the next 90 minutes, i'd like to show you that all your problems can be solved by my penis. |
| 4112 |
brainly-green |
<brainly-green> bleh i don't like classes, I think they must matter more in big projects with many people |
| 2030 |
bronaugh |
<bronaugh> pfeilspitze: perl in the kernel. |
| 3387 |
bronaugh |
<bronaugh> wow, sometimes I feel smrt in here |
| 1979 |
bronaugh_ |
<bronaugh_> but I'm dick waving now, and that's not really necessary. |
| 7400 |
bryanedds |
<bryanedds> faggot C++ elitists |
| 7315 |
bsl |
<bsl> i dont have down syndrome |
| 4474 |
bud12345 |
<bud12345> Ville is probably Swedish. |
| 2936 |
buggarage |
<buggarage> by the bot! cruel |
| 5981 |
buggle |
<buggle> My current attempt is: (((((bool*)*)*)*)*)* p = new bool[N+1][N+1][N+1][N+1][N+1][N+1]; but this isn't working as you probably guesse |
| 3845 |
bust3d |
<bust3d> the bad thign is that im still a virgin |
| 4274 |
bust3d |
<bust3d> Visual Baisc= good |
| 2256 |
busted |
<busted> " 'ubuntu' is an african word for i don't know how to configure BSD" |
| 4400 |
busted |
<busted> is it good or bad |
| 7941 |
bwy |
<bwy> Anyway, ##c++ isn't here to help people with their course, it's here to offer unrequested advice in a condescending manner. |
| 7944 |
bwy |
<bwy> It's always possible that cin stops working if you shake it about too much. |
| 8000 |
bwy |
<bwy> If you know enough about templates, you can use them to make babies. |
| 3349 |
c0ol |
<c0ol> I beleive both windows and linux use utf-8 with ASCII |
| 4142 |
c1|freaky |
<c1|freaky> what are pubes? |
| 4865 |
cLtmstr_ |
<cLtmstr_> rooting is a way of hacking and i am trying to make a simulation. |
| 7226 |
cMircea |
<cMircea> Shouldn't store a pointer in container anyway. |
| 8355 |
cYmen2 |
<cYmen2> I'm totally confused by all those special characters |
| 8401 |
cYmen2 |
<cYmen2> 3 times the size of a midget's penis |
| 8402 |
cYmen2 |
<cYmen2> damn you internet, where everything goes on record |
| 4250 |
c_newbie |
<c_newbie> how to parsing every data that sent to client with delimitry completly? |
| 4836 |
cached |
<cached> !why |
| 5053 |
cactus2 |
<cactus2> does my english is so bad? |
| 2177 |
caddy |
<caddy> bpuzon: injoke. nevermind. |
| 2205 |
caddy |
<caddy> raf256: I almost would say "express yourself more clearly" but I'm afraid of the consequences |
| 5727 |
can |
* can haz cheezburger |
| 3069 |
canine_kouji |
<canine_kouji> the average dog penis on a 60-80lb dog is 5.5-8 inches |
| 2854 |
capgadget |
<capgadget> Don't know. I don't debug. I get it right the first time. |
| 4859 |
capitol |
<capitol> i have a pet theory, c++ programmers like to use templates because it significally increases compilation time, and that time is used to fetch coffe. |
| 2341 |
carden |
<carden> sharing is for care bears and hippies! |
| 2342 |
carden |
<carden> ummm I like to give non compiling code so people can learn from my mistakes |
| 2380 |
carden |
<carden> its like a balloon if you rub it on your hair that makes it static |
| 2471 |
carden_ |
<carden_> I have decided that c and c++ are the same language, and any differences that you point out are the work of the devil put on this earth to delude me. |
| 2784 |
carjack |
<carjack> I'm 70% water so 100 plus 70 equals 170, that can't be possible, so you're 100% dumb. |
| 7583 |
carranca |
<carranca> Also do you know any plugin to add to Visual Studio to check for code correctness? |
| 3113 |
cassiopea |
<cassiopea> your help should keep me busy for another coupla hours |
| 6179 |
catron |
<catron> that will delete the windows dir... not that stupid |
| 4074 |
ccX |
<ccX> does Boost have non blocking sleep |
| 991 |
cdubya |
<cdubya> what would be the most likely culprit if you're getting junk written into an array element that shouldn't be there.....? |
| 2108 |
cehteh |
<cehteh> =|:o)X |
| 4677 |
cehteh |
<cehteh> Cancer research causes rats? |
| 6286 |
cehteh |
<cehteh> hehe .. when the compiler is wrong and its open source, you can always fix it :) |
| 2457 |
cesK |
<cesK> I do not succeed to find the error. I am driving crazy.. |
| 2703 |
ceztko |
<ceztko> last question on Qt: does it use Macros? |
| 573 |
cfan |
<cfan> now it works.. it predicts the presence of gl |
| 2868 |
change |
<change> wah, sleep is calling, he wants 5 gram of my dangling pointers! |
| 1585 |
charles` |
<charles`> d1zzy: I'm stupid... heh |
| 2980 |
charlls |
<charlls> it was about time someone brought hookers in this channel |
| 3033 |
charlls |
<charlls> people often refer to "DLL hell" when talking about certain common mishappens when dealing with libraries in windows, but people never talk about the "include hell". That its a bit dissapointing |
| 3210 |
charlls |
<charlls> charlls its sad that c++ doesnt allow you to forward declare typedefs, otherwise you could use that i guess |
| 3880 |
charlls |
<charlls> if you have played mortal kombat, emacs will be piece of cake |
| 4323 |
charlls |
<charlls> what does mean the word 'spastic'? |
| 4413 |
charlls |
<charlls> you mean there are no inmediate plans to wrap boost libraries to brainfuck? |
| 4491 |
charlls |
<charlls> if fallout is the campbell soup artwork of andy warhol, grim fandango is the pieta of michaelangelo, and alice mcgee is the gioconda |
| 4497 |
charlls |
<charlls> struct bait : public grabbable |
| 4511 |
charlls |
<charlls> functional crowd are funny crazy little leprechauns |
| 4512 |
charlls |
<charlls> java is a cunt |
| 4539 |
charlls |
<charlls> raf256 i wanted to see what happen when the same quote was multiple grabbed |
| 4541 |
charlls |
<charlls> this massive blob here, look, its shiny, has a gnu, its white, lots of buttons, text.. nice huh? |
| 5126 |
charlls |
<charlls> he never saw himself in a mirror, so he just assumed he was a carrot |
| 5131 |
charlls |
<charlls> irc is what straight, hairy men do instead of blogging |
| 5481 |
charlls |
<charlls> it would actually make more sense to run general purpose software on that and download the graphics rendering code to the cpu |
| 5508 |
charlls |
<charlls> i should recharge on 4chan |
| 7640 |
charlls |
<charlls> life itself is a distraction from death |
| 8038 |
charlls |
<charlls> my penis cries at the look of ousum builtin functions of postgres |
| 7696 |
cher |
<cher> Is there really a difference between Windows and a noise generator? And how much differes find /usr/src/linux -type f | xargs cat >/dev/audio from dd if=/dev/random of=/dev/audio? ... |
| 2069 |
chessguy |
* chessguy eats some yeast and rises again |
| 1086 |
chester |
<chester> shit shit shit, i've got 30 classes and i've never written a copy constructor before |
| 7455 |
chetnick |
<chetnick> thanks, i just found something on the web, it says that c++ does not support functionality to print output in different colors. I am gonna have to use third party library (ncurses) or to use bash color escape sequences. Thanks again. |
| 3424 |
chiawiki |
<chiawiki> IOStreams and locales and facets f**** up my brain |
| 2326 |
chienyehliao |
<chienyehliao> 感謝您 |
| 3080 |
chino2 |
<chino2> does c++ have a main starting point like in c program ? |
| 128 |
chorler |
* chorler feels both disabled and elite, what to do? |
| 2544 |
chowmeined |
<chowmeined> dynamic_cast<magic_missle>? |
| 2833 |
chrisjw |
<chrisjw> hi, what are c++ libraries please lol |
| 3128 |
chrisjw |
<chrisjw> if so go fuck yourself, else im sorry |
| 3130 |
chrisjw |
<chrisjw> is there a random class for c++ |
| 4488 |
chrisjw |
<chrisjw> reality failure! restart universe (y/n/q) |
| 1597 |
chron |
<chron> your'e too lame to help |
| 1600 |
chron |
<chron> so the way i see it, C++ makes all other programming languages simpler? |
| 1696 |
chron |
<chron> when i first learned english, it was from addison wesley haha |
| 5990 |
chuka |
<chuka> which simple function i can use to draw graph x/y in visual c 6.0?? |
| 692 |
ciaranm |
<ciaranm> thorie: because inventing a new string is way beyond the capabilities of anyone using php |
| 717 |
ciaranm |
<ciaranm> m4 isn't a programming language, it's an abomination |
| 922 |
ciaranm |
<ciaranm> c# is microsoft's version of java. java is sun's version of c++, aimed at idiots |
| 3343 |
cizra |
<cizra> I mean, I myvector.push_back(someclass), but nothing happens. |
| 685 |
codeMunky |
<codeMunky> is it possible to get MSVC++ 7.1 .net's intellisense stuck in a infinite loop? |
| 7025 |
code_ |
<code_> DAMN! creating a gui with c++ is so much more of a hassle and complicated compared to visual basic |
| 7026 |
code_ |
<code_> coppro, i don't know if its just because i am learning c++ first but i find c++ a better syntax than vb and stff |
| 7027 |
code_ |
<code_> how do i get glade incorported with visual studio |
| 5264 |
codergeek42 |
<codergeek42> and if not, you can cast the c_str result as applicable. :] |
| 7692 |
codeshot |
<codeshot> UML is documentation, and documentation never gets written. |
| 7694 |
codeshot |
<codeshot> C++... Sometimes you have to ask for the cheap stuff, and occasionally you have to ask for the stuff that doesn't break. |
| 5171 |
codeunderload |
<codeunderload> yes, NULL is useless in c++ |
| 3858 |
coh |
<coh> hey.. what design pattern would be most useful for an mmorpg? |
| 6741 |
collider |
<collider> lololol i am an ignorant nigger! |
| 6760 |
collider |
<collider> i wish people knew that [social] liberalism is not a synonym for socialist |
| 6793 |
collider |
<collider> LOLOLOL Linux is a pretty cool guy. eh lives in california and doesn't afraid of anything! |
| 6802 |
collider |
<collider> a girl said to me once there is nothing on this earth more spoiled than a pretty blonde (she was a pretty blonde) |
| 6804 |
collider |
<collider> SlashLife: could you please get off my case? |
| 6805 |
collider |
<collider> i'd rather just troll him again if he wants to do that |
| 8062 |
comawhite |
<comawhite> !give hyperair geordi |
| 134 |
combo |
<combo> ever hear of bash.org? |
| 248 |
combo |
<combo> God I love the sound of my own keyboard. |
| 6325 |
coppro |
<coppro> if you get it wrong, go to #geordi, get it working, and come back |
| 6457 |
coppro |
<coppro> in fact, my quote sucks so bad I had a factoid made from it in hopes someone would grab another one |
| 6458 |
coppro |
<coppro> I should grab that... |
| 6978 |
coppro |
<coppro> Example: I have really bad quotes, so eventually someone will take pity on me and !grab coppro after I say something |
| 6991 |
coppro |
<coppro> once you learn operator overloading, you'll be really happy |
| 7088 |
coppro |
<coppro> that's too funny to ignore, even if it /is/ about me |
| 7115 |
coppro |
<coppro> when insulting my name, use 'crappo' not 'coppro' :P |
| 7271 |
coppro |
<coppro> also, #geordi |
| 7378 |
coppro |
<coppro> no, it's very important |
| 7380 |
coppro |
<coppro> OzoneNerd: never |
| 7697 |
coppro |
<coppro> I ran ent on a word document, it says that compression could reduce it by 76%, that's roughly the ratio I get when converting .DOC to .ODT |
| 7948 |
coppro |
<coppro> I'm probably whatever the sober equivalent of drunk is |
| 8313 |
coppro |
<coppro> agree with fow |
| 8339 |
coppro |
<coppro> C# is the MSFT version of Java |
| 7360 |
corollax |
<corollax> Hrm. Tonight doesn't seem to be my night. |
| 1882 |
cplusplus |
<cplusplus> i dont think |
| 5724 |
cppguru |
<cppguru> orbitz: You have assumed that my opinion is that C++ is the Only One True Language. It is not. You have assumed that my mentioning names is "name dropping" to gain credibility. It was not. You have filtered my (possibly ambiguous) words through your own preconceptions and instead of asking for clarification you have made a judgement. That is your prerogative, I won't take away that right from you. However, it does not lead to successful conversation. |
| 4038 |
cr4z3d |
<cr4z3d> GTK+ works on windows? i thought it was linux only |
| 4256 |
cran1988 |
<cran1988> What do i need to know to be a professional in c++ ? |
| 6969 |
crashanddie |
<crashanddie> aren't we all mature? |
| 3293 |
crazy_coder |
<crazy_coder> I press enter and nothing happens |
| 7805 |
crazy_monkey |
<crazy_monkey> I am asked about my IT knowledge... does html count as programming language? |
| 2998 |
crazy_pete |
<crazy_pete> the possum that i feed at night finds me useful but frightening |
| 3139 |
crazy_pete |
<crazy_pete> informs nolyc that he has strong S&M tendencies and that he can pour hot grits on his genitals ANYTIME |
| 3147 |
crazy_pete |
<crazy_pete> The chinese were very perplexed when billboards (that were SUPPOSED to say "Come alive with Pepsi") appeared all over china saying "Pepsi resurrects your ancestors from the grave" |
| 3148 |
crazy_pete |
<crazy_pete> i am 44 the cutoff for donation is 39 Fetrovsky |
| 3149 |
crazy_pete |
<crazy_pete> Do sperm banks pay interest in money or sperm? |
| 3151 |
crazy_pete |
<crazy_pete> (MY favourite example of government idiocy is the fact that here in Missouri, you must be 21 to purchase a toy gun, but only 18 to purchase a REAL gun) |
| 3156 |
crazy_pete |
<crazy_pete> "Please finger my bum as i am no longer infected" is also a standard greeting in English, bob777 |
| 3304 |
crazy_pete |
<crazy_pete> At that point the driver gets out holding a shotgun |
| 3305 |
crazy_pete |
<crazy_pete> when i saw flashing lights about 5 minutes later i figured it was safe to get up and sure enough they were picking a body up and loading it into a body bag |
| 3309 |
crazy_pete |
<crazy_pete> Although i am pretty good at not testifying if i dont want to "I was really high on crack that day. I kept seeing people that weren't there that were attacking me. I am willing to testify but i am not in the least sure what is real and what is not |
| 3323 |
crazy_pete |
<crazy_pete> I fought against the USA in the sandinista war, iceagle we were indoctrinated in Red history all over the place ;-) |
| 3341 |
crazy_pete |
<crazy_pete> you know the funny thing is i never actually killed anyone |
| 3368 |
crazy_pete |
<crazy_pete> saying that bill gates is to be admired because he has created jobs for windows programmers i like saying child molesters should be admired because they create jobs for prison guards |
| 3409 |
crazy_pete |
<crazy_pete> i am basically covered in pubes from my nose to my feet :-) |
| 3451 |
crazy_pete |
<crazy_pete> Women are not evil, it is the people who let them vote that are evil :-) |
| 3465 |
crazy_pete |
<crazy_pete> i wanna get a t shirt that says "I am gonna come back in an hour and check up on you and yer mama. If you can't give a me good reason why you hate clowns, i'm gonna kill yer whole fuckin family" |
| 3483 |
crazy_pete |
<crazy_pete> And then afterwards says "You unfeeling animal freak, you raped me without any concern for my feelings and just overpowered me like a crazed animal..... Do it again!" :-) |
| 3486 |
crazy_pete |
<crazy_pete> i bet i am the least sexually repressed, i have not only had sex with a greater number of people than anyone in this room, i bet i have had sex with a greater number of species too! |
| 3537 |
crazy_pete |
<crazy_pete> "Why do you have a headache?" "Well because my head hurts" :-) |
| 3541 |
crazy_pete |
<crazy_pete> and then i am going to put you on ignore evilgeek so not only do i disprove you, i get the last word too! NYAHNYAHNYAH ;-) |
| 3542 |
crazy_pete |
<crazy_pete> however wages are going up again as various companies realise that paying someone with 10 years experience in C++ $55/hour really is better than outsourcing for $10/hour to an indian who has never used a computer because his hut doesn't have electricity |
| 3544 |
crazy_pete |
<crazy_pete> probably some sort of faggoty UN human rights thing, every ISO standards committee has to have a representative from the retard community or it cant be called "international" |
| 3720 |
crazy_pete |
<crazy_pete> see i am hypomanic, the room falls silent and i think it is my fault :-) |
| 3833 |
crazy_pete |
<crazy_pete> that was actually very clever, raf256 |
| 3834 |
crazy_pete |
<crazy_pete> i already slunk into the corner in shame, you don't have to rub it in, Adrinael :-) |
| 4726 |
crazy_pete |
<crazy_pete> man being a vegetarian for 13 years was stupid :-) |
| 4738 |
crazy_pete |
<crazy_pete> Rudolph the tight butt reindeer, your butt is better than Pussy! |
| 4741 |
crazy_pete |
<crazy_pete> i bet i have had sex with 4000 people |
| 5137 |
crazy_pete |
<crazy_pete> i have always wanted to convert to mormonism, marry some mormon chicks, get them knocked up, then say "ahaha, i never believed your stupid shit, i just wanted to get your daughters pregnant, BYE!" :-) |
| 5421 |
crazy_pete |
<crazy_pete> i have always wanted tie someone up and burn off their penis with a blow torch |
| 5488 |
crazy_pete |
<crazy_pete> it is ok if you are smoking crack, henke37 everybody deserves a little fun |
| 5569 |
crazy_pete |
<crazy_pete> "Do you know why i asked you in here today?" "Yeah man, and i SWEAR i didn't know she was your wife!" |
| 5674 |
crazy_pete |
<crazy_pete> in fact to be that rich and have that much money to spend on health and beauty care, and still be a butt ugly as the british royal family you pretty much have to be jewish :-) |
| 5765 |
crazy_pete |
<crazy_pete> actually at that point it was more like "HAHAHAH Fuck you!" time |
| 5768 |
crazy_pete |
<crazy_pete> i think mine is 8M long |
| 5775 |
crazy_pete |
<crazy_pete> everytime i defecate i kill billions of bacteria by dropping them into the chlorinated toilet water |
| 5776 |
crazy_pete |
<crazy_pete> ANd the USA military requires all its members to swear an oath to defend the constitution against all enemies both foreign and domestic |
| 5780 |
crazy_pete |
<crazy_pete> i thought Lolichan was a TV trying to seduce bigcheese to bring shame to his mormonhood |
| 5783 |
crazy_pete |
<crazy_pete> i am probably alot more guys fathers than i realise |
| 5799 |
crazy_pete |
<crazy_pete> i keep having this recurring fantasy of a girl tying me up and sodomising me with strap on while screaming "You left your mittens at school again you worthless little bastard" but i want her to sprinkle vodka and blow cigarette smoke around the room so it smells like mom... |
| 5800 |
crazy_pete |
<crazy_pete> if he finshishes with "And my butt muscles are so tight that i have never lost a fight because my pulsating anal sphincter can sooth the most savage beast" i am leaving :-) |
| 5820 |
crazy_pete |
* crazy_pete sings "I gotta head full of ideas that are driving me insane" |
| 5864 |
crazy_pete |
<crazy_pete> just remember svm |
